DE3109442C2 - Verfahren zur Herstellung von Resorcin - Google Patents
Verfahren zur Herstellung von ResorcinInfo
- Publication number
- DE3109442C2 DE3109442C2 DE3109442A DE3109442A DE3109442C2 DE 3109442 C2 DE3109442 C2 DE 3109442C2 DE 3109442 A DE3109442 A DE 3109442A DE 3109442 A DE3109442 A DE 3109442A DE 3109442 C2 DE3109442 C2 DE 3109442C2
- Authority
- DE
- Germany
- Prior art keywords
- isopropylphenol
- acid
- resorcinol
- perfluorinated
- production
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 title claims abstract description 24
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 13
- 238000000034 method Methods 0.000 title claims abstract description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical class CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims abstract description 10
- 239000002253 acid Substances 0.000 claims abstract description 10
- -1 Lewis acid fluoride Chemical class 0.000 claims abstract description 9
- 150000002148 esters Chemical class 0.000 claims abstract description 6
- 239000011347 resin Substances 0.000 claims abstract description 6
- 229920005989 resin Polymers 0.000 claims abstract description 6
- 238000003776 cleavage reaction Methods 0.000 claims abstract description 5
- QZLRYQOIRRXFAC-UHFFFAOYSA-N hydrogen peroxide 3-propan-2-ylphenol Chemical compound OO.CC(C)C1=CC=CC(O)=C1 QZLRYQOIRRXFAC-UHFFFAOYSA-N 0.000 claims abstract description 5
- 230000007017 scission Effects 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 4
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 claims 1
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims 1
- VLJSLTNSFSOYQR-UHFFFAOYSA-N 3-propan-2-ylphenol Chemical compound CC(C)C1=CC=CC(O)=C1 VLJSLTNSFSOYQR-UHFFFAOYSA-N 0.000 abstract description 13
- 239000003054 catalyst Substances 0.000 abstract description 11
- 239000003930 superacid Substances 0.000 abstract description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 abstract description 8
- 238000006462 rearrangement reaction Methods 0.000 abstract description 4
- 239000000203 mixture Substances 0.000 abstract description 3
- 150000003460 sulfonic acids Chemical class 0.000 abstract description 3
- CRBJBYGJVIBWIY-UHFFFAOYSA-N 2-isopropylphenol Chemical class CC(C)C1=CC=CC=C1O CRBJBYGJVIBWIY-UHFFFAOYSA-N 0.000 abstract description 2
- 238000010555 transalkylation reaction Methods 0.000 abstract description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 abstract description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 abstract 1
- 239000002841 Lewis acid Substances 0.000 abstract 1
- 230000029936 alkylation Effects 0.000 abstract 1
- 238000005804 alkylation reaction Methods 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 210000004124 hock Anatomy 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000002432 hydroperoxides Chemical class 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- MDZUBIFFXUJCKF-UHFFFAOYSA-N (3-propan-2-ylphenyl) trifluoromethanesulfonate Chemical compound CC(C)C1=CC=CC(OS(=O)(=O)C(F)(F)F)=C1 MDZUBIFFXUJCKF-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- IROSBXFYXRIPRU-UHFFFAOYSA-N 1,3-bis(2-hydroperoxypropan-2-yl)benzene Chemical compound OOC(C)(C)C1=CC=CC(C(C)(C)OO)=C1 IROSBXFYXRIPRU-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid Chemical compound C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- WSNDAYQNZRJGMJ-UHFFFAOYSA-N 2,2,2-trifluoroethanone Chemical compound FC(F)(F)[C]=O WSNDAYQNZRJGMJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DCERHCFNWRGHLK-UHFFFAOYSA-N C[Si](C)C Chemical compound C[Si](C)C DCERHCFNWRGHLK-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000006701 autoxidation reaction Methods 0.000 description 1
- HUFIRBOBXZUFPV-UHFFFAOYSA-N benzene-1,3-diol Chemical compound OC1=CC=CC(O)=C1.OC1=CC=CC(O)=C1 HUFIRBOBXZUFPV-UHFFFAOYSA-N 0.000 description 1
- WRUAHXANJKHFIL-UHFFFAOYSA-N benzene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(S(O)(=O)=O)=C1 WRUAHXANJKHFIL-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- MRIZMKJLUDDMHF-UHFFFAOYSA-N cumene;hydrogen peroxide Chemical class OO.CC(C)C1=CC=CC=C1 MRIZMKJLUDDMHF-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000005205 dihydroxybenzenes Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical class OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 1
- WQRUBDGMEUZKTQ-UHFFFAOYSA-N hydrogen peroxide (3-propan-2-ylphenyl) trifluoromethanesulfonate Chemical compound OO.CC(C)C1=CC=CC(OS(=O)(=O)C(F)(F)F)=C1 WQRUBDGMEUZKTQ-UHFFFAOYSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-M hydroperoxide group Chemical group [O-]O MHAJPDPJQMAIIY-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- JGTNAGYHADQMCM-UHFFFAOYSA-N perfluorobutanesulfonic acid Chemical compound OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F JGTNAGYHADQMCM-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000009993 protective function Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- AZMVFYODMYSDLY-UHFFFAOYSA-N trimethyl-(3-propan-2-ylphenoxy)silane Chemical compound CC(C)C1=CC=CC(O[Si](C)(C)C)=C1 AZMVFYODMYSDLY-UHFFFAOYSA-N 0.000 description 1
- AAPLIUHOKVUFCC-UHFFFAOYSA-N trimethylsilanol Chemical compound C[Si](C)(C)O AAPLIUHOKVUFCC-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/01—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis
- C07C37/055—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis the substituted group being bound to oxygen, e.g. ether group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/01—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis
- C07C37/055—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis the substituted group being bound to oxygen, e.g. ether group
- C07C37/0555—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis the substituted group being bound to oxygen, e.g. ether group being esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/08—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by decomposition of hydroperoxides, e.g. cumene hydroperoxide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms by addition reactions, i.e. reactions involving at least one carbon-to-carbon unsaturated bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/16—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms by condensation involving hydroxy groups of phenols or alcohols or the ether or mineral ester group derived therefrom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/18—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms by condensation involving halogen atoms of halogenated compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/48—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by exchange of hydrocarbon groups, which may be substituted, from the same of other compounds, e.g. transalkylation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/68—Purification; separation; Use of additives, e.g. for stabilisation
- C07C37/86—Purification; separation; Use of additives, e.g. for stabilisation by treatment giving rise to a chemical modification
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/130,402 US4339614A (en) | 1980-03-14 | 1980-03-14 | Superacid catalyzed preparation of resorcinol from meta-isopropylphenol |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3109442A1 DE3109442A1 (de) | 1981-12-24 |
| DE3109442C2 true DE3109442C2 (de) | 1984-09-13 |
Family
ID=22444539
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3109442A Expired DE3109442C2 (de) | 1980-03-14 | 1981-03-12 | Verfahren zur Herstellung von Resorcin |
| DE3152701A Expired DE3152701C2 (de) | 1980-03-14 | 1981-03-12 | Verfahren zur Herstellung von im wesentlichen reinem m-Isopropylphenol |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3152701A Expired DE3152701C2 (de) | 1980-03-14 | 1981-03-12 | Verfahren zur Herstellung von im wesentlichen reinem m-Isopropylphenol |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4339614A (OSRAM) |
| JP (1) | JPS56142225A (OSRAM) |
| BE (1) | BE887893A (OSRAM) |
| CA (1) | CA1144944A (OSRAM) |
| DE (2) | DE3109442C2 (OSRAM) |
| FR (2) | FR2493832A1 (OSRAM) |
| GB (5) | GB2072172B (OSRAM) |
| IT (1) | IT1144703B (OSRAM) |
| NL (1) | NL8101251A (OSRAM) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1129809B (it) * | 1979-03-26 | 1986-06-11 | Ugine Kuhlmann | Composizione catalitica per la conversione di idrocarburi e procedimento per la disidratazione di acidi perfluoroalcansolfonici destinati a fare parte bella composizione |
| US4423254A (en) * | 1980-03-14 | 1983-12-27 | Pcuk Produits Chimiques Ugine Kuhlmann | Superacid catalyzed preparation of resorcinol from meta-isopropylphenol |
| US4484011A (en) * | 1983-12-02 | 1984-11-20 | Eastman Kodak Company | Process for preparation of 4-isopropylphenol |
| DE3614898A1 (de) * | 1986-05-02 | 1987-11-05 | Agfa Gevaert Ag | Magnetbandkassette |
| JP2577421B2 (ja) * | 1988-02-04 | 1997-01-29 | 三井石油化学工業株式会社 | 3−(2−ヒドロペルオキシ−2−プロピル)フェノールおよび該化合物を用いたレゾルシンの製造方法 |
| US6586640B2 (en) * | 2001-06-26 | 2003-07-01 | E. I. Du Pont De Nemours And Company | Decomposition of organic hydroperoxides in the presence of a particulate catalyst containing highly fluorinated polymer having sulfonic acid groups and process for the manufacture of bisphenol A |
| HU0402530D0 (en) * | 2004-12-08 | 2005-02-28 | Richter Gedeon Vegyeszet | New process for producing compounds containing phenolic hydroxyl group |
| US7973185B2 (en) * | 2004-12-08 | 2011-07-05 | Richter Gedeon Nyrt. | Process for the preparation of phenolic hydroxy-substituted compounds |
| DE102005041992A1 (de) | 2005-09-05 | 2007-03-15 | Schabinger, Günter Wilhelm | Brennkraftmaschine |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2514347A (en) * | 1946-12-05 | 1950-07-04 | Monsanto Chemicals | Isomerization of secondary aralkyl phenols |
| US2551628A (en) * | 1947-10-02 | 1951-05-08 | Koppers Co Inc | Isomerization of phenols |
| US2799715A (en) * | 1954-11-03 | 1957-07-16 | Hercules Powder Co Ltd | Preparation of dihydric phenols |
| FR1153161A (fr) * | 1955-04-27 | 1958-03-03 | Universal Oil Prod Co | Procédé d'alcoylation de composés aromatiques |
| GB819450A (en) * | 1957-03-15 | 1959-09-02 | Bataafsche Petroleum Maatchapp | Process for the conversion of hydroperoxides of secondary alkyl aryls into phenols and ketones |
| US3028410A (en) * | 1958-06-26 | 1962-04-03 | Hooker Chemical Corp | Synthesis of polyhydroxy aromatic compounds |
| GB857113A (en) * | 1958-08-08 | 1960-12-29 | Distillers Co Yeast Ltd | Manufacture of resorcinol |
| GB873676A (en) * | 1958-08-08 | 1961-07-26 | Distillers Co Yeast Ltd | Manufacture of resorcinol |
| GB1033218A (en) * | 1962-04-18 | 1966-06-22 | Huels Chemische Werke Ag | Process for the production of 3-alkylphenols |
| BE642717A (OSRAM) * | 1963-01-19 | |||
| GB1112502A (en) * | 1966-04-22 | 1968-05-08 | Coalite Chem Prod Ltd | Rearrangement of xylenols |
| FR1541571A (fr) * | 1966-10-31 | 1968-10-04 | Universal Oil Prod Co | Procédé de préparation d'un hydrocarbure aromatique alcoylé |
| GB1227419A (OSRAM) * | 1967-04-14 | 1971-04-07 | ||
| US4207264A (en) * | 1969-10-29 | 1980-06-10 | The Goodyear Tire & Rubber Company | Rearrangement of aralkyl hydroperoxides to form phenols and carbonyl compounds |
| GB1342835A (en) * | 1970-03-05 | 1974-01-03 | Signal Chemical Co | Process for the neutralization of rearrangement reaction products and process for the continuous isolation of dihydric phenols |
| US3932537A (en) * | 1971-09-09 | 1976-01-13 | Reichhold Chemicals, Inc. | Alkylation of phenols |
| US3882093A (en) * | 1974-01-02 | 1975-05-06 | Du Pont | Sulfonyl-containing fluorocarbon vinyl ethers and ion exchange membrane formed therefrom |
| US4041090A (en) * | 1976-03-04 | 1977-08-09 | Shell Oil Company | Ethylbenzene process using an unsupported perfluorinated polymer catalyst |
| US4147726A (en) * | 1976-11-08 | 1979-04-03 | Phillips Petroleum Company | Acid-catalyzed hydrolysis of organic hydroperoxide employing a polar solvent and phenol as reaction medium |
| US4164510A (en) * | 1977-07-22 | 1979-08-14 | The Upjohn Company | Process for the autoxidation of an isopropylphenyl ester |
| US4103096A (en) | 1977-10-13 | 1978-07-25 | Stauffer Chemical Company | Preparation of meta-alkylphenols |
| JPS5461131A (en) * | 1977-10-13 | 1979-05-17 | Stauffer Chemical Co | Manufacture of alkylphenols |
| US4156790A (en) * | 1978-04-10 | 1979-05-29 | General Electric Company | Isomerization of dihydroxydiphenyl compounds |
| DE3106170C2 (de) * | 1980-02-22 | 1984-06-20 | Kureha Kagaku Kogyo K.K., Tokio/Tokyo | 3,3,3-trifluorpropylierte Benzolderivate |
-
1980
- 1980-03-14 US US06/130,402 patent/US4339614A/en not_active Expired - Lifetime
-
1981
- 1981-03-10 FR FR8104704A patent/FR2493832A1/fr active Granted
- 1981-03-11 BE BE0/204083A patent/BE887893A/fr not_active IP Right Cessation
- 1981-03-12 DE DE3109442A patent/DE3109442C2/de not_active Expired
- 1981-03-12 DE DE3152701A patent/DE3152701C2/de not_active Expired
- 1981-03-12 GB GB8107819A patent/GB2072172B/en not_active Expired
- 1981-03-13 JP JP3548381A patent/JPS56142225A/ja active Pending
- 1981-03-13 CA CA000372928A patent/CA1144944A/fr not_active Expired
- 1981-03-13 IT IT67355/81A patent/IT1144703B/it active
- 1981-03-13 NL NL8101251A patent/NL8101251A/nl not_active Application Discontinuation
- 1981-10-27 FR FR8120154A patent/FR2499067A1/fr active Granted
-
1983
- 1983-11-24 GB GB08331323A patent/GB2136798B/en not_active Expired
- 1983-11-24 GB GB838331326A patent/GB8331326D0/en active Pending
- 1983-11-24 GB GB08331322A patent/GB2137195B/en not_active Expired
- 1983-11-24 GB GB08331324A patent/GB2136419B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2499067A1 (fr) | 1982-08-06 |
| GB2136798A (en) | 1984-09-26 |
| GB2136419A (en) | 1984-09-19 |
| US4339614A (en) | 1982-07-13 |
| GB2137195B (en) | 1985-06-05 |
| GB2137195A (en) | 1984-10-03 |
| CA1144944A (fr) | 1983-04-19 |
| FR2493832A1 (fr) | 1982-05-14 |
| GB2136419B (en) | 1985-05-22 |
| GB2072172A (en) | 1981-09-30 |
| BE887893A (fr) | 1981-09-11 |
| JPS56142225A (en) | 1981-11-06 |
| GB8331322D0 (en) | 1984-01-04 |
| GB8331326D0 (en) | 1984-01-04 |
| GB2072172B (en) | 1984-11-07 |
| NL8101251A (nl) | 1981-10-01 |
| DE3109442A1 (de) | 1981-12-24 |
| DE3152701C2 (de) | 1985-10-17 |
| FR2499067B1 (OSRAM) | 1984-11-30 |
| IT8167355A0 (it) | 1981-03-13 |
| FR2493832B1 (OSRAM) | 1984-11-30 |
| GB8331324D0 (en) | 1984-01-04 |
| IT1144703B (it) | 1986-10-29 |
| GB8331323D0 (en) | 1984-01-04 |
| GB2136798B (en) | 1985-05-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2064497C3 (de) | Verfahren zur Kernhydroxylierung von aromatischen Verbindungen | |
| DE913778C (de) | Verfahren zur Herstellung von Phenolen | |
| DE857810C (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Hydroperoxyden | |
| DE3109442C2 (de) | Verfahren zur Herstellung von Resorcin | |
| DE3109339C2 (de) | Verfahren zur Herstellung von Resorcin | |
| DE69007323T2 (de) | Verfahren zur Herstellung von sec.-Butylbenzol. | |
| DE2658545B2 (de) | Verfahren zur Kernhydroxylierung von aromatischen Verbindungen | |
| DE69218185T2 (de) | Selektive hydroxylierung von phenol oder phenolischen äthern | |
| DE875356C (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Hydroperoxyden | |
| DE2508452C2 (de) | Verfahren zur Herstellung von Alkylphenolen | |
| DE1804693A1 (de) | Chemisches Verfahren | |
| EP0491142B1 (de) | Verfahren zur Herstellung von Gemischen cyclischer Acroleinglycerinacetale | |
| DE3102305C2 (de) | Verfahren zur Herstellung von α- oder β-Naphthol durch regioselektive Hydroxylierung von Naphthalin mit Wasserstoffperoxid | |
| DE3618643C2 (OSRAM) | ||
| DE3712610C2 (OSRAM) | ||
| DE3887859T2 (de) | Zersetzung von Dihydroperoxyd zu Resorcin. | |
| DE2027162C3 (de) | Verfahren zur Brommethylierung von Benzolkohlenw asserstoffen | |
| DE680023C (de) | Verfahren zur Herstellung von Methacrylsaeure | |
| DE2049049A1 (de) | Verfahren zur Herstellung von Isopren | |
| DE866941C (de) | Verfahren zur Herstellung von ª‰-Naphthol | |
| DE2951792C2 (OSRAM) | ||
| DE962527C (de) | Verfahren zur Herstellung von Oxyhydroperoxyden | |
| DE1016270B (de) | Verfahren zur gleichzeitigen Herstellung von Phenolen und Ketonen oder Aldehyden | |
| DE69318007T2 (de) | Verfahren zur herstellung von aromatischen hydroxyderivaten | |
| DE3722796C2 (OSRAM) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3152701 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 3152701 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| AH | Division in |
Ref country code: DE Ref document number: 3152701 Format of ref document f/p: P |
|
| 8339 | Ceased/non-payment of the annual fee |