DE3027168C2 - - Google Patents
Info
- Publication number
- DE3027168C2 DE3027168C2 DE3027168A DE3027168A DE3027168C2 DE 3027168 C2 DE3027168 C2 DE 3027168C2 DE 3027168 A DE3027168 A DE 3027168A DE 3027168 A DE3027168 A DE 3027168A DE 3027168 C2 DE3027168 C2 DE 3027168C2
- Authority
- DE
- Germany
- Prior art keywords
- solution
- diphenylmethylene
- mol
- methylene
- product
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000000034 method Methods 0.000 claims description 41
- -1 acetamide compound Chemical class 0.000 claims description 26
- 238000002360 preparation method Methods 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 230000008569 process Effects 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 10
- 230000002378 acidificating effect Effects 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- UZANHCWZMIOSEA-UHFFFAOYSA-N 3-benzhydrylidene-1-propan-2-ylazetidine Chemical compound C1N(C(C)C)CC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 UZANHCWZMIOSEA-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- BEIXIWVOQKATJH-UHFFFAOYSA-N 3-benzhydrylidene-1-methylazetidine Chemical compound C1N(C)CC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 BEIXIWVOQKATJH-UHFFFAOYSA-N 0.000 claims description 2
- BJUHVJHOJBHLJS-UHFFFAOYSA-N 3-benzhydrylidene-1-ethylpyrrolidine Chemical compound C1N(CC)CCC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 BJUHVJHOJBHLJS-UHFFFAOYSA-N 0.000 claims 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 claims 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 43
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- 229910052739 hydrogen Inorganic materials 0.000 description 26
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 22
- 229910052757 nitrogen Inorganic materials 0.000 description 22
- 239000000203 mixture Substances 0.000 description 19
- 239000000047 product Substances 0.000 description 19
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- 238000004519 manufacturing process Methods 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 239000007858 starting material Substances 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N isopropyl alcohol Natural products CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 11
- 238000010992 reflux Methods 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 6
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- NEBPTMCRLHKPOB-UHFFFAOYSA-N 2,2-diphenylacetonitrile Chemical compound C=1C=CC=CC=1C(C#N)C1=CC=CC=C1 NEBPTMCRLHKPOB-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000012429 reaction media Substances 0.000 description 5
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 150000003869 acetamides Chemical class 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WXKCTFWSGGKULR-UHFFFAOYSA-N 3-chloro-1-methylazetidine Chemical compound CN1CC(Cl)C1 WXKCTFWSGGKULR-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 238000006105 Hofmann reaction Methods 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- GPNSPIGRLLHVCN-UHFFFAOYSA-N 1-cyclohexylazetidin-3-ol Chemical compound C1C(O)CN1C1CCCCC1 GPNSPIGRLLHVCN-UHFFFAOYSA-N 0.000 description 2
- CPHUUWJMAOTJLB-UHFFFAOYSA-N 2-methylidenepyrrolidine Chemical class C=C1CCCN1 CPHUUWJMAOTJLB-UHFFFAOYSA-N 0.000 description 2
- QPVAQCZYWWNDTR-UHFFFAOYSA-N 3-benzhydrylidene-1-(1-phenylethyl)azetidine Chemical compound C=1C=CC=CC=1C(C)N(C1)CC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 QPVAQCZYWWNDTR-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 238000007167 Hofmann rearrangement reaction Methods 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- AKZWRTCWNXHHFR-PDIZUQLASA-N [(3S)-oxolan-3-yl] N-[(2S,3S)-4-[(5S)-5-benzyl-3-[(2R)-2-carbamoyloxy-2,3-dihydro-1H-inden-1-yl]-4-oxo-3H-pyrrol-5-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate Chemical compound NC(=O)O[C@@H]1Cc2ccccc2C1C1C=N[C@](C[C@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOC2)(Cc2ccccc2)C1=O AKZWRTCWNXHHFR-PDIZUQLASA-N 0.000 description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 2
- 150000007960 acetonitrile Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 230000001430 anti-depressive effect Effects 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- UVWQYWHKTZABSO-ILADVTTDSA-N de voachalotinol Chemical compound CN1C2=CC=CC=C2C(C[C@H]2[C@@H]3CO)=C1[C@H]1N2C/C(=C/C)[C@@H]3C1 UVWQYWHKTZABSO-ILADVTTDSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- ZMXWVFGREWGXIE-UHFFFAOYSA-N 1-ethylazetidin-3-ol Chemical compound CCN1CC(O)C1 ZMXWVFGREWGXIE-UHFFFAOYSA-N 0.000 description 1
- XSGMJDQRZDWEPW-UHFFFAOYSA-N 1-propan-2-ylazetidin-3-ol Chemical compound CC(C)N1CC(O)C1 XSGMJDQRZDWEPW-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ICBQXEWYZVQCFH-UHFFFAOYSA-N 3-(4-bromoanilino)-n,n-dimethylpropanamide Chemical compound CN(C)C(=O)CCNC1=CC=C(Br)C=C1 ICBQXEWYZVQCFH-UHFFFAOYSA-N 0.000 description 1
- CONJWKMRLJJHTL-UHFFFAOYSA-N 3-benzhydrylidene-1-cyclohexylazetidine Chemical compound C1N(C2CCCCC2)CC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 CONJWKMRLJJHTL-UHFFFAOYSA-N 0.000 description 1
- VGYVWVIAQUWWGO-UHFFFAOYSA-N 3-benzhydrylidene-1-ethylazetidine Chemical compound C1N(CC)CC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 VGYVWVIAQUWWGO-UHFFFAOYSA-N 0.000 description 1
- LLRSDUFZOOGBFB-UHFFFAOYSA-N 3-benzhydrylidene-1-ethylpiperidine Chemical compound C(C)N1CC(CCC1)=C(C1=CC=CC=C1)C1=CC=CC=C1 LLRSDUFZOOGBFB-UHFFFAOYSA-N 0.000 description 1
- KXHUKGKOOUFKQH-UHFFFAOYSA-N 3-benzhydrylidene-1-methylpyrrolidine Chemical compound C1N(C)CCC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 KXHUKGKOOUFKQH-UHFFFAOYSA-N 0.000 description 1
- FTNOJINZWIALRG-UHFFFAOYSA-N 3-benzhydrylidene-1-propan-2-ylazetidine;oxalic acid Chemical compound OC(=O)C(O)=O.C1N(C(C)C)CC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 FTNOJINZWIALRG-UHFFFAOYSA-N 0.000 description 1
- MCCWHJXTFWTLDH-UHFFFAOYSA-N 3-chloro-1-methylazetidine;hydrochloride Chemical compound Cl.CN1CC(Cl)C1 MCCWHJXTFWTLDH-UHFFFAOYSA-N 0.000 description 1
- KSMPVQGZQQURBU-UHFFFAOYSA-N 3-methylideneazetidine Chemical class C=C1CNC1 KSMPVQGZQQURBU-UHFFFAOYSA-N 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- JQLBQMNOMQIWQM-UHFFFAOYSA-N C(C(=O)O)(=O)O.CN1CCC1 Chemical compound C(C(=O)O)(=O)O.CN1CCC1 JQLBQMNOMQIWQM-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- YEWGIGCYIAMFMA-UHFFFAOYSA-N LSM-2007 Chemical compound C1C2=CC=CC=C2CCN(C)CCC2=C1NC1=CC=CC=C21 YEWGIGCYIAMFMA-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- YRBBTNSJJXHMPP-UHFFFAOYSA-N Melosatin A Chemical compound C=12C(=O)C(=O)NC2=C(OC)C(OC)=CC=1CCCCCC1=CC=CC=C1 YRBBTNSJJXHMPP-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- GMWFCJXSQQHBPI-UHFFFAOYSA-N azetidin-3-ol Chemical group OC1CNC1 GMWFCJXSQQHBPI-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229950001336 bromamide Drugs 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- RMZAYIKUYWXQPB-UHFFFAOYSA-N trioctylphosphane Chemical compound CCCCCCCCP(CCCCCCCC)CCCCCCCC RMZAYIKUYWXQPB-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/059,092 US4242261A (en) | 1979-07-19 | 1979-07-19 | Production of methylene-cycloamines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3027168A1 DE3027168A1 (de) | 1981-02-12 |
| DE3027168C2 true DE3027168C2 (OSRAM) | 1990-07-05 |
Family
ID=22020801
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803027168 Granted DE3027168A1 (de) | 1979-07-19 | 1980-07-17 | Verfahren zur herstellung von methylen-cycloamin-derivaten |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4242261A (OSRAM) |
| JP (1) | JPS5625153A (OSRAM) |
| KR (1) | KR840002233B1 (OSRAM) |
| AU (1) | AU538138B2 (OSRAM) |
| CA (1) | CA1128939A (OSRAM) |
| CH (1) | CH646954A5 (OSRAM) |
| DE (1) | DE3027168A1 (OSRAM) |
| EG (1) | EG14720A (OSRAM) |
| ES (1) | ES493498A0 (OSRAM) |
| FR (1) | FR2461703A1 (OSRAM) |
| GB (1) | GB2058049B (OSRAM) |
| HK (1) | HK385A (OSRAM) |
| IE (1) | IE49945B1 (OSRAM) |
| IL (1) | IL60375A (OSRAM) |
| IT (1) | IT1141609B (OSRAM) |
| NL (1) | NL8004165A (OSRAM) |
| PH (1) | PH15057A (OSRAM) |
| PT (1) | PT71581A (OSRAM) |
| SE (1) | SE448993B (OSRAM) |
| SG (1) | SG26284G (OSRAM) |
| ZA (1) | ZA803778B (OSRAM) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4540690A (en) * | 1982-02-09 | 1985-09-10 | The Upjohn Company | 2-(Phenylmethylene)cycloalkylamines and -azetidines |
| US4652559A (en) * | 1982-08-16 | 1987-03-24 | The Upjohn Company | 2-(Phenylmethylene)cycloalkyl-azetidines |
| GB8825505D0 (en) * | 1988-11-01 | 1988-12-07 | Pfizer Ltd | Therapeutic agents |
| US5932594A (en) * | 1988-11-01 | 1999-08-03 | Pfizer, Inc. | Muscarinic receptor antagonists |
| GB8906166D0 (en) * | 1989-03-17 | 1989-05-04 | Pfizer Ltd | Therapeutic agents |
| KR100652994B1 (ko) * | 1998-09-11 | 2006-11-30 | 아방티 파르마 소시에테 아노님 | 아제티딘 유도체, 이의 제조방법 및 이를 함유하는 약제 |
| FR2783246B1 (fr) * | 1998-09-11 | 2000-11-17 | Aventis Pharma Sa | Derives d'azetidine, leur preparation et les medicaments les contenant |
| FR2805818B1 (fr) * | 2000-03-03 | 2002-04-26 | Aventis Pharma Sa | Derives d'azetidine, leur preparation et les compositions pharmaceutiques les contenant |
| FR2805810B1 (fr) * | 2000-03-03 | 2002-04-26 | Aventis Pharma Sa | Compositions pharmaceutiques contenant des derives de 3- amino-azetidine, les nouveaux derives et leur preparation |
| FR2805817B1 (fr) * | 2000-03-03 | 2002-04-26 | Aventis Pharma Sa | Compositions pharmaceutiques contenant des derives d'azetidine, les nouveaux derives d'azetidine et leur preparation |
| US6566356B2 (en) | 2000-03-03 | 2003-05-20 | Aventis Pharma S.A. | Pharmaceutical compositions containing 3-aminoazetidine derivatives, novel derivatives and their preparation |
| MXPA05013583A (es) * | 2003-06-11 | 2006-03-09 | Merck & Co Inc | Derivados de 3-alquil y 3-alquenilazetidina sustituidos. |
| US7906652B2 (en) * | 2005-11-28 | 2011-03-15 | Merck Sharp & Dohme Corp. | Heterocycle-substituted 3-alkyl azetidine derivatives |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL130532C (OSRAM) * | 1961-02-09 | |||
| US3192210A (en) * | 1961-12-04 | 1965-06-29 | Robins Co Inc A H | 4-(omega-substituted alkyl)-3, 3-disubstituted-1-substituted-2-pyrrolidinones and 4-(omega-substituted alkyl)-3, 3-disubstituted-1-substituted-2-thionpyrrolidinones |
| US3192221A (en) * | 1961-12-04 | 1965-06-29 | Robins Co Inc A H | 4-(omega-substituted alkyl)-3, 3-disubstituted-1-substituted-2-pyrrolidinones and 4-(omega-substituted alkyl)-3, 3-disubstituted-1-substituted-2-thionpyrrolidinones and production thereof |
| US3192206A (en) * | 1961-12-04 | 1965-06-29 | Robins Co Inc A H | 4-(omega-aminoalkyl)-3, 3-disubstitutedn-hydrocarbon-2-pyrrolidinones and corresponding-2-thionpyrrolidinones |
| US3458635A (en) * | 1966-08-08 | 1969-07-29 | Robins Co Inc A H | Compositions containing 3-di-substituted methylene pyrrolidines and methods of treating depression |
| US3732247A (en) * | 1970-08-14 | 1973-05-08 | Robins Co Inc A H | 3-di-substituted methylene pyrrolidines wherein the 1-or n-lower-alkyl substituent contains at least two carbon atoms |
| US4002766A (en) * | 1974-12-26 | 1977-01-11 | A. H. Robins Company, Incorporated | Antiarrhythmia methods |
| US4133881A (en) * | 1977-04-27 | 1979-01-09 | A. H. Robins Company, Incorporated | Azetidinyl acetonitrile and acetamide antiarrhythmia compositions and methods |
-
1979
- 1979-07-19 US US06/059,092 patent/US4242261A/en not_active Expired - Lifetime
-
1980
- 1980-06-23 IL IL60375A patent/IL60375A/xx unknown
- 1980-06-25 ZA ZA00803778A patent/ZA803778B/xx unknown
- 1980-07-09 EG EG80404A patent/EG14720A/xx active
- 1980-07-11 PH PH24280A patent/PH15057A/en unknown
- 1980-07-14 GB GB8022967A patent/GB2058049B/en not_active Expired
- 1980-07-17 FR FR8015840A patent/FR2461703A1/fr active Granted
- 1980-07-17 IE IE1488/80A patent/IE49945B1/en not_active IP Right Cessation
- 1980-07-17 SE SE8005235A patent/SE448993B/sv not_active IP Right Cessation
- 1980-07-17 DE DE19803027168 patent/DE3027168A1/de active Granted
- 1980-07-18 CH CH552780A patent/CH646954A5/fr not_active IP Right Cessation
- 1980-07-18 CA CA356,552A patent/CA1128939A/en not_active Expired
- 1980-07-18 NL NL8004165A patent/NL8004165A/nl not_active Application Discontinuation
- 1980-07-18 ES ES493498A patent/ES493498A0/es active Granted
- 1980-07-18 AU AU60617/80A patent/AU538138B2/en not_active Ceased
- 1980-07-18 IT IT68156/80A patent/IT1141609B/it active
- 1980-07-18 PT PT71581A patent/PT71581A/pt unknown
- 1980-07-19 JP JP9927380A patent/JPS5625153A/ja active Granted
- 1980-07-19 KR KR1019800002868A patent/KR840002233B1/ko not_active Expired
-
1984
- 1984-03-27 SG SG262/84A patent/SG26284G/en unknown
-
1985
- 1985-01-03 HK HK3/85A patent/HK385A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB2058049B (en) | 1983-09-07 |
| JPS5625153A (en) | 1981-03-10 |
| SG26284G (en) | 1985-03-08 |
| IE801488L (en) | 1981-01-19 |
| NL8004165A (nl) | 1981-01-21 |
| CH646954A5 (fr) | 1984-12-28 |
| CA1128939A (en) | 1982-08-03 |
| PT71581A (en) | 1980-08-01 |
| GB2058049A (en) | 1981-04-08 |
| IT1141609B (it) | 1986-10-01 |
| HK385A (en) | 1985-01-11 |
| FR2461703A1 (fr) | 1981-02-06 |
| IE49945B1 (en) | 1986-01-08 |
| JPS643186B2 (OSRAM) | 1989-01-19 |
| PH15057A (en) | 1982-06-03 |
| ES8106491A1 (es) | 1981-07-01 |
| IT8068156A0 (it) | 1980-07-18 |
| EG14720A (en) | 1986-03-31 |
| ES493498A0 (es) | 1981-07-01 |
| IL60375A (en) | 1983-07-31 |
| SE8005235L (sv) | 1981-01-20 |
| SE448993B (sv) | 1987-03-30 |
| FR2461703B1 (OSRAM) | 1983-04-22 |
| IL60375A0 (en) | 1980-09-16 |
| KR830003417A (ko) | 1983-06-20 |
| ZA803778B (en) | 1981-09-30 |
| US4242261A (en) | 1980-12-30 |
| DE3027168A1 (de) | 1981-02-12 |
| KR840002233B1 (ko) | 1984-12-06 |
| AU6061780A (en) | 1981-01-22 |
| AU538138B2 (en) | 1984-08-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3027168C2 (OSRAM) | ||
| DE2929777C2 (OSRAM) | ||
| DD202152A5 (de) | Verfahren zur herstellung von phenylpiperazinderivaten | |
| EP0136658A2 (de) | 1-Benzyl-aminoalkyl-pyrrolidinone und ihre Säureadditionssalze, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2651572A1 (de) | Aminoalkohol-derivat und verfahren zu seiner herstellung | |
| DE2002840A1 (de) | 2,3,5-trisubstit,-2'-Hydroxy-6,7-benzomorphane und Verfahren zu deren Herstellung | |
| DD229402A5 (de) | Verfahren zur herstellung von piperidinion-derivaten, die als myocard-schutz eine antiarrhytmische aktivitaet ausweisen | |
| DE3035395A1 (de) | Verfahren zur herstellung von pyrazol | |
| AT265256B (de) | Verfahren zur Herstellung neuer 2-Aryltetrahydropyran-3-amine und ihrer Salze | |
| DE2661028C2 (OSRAM) | ||
| DE1668550C (OSRAM) | ||
| DE19727350C1 (de) | Verfahren zur Herstellung von Nifedipin | |
| EP0478941B1 (de) | Arzneimittel welche substituierte 2-Cyclohexen-1yl-amin-Derivate enthalten und ihre Verwendung zur Bekämpfung von Krankheiten | |
| DE3819438A1 (de) | Verfahren zur herstellung von optisch aktiven 1-arylethylaminen | |
| DE2902541C2 (OSRAM) | ||
| EP0581797B1 (de) | Neue thiophen-2-carbonsäurederivate und verfahren zu deren herstellung | |
| DE2438462C3 (de) | Verfahren zur Herstellung von nÄthinylbenzhydrol und seinen ringsubstituierten Derivaten sowie ringsubstituierte a-Äthinylbenzhydrolderivate und solche enthaltende Arzneimittel | |
| DE2505143A1 (de) | Verfahren zur herstellung von spiro-(4,5)-decanderivaten | |
| DE928286C (de) | Verfahren zur Herstellung eines neuen, analgetisch wirksamen 1-Phenyl-pyrazolderivates | |
| DE19647538A1 (de) | Verfahren zur Herstellung von enantiomerenreinem N-Methyl-N-[1-phenyl-2-(-3-hydroxypyrrolidin-1-yl)ethyl]-2,2-diphenylacetamid | |
| DE2201804C3 (de) | Phenyläthylbenzylamine und Verfahren zu ihrer Herstellung | |
| DE1900948C (de) | Cis- und trans-2-Methyl-5-(3, 4, S-trimethoxybenzamidoJ-decahydroisochinolin | |
| AT262266B (de) | Verfahren zur Herstellung des neuen 1,2-Diphenyl-2-propionyloxy-3-(dimethylaminomethyl)-3-butens und seiner Salze | |
| DE1132914B (de) | Verfahren zur Herstellung von Carbaminsaeureestern von Aralkyl-alkoholen | |
| AT332867B (de) | Verfahren zur herstellung neuer 3-(4-biphenylyl)-buttersauren, deren estern, amiden und salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |