DE2650555C2 - - Google Patents
Info
- Publication number
- DE2650555C2 DE2650555C2 DE2650555A DE2650555A DE2650555C2 DE 2650555 C2 DE2650555 C2 DE 2650555C2 DE 2650555 A DE2650555 A DE 2650555A DE 2650555 A DE2650555 A DE 2650555A DE 2650555 C2 DE2650555 C2 DE 2650555C2
- Authority
- DE
- Germany
- Prior art keywords
- amino
- formula
- dye
- fiber
- sulfonic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 claims description 57
- -1 polyazo Polymers 0.000 claims description 40
- 239000000985 reactive dye Substances 0.000 claims description 33
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 29
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 26
- 150000001875 compounds Chemical class 0.000 claims description 25
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 claims description 23
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 15
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 230000008569 process Effects 0.000 claims description 12
- 239000000987 azo dye Substances 0.000 claims description 11
- 229910006069 SO3H Inorganic materials 0.000 claims description 10
- 238000004043 dyeing Methods 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 150000004696 coordination complex Chemical class 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000002243 precursor Substances 0.000 claims 2
- 239000002253 acid Substances 0.000 description 30
- 239000000243 solution Substances 0.000 description 23
- 239000007859 condensation product Substances 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 230000008878 coupling Effects 0.000 description 18
- 238000010168 coupling process Methods 0.000 description 18
- 238000005859 coupling reaction Methods 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- 150000004699 copper complex Chemical class 0.000 description 11
- 229910052804 chromium Inorganic materials 0.000 description 9
- 239000011651 chromium Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 8
- 229920000742 Cotton Polymers 0.000 description 8
- 238000009833 condensation Methods 0.000 description 8
- 230000005494 condensation Effects 0.000 description 8
- 235000002639 sodium chloride Nutrition 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- WQTCZINVPXJNEL-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC=C1N WQTCZINVPXJNEL-UHFFFAOYSA-N 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- 125000003277 amino group Chemical group 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 150000004984 aromatic diamines Chemical class 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- NEECEUZBAHTVIN-UHFFFAOYSA-N 4-amino-3-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1Cl NEECEUZBAHTVIN-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- 150000004982 aromatic amines Chemical class 0.000 description 4
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- GRGSHONWRKRWGP-UHFFFAOYSA-N 2-amino-4-sulfobenzoic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1C(O)=O GRGSHONWRKRWGP-UHFFFAOYSA-N 0.000 description 3
- MJNYPLCGWXFYPD-UHFFFAOYSA-N 2-amino-5-sulfobenzoic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1C(O)=O MJNYPLCGWXFYPD-UHFFFAOYSA-N 0.000 description 3
- XJQRCFRVWZHIPN-UHFFFAOYSA-N 3-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1Cl XJQRCFRVWZHIPN-UHFFFAOYSA-N 0.000 description 3
- GADKYCGOSLZAKG-UHFFFAOYSA-N 3-amino-4-ethoxybenzenesulfonic acid Chemical compound CCOC1=CC=C(S(O)(=O)=O)C=C1N GADKYCGOSLZAKG-UHFFFAOYSA-N 0.000 description 3
- FLIOATBXVNLPLK-UHFFFAOYSA-N 3-amino-4-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(S(O)(=O)=O)C=C1N FLIOATBXVNLPLK-UHFFFAOYSA-N 0.000 description 3
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 3
- SJCTXIKOXTUQHC-UHFFFAOYSA-N 4-amino-2,5-dichlorobenzenesulfonic acid Chemical compound NC1=CC(Cl)=C(S(O)(=O)=O)C=C1Cl SJCTXIKOXTUQHC-UHFFFAOYSA-N 0.000 description 3
- MICDVUDJBHIFHA-UHFFFAOYSA-N 4-amino-2,5-dimethoxybenzenesulfonic acid Chemical compound COC1=CC(S(O)(=O)=O)=C(OC)C=C1N MICDVUDJBHIFHA-UHFFFAOYSA-N 0.000 description 3
- CVYDAAGFDZATJD-UHFFFAOYSA-N 4-amino-3-bromobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1Br CVYDAAGFDZATJD-UHFFFAOYSA-N 0.000 description 3
- NTPCHAXHWPDMEI-UHFFFAOYSA-N 5-amino-2,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C=C1N NTPCHAXHWPDMEI-UHFFFAOYSA-N 0.000 description 3
- 150000001555 benzenes Chemical class 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 2
- WXUAZZARGUDIHU-UHFFFAOYSA-N 2-(ethylamino)-5-sulfobenzoic acid Chemical compound CCNC1=CC=C(S(O)(=O)=O)C=C1C(O)=O WXUAZZARGUDIHU-UHFFFAOYSA-N 0.000 description 2
- JWNYMRVWULNVDD-UHFFFAOYSA-N 2-(methylamino)-5-sulfobenzoic acid Chemical compound CNC1=CC=C(S(O)(=O)=O)C=C1C(O)=O JWNYMRVWULNVDD-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 101100294102 Caenorhabditis elegans nhr-2 gene Proteins 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 150000005125 dioxazines Chemical class 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- YYHJPNVCYHVPJK-UHFFFAOYSA-N naphthalen-1-yl-(2-phenylnaphthalen-1-yl)diazene Chemical class C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=C1N=NC1=CC=CC2=CC=CC=C12 YYHJPNVCYHVPJK-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 235000021286 stilbenes Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- ZNXSFVXZQBETRJ-UHFFFAOYSA-N (3-aminophenyl)urea Chemical compound NC(=O)NC1=CC=CC(N)=C1 ZNXSFVXZQBETRJ-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical group C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- SSYKTZQYHQJVAJ-UHFFFAOYSA-N 1-(3-aminophenyl)-4-[(2-carboxy-4-sulfophenyl)diazenyl]-5-oxo-4H-pyrazole-3-carboxylic acid Chemical compound NC=1C=C(C=CC=1)N1N=C(C(C1=O)N=NC1=C(C=C(C=C1)S(=O)(=O)O)C(=O)O)C(=O)O SSYKTZQYHQJVAJ-UHFFFAOYSA-N 0.000 description 1
- UGEHFOSBNBEWMP-UHFFFAOYSA-N 2,3-diaminobenzenesulfonic acid Chemical class NC1=CC=CC(S(O)(=O)=O)=C1N UGEHFOSBNBEWMP-UHFFFAOYSA-N 0.000 description 1
- DVXMQZHDVBYYEQ-UHFFFAOYSA-N 2,4,6-triaminopyridine-3-carbonitrile Chemical compound NC1=CC(N)=C(C#N)C(N)=N1 DVXMQZHDVBYYEQ-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- QGNJPFLIBOTDKU-UHFFFAOYSA-N 2,5-diaminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=C(N)C(S(O)(=O)=O)=C1 QGNJPFLIBOTDKU-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- XVPINEOVXMFEPE-UHFFFAOYSA-N 2-(3-aminoanilino)-2-oxoethanesulfonic acid Chemical compound NC1=CC=CC(NC(=O)CS(O)(=O)=O)=C1 XVPINEOVXMFEPE-UHFFFAOYSA-N 0.000 description 1
- RTTVSZDELFXAPX-UHFFFAOYSA-N 2-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]benzoic acid Chemical compound OS(=O)(=O)C1=CC2=CC(N)=CC=C2C(O)=C1N=NC1=CC=CC=C1C(O)=O RTTVSZDELFXAPX-UHFFFAOYSA-N 0.000 description 1
- SKZSFCVUIPNMKJ-UHFFFAOYSA-N 2-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]benzene-1,4-disulfonic acid Chemical compound OC=1C2=CC(N)=CC=C2C=C(S(O)(=O)=O)C=1N=NC1=CC(S(O)(=O)=O)=CC=C1S(O)(=O)=O SKZSFCVUIPNMKJ-UHFFFAOYSA-N 0.000 description 1
- KHSMHQTVZMKYOD-UHFFFAOYSA-N 2-[(8-amino-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]-5-[(4-methoxyphenyl)diazenyl]benzoic acid Chemical compound NC=1C=C(C=C2C=C(C(=C(C=12)O)N=NC1=C(C=C(C=C1)N=NC1=CC=C(C=C1)OC)C(=O)O)S(=O)(=O)O)S(=O)(=O)O KHSMHQTVZMKYOD-UHFFFAOYSA-N 0.000 description 1
- XFAWFWZQPYCAPS-UHFFFAOYSA-N 2-[[1-(3-aminophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzene-1,4-disulfonic acid Chemical compound NC=1C=C(C=CC=1)N1N=C(C(C1=O)N=NC1=C(C=CC(=C1)S(=O)(=O)O)S(=O)(=O)O)C XFAWFWZQPYCAPS-UHFFFAOYSA-N 0.000 description 1
- DVIMVGIZDUSQLL-UHFFFAOYSA-N 2-[[1-hydroxy-6-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]-4-sulfobenzoic acid Chemical compound CNC=1C=C2C=C(C(=C(C2=CC1)O)N=NC1=C(C=CC(=C1)S(=O)(=O)O)C(=O)O)S(=O)(=O)O DVIMVGIZDUSQLL-UHFFFAOYSA-N 0.000 description 1
- CFCXQQUQLZIZPI-UHFFFAOYSA-N 2-amino-3,5-dimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(N)C(S(O)(=O)=O)=C1 CFCXQQUQLZIZPI-UHFFFAOYSA-N 0.000 description 1
- VRLPHBSFRWMMPW-UHFFFAOYSA-N 2-amino-4-chloro-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1Cl VRLPHBSFRWMMPW-UHFFFAOYSA-N 0.000 description 1
- BDCJBCKISOZMBR-UHFFFAOYSA-N 2-amino-4-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(S(O)(=O)=O)C(N)=C1 BDCJBCKISOZMBR-UHFFFAOYSA-N 0.000 description 1
- FJHGMUDVUAXUEK-UHFFFAOYSA-N 2-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C(N)=C1 FJHGMUDVUAXUEK-UHFFFAOYSA-N 0.000 description 1
- YMJXNYUOEJPKHH-UHFFFAOYSA-N 2-amino-4-nitrobenzenesulfonic acid Chemical compound NC1=CC([N+]([O-])=O)=CC=C1S(O)(=O)=O YMJXNYUOEJPKHH-UHFFFAOYSA-N 0.000 description 1
- DCYBHNIOTZBCFS-UHFFFAOYSA-N 2-amino-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC=C1N=NC1=CC=C(S(O)(=O)=O)C=C1 DCYBHNIOTZBCFS-UHFFFAOYSA-N 0.000 description 1
- VYZCFAPUHSSYCC-UHFFFAOYSA-N 2-amino-5-chloro-4-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=C(S(O)(=O)=O)C=C1Cl VYZCFAPUHSSYCC-UHFFFAOYSA-N 0.000 description 1
- KTFUNVBAGAPLLC-UHFFFAOYSA-N 2-amino-5-ethoxybenzenesulfonic acid Chemical compound CCOC1=CC=C(N)C(S(O)(=O)=O)=C1 KTFUNVBAGAPLLC-UHFFFAOYSA-N 0.000 description 1
- VMKHNXYWSCMKSS-UHFFFAOYSA-N 2-amino-5-hydroxy-6-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC2=C(S(O)(=O)=O)C(N)=CC=C2C(O)=C1N=NC1=CC(S(O)(=O)=O)=CC=C1O VMKHNXYWSCMKSS-UHFFFAOYSA-N 0.000 description 1
- HIVUAOXLSJITPA-UHFFFAOYSA-N 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=C(S(O)(=O)=O)C(N)=CC=C21 HIVUAOXLSJITPA-UHFFFAOYSA-N 0.000 description 1
- KZKGEEGADAWJFS-UHFFFAOYSA-N 2-amino-5-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C(S(O)(=O)=O)=C1 KZKGEEGADAWJFS-UHFFFAOYSA-N 0.000 description 1
- LTPSRQRIPCVMKQ-UHFFFAOYSA-N 2-amino-5-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C(S(O)(=O)=O)=C1 LTPSRQRIPCVMKQ-UHFFFAOYSA-N 0.000 description 1
- LTASFWDWBYFZQQ-UHFFFAOYSA-N 2-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LTASFWDWBYFZQQ-UHFFFAOYSA-N 0.000 description 1
- AKLDPNVZTZIVFA-UHFFFAOYSA-N 2-azaniumyl-4,5-dichlorobenzenesulfonate Chemical compound NC1=CC(Cl)=C(Cl)C=C1S(O)(=O)=O AKLDPNVZTZIVFA-UHFFFAOYSA-N 0.000 description 1
- OLCKRGCUQOKQCM-UHFFFAOYSA-N 2-fluoro-1,3,5-triazine Chemical group FC1=NC=NC=N1 OLCKRGCUQOKQCM-UHFFFAOYSA-N 0.000 description 1
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- IRGXCZQWHGTCIF-UHFFFAOYSA-N 3-[(4,6-diamino-3-cyanopyridin-2-yl)amino]benzenesulfonic acid Chemical compound NC1=CC(N)=C(C#N)C(NC=2C=C(C=CC=2)S(O)(=O)=O)=N1 IRGXCZQWHGTCIF-UHFFFAOYSA-N 0.000 description 1
- XXZDPVOWJBCNQC-UHFFFAOYSA-N 3-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,5-disulfonic acid Chemical compound CC1=CC(N)=CC=C1N=NC1=CC(S(O)(=O)=O)=C(C=CC=C2S(O)(=O)=O)C2=C1 XXZDPVOWJBCNQC-UHFFFAOYSA-N 0.000 description 1
- FOINSAWEWXUXPQ-UHFFFAOYSA-N 4-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(S(O)(=O)=O)C(N)=C1 FOINSAWEWXUXPQ-UHFFFAOYSA-N 0.000 description 1
- KKBQCLVIBFUKGQ-UHFFFAOYSA-N 4-amino-5-methylbenzene-1,3-disulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1N KKBQCLVIBFUKGQ-UHFFFAOYSA-N 0.000 description 1
- NHHOHOZBHYGTET-UHFFFAOYSA-N 4-amino-6-[(4-chloro-2-sulfophenyl)diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OC1=C2C(N)=CC=C(S(O)(=O)=O)C2=CC(S(O)(=O)=O)=C1N=NC1=CC=C(Cl)C=C1S(O)(=O)=O NHHOHOZBHYGTET-UHFFFAOYSA-N 0.000 description 1
- HIMMCCJEMMCUJS-UHFFFAOYSA-N 4-fluorotriazine Chemical group FC1=CC=NN=N1 HIMMCCJEMMCUJS-UHFFFAOYSA-N 0.000 description 1
- XHHWJFFOFMYBHG-UHFFFAOYSA-N 4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]-6-(methylamino)naphthalene-2-sulfonic acid Chemical compound OC=1C2=CC(NC)=CC=C2C=C(S(O)(=O)=O)C=1N=NC1=CC=C(OC)C=C1S(O)(=O)=O XHHWJFFOFMYBHG-UHFFFAOYSA-N 0.000 description 1
- FPYLBERKEKTGLO-UHFFFAOYSA-N 4-hydroxy-6-(methylamino)-3-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid Chemical compound OC=1C2=CC(NC)=CC=C2C=C(S(O)(=O)=O)C=1N=NC1=CC=CC=C1S(O)(=O)=O FPYLBERKEKTGLO-UHFFFAOYSA-N 0.000 description 1
- BCKLFBZLLBBVHX-UHFFFAOYSA-N 5-[(3-aminobenzoyl)amino]-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound NC1=CC=CC(C(=O)NC=2C3=C(O)C(N=NC=4C(=CC=CC=4)S(O)(=O)=O)=C(C=C3C=C(C=2)S(O)(=O)=O)S(O)(=O)=O)=C1 BCKLFBZLLBBVHX-UHFFFAOYSA-N 0.000 description 1
- AFABYZDPBFSKLR-UHFFFAOYSA-N 5-[(6-amino-1-hydroxy-3,5-disulfonaphthalen-2-yl)diazenyl]-2-hydroxybenzoic acid Chemical compound Nc1ccc2c(O)c(N=Nc3ccc(O)c(c3)C(O)=O)c(cc2c1S(O)(=O)=O)S(O)(=O)=O AFABYZDPBFSKLR-UHFFFAOYSA-N 0.000 description 1
- YEZBOLDRJIAVBA-UHFFFAOYSA-N 5-[(8-amino-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]-2-hydroxybenzoic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=C(O)C(C(O)=O)=C1 YEZBOLDRJIAVBA-UHFFFAOYSA-N 0.000 description 1
- PHRVJZNHPVJYOM-UHFFFAOYSA-N 5-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(N)C(S(O)(=O)=O)=C1 PHRVJZNHPVJYOM-UHFFFAOYSA-N 0.000 description 1
- CCABXCUZXGZDFM-UHFFFAOYSA-N 5-amino-2-[[1-hydroxy-3-sulfo-7-(3-sulfoanilino)naphthalen-2-yl]diazenyl]benzoic acid Chemical compound S(=O)(=O)(O)C=1C=C(C=CC1)NC1=CC=C2C=C(C(=C(C2=C1)O)N=NC1=C(C=C(C=C1)N)C(=O)O)S(=O)(=O)O CCABXCUZXGZDFM-UHFFFAOYSA-N 0.000 description 1
- YSUNNMYIEJJXBW-UHFFFAOYSA-N 5-amino-3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC(S(O)(=O)=O)=CC(Cl)=C1O YSUNNMYIEJJXBW-UHFFFAOYSA-N 0.000 description 1
- NQGIFVWQIYLXKQ-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=C([N+]([O-])=O)C=C1O NQGIFVWQIYLXKQ-UHFFFAOYSA-N 0.000 description 1
- ISTNBIUEOOWHHO-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=CC=C1S(O)(=O)=O ISTNBIUEOOWHHO-UHFFFAOYSA-N 0.000 description 1
- ZTTJTIAKGUQOMO-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[[2-methoxy-5-methyl-4-[(2-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid Chemical compound COc1cc(N=Nc2ccccc2S(O)(=O)=O)c(C)cc1N=Nc1c(O)c2c(N)cc(cc2cc1S(O)(=O)=O)S(O)(=O)=O ZTTJTIAKGUQOMO-UHFFFAOYSA-N 0.000 description 1
- KPYURLAXBKQIAC-UHFFFAOYSA-N 5-aminonaphthalene-1,3,6-trisulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=C(S(O)(=O)=O)C=CC2=C1S(O)(=O)=O KPYURLAXBKQIAC-UHFFFAOYSA-N 0.000 description 1
- HBZVNWNSRNTWPS-UHFFFAOYSA-N 6-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(N)=CC=C21 HBZVNWNSRNTWPS-UHFFFAOYSA-N 0.000 description 1
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 1
- SEMRCUIXRUXGJX-UHFFFAOYSA-N 6-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(N)=CC=C21 SEMRCUIXRUXGJX-UHFFFAOYSA-N 0.000 description 1
- IRJIXEKAWHQKHK-UHFFFAOYSA-N 7-acetamido-3-[(5-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(NC(=O)C)=CC=C2C(O)=C1N=NC1=CC(N)=CC=C1S(O)(=O)=O IRJIXEKAWHQKHK-UHFFFAOYSA-N 0.000 description 1
- KKAMNIDZQVXDJV-UHFFFAOYSA-N 7-acetamido-4-hydroxynaphthalene-2-sulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(NC(=O)C)=CC=C21 KKAMNIDZQVXDJV-UHFFFAOYSA-N 0.000 description 1
- ZBILXVWKWMKHEA-UHFFFAOYSA-N 7-amino-4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(N)=CC=C2C(O)=C1N=NC1=CC(S(O)(=O)=O)=CC=C1O ZBILXVWKWMKHEA-UHFFFAOYSA-N 0.000 description 1
- WJBNEMQYSHMDPS-UHFFFAOYSA-N 7-amino-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(N)=CC=C2C(O)=C1N=NC1=CC=CC=C1S(O)(=O)=O WJBNEMQYSHMDPS-UHFFFAOYSA-N 0.000 description 1
- KMXMLAGYNHELHA-UHFFFAOYSA-N 8-hydroxynaphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 KMXMLAGYNHELHA-UHFFFAOYSA-N 0.000 description 1
- CIVGDNRBRWQLAV-UHFFFAOYSA-N C1=CC(N)([N+]([O-])=O)CC(S(O)(=O)=O)=C1C=CC1=CC=CC=C1S(O)(=O)=O Chemical compound C1=CC(N)([N+]([O-])=O)CC(S(O)(=O)=O)=C1C=CC1=CC=CC=C1S(O)(=O)=O CIVGDNRBRWQLAV-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N N-phenyl aniline Natural products C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- FWWXQUJVJBSVRD-UHFFFAOYSA-N NC=1C=C(C=CC1)C1=C(C2=C(C=C(C=C2C=C1)S(=O)(=O)O)O)N Chemical compound NC=1C=C(C=CC1)C1=C(C2=C(C=C(C=C2C=C1)S(=O)(=O)O)O)N FWWXQUJVJBSVRD-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 150000004700 cobalt complex Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- ICIDZHMCYAIUIJ-UHFFFAOYSA-N dinaphthalen-1-yldiazene Chemical compound C1=CC=C2C(N=NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ICIDZHMCYAIUIJ-UHFFFAOYSA-N 0.000 description 1
- PPSZHCXTGRHULJ-UHFFFAOYSA-N dioxazine Chemical compound O1ON=CC=C1 PPSZHCXTGRHULJ-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- FBGJJTQNZVNEQU-UHFFFAOYSA-N n,3-dimethylaniline Chemical compound CNC1=CC=CC(C)=C1 FBGJJTQNZVNEQU-UHFFFAOYSA-N 0.000 description 1
- PEMGGJDINLGTON-UHFFFAOYSA-N n-(3-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(N)=C1 PEMGGJDINLGTON-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 description 1
- FKORGLNGEASTQE-UHFFFAOYSA-N naphthalene-1,3-disulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC(S(O)(=O)=O)=C21 FKORGLNGEASTQE-UHFFFAOYSA-N 0.000 description 1
- VILFVXYKHXVYAB-UHFFFAOYSA-N naphthalene-2,7-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 VILFVXYKHXVYAB-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- LJRGBERXYNQPJI-UHFFFAOYSA-M sodium;3-nitrobenzenesulfonate Chemical compound [Na+].[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 LJRGBERXYNQPJI-UHFFFAOYSA-M 0.000 description 1
- FNLGVABBDVJJOP-UHFFFAOYSA-M sodium;7-amino-4-hydroxynaphthalene-2-sulfonate Chemical compound [Na+].OC1=CC(S([O-])(=O)=O)=CC2=CC(N)=CC=C21 FNLGVABBDVJJOP-UHFFFAOYSA-M 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P1/00—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed
- D06P1/38—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using reactive dyes
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1434875A CH620940A5 (en) | 1975-11-06 | 1975-11-06 | Reactive dyes contg. trifluoro-triazine gps. |
| CH1316276A CH631200A5 (en) | 1976-10-18 | 1976-10-18 | Process for preparing fibre-reactive dyes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2650555A1 DE2650555A1 (de) | 1977-05-18 |
| DE2650555C2 true DE2650555C2 (enExample) | 1989-01-26 |
Family
ID=25711673
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762650555 Granted DE2650555A1 (de) | 1975-11-06 | 1976-11-04 | Faserreaktive farbstoffe, deren herstellung und verwendung |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4906737A (enExample) |
| JP (1) | JPS6048546B2 (enExample) |
| AR (1) | AR242241A1 (enExample) |
| BR (1) | BR7607424A (enExample) |
| CA (1) | CA1067894A (enExample) |
| CS (1) | CS195316B2 (enExample) |
| DE (1) | DE2650555A1 (enExample) |
| ES (1) | ES453025A1 (enExample) |
| FR (1) | FR2330739A1 (enExample) |
| GB (1) | GB1549820A (enExample) |
| IT (1) | IT1121683B (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2654351A1 (de) * | 1976-12-01 | 1978-06-08 | Bayer Ag | Anthrachinon-reaktivfarbstoffe |
| DE2655089C2 (de) * | 1976-12-04 | 1984-08-16 | Bayer Ag, 5090 Leverkusen | Azoreaktivfarbstoffe |
| DE2729011C2 (de) | 1977-06-28 | 1987-01-15 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| CH637679A5 (de) * | 1977-07-22 | 1983-08-15 | Bayer Ag | Faserreaktive disazofarbstoffe. |
| LU78082A1 (de) * | 1977-09-06 | 1979-05-23 | Ciba Geigy Ag | Farbstoffe,deren herstellung und verwendung |
| LU78115A1 (de) * | 1977-09-12 | 1979-05-23 | Ciba Geigy Ag | Azofarbstoffe,deren herstellung und verwendung |
| DE2745831A1 (de) * | 1977-10-12 | 1979-04-19 | Cassella Ag | Faserreaktive phthalocyaninazofarbstoffe |
| DE2749647A1 (de) * | 1977-11-05 | 1979-05-10 | Bayer Ag | Reaktivfarbstoffe |
| DE2825594A1 (de) * | 1978-06-10 | 1979-12-20 | Bayer Ag | Azo-reaktivfarbstoffe |
| DE2828227A1 (de) | 1978-06-28 | 1980-01-10 | Bayer Ag | Phthalocyanin-reaktivfarbstoffe |
| CH627206A5 (enExample) * | 1978-07-06 | 1981-12-31 | Ciba Geigy Ag | |
| DE2849068C2 (de) | 1978-11-11 | 1985-06-20 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| DE2852672A1 (de) * | 1978-12-06 | 1980-06-19 | Bayer Ag | Reaktiv-farbstoffe |
| DE2853823A1 (de) * | 1978-12-13 | 1980-07-03 | Bayer Ag | Verfahren zur herstellung von phthalocyanin-reaktivfarbstoffen |
| DE2901481A1 (de) * | 1979-01-16 | 1980-07-24 | Bayer Ag | Reaktivfarbstoffe |
| CH643872A5 (de) | 1979-12-21 | 1984-06-29 | Sandoz Ag | Disazoverbindungen, verfahren zur herstellung und verwendung. |
| US4523925A (en) * | 1982-06-09 | 1985-06-18 | Ciba-Geigy Corporation | Process for dyeing or printing cellulose textile fiber materials with reactive dyes containing fluoro-triazine |
| CH655735A5 (de) * | 1982-09-17 | 1986-05-15 | Sandoz Ag | Reaktive monoazoverbindungen. |
| DE3542001A1 (de) * | 1985-11-28 | 1987-06-04 | Bayer Ag | Reaktivfarbstoffe |
| DE3917046A1 (de) * | 1989-05-25 | 1990-11-29 | Bayer Ag | Verfahren zur herstellung von substituierten 2,4-diamino-6-fluor-s-triazinen |
| EP0568876B1 (de) | 1992-05-04 | 1996-08-28 | Bayer Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| DE4215485A1 (de) * | 1992-05-11 | 1993-11-18 | Bayer Ag | Neue Reaktivfarbstoffe |
| TW446734B (en) * | 1997-12-11 | 2001-07-21 | Ciba Sc Holding Ag | Process for dyeing or printing and novel reactive dyes |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH431758A (de) * | 1963-07-10 | 1967-03-15 | Geigy Ag J R | Verfahren zur Herstellung neuer reaktiver Farbstoffe |
| GB1189312A (en) * | 1966-08-01 | 1970-04-22 | Ici Ltd | Water-Soluble Polyazo Dyestuffs of the Triazine Series |
| DE1644184C3 (de) * | 1966-12-05 | 1974-03-28 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe, Verfahren zu deren Herstellung und Verwendung zum Färben und Bedrucken cellulosehaltiger Materialien |
| DE1644208C3 (de) * | 1967-04-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| GB1271226A (en) * | 1968-09-24 | 1972-04-19 | Ici Ltd | Reactive dyestuffs containing 3-azo-2-hydroxy-6-pyridone residues |
| GB1429007A (en) * | 1973-03-28 | 1976-03-24 | Ici Ltd | Reactive copper-containing monoazo dyestuffs |
| CH612448A5 (enExample) * | 1974-12-20 | 1979-07-31 | Ciba Geigy Ag | |
| CH606347A5 (enExample) * | 1975-01-15 | 1978-10-31 | Ciba Geigy Ag |
-
1976
- 1976-11-03 IT IT7652021A patent/IT1121683B/it active
- 1976-11-03 GB GB45758/76A patent/GB1549820A/en not_active Expired
- 1976-11-04 FR FR7633324A patent/FR2330739A1/fr active Granted
- 1976-11-04 AR AR76265355A patent/AR242241A1/es active
- 1976-11-04 DE DE19762650555 patent/DE2650555A1/de active Granted
- 1976-11-04 CA CA264,919A patent/CA1067894A/en not_active Expired
- 1976-11-05 CS CS767173A patent/CS195316B2/cs unknown
- 1976-11-05 BR BR7607424A patent/BR7607424A/pt unknown
- 1976-11-05 ES ES453025A patent/ES453025A1/es not_active Expired
- 1976-11-06 JP JP51132778A patent/JPS6048546B2/ja not_active Expired
-
1988
- 1988-08-17 US US07/233,923 patent/US4906737A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6048546B2 (ja) | 1985-10-28 |
| CA1067894A (en) | 1979-12-11 |
| AR242241A1 (es) | 1993-03-31 |
| US4906737A (en) | 1990-03-06 |
| GB1549820A (en) | 1979-08-08 |
| JPS5274618A (en) | 1977-06-22 |
| BR7607424A (pt) | 1977-09-20 |
| IT1121683B (it) | 1986-04-10 |
| FR2330739A1 (fr) | 1977-06-03 |
| CS195316B2 (en) | 1980-01-31 |
| DE2650555A1 (de) | 1977-05-18 |
| FR2330739B1 (enExample) | 1978-12-22 |
| ES453025A1 (es) | 1977-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2650555C2 (enExample) | ||
| DE2927102C2 (enExample) | ||
| DE1644208C3 (de) | Reaktivfarbstoffe | |
| DE2556640C2 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE1644204B2 (de) | Reaktivfarbstoffe und deren verwendung | |
| EP0070806A2 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| EP0126026B1 (de) | Verfahren zum Färben von Seide oder seidenhaltigen gemischten Fasermaterialien | |
| DE1644203B2 (de) | Reaktivfarbstoffe | |
| DE1252824B (de) | Verfahren zur Herstellung von reaktiven Farbstoffen | |
| DE2653199C2 (enExample) | ||
| DE3335956A1 (de) | Aminosubstituierte, fluorhaltige pyrimidinyl-reaktivfarbstoffe | |
| DE2838540C2 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| EP0085654B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| CH467838A (de) | Verfahren zur Herstellung metallfreier Azofarbstoffe | |
| DE2839209C2 (de) | Azofarbstoffe, deren Herstellung und Verwendung | |
| EP0036522B1 (de) | Wasserlösliche Nickelphthalocyanin-azofarbstoffe und deren Verwendung | |
| DE3107265A1 (de) | Reaktivfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben oder bedrucken von fasermaterialien | |
| DE1644206C3 (de) | Wasserlösliche Reaktivfarbstoffe, deren Herstellung und Verwendung zum Färben von Cellulosematerialien, Wolle, Seide, Polyamid- und Polyurethanfasern | |
| DE1544505C3 (de) | Reaktivfarbstoffe und Verfahren zu deren Herstellung und Anwendung | |
| DE1544499C3 (de) | Reaktivfarbstoffe | |
| DE1544561A1 (de) | Reaktivfarbstoffe und Verfahren zu deren Herstellung | |
| DE1261257B (de) | Verfahren zur Herstellung von Farbstoffen | |
| EP0103156B1 (de) | Wasserlösliche Kupferkomplex-Disazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE1544505B2 (de) | Reaktivfarbstoffe und verfahren zu deren herstellung und anwendung | |
| DE1191059B (de) | Verfahren zur Herstellung von Azofarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| Q176 | The application caused the suspense of an application |
Ref document number: 2655089 Country of ref document: DE |
|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |