DE2557552C2 - Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe - Google Patents
Diurethane und herbizide Mittel, enthaltend diese Verbindungen als WirkstoffeInfo
- Publication number
- DE2557552C2 DE2557552C2 DE19752557552 DE2557552A DE2557552C2 DE 2557552 C2 DE2557552 C2 DE 2557552C2 DE 19752557552 DE19752557552 DE 19752557552 DE 2557552 A DE2557552 A DE 2557552A DE 2557552 C2 DE2557552 C2 DE 2557552C2
- Authority
- DE
- Germany
- Prior art keywords
- ester
- phenyl
- acid
- bromoethyl
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title description 18
- 239000004480 active ingredient Substances 0.000 title description 11
- 239000004009 herbicide Substances 0.000 title description 3
- 150000002148 esters Chemical class 0.000 description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 25
- 125000005999 2-bromoethyl group Chemical group 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- -1 3-trifluoromethylphenyl Chemical group 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 244000061456 Solanum tuberosum Species 0.000 description 5
- 235000002595 Solanum tuberosum Nutrition 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 230000002363 herbicidal effect Effects 0.000 description 5
- 235000012015 potatoes Nutrition 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 240000005702 Galium aparine Species 0.000 description 3
- 235000014820 Galium aparine Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000007530 organic bases Chemical group 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 2
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 2
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 244000292693 Poa annua Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- RREILSCLQKRVJG-UHFFFAOYSA-N [3-(ethoxycarbonylamino)phenyl] n-(2-bromoethyl)-n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)N(CCBr)C=2C=CC=CC=2)=C1 RREILSCLQKRVJG-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000006627 ethoxycarbonylamino group Chemical group 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- IEJBEBRAATYCNM-UHFFFAOYSA-N 2-bromoethyl(phenyl)carbamic acid Chemical compound BrCCN(C(=O)O)C1=CC=CC=C1 IEJBEBRAATYCNM-UHFFFAOYSA-N 0.000 description 1
- LYBKTSWEHSRGKC-UHFFFAOYSA-N 2-bromoethyl-[3-(trifluoromethyl)phenyl]carbamic acid Chemical compound BrCCN(C(O)=O)C1=CC(=CC=C1)C(F)(F)F LYBKTSWEHSRGKC-UHFFFAOYSA-N 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 240000004385 Centaurea cyanus Species 0.000 description 1
- 235000005940 Centaurea cyanus Nutrition 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 244000303225 Lamium amplexicaule Species 0.000 description 1
- 235000009198 Lamium amplexicaule Nutrition 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 240000006928 Persicaria lapathifolia Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 240000005498 Setaria italica Species 0.000 description 1
- 235000007226 Setaria italica Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- LKDBNSDHTCEZLY-UHFFFAOYSA-N [3-(ethoxycarbonylamino)phenyl] n-(2-bromoethyl)-n-(2-methylphenyl)carbamate Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)N(CCBr)C=2C(=CC=CC=2)C)=C1 LKDBNSDHTCEZLY-UHFFFAOYSA-N 0.000 description 1
- DVSMAMCPLUOEIC-UHFFFAOYSA-N [3-(methoxycarbonylamino)phenyl] n-(2-bromoethyl)-n-(2-methylphenyl)carbamate Chemical compound COC(=O)NC1=CC=CC(OC(=O)N(CCBr)C=2C(=CC=CC=2)C)=C1 DVSMAMCPLUOEIC-UHFFFAOYSA-N 0.000 description 1
- BKAMNNNITGGVQD-UHFFFAOYSA-N [3-(methoxycarbonylamino)phenyl] n-(2-bromoethyl)-n-phenylcarbamate Chemical compound COC(=O)NC1=CC=CC(OC(=O)N(CCBr)C=2C=CC=CC=2)=C1 BKAMNNNITGGVQD-UHFFFAOYSA-N 0.000 description 1
- SSQUFIKXGKCKJE-UHFFFAOYSA-N [3-(methoxycarbonylamino)phenyl] n-(2-chloroethyl)-n-phenylcarbamate Chemical compound COC(=O)NC1=CC=CC(OC(=O)N(CCCl)C=2C=CC=CC=2)=C1 SSQUFIKXGKCKJE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- IMNFDUFMRHMDMM-UHFFFAOYSA-N anhydrous n-heptane Natural products CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Description
R1 2-Bromäthyl oder 2-Chloräthyl,
15 R2 Phenyl, 2-Methylphenyl, 3-Chlorphenyl oder 3-Trifluormethylphenyl,
R3 Methyl, Äthyl, Allyl, 2-Propinyl oder 1-Methylpropinyl und
X Sauerstoff oder Schwefel
bedeuten.
20 2. Herbizide Mittel, enthaltend mindestens ein Diurethan nach Anspruch 1.
20 2. Herbizide Mittel, enthaltend mindestens ein Diurethan nach Anspruch 1.
J—NH-CO —X-R3
Die Erfindung betrifft neue Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe.
Die selektiv-herbizide Wirkung von Diurethanen ist bereits bekannt (DE-PS 15 67 151). Eine befriedigende
herbizide Wirkung gegen besonders schwer bekämpfbare Unkräuter, wie Amarantus sp., Galium aparine, Poa
annua, und eine ausreichende Selektivität für Getreidearten und Kartoffeln konnte für diese Urethane bisher
nicht ausgewiesen werden.
3ü Aufgabe der vorliegenden Erfindung ist daher die Schaffung neuer Substanzen und eines diese Substanzen enthaltenden herbiziden Mittels, welches eine bessere Unkrautwirkung und Verträglichkeit für Getreidearten
3ü Aufgabe der vorliegenden Erfindung ist daher die Schaffung neuer Substanzen und eines diese Substanzen enthaltenden herbiziden Mittels, welches eine bessere Unkrautwirkung und Verträglichkeit für Getreidearten
und Kartoffeln als die Mittel mit den bekannten Diurethanen aufweisen.
Diese Aufgabe wird erfindungsgemüß durch die Bereitstellung von Diurethanen und eines herbiziden Mittels,
Diese Aufgabe wird erfindungsgemüß durch die Bereitstellung von Diurethanen und eines herbiziden Mittels,
das mindestens ein solches Diurethan enthält gelöst. 35 Diese Diurethane besitzen die allgemeine Formel
R, 2-Bromäthyl oder 2-Chloräthyl,
R; Phenyl, 2-Methylphenyl, 3-Chlorphenyl oder 3-Trifluormethylphenyl,
R1 Methyl, Äthyl, Allyl, 2-Propinyl oder 1-Methylpropinyl und
X Sauerstoff oder Schwefel
bedeuten, enthält.
Diese Verbindungen zeichnen sich durch eine überraschend große Verträglichkeit gegenüber Kartoffeln,
Geireidearten, Mais und Reis aus.
In einem Vergleichsversuch konnte gezeigt werden, daß die aus der DE-OS 24 13 933 bekannten nahe verwandten
Diurethane mit selektiver Wirkung insbesondere in Baumwollkulturen im Gegensatz zu den erfindungsgemäßen
neuen Diurethanen keine selektive Wirkung in Kartoffeln entfalten. Diese bekannten Verbindungen
schädigten die Kartoffeln teilweise schon in Aufwandmengen von 1 kg Wirkstoff/ha, so daß sie in diesen
Nutzpflanzenkulturen nicht verwendet werden können.
Als schwer bekämpfbare Unkräuter, die mit den erfindungsgemäßen Wirkstoffen bekämpft werden können,
sind zum Beispiel zu nennen Amarantus sp., Galium aparine, Poa annua, Echinochloa crus gallä, Seiaria, Digitaria
sanguinalis, Avena fatua.
Die günstigste Wirkung entfalten die erfindungsgemäßen Verbindungen, wenn sie im Nachauflaufverfahren
(post-emergence) angewandt werden. Die herbizide Wirkung erstreckt sich hierbei gegen viele Pflanzenarten,
wie zum Beispiel Stellaria media, Senecio vulgaris, Lamium amplexicaule, Centaurea cyanus, Amarantus retroflexus,
Chrysanthemum segeHim, Ipomea sp., Polygonum lapathifolium, Galium aparine, Setaria italica, Poa
annua, Echinochloa crus galli, Digitaria sanguinalis, Avena fatua, Alopecurus myosuroides.
Die Aufwandmengen für eine selektive Unkrautbekämpfung betragen etwa 0,5 bis 5 kg Wirkstoff/ha.
Bevorzugte Verbindungen gemäß der Erfindung sind die folgenden:
N-(2-Bromäthyl)-carbanilsäure-[3-(methoxycarbonyIamino)-phenyl]-ester,
N-{2-Bromäthyl)-carbanilsäure-[3-(äthoxycarbonylamino)-phenyl]-ester,
N-(2-Bromäthyl)-carbaniIsäure-[3-{methy!thiocarbonylamino)-phenyI]-ester,
N-(2-Bromäthyl)-carbaniIsäure-[3-(äthyIthiocarbonylamino)-phenyl]-ester,
N-(2-Chloräthyl)-carbanilsäure-[3-{methoxycarbonylamino)-phen.y!]-ester,
N-<2-ChIoräthyl)-c2rbaniIsäure-[3-(äthoxycarbonyIamino)-phenylj-ester,
N^-ChloräthyO-carbanilsäure-is^methylthiocarbonylaminoJ-phenylJ-ester,
N-(2-Chloräthyl)-carbanilsäure-[3-(äthylthiocarbonylainino)-phenyl]-ester,
N-{2-Bromäthyl)-carbaniIsäure-[3-(a!lyIoxycarbonylamino)-phenyl]-ester,
N-(2-ChIoräthyl)-carbaniIsäure-[3-(l-methylpropinyloxycarbonylamino)-phenyl]-ester,
N-(2-Bromäthyl)-carbanilsäure-[3-{2-propinyloxycarbonylamino)-phenyl]-ester,
N-(2-ChIoräthyl)-carbaniIsäure-[3-(2-propinyloxycarbonyIamino)-phenyl]-ester,
N-(2-Bromäthyl)-2-methylcarbanilsäure-[3-(methoxycarbonylamino)-phenyl]-ester,
N-(2-BromäthyI)-3-chIorcarbanilsäure-[3-(methoxycarbo^yIamino)-phenyl]-ester,
N-b-Bromäthylj^-methylcarbanilsäure-P-iäthoxycarbonylaminoi-phenylJ-ester,
N-(2-Bromäthyl)-3-trifIuormethyIcarbanilsäure-[3-(methoxycarbonyIamino)-phenyl]-ester.
Die erfindungsgemäßen Verbindungen können entweder allein, in Mischung miteinander oder - wenn
üblich - mit anderen Wirkstoffen angewendet werden. Gegebenenfalls können andere Entblätterungs-, Pflanzenschutz-
oderSchädlingsbekämpfungsmittel je nach dem gewünschten Zweck zugesetzt werden.
Eine Förderung der Wirkung und der Wirkungsgeschwindigkeit kann bekanntermaßen durch wirkungssteigernde
Zusätze, wie organische Lösungsmittel, Netzmittel und Öle erzielt werden. Das läßt eine Minderung der
Aufwandmenge des eigentlichen Wirkstoffes zu.
Zweckmäßig werden die gekennzeichneten Wirkstoffe oder deren Mischungen in Form von Zubereitungen,
wie Pulvern, Streumitteln, Granulaten, Lösungen, Emulsionen oder Suspensionen, unter Zusatz von flüssigen
und/oder festen Trägerstoffen bzw. Verdünnungsmitteln und gegebenenfalls von Netz-, Haft-, Emulgiür- und/
oder Dispergierhilfsmitteln angewandt.
Geeignete flüssige Trägerstoffe sind z. B. Wasser, aliphatische und aromatische Kohlenwasserstoffe, wie Benzol,
Toluol, Xylol, Cyclohexanon, Isophoron, Dimethylsuifoxyd, Dimethylformamid, weiterhin Mineralölfraktionen.
Als feste Trägen DiTe eignen sich Mineralerden, z. B. Tonsil, Silicagel, Talkum, Kaolin, Attaclay, Kalkstein,
Kieselsäure und pflanzliche Produkt, z. B. Mehle.
An oberflächenaktiven Stoffen sind zu nennen: z. B. Calciumligninsulfonat, Polyoxyäthylen-alkylphenoläther,
Naphthalinsulfonsäuren u*d deren Salze, Phenolsulfonsäuren und deren Salze, Formaldehydkondensate,
Fettalkoholsulfate sowie substituierte Benzolsulfonsäuren und deren Salze.
Der Anteil des bzw. der Wirkstoffe(s) in den verschiedenen Zubereitungen kann in weiten Grenzen variieren.
Beispielsweise enthalten die Mittel etwa 10 bis 80 Gewichtsprozente Wirkstoffe, etwa 90 bis 20 Gewichtsprozente
flüssige oder feste Trägerstoffe sowie gegebenenfalls bis zu 20 Gewichtsprozente oberflächenaktive Stoffe.
Die Ausbringung der Mittel kann in üblicher Weise erfolgen, z. B. mit Wasser als Träger in Spritzt· iltimengen
von etwa 100 bis 1000 Liter/ha. Eine Anwendung der Mittel im sogenannten »Low Volume-« und »Ultra-low-Volume-Verfahren«
ist ebenso möglich wie ihre Applikation in Form von sogenannten Mikrogranulaten.
Die Herstellung dieser Zubereitungen kann in an sich brkannter Art und Weise, z. B. durch Misch- oder Mahlverfahren,
durchgeführt werden. Gewünschtenfalls können die Einzelkomponenten auch erst kurz vor ihrer Verwendung
gemischt werden, wie es z. B. im sogenannten Tankmixverfahren in der Praxis durchgeführt wird.
Die erfindungsgemäßen Diurethane können nach an sich bekannten Verfahren hergestellt werden, indem
^! man zum Beispiel
i| a) Verbindungen der allgemeinen Formel
it O —COCl
:',: L I— NH-COXR3
■■■■ mit einem Amin der allgemeinen Formel
in Gegenwart eines Säureakzeptors, z. B. unter Zusatz von überschüssigem Amin oder einer anorganischen
Base, wie z. B. Natronlauge, Natriumcarbonat, Kaliumcarbonat oder einer tertiären organischen Base wie ή5
ζ. Β. Triethylamin umsetzt oder
b) Verbindungen der allgemeinen Formel
OH
OH
NH-COXR3
in Gegenwart einer tertiären organischen Base, wie z. B. Triäthylamir^oder Pyridin oder als Alkalisalze mit
Carbamoylchloriden der allgemeinen Formel
R1
N —CO-Cl
c)
bei Temperaturen von 0°-100°C reagieren läßt oder
Verbindungen der allgemeinen Formel (sofern R, und R2 keine leicht hydrierbaren Reste bedeuten)
R1
Ο —CO —1
NO2
katalytisch, ζ. B. unter Verwendung von Nickel in Methanol zum entsprechenden Amin hydriert und
anschließend mit Verbindungen der allgemeinen Formel
Cl-COXR3
in Gegenwart eines Säureakzeptors, z. B. einer anorganischen Base, wie Natronlauge, Natriumcarbonat
oder Kaliumcarbonat oder einer tertiären organischen Base, wie z. B. Triäthylamin, zu den gewünschten
Verfahrensprodukten umsetzt und diese darauf in üblicherweise isoliert, wobei R1, R2, R3 und X die obige
Bedeutung haben.
Die folgenden Beispiele erläutern die Herstellung der erfindungsgemäßen Verbindungen.
N-(2-Chloräthyl)-carbanilsäure-[3-(methoxycarbonylamino)-phenyl]-ester
N-(2-Chloräthyl)-carbanilsäure-[3-(methoxycarbonylamino)-phenyl]-ester
In eine Lösung von 23 g N-(2-ChloräthyI)-aniIin-hydrnchlorid in 50 ml Wasser und 50 ml Essigester wird unter
Rühren eine Lösung von 22,9 g ChlorameisensäureO-methoxycarbonylaminophenylester in 50 ml Essigester
und gleichzeitig eine Lösung von 30,5 g Kaliumcarbonat in 150 ml Wasser bei 10 bis 15°C eingetropft. 30 Minuten
wird bei 15°C nachgerührt, dann die organische Phase abgetrennt und mit ca. 100 ml Essigester verdünnt,
und bji 0°C der Reihe nach mil verdünnter Natronlauge, Wasser, verdünnter Salzsäure und Wasser gewaschen.
Nach dem Trocknen mit Magnesiumsulfat wird unter vermindertem Druck eingedampft. Der zunächst ölig
erhaltene Rückstand kristallisiert bald durch und wird aus Essigester/Pentan umkristaüisiert.
Ausbeute: 3Og = 86% der Theorie Fp.: 98-1000C
In analoger Weise lassen sich die folgenden Verbindungen herstellen:
In analoger Weise lassen sich die folgenden Verbindungen herstellen:
Erfindungsgenviße Verbindung
Physikalische Konstante
N-(2-Bromäthyl)-carbanilsäure-[3-(methoxy-carbonylamino)-phenyl]-ester Fp.: 88- 900C
N-(2-Bromäthyl)-carbanilsäure-[3-(äthoxycarbonylamino)-phenyl]-ester Fp.: 80- 82°C
N-(2-Bromäthyl)-carbanilsäure-[3-(methylthioGarbonylamino)-phenyl]-ester Fp.: 118- 1200C
N-(2-Bromäthyl)-carbanilsäure-[3-(äthylthiocarbonylamino)-phenyl]-ester Fp : 78- 800C
N-(2-ChlOräthyl)-carbanilsäure-[3-(äthoxycarbonylamino)-phenyl]-ester Fp.: 71- 73°C
N-(2-ChlOräthyl)-carbanilsäure-[3-(methylthiocarbonylamino)-phenyl]-ester Fp.: 122-124°C
N-(2-Chloräth>:)-carbanilsäure-[3-(äthylthiocarbonylamino)-phenyl]-ester Fp.: 75- 760C
N-(2-BromäthylHfrbanilsäure-[3-(allyloxycarbonylamino)-phenyl]-ester Fp.: 80- 81°C
N-(2-Chlorä[hyl)-carbanilsaure-[3-(l-methylpropinyloxycarbonylamino)-phenyl]-ester Fp.: 96- 98°C
Fortsetzung
ürfindungsgemiiUe Verbindung Physikalische
knnsl.tnlo
N-(2-Bromäthyl)-carbaniIsäure-[3-(2-propinylo.xycarbonylamino)-phenyl|-ester Fp.: IO5-I()6°C
N-(2-Chloräthyl)-carbanilsäure-[3-(2-propinyloxycarbonylamino)-phenyl]-ester Fp.: 121 -I23°C ·
N-(2-Bromäthyl)-2-methylcarbanilsäure-[3-(methoxycarbonylamino)-phenyll-ester Fp.: 108 -1IU0C
N-(2-Bromäthyl)-2-methylcarbanilsäure-[3-(äthoxycarbonylamino)-phenyl]-ester Fp.: 104-106°C ln
N-(2-Bromäthyl)-3-chlorcarbanilsäure-[3-(melhoxycarbonylamino)-phcnyl|-estcr Fp.: 100-1020C
Diese Verbindungen sind löslich in Aceton, Cyclohexanon, Essigester, Isophoron, Äther, Tetrahydrofuran
und Dimethylformamid und praktisch unlöslich in Wasser und Leichtbenzin. i.s
Die Ausgangsprodukte zur Herstellung der erfindungsgfmälSen Verbindungen sind an sich bekannt oder
können nach an sich bekannten Verfahren hergestellt werden.
Die folgenden Ausführungsbeispiele dienen zur Erläuterungder Wirkungsweise der erfindungsgemäßen Verbindungen.
Im Gewächshaus wurden die unten aufgeführten Pflanzen im Nachauflaufverfahren (post-emergence) mit
einer Aufwandmenge von 3 kg Wirkstoff/ha behandelt. Als Vergleichsmittel dienten
1) 3-Methoxycarbonylarninophenyl-N-(3-rnethylphenyl)-carbarr.at
2) 2,4-Dichlor-phenoxyessigsäure.
Die Pflanzen befanden sich im Jugendstadium. Die Mittel wurden als Emulsionen ausgebracht. Die applizierte
Flüssigkeitsmenge entsprach 500 Liter/ha. Nach 14 Tagen wurde der Behandlungserfolg bonitiert (0 Jo
= totale Vernichtung, 10 = keine Schädigung).
Die Werte in der nachfolgenden Tabelle verdeutlichen die gute Kulturverträglichkeit der erfindungsgemäßen
Mittel, während die bekannten Vergleichsmittel die Kulturpflanzen erheblich schädigten.
Erfindungsgemäße Verbindungen
N-(2-Bromäthyl)-carbanilsa'ure-[3-(methoxy-carbonyl- 3 10 10 10 10 10 0000000000000 1 2
amino)-phenyl]-ester N-tf-BromäthyO-carbanilsüure-P-iäthoxycarbonyl- 3 10 10 10 10 10 0000000000303 2
amino)-phenyl]-ester
N-(2-Bromäthyl)-carbanilsäure-[3-(methylthio- 3 8 10 10 10 10 0
carbonylamino)-phenyl]-ester
N-Cl-BromäthyO-carbanilsäure-P-iäthylthiocarbonyl- 3 10-10 10 10 0
amino)-phenyl]-ester
N-iZ-ChlorüthyO-carbanilsäure-P-imethoxycarbonyl- 3 10 9 - - 10 0
amino)-phenyl]-ester
N-Oi-ChloräthyD-carbnnilsäure-P-iät.hoxycarbonyl- 3 - - 8 - 10 0
amino)-phenylj-ester
N-P-ChloräthyO-carbanilsäure-P-imetliylthio- 3 10 - - 10 0
carbonylamino)-phenyl]-ester
N-C'-ChloräthyO-carbanilsäure-P-Cäthylthiocarbonyl- 3 8 10 10 10 10 0
ainino)-phenyl]-ester
N-O'-BromüthyO-earbanitsäure-P-iallyloxycarbonyl- 3 10 10 10 10 10 0
amino)-phenyl]-ester
N-Ci-ChloräthyO-carbanilsäure-P-a-methylpropinyl- 3 10 10 10 10 10 0
oxycarbonylamino)-phenyl]-ester
N-(2-Bromäthyl)-carbaniIsäure-[3-(2-propinyloxy- 3 - lö 9 10 10 0
carbonylamino)-phenyl]-ester
N-OZ-ChloräthyO-carbanilsäure-P-ipropinyloxy- 3 - 10 9 10 10 0
carbonylamino)-phenyl]-sster
N^BromäthyO-I-methylcarbanilsäure-ß-irnethoxy- 3 10 8 10 10 10 0
carbonylamino)-phenyl]-ester
N-CZ-BromäthyO^-methylcarbanilsäure-^-iäthoxy- 3 10 8 10 10 10 0
carbonylamino)-phenyl]-ester
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3 | 0 | 3 |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 5 | 4 | - |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 | 0 | 3 | 0 | 0 |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 | 0 | 3 | 0 | 3 |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3 | 2 | 4 |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | - | 5 | 1 |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | - | 2 | 2 |
| 0 | 0 | 0 | 0 | 0 | 0 | 0 | - | 0 | - | 3 | 0 |
| 0 | 0 | 0 | 0 | 0 | 4 | 0 | 3 | 0 | 2 | 4 | 0 |
| 2 | 0 | 0 | 0 | 0 | C | 0 | 0 | 0 | 3 | - | 0 |
| - | 0 | 0 | 0 | 0 | C | 0 | - | 0 | 5 | - | 2 |
| _ | 0 | 0 | 0 | 0 | C' | 0 | 0 | _ | _ | 4 |
Fortsetzung
ι ι i I ι ι ι _| δ ι a ι ι β ι ι ι ι
Erfindungsgemäße Verbindungen
N-(2-Bromathyl)-3-chlorcarbanilsäure-[3-(l-methyl- 3 10 9 10 IO 10 00000020
äthoxycarbonylamino)-phenyl]-ester
Vergleichsmittel
S-Methoxycarbonylaminophenyl-N-P-methylphenyl)- 3 8--- 800000000
carbamat
2,4-Üichlor-phenoxyessigsäure 3 81088-00000000
- totale Vernichtung.
- keim; Schädigung.
- keim; Schädigung.
Claims (1)
1. Diurethane der allgemeinen Formel R1
R2
ίο I^ /-NH-CO-X-R3
in der
Priority Applications (20)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752557552 DE2557552C2 (de) | 1975-12-18 | 1975-12-18 | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe |
| ES451210A ES451210A1 (es) | 1975-12-18 | 1976-09-03 | Procedimiento para la preparacion de diuretanos con efecto herbicida. |
| CS605376A CS189033B2 (en) | 1975-12-18 | 1976-09-17 | Herbicide means and method of making the active substance |
| BR7606269A BR7606269A (pt) | 1975-12-18 | 1976-09-21 | Diuretanas,composicoes herbicidas contendo estes compostos e processo para preparacao destes compostos |
| DK457776A DK457776A (da) | 1975-12-18 | 1976-10-12 | Diurethaner fremgangsmade til fremstilling af disse forbindelser samt herbicide midler indeholdende dem |
| LU76039A LU76039A1 (de) | 1975-12-18 | 1976-10-20 | |
| DD19570376A DD126945A5 (de) | 1975-12-18 | 1976-11-10 | |
| IL50979A IL50979A (en) | 1975-12-18 | 1976-11-24 | Carbamoyloxy phenyl carbamates,process for the preparation thereof and herbicidal compositions containing them |
| SU762427098A SU691084A3 (ru) | 1975-12-18 | 1976-12-08 | Способ получени диуретанов |
| SU762427160A SU604457A3 (ru) | 1975-12-18 | 1976-12-13 | Гербицидное средство |
| GB51914/76A GB1572542A (en) | 1975-12-18 | 1976-12-13 | Herbicidally active diurethanes process for their manufacture and their use |
| IE273776A IE44673B1 (en) | 1975-12-18 | 1976-12-15 | Herbicidally active diurethanes,process for their manufacture and their use |
| BE173413A BE849571A (fr) | 1975-12-18 | 1976-12-17 | Diurethannes, leur procede de preparation et leur utilisation |
| NL7614034A NL7614034A (nl) | 1975-12-18 | 1976-12-17 | Diurethanen, werkwijze voor het bereiden van deze verbindingen, alsmede op deze verbindingen gebaseerde herbicide middelen. |
| JP15187276A JPS5277033A (en) | 1975-12-18 | 1976-12-17 | Diurethane* process for manufacture thereof and herbicide containing it |
| ZA767508A ZA767508B (en) | 1975-12-18 | 1976-12-17 | Herbicidally active diurethanes process for their manufacture and their use |
| AU20670/76A AU507844B2 (en) | 1975-12-18 | 1976-12-17 | Herbicidally active diurathanes process for their manufacture and their use |
| IT3052776A IT1065794B (it) | 1975-12-18 | 1976-12-17 | Diuretani,processo per preparare questi composti e erbicidi che li contengono |
| FR7638305A FR2335496A1 (fr) | 1975-12-18 | 1976-12-20 | Bis-urethannes et produits herbicides qui en renferment |
| US05/936,477 US4202684A (en) | 1975-12-18 | 1978-08-24 | Carbanilic acid esters, process for making the same and herbicidal compositions containing same |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752557552 DE2557552C2 (de) | 1975-12-18 | 1975-12-18 | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2557552A1 DE2557552A1 (de) | 1977-06-30 |
| DE2557552C2 true DE2557552C2 (de) | 1984-12-20 |
Family
ID=5964983
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752557552 Expired DE2557552C2 (de) | 1975-12-18 | 1975-12-18 | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe |
Country Status (18)
| Country | Link |
|---|---|
| JP (1) | JPS5277033A (de) |
| AU (1) | AU507844B2 (de) |
| BE (1) | BE849571A (de) |
| BR (1) | BR7606269A (de) |
| CS (1) | CS189033B2 (de) |
| DD (1) | DD126945A5 (de) |
| DE (1) | DE2557552C2 (de) |
| DK (1) | DK457776A (de) |
| ES (1) | ES451210A1 (de) |
| FR (1) | FR2335496A1 (de) |
| GB (1) | GB1572542A (de) |
| IE (1) | IE44673B1 (de) |
| IL (1) | IL50979A (de) |
| IT (1) | IT1065794B (de) |
| LU (1) | LU76039A1 (de) |
| NL (1) | NL7614034A (de) |
| SU (2) | SU691084A3 (de) |
| ZA (1) | ZA767508B (de) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2650796A1 (de) * | 1976-11-03 | 1978-05-11 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes selektives herbizides mittel |
| DE2819748C2 (de) * | 1978-05-02 | 1986-07-31 | Schering AG, 1000 Berlin und 4709 Bergkamen | N-Äthylcarbanilsäure-(3-methoxycarbonylamino)-phenylester, Verfahren zur Herstellung dieser Verbindung sowie diese enthaltendes selektives herbizides Mittel |
| DE2901658A1 (de) * | 1979-01-15 | 1980-07-24 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| DE2913975A1 (de) * | 1979-04-05 | 1980-10-23 | Schering Ag | N-(2-propinyl)-carbanilsaeure-(3-alkoxy- und alkylthiocarbonylamino-phenyl)-ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel |
| CN103191552A (zh) * | 2013-02-12 | 2013-07-10 | 陇东学院 | 网球球拍 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3404975A (en) * | 1964-12-18 | 1968-10-08 | Fmc Corp | m-(carbamoyloxy)-carbanilates as herbicides |
| DE2310648C3 (de) * | 1973-03-01 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel |
| DE2413933A1 (de) * | 1974-03-20 | 1975-09-25 | Schering Ag | Diurethane mit selektiver herbizider wirkung |
-
1975
- 1975-12-18 DE DE19752557552 patent/DE2557552C2/de not_active Expired
-
1976
- 1976-09-03 ES ES451210A patent/ES451210A1/es not_active Expired
- 1976-09-17 CS CS605376A patent/CS189033B2/cs unknown
- 1976-09-21 BR BR7606269A patent/BR7606269A/pt unknown
- 1976-10-12 DK DK457776A patent/DK457776A/da not_active Application Discontinuation
- 1976-10-20 LU LU76039A patent/LU76039A1/xx unknown
- 1976-11-10 DD DD19570376A patent/DD126945A5/xx unknown
- 1976-11-24 IL IL50979A patent/IL50979A/xx unknown
- 1976-12-08 SU SU762427098A patent/SU691084A3/ru active
- 1976-12-13 SU SU762427160A patent/SU604457A3/ru active
- 1976-12-13 GB GB51914/76A patent/GB1572542A/en not_active Expired
- 1976-12-15 IE IE273776A patent/IE44673B1/en unknown
- 1976-12-17 JP JP15187276A patent/JPS5277033A/ja active Granted
- 1976-12-17 IT IT3052776A patent/IT1065794B/it active
- 1976-12-17 BE BE173413A patent/BE849571A/xx not_active IP Right Cessation
- 1976-12-17 NL NL7614034A patent/NL7614034A/xx not_active Application Discontinuation
- 1976-12-17 AU AU20670/76A patent/AU507844B2/en not_active Expired
- 1976-12-17 ZA ZA767508A patent/ZA767508B/xx unknown
- 1976-12-20 FR FR7638305A patent/FR2335496A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| BR7606269A (pt) | 1978-04-04 |
| DE2557552A1 (de) | 1977-06-30 |
| IE44673L (en) | 1977-06-18 |
| NL7614034A (nl) | 1977-06-21 |
| FR2335496B1 (de) | 1982-05-21 |
| JPS5277033A (en) | 1977-06-29 |
| IL50979A0 (en) | 1977-01-31 |
| CS189033B2 (en) | 1979-03-30 |
| DD126945A5 (de) | 1977-08-24 |
| AU2067076A (en) | 1978-06-22 |
| BE849571A (fr) | 1977-06-17 |
| GB1572542A (en) | 1980-07-30 |
| ES451210A1 (es) | 1977-09-16 |
| IE44673B1 (en) | 1982-02-24 |
| IL50979A (en) | 1981-05-20 |
| ZA767508B (en) | 1977-11-30 |
| AU507844B2 (en) | 1980-02-28 |
| SU691084A3 (ru) | 1979-10-05 |
| JPS5639308B2 (de) | 1981-09-11 |
| IT1065794B (it) | 1985-03-04 |
| FR2335496A1 (fr) | 1977-07-15 |
| SU604457A3 (ru) | 1978-04-25 |
| DK457776A (da) | 1977-06-19 |
| LU76039A1 (de) | 1977-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2530439A1 (de) | Neue bis-(0-1-alkylthio-aethylimino) -n-methylcarbaminsaeure)-n,n'-sulfide, verfahren zu ihrer herstellung und schaedlingsbekaempfungsmittel | |
| DE1518815C3 (de) | m-(UreidophenyI)-carbaminsäureester, deren Herstellung und diese enthaltende herbizide Mittel | |
| DE2254200A1 (de) | Tetrahydro-1.3.5-triazin-2.6-dione, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE2557552C2 (de) | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe | |
| DE2108975C3 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| DE2206011A1 (de) | 1-acyl-3-aminosulfonyl-2-imino-benzimidazoline, verfahren zu ihrer herstellung und ihre fungizide verwendung | |
| DE2928410A1 (de) | Acylharnstoffe, insektizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung | |
| DE2341079C2 (de) | m-Diurethane und selektive herbizide Mittel enthaltend diese Verbindungen als Wirkstoffe | |
| DE2045907C3 (de) | Biscarbamate und Herbizide, die sie als Wirkstoff enthalten | |
| DE2121957C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| DE2344134A1 (de) | Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1142599B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE2310648C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel | |
| DE2210540A1 (de) | Cyanphenylcarbonate | |
| DE2310649C3 (de) | Diurethane sowie diese enthaltende selektive herbizide Mittel | |
| DD201969A5 (de) | Fungizide mittel | |
| DE2320362A1 (de) | Dichlorthiazolylharnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE2819748C2 (de) | N-Äthylcarbanilsäure-(3-methoxycarbonylamino)-phenylester, Verfahren zur Herstellung dieser Verbindung sowie diese enthaltendes selektives herbizides Mittel | |
| DE2445529A1 (de) | Alkoxycarbonylphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| CH645344A5 (de) | N-(2-propinyl)-carbanilsaeure-(3-methoxycarbonylaminophenyl)-ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel. | |
| EP0007066A1 (de) | 4-Alkyl- und 4-Allyl-merkapto-, sulfinyl- und sulfonyl-methyl-2-amino-6-N,N'-dimethylcarbamoyloxy-pyrimidine, Verfahren zu ihrer Herstellung, Mittel welche diese Pyrimidine enthalten und deren Verwendung zur Bekämpfung von Insekten | |
| DE1543604C3 (de) | ||
| AT230896B (de) | Verfahren zur Herstellung von neuen Carbaminsäureestern | |
| DE1542853C3 (de) | Substituierte p-Cyanophenylcarbamate und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE2059309A1 (de) | Selektives herbizides Mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |