DE2530577C2 - - Google Patents
Info
- Publication number
- DE2530577C2 DE2530577C2 DE2530577A DE2530577A DE2530577C2 DE 2530577 C2 DE2530577 C2 DE 2530577C2 DE 2530577 A DE2530577 A DE 2530577A DE 2530577 A DE2530577 A DE 2530577A DE 2530577 C2 DE2530577 C2 DE 2530577C2
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- compounds
- formula
- alkyl
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052757 nitrogen Chemical group 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000001589 carboacyl group Chemical group 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000004385 trihaloalkyl group Chemical group 0.000 claims description 3
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 4
- -1 alkoxy radical Chemical class 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 102000003946 Prolactin Human genes 0.000 description 3
- 108010057464 Prolactin Proteins 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000003291 dopaminomimetic effect Effects 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- JKAHWGPTNVUTNB-IXPVHAAZSA-N lergotrile Chemical compound C1=CC([C@H]2C[C@@H](CC#N)CN([C@@H]2C2)C)=C3C2=C(Cl)NC3=C1 JKAHWGPTNVUTNB-IXPVHAAZSA-N 0.000 description 3
- 229950007886 lergotrile Drugs 0.000 description 3
- 229940097325 prolactin Drugs 0.000 description 3
- 230000028327 secretion Effects 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000007850 degeneration Effects 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PGZVFRAEAAXREB-UHFFFAOYSA-N 2,2-dimethylpropanoyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC(=O)C(C)(C)C PGZVFRAEAAXREB-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 208000001287 Galactorrhea Diseases 0.000 description 1
- 206010017600 Galactorrhoea Diseases 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 229940052760 dopamine agonists Drugs 0.000 description 1
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- RHGUXDUPXYFCTE-ZWNOBZJWSA-N ergoline Chemical class C1=CC([C@@H]2[C@H](NCCC2)C2)=C3C2=CNC3=C1 RHGUXDUPXYFCTE-ZWNOBZJWSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000035558 fertility Effects 0.000 description 1
- 150000002221 fluorine Chemical class 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000006651 lactation Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- DIVDFFZHCJEHGG-UHFFFAOYSA-N oxidopamine Chemical compound NCCC1=CC(O)=C(O)C=C1O DIVDFFZHCJEHGG-UHFFFAOYSA-N 0.000 description 1
- CFHIDWOYWUOIHU-UHFFFAOYSA-N oxomethyl Chemical compound O=[CH] CFHIDWOYWUOIHU-UHFFFAOYSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 210000003523 substantia nigra Anatomy 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH998374A CH605936A5 (en) | 1974-07-19 | 1974-07-19 | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs |
| CH1103174A CH605938A5 (en) | 1974-08-13 | 1974-08-13 | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2530577A1 DE2530577A1 (de) | 1976-01-29 |
| DE2530577C2 true DE2530577C2 (enExample) | 1990-11-08 |
Family
ID=25705648
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752530577 Granted DE2530577A1 (de) | 1974-07-19 | 1975-07-09 | Neue organische verbindungen, ihre herstellung und verwendung |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5134199A (enExample) |
| AU (1) | AU505314B2 (enExample) |
| CA (1) | CA1073452A (enExample) |
| DD (1) | DD118635A5 (enExample) |
| DE (1) | DE2530577A1 (enExample) |
| DK (2) | DK143902C (enExample) |
| ES (1) | ES439548A1 (enExample) |
| FI (1) | FI61188C (enExample) |
| FR (1) | FR2282889A1 (enExample) |
| GB (3) | GB1517971A (enExample) |
| HK (2) | HK56980A (enExample) |
| IE (1) | IE41426B1 (enExample) |
| IL (1) | IL47735A (enExample) |
| MY (2) | MY8100217A (enExample) |
| NL (1) | NL7508416A (enExample) |
| NO (1) | NO752493L (enExample) |
| PH (1) | PH16594A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1573621A (en) * | 1976-01-02 | 1980-08-28 | Sandoz Ltd | Acylated 6-methyl-8a-amino-ergoline i compounds |
| DE2656344A1 (de) * | 1975-12-23 | 1977-07-07 | Sandoz Ag | Ergolinderivate, ihre verwendung und herstellung |
| IT1064473B (it) * | 1976-11-24 | 1985-02-18 | Simes | Sulfamoil derivati dell'8-beta-amminometilergolina |
| BE889713A (fr) * | 1980-07-25 | 1982-01-25 | Sandoz Sa | Nouveaux derives de l'ergoline, leur preparation et leur application comme medicaments |
| CH654838A5 (fr) * | 1980-07-25 | 1986-03-14 | Sandoz Ag | Ergolinderivate, verfahren zu deren herstellung, diese enthaltende pharmazeutische zusammensetzungen. |
| CH644606A5 (de) * | 1980-09-23 | 1984-08-15 | Sandoz Ag | Verfahren zur isomerisierung von 9,10-dihydrolysergsaeurederivaten. |
| DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| JPS58174081A (ja) * | 1982-04-05 | 1983-10-13 | Mitsubishi Heavy Ind Ltd | 船内機関室通風装置 |
| HU197569B (en) * | 1984-01-12 | 1989-04-28 | Sandoz Ag | Process for producing 8alpha-acylaminoergoline derivatives and pharmaceuticals comprising such compounds |
| HU195810B (en) * | 1984-12-24 | 1988-07-28 | Sandoz Ag | Process for preparing new 8alpha-acyl-amino-ergoline derivatives and pharmaceutical compositions containing such compounds |
| HUT45248A (en) * | 1986-01-24 | 1988-06-28 | Sandoz Ag | Process for producing 8alpha-(acylamino)-ergoline derivatives and pharmaceuticals comprising such compounds |
| AT392945B (de) * | 1988-06-27 | 1991-07-10 | Gerhard Mader Ges M B H Ing | Lager- und transportbehaelter fuer schuettgueter und lose materialien |
| DE4033496A1 (de) * | 1990-10-20 | 1992-04-23 | Sandoz Ag | Neue ergolinderivate, ihre herstellung und verwendung |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3218323A (en) * | 1965-11-16 | Esters of i,g-dimethyl-b-ergolenyl carbamic acid | ||
| FR1360618A (fr) * | 1963-06-17 | 1964-05-08 | Sandoz Sa | Nouveaux uréthanes de la série lysergique et leur préparation |
| CH507248A (de) * | 1967-03-16 | 1971-05-15 | Spofa Vereinigte Pharma Werke | Verfahren zur Herstellung von D-6-Methylergolin(I)ylessigsäure |
| NL6818658A (enExample) * | 1968-01-18 | 1969-07-22 | ||
| AR206772A1 (es) * | 1972-07-21 | 1976-08-23 | Lilly Co Eli | Procedimiento para preparar una nueva d-2-halo-6-metil-8-ciano(carboxamido)metil ergolina |
-
1975
- 1975-07-04 GB GB28238/75A patent/GB1517971A/en not_active Expired
- 1975-07-04 GB GB4649/78A patent/GB1517973A/en not_active Expired
- 1975-07-04 GB GB4648/78A patent/GB1517972A/en not_active Expired
- 1975-07-09 DE DE19752530577 patent/DE2530577A1/de active Granted
- 1975-07-10 FI FI752011A patent/FI61188C/fi not_active IP Right Cessation
- 1975-07-11 NO NO752493A patent/NO752493L/no unknown
- 1975-07-12 DK DK313175A patent/DK143902C/da not_active IP Right Cessation
- 1975-07-15 NL NL7508416A patent/NL7508416A/xx not_active Application Discontinuation
- 1975-07-16 DD DD187329A patent/DD118635A5/xx unknown
- 1975-07-17 AU AU83162/75A patent/AU505314B2/en not_active Expired
- 1975-07-17 IE IE1596/75A patent/IE41426B1/en unknown
- 1975-07-17 PH PH17392A patent/PH16594A/en unknown
- 1975-07-17 ES ES439548A patent/ES439548A1/es not_active Expired
- 1975-07-18 JP JP50087425A patent/JPS5134199A/ja active Pending
- 1975-07-18 IL IL47735A patent/IL47735A/xx unknown
- 1975-07-18 CA CA231,773A patent/CA1073452A/en not_active Expired
- 1975-07-18 FR FR7522484A patent/FR2282889A1/fr active Granted
-
1980
- 1980-07-10 DK DK298980A patent/DK145542C/da not_active IP Right Cessation
- 1980-10-09 HK HK569/80A patent/HK56980A/xx unknown
- 1980-10-09 HK HK568/80A patent/HK56880A/xx unknown
-
1981
- 1981-12-30 MY MY217/81A patent/MY8100217A/xx unknown
- 1981-12-30 MY MY215/81A patent/MY8100215A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK298980A (da) | 1980-07-10 |
| GB1517971A (en) | 1978-07-19 |
| AU8316275A (en) | 1977-01-20 |
| GB1517973A (en) | 1978-07-19 |
| DK145542B (da) | 1982-12-06 |
| ES439548A1 (es) | 1977-06-16 |
| HK56880A (en) | 1980-10-16 |
| FR2282889A1 (fr) | 1976-03-26 |
| DK143902C (da) | 1982-04-13 |
| JPS5134199A (enExample) | 1976-03-23 |
| AU505314B2 (en) | 1979-11-15 |
| FR2282889B1 (enExample) | 1979-08-10 |
| NO752493L (enExample) | 1976-01-20 |
| DE2530577A1 (de) | 1976-01-29 |
| DD118635A5 (enExample) | 1976-03-12 |
| DK145542C (da) | 1983-05-02 |
| IL47735A (en) | 1979-11-30 |
| IE41426L (en) | 1976-01-19 |
| MY8100215A (en) | 1981-12-31 |
| DK143902B (da) | 1981-10-26 |
| FI61188C (fi) | 1982-06-10 |
| PH16594A (en) | 1983-11-22 |
| FI752011A7 (enExample) | 1976-01-20 |
| IL47735A0 (en) | 1975-10-15 |
| DK313175A (da) | 1976-01-20 |
| FI61188B (fi) | 1982-02-26 |
| IE41426B1 (en) | 1980-01-02 |
| GB1517972A (en) | 1978-07-19 |
| CA1073452A (en) | 1980-03-11 |
| NL7508416A (nl) | 1976-01-21 |
| HK56980A (en) | 1980-10-16 |
| MY8100217A (en) | 1981-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2656344C2 (enExample) | ||
| DE2530577C2 (enExample) | ||
| DE2705025A1 (de) | Xanthinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| EP0528922B1 (de) | Neue sulfonylverbindungen | |
| DE2524575A1 (de) | 8-thiomethylergoline | |
| DE68925270T2 (de) | Pyrrolo[3,2-e]pyrazolo[1,5-a]pyrimidinderivate und diese enthaltende Arzneimittel | |
| EP0387821A2 (de) | 2-Alkyl-4-arylmethylaminochinoline, ihre Verwendung und daraus hergestellte Arzneimittel | |
| DE69718968T2 (de) | 3-(bis-substituierte-phenylmethylen)oxindol-derivate | |
| DE69021355T2 (de) | Pyridon-Derivate, Herstellungsprozess, neu erhaltene Zwischenprodukte und ihre Verwendung als Arzneimittel sowie Arzneimittelzusammensetzungen, die diese enthalten. | |
| CH615929A5 (en) | Process for the preparation of novel ergoline compounds | |
| DE2802023A1 (de) | Neue ergotderivate, ihre herstellung und verwendung | |
| CH622518A5 (en) | Process for the preparation of novel ergoline compounds | |
| DE2554000A1 (de) | 6-methyl-8-(substituierte)methylergoline | |
| DE2454619A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE2633839A1 (de) | Neue 4-aminopropoxyindolderivate, ihre herstellung und verwendung | |
| AT376221B (de) | Verfahren zur herstellung neuer ergolinderivate | |
| DD253616A5 (de) | Verfahren zur herstellung von neuen pleunromutilinderivaten | |
| DE2751071A1 (de) | Sulfamoyl-derivate des 8-beta-aminomethylergolins | |
| DE2520131A1 (de) | Stickstoffhaltige polycyclische verbindungen und verfahren zu deren herstellung | |
| AT258479B (de) | Verfahren zur Herstellung von neuen Verbindungen aus der Klasse des D-6-Methyl- (und -1,6-Dimethyl)-8-amino-methyl-ergolins I | |
| CH615181A5 (en) | Process for the preparation of novel ergolene derivatives | |
| AT246339B (de) | Verfahren zur Herstellung von neuen p-Alkylbenzyltropiniumderivaten | |
| CH654838A5 (fr) | Ergolinderivate, verfahren zu deren herstellung, diese enthaltende pharmazeutische zusammensetzungen. | |
| DE2754028A1 (de) | Ergolin-derivate, verfahren zu ihrer herstellung und arzneimittel | |
| DE2257750A1 (de) | Isoxazolinonderivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |