FI61188C - Foerfarande foer framstaellning av 8alfa-syanometylergolin-i-foereningar med dopaminergisk och prolaktinsekretionshaemmande verkan - Google Patents
Foerfarande foer framstaellning av 8alfa-syanometylergolin-i-foereningar med dopaminergisk och prolaktinsekretionshaemmande verkan Download PDFInfo
- Publication number
- FI61188C FI61188C FI752011A FI752011A FI61188C FI 61188 C FI61188 C FI 61188C FI 752011 A FI752011 A FI 752011A FI 752011 A FI752011 A FI 752011A FI 61188 C FI61188 C FI 61188C
- Authority
- FI
- Finland
- Prior art keywords
- compounds
- formula
- preparation
- cyanomethylgolin
- 8alfa
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 5
- 229940126601 medicinal product Drugs 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 45
- 230000003291 dopaminomimetic effect Effects 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 102000003946 Prolactin Human genes 0.000 claims description 9
- 108010057464 Prolactin Proteins 0.000 claims description 9
- 229940097325 prolactin Drugs 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 230000002401 inhibitory effect Effects 0.000 claims description 6
- 239000000460 chlorine Chemical group 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 241000700159 Rattus Species 0.000 description 8
- 230000028327 secretion Effects 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000010171 animal model Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- -1 chlorine or bromine Chemical class 0.000 description 3
- 230000004720 fertilization Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 230000003285 pharmacodynamic effect Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 206010017600 Galactorrhoea Diseases 0.000 description 2
- 208000018737 Parkinson disease Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000006651 lactation Effects 0.000 description 2
- 230000003902 lesion Effects 0.000 description 2
- 125000005905 mesyloxy group Chemical group 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LBMFWYCMCHRLBU-DJSGYFEHSA-N 2-[(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]acetonitrile Chemical compound C1=CC([C@H]2C[C@@H](CC#N)CN([C@@H]2C2)C)=C3C2=CNC3=C1 LBMFWYCMCHRLBU-DJSGYFEHSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 208000001287 Galactorrhea Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- LPMRLAHSKOBNRK-SKNXHYNKSA-N [(6ar,10ar)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-yl]methyl methanesulfonate Chemical compound C1=CC([C@@H]2[C@H](NCC(C2)COS(=O)(=O)C)C2)=C3C2=CNC3=C1 LPMRLAHSKOBNRK-SKNXHYNKSA-N 0.000 description 1
- BCVPRQUMTMMZES-DJSGYFEHSA-N [(6ar,9r,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methyl methanesulfonate Chemical compound C1=CC([C@H]2C[C@@H](COS(C)(=O)=O)CN([C@@H]2C2)C)=C3C2=CNC3=C1 BCVPRQUMTMMZES-DJSGYFEHSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 208000013404 behavioral symptom Diseases 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000009610 hypersensitivity Effects 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- LLCOIQRNSJBFSN-UHFFFAOYSA-N methane;sulfurochloridic acid Chemical compound C.OS(Cl)(=O)=O LLCOIQRNSJBFSN-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- DIVDFFZHCJEHGG-UHFFFAOYSA-N oxidopamine Chemical compound NCCC1=CC(O)=C(O)C=C1O DIVDFFZHCJEHGG-UHFFFAOYSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 210000001215 vagina Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI803192A FI62537C (fi) | 1974-07-19 | 1980-10-08 | Foerfarande foer framstaellning av 8alfa-ergolin-i-foereningarmed dopaminergisk och prolaktinsekretionshaemmande verkan |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH998374 | 1974-07-19 | ||
| CH998374A CH605936A5 (en) | 1974-07-19 | 1974-07-19 | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs |
| CH1103174A CH605938A5 (en) | 1974-08-13 | 1974-08-13 | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs |
| CH1103174 | 1974-08-13 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI752011A7 FI752011A7 (enExample) | 1976-01-20 |
| FI61188B FI61188B (fi) | 1982-02-26 |
| FI61188C true FI61188C (fi) | 1982-06-10 |
Family
ID=25705648
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI752011A FI61188C (fi) | 1974-07-19 | 1975-07-10 | Foerfarande foer framstaellning av 8alfa-syanometylergolin-i-foereningar med dopaminergisk och prolaktinsekretionshaemmande verkan |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5134199A (enExample) |
| AU (1) | AU505314B2 (enExample) |
| CA (1) | CA1073452A (enExample) |
| DD (1) | DD118635A5 (enExample) |
| DE (1) | DE2530577A1 (enExample) |
| DK (2) | DK143902C (enExample) |
| ES (1) | ES439548A1 (enExample) |
| FI (1) | FI61188C (enExample) |
| FR (1) | FR2282889A1 (enExample) |
| GB (3) | GB1517972A (enExample) |
| HK (2) | HK56880A (enExample) |
| IE (1) | IE41426B1 (enExample) |
| IL (1) | IL47735A (enExample) |
| MY (2) | MY8100217A (enExample) |
| NL (1) | NL7508416A (enExample) |
| NO (1) | NO752493L (enExample) |
| PH (1) | PH16594A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1573621A (en) * | 1976-01-02 | 1980-08-28 | Sandoz Ltd | Acylated 6-methyl-8a-amino-ergoline i compounds |
| DE2656344A1 (de) * | 1975-12-23 | 1977-07-07 | Sandoz Ag | Ergolinderivate, ihre verwendung und herstellung |
| IT1064473B (it) * | 1976-11-24 | 1985-02-18 | Simes | Sulfamoil derivati dell'8-beta-amminometilergolina |
| BE889713A (fr) * | 1980-07-25 | 1982-01-25 | Sandoz Sa | Nouveaux derives de l'ergoline, leur preparation et leur application comme medicaments |
| CH654838A5 (fr) * | 1980-07-25 | 1986-03-14 | Sandoz Ag | Ergolinderivate, verfahren zu deren herstellung, diese enthaltende pharmazeutische zusammensetzungen. |
| CH644606A5 (de) * | 1980-09-23 | 1984-08-15 | Sandoz Ag | Verfahren zur isomerisierung von 9,10-dihydrolysergsaeurederivaten. |
| DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| JPS58174081A (ja) * | 1982-04-05 | 1983-10-13 | Mitsubishi Heavy Ind Ltd | 船内機関室通風装置 |
| HU197569B (en) * | 1984-01-12 | 1989-04-28 | Sandoz Ag | Process for producing 8alpha-acylaminoergoline derivatives and pharmaceuticals comprising such compounds |
| CH666035A5 (de) * | 1984-12-24 | 1988-06-30 | Sandoz Ag | 8-alpha-acylaminoergolene. |
| HUT45248A (en) * | 1986-01-24 | 1988-06-28 | Sandoz Ag | Process for producing 8alpha-(acylamino)-ergoline derivatives and pharmaceuticals comprising such compounds |
| AT392945B (de) * | 1988-06-27 | 1991-07-10 | Gerhard Mader Ges M B H Ing | Lager- und transportbehaelter fuer schuettgueter und lose materialien |
| DE4033496A1 (de) * | 1990-10-20 | 1992-04-23 | Sandoz Ag | Neue ergolinderivate, ihre herstellung und verwendung |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3218323A (en) * | 1965-11-16 | Esters of i,g-dimethyl-b-ergolenyl carbamic acid | ||
| FR1360618A (fr) * | 1963-06-17 | 1964-05-08 | Sandoz Sa | Nouveaux uréthanes de la série lysergique et leur préparation |
| CH507248A (de) * | 1967-03-16 | 1971-05-15 | Spofa Vereinigte Pharma Werke | Verfahren zur Herstellung von D-6-Methylergolin(I)ylessigsäure |
| NL6818658A (enExample) * | 1968-01-18 | 1969-07-22 | ||
| AR206772A1 (es) * | 1972-07-21 | 1976-08-23 | Lilly Co Eli | Procedimiento para preparar una nueva d-2-halo-6-metil-8-ciano(carboxamido)metil ergolina |
-
1975
- 1975-07-04 GB GB4648/78A patent/GB1517972A/en not_active Expired
- 1975-07-04 GB GB4649/78A patent/GB1517973A/en not_active Expired
- 1975-07-04 GB GB28238/75A patent/GB1517971A/en not_active Expired
- 1975-07-09 DE DE19752530577 patent/DE2530577A1/de active Granted
- 1975-07-10 FI FI752011A patent/FI61188C/fi not_active IP Right Cessation
- 1975-07-11 NO NO752493A patent/NO752493L/no unknown
- 1975-07-12 DK DK313175A patent/DK143902C/da not_active IP Right Cessation
- 1975-07-15 NL NL7508416A patent/NL7508416A/xx not_active Application Discontinuation
- 1975-07-16 DD DD187329A patent/DD118635A5/xx unknown
- 1975-07-17 AU AU83162/75A patent/AU505314B2/en not_active Expired
- 1975-07-17 PH PH17392A patent/PH16594A/en unknown
- 1975-07-17 IE IE1596/75A patent/IE41426B1/en unknown
- 1975-07-17 ES ES439548A patent/ES439548A1/es not_active Expired
- 1975-07-18 JP JP50087425A patent/JPS5134199A/ja active Pending
- 1975-07-18 CA CA231,773A patent/CA1073452A/en not_active Expired
- 1975-07-18 FR FR7522484A patent/FR2282889A1/fr active Granted
- 1975-07-18 IL IL47735A patent/IL47735A/xx unknown
-
1980
- 1980-07-10 DK DK298980A patent/DK145542C/da not_active IP Right Cessation
- 1980-10-09 HK HK568/80A patent/HK56880A/xx unknown
- 1980-10-09 HK HK569/80A patent/HK56980A/xx unknown
-
1981
- 1981-12-30 MY MY217/81A patent/MY8100217A/xx unknown
- 1981-12-30 MY MY215/81A patent/MY8100215A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL47735A0 (en) | 1975-10-15 |
| DK313175A (da) | 1976-01-20 |
| GB1517971A (en) | 1978-07-19 |
| HK56980A (en) | 1980-10-16 |
| DK298980A (da) | 1980-07-10 |
| AU505314B2 (en) | 1979-11-15 |
| DK143902C (da) | 1982-04-13 |
| FI61188B (fi) | 1982-02-26 |
| PH16594A (en) | 1983-11-22 |
| CA1073452A (en) | 1980-03-11 |
| MY8100217A (en) | 1981-12-31 |
| MY8100215A (en) | 1981-12-31 |
| FR2282889A1 (fr) | 1976-03-26 |
| IL47735A (en) | 1979-11-30 |
| HK56880A (en) | 1980-10-16 |
| DK145542C (da) | 1983-05-02 |
| DE2530577A1 (de) | 1976-01-29 |
| DE2530577C2 (enExample) | 1990-11-08 |
| DK145542B (da) | 1982-12-06 |
| GB1517972A (en) | 1978-07-19 |
| FI752011A7 (enExample) | 1976-01-20 |
| DD118635A5 (enExample) | 1976-03-12 |
| AU8316275A (en) | 1977-01-20 |
| ES439548A1 (es) | 1977-06-16 |
| IE41426B1 (en) | 1980-01-02 |
| GB1517973A (en) | 1978-07-19 |
| NO752493L (enExample) | 1976-01-20 |
| JPS5134199A (enExample) | 1976-03-23 |
| FR2282889B1 (enExample) | 1979-08-10 |
| NL7508416A (nl) | 1976-01-21 |
| IE41426L (en) | 1976-01-19 |
| DK143902B (da) | 1981-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI61188C (fi) | Foerfarande foer framstaellning av 8alfa-syanometylergolin-i-foereningar med dopaminergisk och prolaktinsekretionshaemmande verkan | |
| JP2716146B2 (ja) | 縮合インドール誘導体およびその製造方法 | |
| JP5222348B2 (ja) | 新規のエリスロマイシン誘導体、それらの製造方法及びそれらの薬剤としての使用 | |
| EP0492485A1 (en) | N-Acyl-2,3-benzodiazepine derivatives, pharmaceutical compositions containing them and process for preparing same | |
| JPS6133031B2 (enExample) | ||
| EP0579681B1 (en) | Crystalline tiagabine hydrochloride monohydrate, its preparation and use | |
| JPS58150593A (ja) | 8―エルゴリニルチオ尿素誘導体及びその製法 | |
| CN119119016B (zh) | 取代噁二唑类化合物其制备方法和用途 | |
| CA3094167A1 (en) | Crystalline forms and methods of producing crystalline forms of a compound | |
| EA009413B1 (ru) | Полиморфные формы габоксадола, агониста gaba | |
| NL193541C (nl) | 8 Alfa-acylaminoergolinen, werkwijzen voor de bereiding daarvan en preparaten die ze bevatten. | |
| US3901891A (en) | 13-bromolysergic acid compounds | |
| NO883263L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive benzimidazol-derivater. | |
| EP0240986B1 (en) | D-nor-7-ergoline derivatives, process for preparing them, pharmaceutical composition and use | |
| EP1858844A1 (en) | Novel crystalline forms of antidiabetic compounds | |
| FI71736B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara erolinderivat och deras syraadditionssalter | |
| CH666035A5 (de) | 8-alpha-acylaminoergolene. | |
| US3592816A (en) | N-substituted piperazides of lysergic acid | |
| US4076715A (en) | 13-Bromo lysergic acid compounds | |
| JPH0513955B2 (enExample) | ||
| IE58497B1 (en) | New process for the preparation of derivatives of 4h-1, 2,4-triazole, the new triazoles so obtained, their use as medicaments and the pharmaceutical compositions containing them | |
| FI83869B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara ergolinderivat. | |
| DK146129B (da) | Analogifremgangsmaade til fremstilling af ergopeptidalkaloidderivater | |
| FI62537B (fi) | Foerfarande foer framstaellning av 8alfa-ergolin-i-foereningarmed dopaminergisk och prolaktinsekretionshaemmande verkan | |
| EP0333073A2 (en) | N-cycloalkylaminoethylbenzamide derivatives, their synthesis and pharmaceutical preparations |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: SANDOZ AG |