DE2503815C2 - Indazol-Derivate, Verfahren zu ihrer Herstellung und Arzneimittel - Google Patents
Indazol-Derivate, Verfahren zu ihrer Herstellung und ArzneimittelInfo
- Publication number
- DE2503815C2 DE2503815C2 DE2503815A DE2503815A DE2503815C2 DE 2503815 C2 DE2503815 C2 DE 2503815C2 DE 2503815 A DE2503815 A DE 2503815A DE 2503815 A DE2503815 A DE 2503815A DE 2503815 C2 DE2503815 C2 DE 2503815C2
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- general formula
- hydrochloride
- compound
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 3
- 239000003814 drug Substances 0.000 title description 2
- 125000003453 indazolyl group Chemical class N1N=C(C2=C1C=CC=C2)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 20
- -1 1-Dimethylaminopropyl Chemical group 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 150000002473 indoazoles Chemical class 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- AFNIERQOVSXQOU-UHFFFAOYSA-N n,n-dimethyl-1-(3-phenyl-1h-indazol-4-yl)propan-1-amine Chemical compound C1=2C(C(N(C)C)CC)=CC=CC=2NN=C1C1=CC=CC=C1 AFNIERQOVSXQOU-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 239000000243 solution Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 230000036760 body temperature Effects 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- 235000006408 oxalic acid Nutrition 0.000 description 5
- LJQNMDZRCXJETK-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine;hydron;chloride Chemical compound Cl.CN(C)CCCCl LJQNMDZRCXJETK-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 3
- MXBKCOLSUUYOHT-UHFFFAOYSA-N 3-phenyl-1h-indazole Chemical compound C1=CC=CC=C1C1=NNC2=CC=CC=C12 MXBKCOLSUUYOHT-UHFFFAOYSA-N 0.000 description 3
- 230000000891 anti-reserpine Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 2
- ZKNTWHPPAIWTHF-UHFFFAOYSA-N 5-chloro-3-phenyl-1h-indazole Chemical compound C12=CC(Cl)=CC=C2NN=C1C1=CC=CC=C1 ZKNTWHPPAIWTHF-UHFFFAOYSA-N 0.000 description 2
- BKFJFOATAKURAK-UHFFFAOYSA-N 5-methyl-3-phenyl-1h-indazole Chemical compound C12=CC(C)=CC=C2NN=C1C1=CC=CC=C1 BKFJFOATAKURAK-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 2
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- BCGWQEUPMDMJNV-UHFFFAOYSA-N imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 description 2
- 229960004801 imipramine Drugs 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 description 2
- 229960003147 reserpine Drugs 0.000 description 2
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 1
- QXKKPVVOOWBLND-UHFFFAOYSA-N 5-bromo-3-phenyl-1h-indazole Chemical compound C12=CC(Br)=CC=C2NN=C1C1=CC=CC=C1 QXKKPVVOOWBLND-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- HCYAFALTSJYZDH-UHFFFAOYSA-N Desimpramine Chemical compound C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 HCYAFALTSJYZDH-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940124599 anti-inflammatory drug Drugs 0.000 description 1
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229960003914 desipramine Drugs 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- WLUFLAHTMDWHAM-UHFFFAOYSA-N n,n-dimethyl-1-(3-phenyl-1h-indazol-4-yl)ethanamine;hydrochloride Chemical compound Cl.C1=2C(C(N(C)C)C)=CC=CC=2NN=C1C1=CC=CC=C1 WLUFLAHTMDWHAM-UHFFFAOYSA-N 0.000 description 1
- OAUVAUIYULRIMI-UHFFFAOYSA-N n-methyl-3-(3-phenylindazol-1-yl)propan-1-amine Chemical compound C12=CC=CC=C2N(CCCNC)N=C1C1=CC=CC=C1 OAUVAUIYULRIMI-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
- C07D231/56—Benzopyrazoles; Hydrogenated benzopyrazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1218474A JPS5637984B2 (enExample) | 1974-01-31 | 1974-01-31 | |
| JP49055000A JPS5922708B2 (ja) | 1974-05-18 | 1974-05-18 | インダゾ−ル誘導体の製法 |
| JP6185374A JPS5652904B2 (enExample) | 1974-06-03 | 1974-06-03 | |
| JP49129521A JPS603063B2 (ja) | 1974-11-12 | 1974-11-12 | インダゾ−ル誘導体の製法 |
| JP49135184A JPS5944313B2 (ja) | 1974-11-26 | 1974-11-26 | インダゾ−ル誘導体の製法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2503815A1 DE2503815A1 (de) | 1975-08-07 |
| DE2503815C2 true DE2503815C2 (de) | 1986-05-22 |
Family
ID=27519371
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2503815A Expired DE2503815C2 (de) | 1974-01-31 | 1975-01-30 | Indazol-Derivate, Verfahren zu ihrer Herstellung und Arzneimittel |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3994890A (enExample) |
| DE (1) | DE2503815C2 (enExample) |
| FR (1) | FR2259601B1 (enExample) |
| GB (1) | GB1489280A (enExample) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3132916A1 (de) * | 1981-08-20 | 1983-03-03 | Kali-Chemie Pharma Gmbh, 3000 Hannover | 1-phenylindazol-3-on-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| US5264576A (en) * | 1992-10-22 | 1993-11-23 | Hoechst-Roussel Pharmaceuticals Incorporated | Pyrazolo[4,3-c]pyridines which are intermediates |
| AP1147A (en) * | 1996-05-03 | 2003-02-25 | Pfizer | Substituted indazole derivatives and related compounds. |
| EP0934311B1 (de) * | 1996-10-14 | 2009-05-13 | Bayer HealthCare AG | Neue heterocyclylmethyl-substituierte pyrazolderivate und ihre verwendung in der behandlung von herz-kreislauf-erkrankungen |
| WO1999064425A1 (en) * | 1998-06-09 | 1999-12-16 | Neurogen Corporation | Substituted thienocycloalkylpyrazoles: dopamine receptor subtype specific ligands |
| MXPA01011720A (es) | 1999-05-14 | 2003-10-14 | Johnson & Johnson | 3-piridil-4-arilpirroles sustituidos, y metodos terapeuticos y profilacticos relacionados. |
| YU54202A (sh) * | 2000-01-18 | 2006-01-16 | Agouron Pharmaceuticals Inc. | Jedinjenja indazola, farmaceutske smeše i postupci za stimulisanje i inhibiranje ćelijske proliferacije |
| US6927233B1 (en) * | 2000-03-17 | 2005-08-09 | Alcon, Inc. | 5ht2 agonists for controlling IOP and treating glaucoma |
| US6956036B1 (en) * | 2000-03-17 | 2005-10-18 | Alcon, Inc. | 6-hydroxy-indazole derivatives for treating glaucoma |
| US6897231B2 (en) * | 2000-07-31 | 2005-05-24 | Signal Pharmaceuticals, Inc. | Indazole derivatives as JNK inhibitors and compositions and methods related thereto |
| US7211594B2 (en) | 2000-07-31 | 2007-05-01 | Signal Pharmaceuticals, Llc | Indazole compounds and compositions thereof as JNK inhibitors and for the treatment of diseases associated therewith |
| US20050009876A1 (en) * | 2000-07-31 | 2005-01-13 | Bhagwat Shripad S. | Indazole compounds, compositions thereof and methods of treatment therewith |
| AU2001284823B2 (en) | 2000-08-14 | 2006-11-30 | Ortho-Mcneil Pharmaceutical, Inc. | Substituted pyrazoles |
| US20070105841A1 (en) * | 2000-08-14 | 2007-05-10 | Breitenbucher J G | Method for treating allergies using substituted pyrazoles |
| US7332494B2 (en) * | 2000-08-14 | 2008-02-19 | Janssen Pharmaceutica, N.V. | Method for treating allergies using substituted pyrazoles |
| ES2261463T3 (es) | 2000-08-14 | 2006-11-16 | Ortho-Mcneil Pharmaceutical, Inc. | Pirazoles sustituidos. |
| EP1309591B1 (en) * | 2000-08-14 | 2007-01-24 | Ortho-McNeil Pharmaceutical, Inc. | Substituted pyrazoles |
| CN1642973A (zh) | 2000-09-06 | 2005-07-20 | 奥索-麦克尼尔药品公司 | 治疗变态反应的方法 |
| US7429599B2 (en) * | 2000-12-06 | 2008-09-30 | Signal Pharmaceuticals, Llc | Methods for treating or preventing an inflammatory or metabolic condition or inhibiting JNK |
| RU2286343C2 (ru) * | 2001-08-10 | 2006-10-27 | Орто-Макнейл Фармасьютикал, Инк. | Замещенные пиразолы |
| US20030073672A1 (en) * | 2001-09-05 | 2003-04-17 | Breitenbucher J. Guy | Method for treating allergies using substituted pyrazoles |
| BR0212613A (pt) * | 2001-09-19 | 2004-08-31 | Pharmacia Corp | Compostos de indazol substituìdos para o tratamento de inflamação |
| US7351729B2 (en) * | 2002-03-08 | 2008-04-01 | Signal Pharmaceuticals, Llc | JNK inhibitors for use in combination therapy for treating or managing proliferative disorders and cancers |
| US20040034084A1 (en) * | 2002-05-24 | 2004-02-19 | Celgene Corporation | Methods for using JNK inhibitors for treating or preventing disease-related wasting |
| US7589199B2 (en) | 2002-06-12 | 2009-09-15 | Chemocentryx, Inc. | Substituted piperazines |
| US7842693B2 (en) * | 2002-06-12 | 2010-11-30 | Chemocentryx, Inc. | Substituted piperazines |
| AU2003236500B9 (en) * | 2002-06-12 | 2009-07-02 | Chemocentryx, Inc. | 1-aryl-4-substituted piperazine derivatives for use as CCR1 antagonists for the treatment of inflammation and immune disorders |
| US20050256130A1 (en) * | 2002-06-12 | 2005-11-17 | Chemocentryx, Inc. | Substituted piperazines |
| US20060004043A1 (en) | 2003-11-19 | 2006-01-05 | Bhagwat Shripad S | Indazole compounds and methods of use thereof |
| CN100542534C (zh) * | 2003-12-09 | 2009-09-23 | 凯莫森特里克斯股份有限公司 | 取代的哌嗪 |
| AU2005219438B2 (en) * | 2004-03-03 | 2011-02-17 | Chemocentryx, Inc. | Bicyclic and bridged nitrogen heterocycles |
| US7435831B2 (en) * | 2004-03-03 | 2008-10-14 | Chemocentryx, Inc. | Bicyclic and bridged nitrogen heterocycles |
| US20070004777A1 (en) * | 2005-03-23 | 2007-01-04 | Bhagwat Shripad S | Methods for treating or preventing acute myelogenous leukemia |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641050A (en) * | 1967-12-12 | 1972-02-08 | Tenneco Chem | 1 5-substituted indazoles |
| NL7000716A (enExample) * | 1969-01-27 | 1970-07-29 | ||
| DE1948793A1 (de) * | 1969-09-26 | 1971-04-01 | Rhein Chemie Rheinau Gmbh | Verfahren zur Herstellung von 4,5,6,7-Tetrahydroindazolen |
-
1975
- 1975-01-15 US US05/541,100 patent/US3994890A/en not_active Expired - Lifetime
- 1975-01-17 GB GB2247/75A patent/GB1489280A/en not_active Expired
- 1975-01-30 FR FR7502955A patent/FR2259601B1/fr not_active Expired
- 1975-01-30 DE DE2503815A patent/DE2503815C2/de not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| US3994890A (en) | 1976-11-30 |
| GB1489280A (en) | 1977-10-19 |
| DE2503815A1 (de) | 1975-08-07 |
| FR2259601B1 (enExample) | 1980-01-11 |
| FR2259601A1 (enExample) | 1975-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2503815C2 (de) | Indazol-Derivate, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE1956384B2 (de) | 1 -Isopropyl-4 phenyl-2-( 1 H)-chinazolinonderivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2205815A1 (de) | Piperazinderivate und verfahren zu ihrer herstellung | |
| DE2340873A1 (de) | Morpholinderivate | |
| DE2426149B2 (de) | 7-Fluor-substituierte Phenothiazine, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| DE2628570B2 (enExample) | ||
| DE2006895A1 (de) | Neue Phenacetylguanidine und Verfahren zu ihrer Herstellung | |
| DD151408A5 (de) | Verfahren zur herstellung neuer pharmazeutisch aktiver phenylpiperazinderivate | |
| DE2264668A1 (de) | Propenylaminderivate und verfahren zu dereb herstellung | |
| DE2051962A1 (de) | Benzimidazo eckige Klammer auf l,2d eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu benzodiazepin 6 (5H) one und Verfahren zu deren Her stellung | |
| DE2313256C3 (de) | l^-Benzisoxazol-3-acetamidoxim, seine Salze, Verfahren zu seiner Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH638525A5 (de) | 3-(tetrazol-5-yl)-1-azaxanthone und verfahren zu ihrer herstellung. | |
| DE1620373A1 (de) | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen | |
| DE2160911A1 (de) | Verfahren zur Herstellung von Aminoketonen | |
| DE2364161A1 (de) | 3-phenoxypropylamin-derivate und deren salze, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2623377A1 (de) | 2-imidazoline und ihre anwendung in pharmazeutischen zubereitungen sowie verfahren zu ihrer herstellung | |
| DE2250469A1 (de) | Verfahren zur herstellung von substituierten benzimidazolen | |
| AT240373B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1962149A1 (de) | Organische Verbindungen und Verfahren zu ihrer Herstellung | |
| AT256814B (de) | Verfahren zur Herstellung von neuen Sulfamiden | |
| AT363095B (de) | Verfahren zur herstellung von neuen piperazinderivaten und deren salzen | |
| DE2615161A1 (de) | Omega-aminoalkoxy-alkane, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| AT363094B (de) | Verfahren zur herstellung von neuen piperazinderivaten und deren salzen | |
| CH615422A5 (enExample) | ||
| DE2203743A1 (de) | Neue Phenalendiamin-Derivate und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |