DE2457582C3 - Wäßriges, saures, galvanisches Chrombad auf Cr (IH)-Basis - Google Patents
Wäßriges, saures, galvanisches Chrombad auf Cr (IH)-BasisInfo
- Publication number
- DE2457582C3 DE2457582C3 DE2457582A DE2457582A DE2457582C3 DE 2457582 C3 DE2457582 C3 DE 2457582C3 DE 2457582 A DE2457582 A DE 2457582A DE 2457582 A DE2457582 A DE 2457582A DE 2457582 C3 DE2457582 C3 DE 2457582C3
- Authority
- DE
- Germany
- Prior art keywords
- molar
- chromium
- bath according
- ions
- concentration
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 title claims description 56
- 239000011651 chromium Substances 0.000 title claims description 49
- 229910052804 chromium Inorganic materials 0.000 title claims description 42
- 230000002378 acidificating effect Effects 0.000 title claims description 5
- -1 ammonium ions Chemical class 0.000 claims description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 17
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 14
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 14
- 150000001450 anions Chemical class 0.000 claims description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 6
- 239000000080 wetting agent Substances 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000008139 complexing agent Substances 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 238000004070 electrodeposition Methods 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 229910001414 potassium ion Inorganic materials 0.000 claims 1
- 229910001415 sodium ion Inorganic materials 0.000 claims 1
- 239000000243 solution Substances 0.000 description 28
- 238000009713 electroplating Methods 0.000 description 12
- 238000007747 plating Methods 0.000 description 12
- 235000002639 sodium chloride Nutrition 0.000 description 12
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 10
- 238000000151 deposition Methods 0.000 description 10
- 230000008021 deposition Effects 0.000 description 10
- JOPOVCBBYLSVDA-UHFFFAOYSA-N chromium(6+) Chemical compound [Cr+6] JOPOVCBBYLSVDA-UHFFFAOYSA-N 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 235000015424 sodium Nutrition 0.000 description 8
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical group OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 4
- 239000004327 boric acid Substances 0.000 description 4
- 150000001844 chromium Chemical class 0.000 description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229910000599 Cr alloy Inorganic materials 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- DKSMCEUSSQTGBK-UHFFFAOYSA-M bromite Chemical compound [O-]Br=O DKSMCEUSSQTGBK-UHFFFAOYSA-M 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 2
- 239000000788 chromium alloy Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 2
- 230000009931 harmful effect Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- WFIZEGIEIOHZCP-UHFFFAOYSA-M potassium formate Chemical compound [K+].[O-]C=O WFIZEGIEIOHZCP-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 239000002351 wastewater Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910000640 Fe alloy Inorganic materials 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 240000007313 Tilia cordata Species 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- HARLYELLJDTGCD-UHFFFAOYSA-N benzene sulfur monoxide Chemical compound S=O.C1=CC=CC=C1 HARLYELLJDTGCD-UHFFFAOYSA-N 0.000 description 1
- 229940063013 borate ion Drugs 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 239000000337 buffer salt Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- BFGKITSFLPAWGI-UHFFFAOYSA-N chromium(3+) Chemical class [Cr+3] BFGKITSFLPAWGI-UHFFFAOYSA-N 0.000 description 1
- QOWZHEWZFLTYQP-UHFFFAOYSA-K chromium(3+);triformate Chemical compound [Cr+3].[O-]C=O.[O-]C=O.[O-]C=O QOWZHEWZFLTYQP-UHFFFAOYSA-K 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- 229910000356 chromium(III) sulfate Inorganic materials 0.000 description 1
- 239000011696 chromium(III) sulphate Substances 0.000 description 1
- 235000015217 chromium(III) sulphate Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000003869 coulometry Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- RBLWMQWAHONKNC-UHFFFAOYSA-N hydroxyazanium Chemical compound O[NH3+] RBLWMQWAHONKNC-UHFFFAOYSA-N 0.000 description 1
- 229910001410 inorganic ion Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000003340 mental effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 208000014451 palmoplantar keratoderma and congenital alopecia 2 Diseases 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000008237 rinsing water Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000003911 water pollution Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25D—PROCESSES FOR THE ELECTROLYTIC OR ELECTROPHORETIC PRODUCTION OF COATINGS; ELECTROFORMING; APPARATUS THEREFOR
- C25D3/00—Electroplating: Baths therefor
- C25D3/02—Electroplating: Baths therefor from solutions
- C25D3/04—Electroplating: Baths therefor from solutions of chromium
- C25D3/06—Electroplating: Baths therefor from solutions of chromium from solutions of trivalent chromium
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electroplating And Plating Baths Therefor (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5787273 | 1973-12-13 | ||
| GB2666574*[A GB1455580A (en) | 1973-12-13 | 1974-06-17 | Electrodeposition of chromium |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2457582A1 DE2457582A1 (de) | 1975-08-21 |
| DE2457582B2 DE2457582B2 (de) | 1977-12-01 |
| DE2457582C3 true DE2457582C3 (de) | 1978-08-17 |
Family
ID=26258369
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2457582A Expired DE2457582C3 (de) | 1973-12-13 | 1974-12-05 | Wäßriges, saures, galvanisches Chrombad auf Cr (IH)-Basis |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3954574A (enExample) |
| JP (1) | JPS5437564B2 (enExample) |
| BR (1) | BR7410411D0 (enExample) |
| CA (1) | CA1031717A (enExample) |
| DE (1) | DE2457582C3 (enExample) |
| ES (1) | ES432830A1 (enExample) |
| FR (1) | FR2254657B1 (enExample) |
| GB (1) | GB1455580A (enExample) |
| IT (1) | IT1027056B (enExample) |
| NL (1) | NL7416108A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2010037532A1 (de) | 2008-10-01 | 2010-04-08 | Voestalpine Stahl Gmbh | Verfahren zum elektrolytischen abscheiden von chrom und chromlegierungen |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4054494A (en) * | 1973-12-13 | 1977-10-18 | Albright & Wilson Ltd. | Compositions for use in chromium plating |
| US4107004A (en) * | 1975-03-26 | 1978-08-15 | International Lead Zinc Research Organization, Inc. | Trivalent chromium electroplating baths and method |
| GB1558169A (en) * | 1975-07-03 | 1979-12-19 | Albright & Wilson | Chromium electroplating |
| GB1562188A (en) * | 1975-08-27 | 1980-03-05 | Albright & Wilson | Chromium electroplating baths |
| GB1596995A (en) * | 1977-06-14 | 1981-09-03 | Ibm | Electroplating chromium and its alloys |
| AU510617B2 (en) * | 1975-12-18 | 1980-07-03 | Albright & Wilson (Australia) Limited | Trivalent chromium electroplating baths |
| US4093521A (en) * | 1975-12-18 | 1978-06-06 | Stanley Renton | Chromium electroplating |
| US4095014A (en) * | 1976-07-06 | 1978-06-13 | Iosso Richard Christ | Wear-resistant zinc articles |
| GB1592761A (en) * | 1976-08-24 | 1981-07-08 | Albright & Wilson | Electroplating baths |
| GB1591051A (en) * | 1977-01-26 | 1981-06-10 | Ibm | Electroplating chromium and its alloys |
| JPS53106348A (en) * | 1977-02-28 | 1978-09-16 | Toyo Soda Mfg Co Ltd | Electrolytic bath for chromium plating |
| JPS55119192A (en) * | 1979-03-09 | 1980-09-12 | Toyo Soda Mfg Co Ltd | Trivalent chromium plating bath |
| GB2071151B (en) | 1980-03-10 | 1983-04-07 | Ibm | Trivalent chromium electroplating |
| US4392922A (en) * | 1980-11-10 | 1983-07-12 | Occidental Chemical Corporation | Trivalent chromium electrolyte and process employing vanadium reducing agent |
| DE3268722D1 (en) * | 1981-03-09 | 1986-03-13 | Battelle Development Corp | High-rate chromium alloy plating |
| US4466865A (en) * | 1982-01-11 | 1984-08-21 | Omi International Corporation | Trivalent chromium electroplating process |
| US4543167A (en) * | 1982-03-05 | 1985-09-24 | M&T Chemicals Inc. | Control of anode gas evolution in trivalent chromium plating bath |
| FR2529581A1 (fr) * | 1982-06-30 | 1984-01-06 | Armines | Bain d'electrolyse a base de chrome trivalent |
| US4450052A (en) * | 1982-07-28 | 1984-05-22 | M&T Chemicals Inc. | Zinc and nickel tolerant trivalent chromium plating baths |
| US4432843A (en) * | 1982-07-29 | 1984-02-21 | Omi International Corporation | Trivalent chromium electroplating baths and processes using thiazole addition agents |
| CA1213558A (en) * | 1982-07-29 | 1986-11-04 | Walter J. Wieczerniak | Method of purifying trivalent chromium electroplating baths |
| US4461680A (en) * | 1983-12-30 | 1984-07-24 | The United States Of America As Represented By The Secretary Of Commerce | Process and bath for electroplating nickel-chromium alloys |
| GB8409073D0 (en) * | 1984-04-07 | 1984-05-16 | Inter Metals & Minerals Sa | Electrodeposition of chromium &c |
| JPS6156294A (ja) * | 1984-08-27 | 1986-03-20 | Nippon Kokan Kk <Nkk> | クロム合金メツキ浴 |
| US4680099A (en) * | 1986-04-07 | 1987-07-14 | Raymund Singleton | Electroplating apparatus |
| US4804446A (en) * | 1986-09-19 | 1989-02-14 | The United States Of America As Represented By The Secretary Of Commerce | Electrodeposition of chromium from a trivalent electrolyte |
| US5413646A (en) * | 1991-02-08 | 1995-05-09 | Blount, Inc. | Heat-treatable chromium |
| US5294326A (en) * | 1991-12-30 | 1994-03-15 | Elf Atochem North America, Inc. | Functional plating from solutions containing trivalent chromium ion |
| US5415763A (en) * | 1993-08-18 | 1995-05-16 | The United States Of America As Represented By The Secretary Of Commerce | Methods and electrolyte compositions for electrodepositing chromium coatings |
| US5558759A (en) * | 1994-07-26 | 1996-09-24 | Sargent Manufacturing Company | Metal finishing process |
| US5759243A (en) * | 1995-03-27 | 1998-06-02 | The United States Of America As Represented By The Secretary Of Commerce | Methods and electrolyte compositions for electrodepositing metal-carbon alloys |
| US6004448A (en) | 1995-06-06 | 1999-12-21 | Atotech Usa, Inc. | Deposition of chromium oxides from a trivalent chromium solution containing a complexing agent for a buffer |
| US5820741A (en) * | 1995-12-05 | 1998-10-13 | Sanchem, Inc. | Passification of zinc surfaces |
| AUPO126596A0 (en) | 1996-07-26 | 1996-08-22 | Resmed Limited | A nasal mask and mask cushion therefor |
| RU2146309C1 (ru) * | 1999-03-25 | 2000-03-10 | Винокуров Евгений Геннадьевич | Электролит для осаждения хромовых покрытий на металлы и сплавы |
| DE50015318D1 (de) * | 2000-11-11 | 2008-10-02 | Enthone | Verfahren zur elektrolytischen Abscheidung aus einer chromhaltigen Lösung |
| US20040154926A1 (en) * | 2002-12-24 | 2004-08-12 | Zhi-Wen Sun | Multiple chemistry electrochemical plating method |
| US20080274373A1 (en) * | 2004-10-18 | 2008-11-06 | Yamaha Hatsudoki Kabushiki Kaisha | Engine Part |
| WO2007115030A1 (en) * | 2006-03-31 | 2007-10-11 | Atotech Deutschland Gmbh | Crystalline chromium deposit |
| KR100872479B1 (ko) | 2007-03-27 | 2008-12-15 | (주)하나나노텍 | 3가 크로메이트 용액과 3가 크로메이트 처리된 금속체 및그의 제조방법 |
| JP2009074168A (ja) * | 2007-08-30 | 2009-04-09 | Nissan Motor Co Ltd | クロムめっき部品およびその製造方法 |
| MX2010003543A (es) | 2007-10-02 | 2010-05-17 | Atotech Deutschland Gmbh | Deposito de aleacion de cromo cristalino. |
| US7780840B2 (en) * | 2008-10-30 | 2010-08-24 | Trevor Pearson | Process for plating chromium from a trivalent chromium plating bath |
| JP6110049B2 (ja) | 2009-02-13 | 2017-04-05 | 日産自動車株式会社 | クロムめっき部品及びその製造方法 |
| KR101198353B1 (ko) * | 2010-07-29 | 2012-11-09 | 한국기계연구원 | 3가크롬도금액 및 이를 이용한 도금방법 |
| US8273235B2 (en) | 2010-11-05 | 2012-09-25 | Roshan V Chapaneri | Dark colored chromium based electrodeposits |
| DE102010055968A1 (de) | 2010-12-23 | 2012-06-28 | Coventya Spa | Substrat mit korrosionsbeständigem Überzug und Verfahren zu dessen Herstellung |
| US9689081B2 (en) | 2011-05-03 | 2017-06-27 | Atotech Deutschland Gmbh | Electroplating bath and method for producing dark chromium layers |
| EP2831314B1 (en) | 2012-03-30 | 2016-05-18 | Tata Steel IJmuiden B.V. | Coated substrate for packaging applications and a method for producing said coated substrate |
| DE102012008544A1 (de) | 2012-05-02 | 2013-11-07 | Umicore Galvanotechnik Gmbh | Verchromte Verbundwerkstoffe ohne Nickelschicht |
| BR112015011465B1 (pt) * | 2012-11-21 | 2021-07-27 | Tata Steel Ijmuiden Bv | Processo para produzir um substrato de aço revestido para aplicações em embalagem |
| DK3146092T3 (da) | 2014-05-21 | 2019-09-16 | Tata Steel Ijmuiden Bv | Fremgangsmåde til plettering af et metalbånd i bevægelse |
| JP2015221944A (ja) * | 2015-08-07 | 2015-12-10 | 日産自動車株式会社 | クロムめっき部品及びその製造方法 |
| ES2926004T3 (es) * | 2017-04-04 | 2022-10-21 | Atotech Deutschland Gmbh & Co Kg | Método controlado para depositar una capa de cromo o aleación de cromo sobre al menos un sustrato |
| EP4077770A1 (en) * | 2019-12-18 | 2022-10-26 | Atotech Deutschland GmbH & Co. KG | Electroplating composition and method for depositing a chromium coating on a substrate |
| FI129420B (en) * | 2020-04-23 | 2022-02-15 | Savroc Ltd | AQUATIC ELECTRIC COATING BATH |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2927066A (en) * | 1955-12-30 | 1960-03-01 | Glenn R Schaer | Chromium alloy plating |
| US3706643A (en) * | 1971-02-19 | 1972-12-19 | Du Pont | Chromium plating bath containing chromic compound and organic component |
| US3729392A (en) * | 1971-02-19 | 1973-04-24 | Du Pont | Plating of titanium with chromium |
| US3706638A (en) * | 1971-02-19 | 1972-12-19 | Du Pont | Chromium plating bath for rotary receptacle plating |
| GB1378883A (en) * | 1971-02-23 | 1974-12-27 | Albright & Wilson | Electroplating |
| GB1368749A (en) * | 1971-09-30 | 1974-10-02 | British Non Ferrous Metals Res | Electrodeposition of chromium |
-
1974
- 1974-06-17 GB GB2666574*[A patent/GB1455580A/en not_active Expired
- 1974-12-05 DE DE2457582A patent/DE2457582C3/de not_active Expired
- 1974-12-06 US US05/530,158 patent/US3954574A/en not_active Expired - Lifetime
- 1974-12-10 JP JP14121174A patent/JPS5437564B2/ja not_active Expired
- 1974-12-11 NL NL7416108A patent/NL7416108A/xx not_active Application Discontinuation
- 1974-12-12 BR BR10411/74A patent/BR7410411D0/pt unknown
- 1974-12-12 FR FR7441019A patent/FR2254657B1/fr not_active Expired
- 1974-12-12 ES ES432830A patent/ES432830A1/es not_active Expired
- 1974-12-12 IT IT70609/74A patent/IT1027056B/it active
- 1974-12-13 CA CA216,019A patent/CA1031717A/en not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2010037532A1 (de) | 2008-10-01 | 2010-04-08 | Voestalpine Stahl Gmbh | Verfahren zum elektrolytischen abscheiden von chrom und chromlegierungen |
| DE102008050034A1 (de) * | 2008-10-01 | 2010-04-15 | Voestalpine Stahl Gmbh | Verfahren zum elektrolytischen Abscheiden von Chrom und Chromlegierungen |
| DE102008050034B4 (de) * | 2008-10-01 | 2013-02-21 | Voestalpine Stahl Gmbh | Verfahren zum elektrolytischen Abscheiden von Chrom und Chromlegierungen |
Also Published As
| Publication number | Publication date |
|---|---|
| CA1031717A (en) | 1978-05-23 |
| DE2457582A1 (de) | 1975-08-21 |
| DE2457582B2 (de) | 1977-12-01 |
| JPS5437564B2 (enExample) | 1979-11-15 |
| US3954574A (en) | 1976-05-04 |
| AU7538074A (en) | 1976-05-20 |
| BR7410411D0 (pt) | 1975-09-16 |
| ES432830A1 (es) | 1977-04-01 |
| JPS5092237A (enExample) | 1975-07-23 |
| FR2254657A1 (enExample) | 1975-07-11 |
| FR2254657B1 (enExample) | 1979-06-08 |
| NL7416108A (nl) | 1975-06-17 |
| IT1027056B (it) | 1978-11-20 |
| GB1455580A (en) | 1976-11-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2457582C3 (de) | Wäßriges, saures, galvanisches Chrombad auf Cr (IH)-Basis | |
| DE3213384C2 (enExample) | ||
| DE2447897A1 (de) | Chromhaltige galvanische baeder | |
| DE832982C (de) | Elektrolyt und Verfahren zur elektrolytischen Abscheidung von Kupfer | |
| DE1150255B (de) | Cyanidfreies alkalisches Glanzzinkbad | |
| DE3628361C2 (enExample) | ||
| DE3020765C2 (enExample) | ||
| DE2912354C2 (de) | Wäßriges saures Bad und Verfahren zur galvanischen Abscheidung von Chrom oder Chromlegierungen | |
| DE2809636A1 (de) | Galvanisierbad auf der basis von dreiwertigem chrom | |
| DE1290782B (de) | Galvanisches Chrombad | |
| DE1213695B (de) | Saures/galvanisches Chrombad zum Abscheiden rissfreier Chromueberzuege und Trockenmischung zur Herstellung des Bades | |
| DE2352970A1 (de) | Korrosionsbestaendige metallueberzuege, die galvanisch abgeschiedenes nickel und mikroporoeses chrom enthalten | |
| CH370612A (de) | Verfahren zur Herstellung galvanischer Kupferüberzüge | |
| DE2147257A1 (de) | Galvanisches Bad und Verfahren zur Abscheidung halbglanzender Nickeluber züge | |
| DE888191C (de) | Bad und Verfahren zur galvanischen Vernicklung | |
| DE2657012C2 (de) | Galvanisches Chrombad | |
| DE69011549T2 (de) | Elektroplattierung von Gold enthaltenden Legierungen. | |
| DE2612444A1 (de) | Dreiwertiges chrom enthaltendes galvanisches verchromungsbad | |
| DE1193334B (de) | Waessriges alkylisches Zinkcyanidbad zum galvanischen Abscheiden von hellglaenzenden Zinkueberzuegen | |
| DE3619386C2 (enExample) | ||
| DE3417416A1 (de) | Waessriges saures galvanisches chrom (iii)-bad und ein verfahren zur galvanischen abscheidung von chrom aus diesem bad auf einem substrat | |
| DE815882C (de) | Verfahren zur Erzeugung von Niederschlaegen auf Metallflaechen durch Elektrolyse | |
| DE2737748A1 (de) | Galvanisches chrombad | |
| DE2600215A1 (de) | Verfahren und waessriges saures bad zur galvanischen abscheidung von zink | |
| DE606052C (de) | Verfahren zur Herstellung von elektrolytischen Platinniederschlaegen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BERENDT, T., DIPL.-CHEM. DR., PAT.-ANW., 8000 MUENCHEN |