DE2447895C2 - Korrosionsschutzmittel und seine Verwendung - Google Patents
Korrosionsschutzmittel und seine VerwendungInfo
- Publication number
- DE2447895C2 DE2447895C2 DE2447895A DE2447895A DE2447895C2 DE 2447895 C2 DE2447895 C2 DE 2447895C2 DE 2447895 A DE2447895 A DE 2447895A DE 2447895 A DE2447895 A DE 2447895A DE 2447895 C2 DE2447895 C2 DE 2447895C2
- Authority
- DE
- Germany
- Prior art keywords
- component
- corrosion protection
- corrosion
- acid
- weight ratio
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000005260 corrosion Methods 0.000 title claims description 31
- 230000007797 corrosion Effects 0.000 title claims description 26
- 239000011814 protection agent Substances 0.000 title claims description 8
- 239000000203 mixture Substances 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 7
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 7
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 4
- 229910000037 hydrogen sulfide Inorganic materials 0.000 claims description 4
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 claims description 4
- 235000019982 sodium hexametaphosphate Nutrition 0.000 claims description 4
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical group 0.000 claims description 3
- 230000002401 inhibitory effect Effects 0.000 claims description 3
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 claims description 2
- 230000000694 effects Effects 0.000 claims description 2
- 229920003169 water-soluble polymer Polymers 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000003112 inhibitor Substances 0.000 description 8
- 229920002472 Starch Polymers 0.000 description 7
- 235000019698 starch Nutrition 0.000 description 7
- 239000008107 starch Substances 0.000 description 7
- 229910019142 PO4 Inorganic materials 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- 239000000498 cooling water Substances 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 5
- 239000010452 phosphate Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- 229910000754 Wrought iron Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 2
- 229920000578 graft copolymer Polymers 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 229920002545 silicone oil Polymers 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- DKPHLYCEFBDQKM-UHFFFAOYSA-H hexapotassium;1-phosphonato-n,n-bis(phosphonatomethyl)methanamine Chemical compound [K+].[K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)CN(CP([O-])([O-])=O)CP([O-])([O-])=O DKPHLYCEFBDQKM-UHFFFAOYSA-H 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229920003145 methacrylic acid copolymer Polymers 0.000 description 1
- 229940117841 methacrylic acid copolymer Drugs 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- -1 phosphonic acid compound Chemical class 0.000 description 1
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C23—COATING METALLIC MATERIAL; COATING MATERIAL WITH METALLIC MATERIAL; CHEMICAL SURFACE TREATMENT; DIFFUSION TREATMENT OF METALLIC MATERIAL; COATING BY VACUUM EVAPORATION, BY SPUTTERING, BY ION IMPLANTATION OR BY CHEMICAL VAPOUR DEPOSITION, IN GENERAL; INHIBITING CORROSION OF METALLIC MATERIAL OR INCRUSTATION IN GENERAL
- C23F—NON-MECHANICAL REMOVAL OF METALLIC MATERIAL FROM SURFACE; INHIBITING CORROSION OF METALLIC MATERIAL OR INCRUSTATION IN GENERAL; MULTI-STEP PROCESSES FOR SURFACE TREATMENT OF METALLIC MATERIAL INVOLVING AT LEAST ONE PROCESS PROVIDED FOR IN CLASS C23 AND AT LEAST ONE PROCESS COVERED BY SUBCLASS C21D OR C22F OR CLASS C25
- C23F11/00—Inhibiting corrosion of metallic material by applying inhibitors to the surface in danger of corrosion or adding them to the corrosive agent
- C23F11/08—Inhibiting corrosion of metallic material by applying inhibitors to the surface in danger of corrosion or adding them to the corrosive agent in other liquids
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Preventing Corrosion Or Incrustation Of Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/404,256 US3992318A (en) | 1973-10-09 | 1973-10-09 | Corrosion inhibitor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2447895A1 DE2447895A1 (de) | 1975-04-10 |
| DE2447895C2 true DE2447895C2 (de) | 1986-12-11 |
Family
ID=23598844
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2447895A Expired DE2447895C2 (de) | 1973-10-09 | 1974-10-08 | Korrosionsschutzmittel und seine Verwendung |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3992318A (esLanguage) |
| JP (1) | JPS585264B2 (esLanguage) |
| BE (1) | BE820826A (esLanguage) |
| BR (1) | BR7408328D0 (esLanguage) |
| CA (1) | CA1042650A (esLanguage) |
| DE (1) | DE2447895C2 (esLanguage) |
| ES (1) | ES430773A1 (esLanguage) |
| FR (1) | FR2246620B1 (esLanguage) |
| GB (1) | GB1463173A (esLanguage) |
| IT (1) | IT1022687B (esLanguage) |
| NL (1) | NL7413235A (esLanguage) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6017828B2 (ja) * | 1975-05-15 | 1985-05-07 | 株式会社片山化学工業研究所 | 循環系高濃縮水用防食剤 |
| JPS51133143A (en) * | 1975-05-15 | 1976-11-18 | Katayama Chemical Works Co | Anticorrosive for condensed water in circulation system |
| GB1539974A (en) * | 1976-11-10 | 1979-02-07 | Ciba Geigy Ag | Method of inhibiting corrosion and scaling of metals in contact with water |
| US4168230A (en) * | 1976-11-10 | 1979-09-18 | Nalco Chemical Company | Synergistic composition comprising phosphorylated ethoxylated glycerine and polyacrylic acid for the prevention of CaCO3 scale in cooling water |
| US4105581A (en) * | 1977-02-18 | 1978-08-08 | Drew Chemical Corporation | Corrosion inhibitor |
| US4217216A (en) * | 1977-04-01 | 1980-08-12 | The Mogul Corporation | Corrosion inhibiting compositions |
| US4138353A (en) * | 1977-04-01 | 1979-02-06 | The Mogul Corporation | Corrosion inhibiting composition and process of using same |
| WO1979000521A1 (en) | 1978-01-17 | 1979-08-09 | Nat Res Dev | Hardenable compositions |
| US4206075A (en) * | 1978-05-05 | 1980-06-03 | Calgon Corporation | Corrosion inhibitor |
| US4246030A (en) * | 1978-12-08 | 1981-01-20 | The Mogul Corporation | Corrosion inhibiting compositions and the process for using same |
| US4239643A (en) * | 1979-01-02 | 1980-12-16 | Monsanto Company | Peroxide stabilization |
| JPS55104530A (en) * | 1979-02-01 | 1980-08-11 | Kurita Water Ind Ltd | Operating method of gas-turbine |
| CA1114595A (en) * | 1979-04-02 | 1981-12-22 | Joseph J. Schuck | Corrosion inhibitor treatment for boiler water |
| US4411865A (en) * | 1979-04-05 | 1983-10-25 | Betz Laboratories, Inc. | Method of corrosion inhibition in aqueous mediums |
| JPS55155813U (esLanguage) * | 1979-04-24 | 1980-11-10 | ||
| US4317744A (en) * | 1979-04-25 | 1982-03-02 | Drew Chemical Corporation | Corrosion inhibitor |
| CA1151498A (en) * | 1979-10-23 | 1983-08-09 | Dearborn Chemicals Ltd. | Treatment of aqueous systems |
| DE3040729A1 (de) * | 1979-10-31 | 1981-05-14 | Nippon Paint Co., Ltd., Osaka | Waessriger anstrichstoff und seine verwendung |
| US4303568A (en) * | 1979-12-10 | 1981-12-01 | Betz Laboratories, Inc. | Corrosion inhibition treatments and method |
| US4351796A (en) * | 1980-02-25 | 1982-09-28 | Ciba-Geigy Corporation | Method for scale control |
| US4297237A (en) * | 1980-03-06 | 1981-10-27 | Calgon Corporation | Polyphosphate and polymaleic anhydride combination for treating corrosion |
| US4409121A (en) * | 1980-07-21 | 1983-10-11 | Uop Inc. | Corrosion inhibitors |
| US4328180A (en) * | 1981-11-04 | 1982-05-04 | Atlantic Richfield Company | Cooling water corrosion inhibitor |
| US4384979A (en) * | 1980-10-31 | 1983-05-24 | Atlantic Richfield Company | Corrosion inhibitor |
| US4446028A (en) * | 1982-12-20 | 1984-05-01 | Betz Laboratories, Inc. | Isopropenyl phosphonic acid copolymers used to inhibit scale formation |
| US4446046A (en) * | 1981-06-17 | 1984-05-01 | Betz Laboratories, Inc. | Poly (alkenyl) phosphonic acid and methods of use thereof |
| US4502978A (en) * | 1982-11-08 | 1985-03-05 | Nalco Chemical Company | Method of improving inhibitor efficiency in hard waters |
| JPS59100272A (ja) * | 1982-11-30 | 1984-06-09 | Kurita Water Ind Ltd | 金属の腐食防止剤 |
| US4936987A (en) * | 1983-03-07 | 1990-06-26 | Calgon Corporation | Synergistic scale and corrosion inhibiting admixtures containing carboxylic acid/sulfonic acid polymers |
| US4487712A (en) * | 1983-05-25 | 1984-12-11 | Basf Wyandotte Corporation | Gelation stabilized water-soluble silicates |
| US4980433A (en) * | 1983-10-26 | 1990-12-25 | Betz Laboratories, Inc. | Novel amine-containing copolymers and their use |
| US4863614A (en) * | 1983-10-26 | 1989-09-05 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4944885A (en) * | 1983-10-26 | 1990-07-31 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4906383A (en) * | 1983-10-26 | 1990-03-06 | Betz Laboratories, Inc. | Novel amine-containing copolymers and their use |
| US4895916A (en) * | 1983-10-26 | 1990-01-23 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4849129A (en) * | 1988-05-06 | 1989-07-18 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4929362A (en) * | 1983-10-26 | 1990-05-29 | Betz Laboratories, Inc. | Calcium phosphate scale control methods |
| US4929695A (en) * | 1983-10-26 | 1990-05-29 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4895664A (en) * | 1983-10-26 | 1990-01-23 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4869845A (en) * | 1983-10-26 | 1989-09-26 | Betz Laboratories, Inc. | Water treatment compositions |
| US4868263A (en) * | 1983-10-26 | 1989-09-19 | Betz Laboratories, Inc. | Novel amine-containing copolymers and their use |
| US4898684A (en) * | 1983-10-26 | 1990-02-06 | Betz Laboratories, Inc. | Novel amine-containing copolymers and their use |
| US4631131A (en) * | 1983-12-08 | 1986-12-23 | R. W. Grace & Co. | Method for inhibiting scale |
| US4600524A (en) * | 1983-12-08 | 1986-07-15 | W. R. Grace & Co. | Composition and method for inhibiting scale |
| US4640793A (en) * | 1984-02-14 | 1987-02-03 | Calgon Corporation | Synergistic scale and corrosion inhibiting admixtures containing carboxylic acid/sulfonic acid polymers |
| US4634532A (en) * | 1984-05-12 | 1987-01-06 | Calgon Corporation | Orthophosphate-containing desalination scale inhibitors |
| US4806310A (en) * | 1985-06-14 | 1989-02-21 | Drew Chemical Corporation | Corrosion inhibitor |
| US4664884A (en) * | 1985-06-14 | 1987-05-12 | Drew Chemical Corporation | Corrosion inhibitor |
| US4904413A (en) * | 1986-03-26 | 1990-02-27 | Nalco Chemical Company | Cooling water corrosion control method and composition |
| US4671934A (en) * | 1986-04-18 | 1987-06-09 | Buckman Laboratories, Inc. | Aminophosphonic acid/phosphate mixtures for controlling corrosion of metal and inhibiting calcium phosphate precipitation |
| US4929425A (en) * | 1986-05-09 | 1990-05-29 | Nalco Chemical Company | Cooling water corrosion inhibition method |
| US4752443A (en) * | 1986-05-09 | 1988-06-21 | Nalco Chemical Company | Cooling water corrosion inhibition method |
| US4895663A (en) * | 1986-05-16 | 1990-01-23 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4925568A (en) * | 1986-08-15 | 1990-05-15 | Calgon Corporation | Polyacrylate blends as boiler scale inhibitors |
| US5053161A (en) * | 1988-06-10 | 1991-10-01 | The Mogul Corporation | Composition for inhibiting scale in water systems |
| US4978456A (en) * | 1988-06-10 | 1990-12-18 | The Mogul Corporation | Method for inhibiting scale and corrosion in water systems |
| DE4135029A1 (de) * | 1990-10-23 | 1992-04-30 | Nalco Chemical Co | Verfahren zur kontrollierten passivierung der innenwaende eines kuehlkreislaufsystems aus kohlenstoffstahl |
| CA2332621C (en) * | 1998-05-28 | 2004-07-20 | Owens Corning | Corrosion inhibiting composition for polyacrylic acid based binders |
| US6180056B1 (en) * | 1998-12-10 | 2001-01-30 | Buckman Laboratories International Inc. | Method and compositions for minimizing biological and colloidal fouling |
| US6913711B2 (en) | 2000-12-19 | 2005-07-05 | Avon Products, Inc. | Corrosion inhibitors |
| CA2537808C (en) * | 2003-09-22 | 2012-08-07 | Buckman Laboratories International, Inc. | Use of cerium salts to inhibit manganese deposition in water systems |
| MXNL04000061A (es) * | 2004-07-21 | 2006-01-26 | Quimiproductos S A De C V | Inhibidor de corrosion para hermetapas de productos envasados y metodo y sistema para la aplicacion del mismo. |
| GB2465211B (en) * | 2008-07-18 | 2013-09-25 | Airedale Chemical Company Ltd | Treatment Solution |
| RU2580685C2 (ru) * | 2014-07-04 | 2016-04-10 | Акционерное общество "Химический завод им. Л.Я. Карпова" | Ингибитор коррозии и солеотложений |
| CN113621952B (zh) * | 2020-05-08 | 2024-02-20 | 广州天至环保科技有限公司 | 一种提升镀层耐腐蚀和表面润湿性的水性保护剂 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3336221A (en) * | 1964-11-05 | 1967-08-15 | Calgon Corp | Method of inhibiting precipitation and scale formation |
| GB1208827A (en) * | 1968-02-23 | 1970-10-14 | Grace W R & Co | Composition and process for inhibiting scaling and/or corrosion in cooling water systems and for stabilizing phosphate solutions |
| US3699048A (en) * | 1969-07-24 | 1972-10-17 | Benckiser Gmbh Joh A | Process of preventing scale and deposit formation in aqueous systems and product |
| US3630938A (en) * | 1969-09-29 | 1971-12-28 | Nalco Chemical Co | Chromate and organophosphate compositions and methods for controlling scale and inhibiting corrosion |
| US3620667A (en) * | 1969-11-18 | 1971-11-16 | William E Zimmie | Method of removing tubercles from a ferrous surface and inhibiting further tubercle formation thereon |
| US3751372A (en) * | 1971-06-18 | 1973-08-07 | Hercules Inc | Scale and corrosion control in circulating water using polyphosphates and organophonic acids |
| US3705005A (en) * | 1971-06-21 | 1972-12-05 | Betz Laboratories | Aminoalkylene phosphonate derivatives as corrosion inhibitors in aqueous systems |
-
1973
- 1973-10-09 US US05/404,256 patent/US3992318A/en not_active Expired - Lifetime
-
1974
- 1974-10-07 GB GB4331774A patent/GB1463173A/en not_active Expired
- 1974-10-08 CA CA211,005A patent/CA1042650A/en not_active Expired
- 1974-10-08 ES ES430773A patent/ES430773A1/es not_active Expired
- 1974-10-08 BR BR8328/74A patent/BR7408328D0/pt unknown
- 1974-10-08 NL NL7413235A patent/NL7413235A/xx active Search and Examination
- 1974-10-08 DE DE2447895A patent/DE2447895C2/de not_active Expired
- 1974-10-08 BE BE149321A patent/BE820826A/xx not_active IP Right Cessation
- 1974-10-08 IT IT28191/74A patent/IT1022687B/it active
- 1974-10-09 FR FR7434014A patent/FR2246620B1/fr not_active Expired
- 1974-10-09 JP JP49115692A patent/JPS585264B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1022687B (it) | 1978-04-20 |
| FR2246620A1 (esLanguage) | 1975-05-02 |
| JPS585264B2 (ja) | 1983-01-29 |
| GB1463173A (en) | 1977-02-02 |
| BE820826A (fr) | 1975-02-03 |
| DE2447895A1 (de) | 1975-04-10 |
| BR7408328D0 (pt) | 1975-07-29 |
| ES430773A1 (es) | 1976-10-16 |
| CA1042650A (en) | 1978-11-21 |
| JPS50110949A (esLanguage) | 1975-09-01 |
| NL7413235A (nl) | 1975-04-11 |
| FR2246620B1 (esLanguage) | 1979-08-03 |
| US3992318A (en) | 1976-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2447895C2 (de) | Korrosionsschutzmittel und seine Verwendung | |
| DE2740671C2 (esLanguage) | ||
| DE69101760T2 (de) | Mittel zur Verhinderung von Calcium enthaltenden Ablagerungen. | |
| DE1936990A1 (de) | Verfahren und Vorrichtung zur Verhinderung von Korrosion | |
| DE3015500C2 (de) | Korrosionsinhibierende Zusammensetzung und Verfahren unter deren Verwendung | |
| DE2505435A1 (de) | Korrosionsinhibitoren fuer wasserfuehrende systeme | |
| DE2457583A1 (de) | Verfahren zur verhinderung der abscheidung von kesselstein, schlamm und anderen verschmutzungsstoffen in waessrigen systemen | |
| DE1903651A1 (de) | Korrosionsinhibierende Zubereitungen,Verfahren zu ihrer Herstellung und Verfahren zur Korrosionsinhibierung | |
| DE2807222B2 (de) | Flüssige, wäßrige Mischung zur Inhibierung von Korrosion und Belagsbildung | |
| DE3230291A1 (de) | Zusammensetzung zur verhinderung von kesselstein in waessrigen systemen | |
| DE3137525A1 (de) | Behandlung von waessrigen systemen zur korrosionshemmung | |
| DE2918967A1 (de) | Korrosionsschutzmittel | |
| DE3249178T1 (de) | Verfahren zur Unterdrückung der Korrosion von Metallen auf Eisenbasis | |
| DE1910002A1 (de) | Wasserbehandlung | |
| DE3249177T1 (de) | Verfahren zur Unterdrückung der Kesselsteinbildung | |
| DE2539687A1 (de) | Mittel zur regelung von kesselsteinablagerungen | |
| EP0184558B1 (de) | Verfahren zur Verhinderung von Kesselstein sowie Antikesselsteinmittel | |
| DE3145283C2 (esLanguage) | ||
| DE3509250C2 (esLanguage) | ||
| DE3238619C2 (esLanguage) | ||
| DE1621440B2 (de) | Korrosions und steinansatzverhuetungsmittel fuer kuehl wasser sowie verfahren zur verhinderung der korrosion und steinsalzbildung durch kuehlwasser | |
| DE2233312A1 (de) | Polyalkylenpolyamin-korrosionsinhibitoren | |
| DE1642436C3 (de) | Verfahren zur Verhinderung von steinbildenden Ablagerungen in wäßrigen Systemen | |
| DE3240780A1 (de) | Verfahren zur kesselspeisewasser-aufbereitung und hierfuehr geeignetes mittel | |
| DE2658475C2 (de) | Verwendung einer Phosphoncarbonsäure in alkalischen Lösungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |