DE2414006C2 - Mehrschichtiges farbphotographisches Aufzeichnungsmaterial - Google Patents
Mehrschichtiges farbphotographisches AufzeichnungsmaterialInfo
- Publication number
- DE2414006C2 DE2414006C2 DE2414006A DE2414006A DE2414006C2 DE 2414006 C2 DE2414006 C2 DE 2414006C2 DE 2414006 A DE2414006 A DE 2414006A DE 2414006 A DE2414006 A DE 2414006A DE 2414006 C2 DE2414006 C2 DE 2414006C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- coupler
- layer
- recording material
- groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 40
- -1 silver halide Chemical class 0.000 claims description 79
- 239000000839 emulsion Substances 0.000 claims description 49
- 229910052709 silver Inorganic materials 0.000 claims description 35
- 239000004332 silver Substances 0.000 claims description 35
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 27
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- 238000005859 coupling reaction Methods 0.000 claims description 15
- 230000008878 coupling Effects 0.000 claims description 14
- 238000010168 coupling process Methods 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 12
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 claims description 4
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 4
- 239000000084 colloidal system Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- GCABLKFGYPIVFC-UHFFFAOYSA-N 3-(1-benzofuran-2-yl)-3-oxopropanenitrile Chemical compound C1=CC=C2OC(C(CC#N)=O)=CC2=C1 GCABLKFGYPIVFC-UHFFFAOYSA-N 0.000 claims description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical group C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000005521 carbonamide group Chemical group 0.000 claims description 3
- LOCAIGRSOJUCTB-UHFFFAOYSA-N indazol-3-one Chemical compound C1=CC=C2C(=O)N=NC2=C1 LOCAIGRSOJUCTB-UHFFFAOYSA-N 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 150000003852 triazoles Chemical class 0.000 claims description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical group O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 claims 1
- 239000010410 layer Substances 0.000 description 74
- 239000000243 solution Substances 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- 238000004519 manufacturing process Methods 0.000 description 14
- 230000001235 sensitizing effect Effects 0.000 description 12
- 229920000159 gelatin Polymers 0.000 description 10
- 235000019322 gelatine Nutrition 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 108010010803 Gelatin Proteins 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000008273 gelatin Substances 0.000 description 9
- 235000011852 gelatine desserts Nutrition 0.000 description 9
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 8
- 239000004793 Polystyrene Substances 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 229960001413 acetanilide Drugs 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 2
- BQCIJWPKDPZNHD-UHFFFAOYSA-N 5-bromo-2h-benzotriazole Chemical compound C1=C(Br)C=CC2=NNN=C21 BQCIJWPKDPZNHD-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000011229 interlayer Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- RNHWYOLIEJIAMV-UHFFFAOYSA-N 1-chlorotetradecane Chemical compound CCCCCCCCCCCCCCCl RNHWYOLIEJIAMV-UHFFFAOYSA-N 0.000 description 1
- CLDZVCMRASJQFO-UHFFFAOYSA-N 2,5-bis(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol Chemical compound CC(C)(C)CC(C)(C)C1=CC(O)=C(C(C)(C)CC(C)(C)C)C=C1O CLDZVCMRASJQFO-UHFFFAOYSA-N 0.000 description 1
- VONWPEXRCLHKRJ-UHFFFAOYSA-N 2-chloro-n-phenylacetamide Chemical compound ClCC(=O)NC1=CC=CC=C1 VONWPEXRCLHKRJ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- CKQHAYFOPRIUOM-UHFFFAOYSA-N 3'-Aminoacetophenone Chemical compound CC(=O)C1=CC=CC(N)=C1 CKQHAYFOPRIUOM-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- KMVPXBDOWDXXEN-UHFFFAOYSA-N 4-nitrophenylhydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=C1 KMVPXBDOWDXXEN-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- PHUOGKYYWROIJH-UHFFFAOYSA-N N(C1=CC=CC=C1)C=1N=NC(C=1N=NC1=CC=CC2=CC=CC=C12)=O Chemical compound N(C1=CC=CC=C1)C=1N=NC(C=1N=NC1=CC=CC2=CC=CC=C12)=O PHUOGKYYWROIJH-UHFFFAOYSA-N 0.000 description 1
- 150000007945 N-acyl ureas Chemical group 0.000 description 1
- MDYMDLNGYHRESS-UHFFFAOYSA-N O=C(NN1N=CCC1=O)C1=CC=CC=C1 Chemical compound O=C(NN1N=CCC1=O)C1=CC=CC=C1 MDYMDLNGYHRESS-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- NNXNKLLWTKSODZ-UHFFFAOYSA-N [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;iron;sodium Chemical compound [Na].[Fe].CC(=O)ON(OC(C)=O)CCN(OC(C)=O)OC(C)=O NNXNKLLWTKSODZ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 1
- XLUXHEZIGIDTCC-UHFFFAOYSA-N acetonitrile;ethyl acetate Chemical compound CC#N.CCOC(C)=O XLUXHEZIGIDTCC-UHFFFAOYSA-N 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000004422 alkyl sulphonamide group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 125000004421 aryl sulphonamide group Chemical group 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001555 benzenes Chemical group 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 239000000298 carbocyanine Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000008358 core component Substances 0.000 description 1
- 230000001808 coupling effect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- AZJUIOMBUXFLOT-UHFFFAOYSA-N n-dodecyl-1-hydroxy-4-iodonaphthalene-2-carboxamide Chemical compound C1=CC=CC2=C(O)C(C(=O)NCCCCCCCCCCCC)=CC(I)=C21 AZJUIOMBUXFLOT-UHFFFAOYSA-N 0.000 description 1
- KIHUPOKUSVEICJ-UHFFFAOYSA-N nonyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 KIHUPOKUSVEICJ-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- QWYZFXLSWMXLDM-UHFFFAOYSA-M pinacyanol iodide Chemical compound [I-].C1=CC2=CC=CC=C2N(CC)C1=CC=CC1=CC=C(C=CC=C2)C2=[N+]1CC QWYZFXLSWMXLDM-UHFFFAOYSA-M 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- ZFCDJOVFDDEYKY-UHFFFAOYSA-M silver;benzenesulfonate Chemical compound [Ag+].[O-]S(=O)(=O)C1=CC=CC=C1 ZFCDJOVFDDEYKY-UHFFFAOYSA-M 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- SYWDUFAVIVYDMX-UHFFFAOYSA-M sodium;4,6-dichloro-1,3,5-triazin-2-olate Chemical compound [Na+].[O-]C1=NC(Cl)=NC(Cl)=N1 SYWDUFAVIVYDMX-UHFFFAOYSA-M 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/305—Substances liberating photographically active agents, e.g. development-inhibiting releasing couplers
- G03C7/30541—Substances liberating photographically active agents, e.g. development-inhibiting releasing couplers characterised by the released group
- G03C7/30558—Heterocyclic group
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3323873A JPS5534933B2 (enExample) | 1973-03-23 | 1973-03-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2414006A1 DE2414006A1 (de) | 1974-10-03 |
| DE2414006C2 true DE2414006C2 (de) | 1982-09-23 |
Family
ID=12380870
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2414006A Expired DE2414006C2 (de) | 1973-03-23 | 1974-03-22 | Mehrschichtiges farbphotographisches Aufzeichnungsmaterial |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3933500A (enExample) |
| JP (1) | JPS5534933B2 (enExample) |
| BR (1) | BR7402270D0 (enExample) |
| CA (1) | CA1025719A (enExample) |
| DE (1) | DE2414006C2 (enExample) |
| FR (1) | FR2222674B1 (enExample) |
| GB (1) | GB1450479A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2536191A1 (de) * | 1974-08-13 | 1976-03-04 | Fuji Photo Film Co Ltd | Zweiwertige purpurkuppler und diese kuppler enthaltende aufzeichnungsmaterialien |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2329587C2 (de) * | 1973-06-09 | 1984-06-20 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbphotographisches Aufzeichnungsmaterial |
| IT1018702B (it) * | 1974-06-26 | 1977-10-20 | Minnesota Mining & Mfg | Copulanti fotografici pivalilaceta nilidici elementi fotografici che comprendono tali copulanti e.o i co loranti formati per sviluppo cromo geno di detti copulanti e metodo per formare una immagine fotografi ca a coloranti in presenza di det ti copulanti |
| JPS5152828A (en) * | 1974-11-05 | 1976-05-10 | Konishiroku Photo Ind | Shashinyo 2 toryogatashiankaburaa |
| GB1528463A (en) * | 1975-01-03 | 1978-10-11 | Agfa Gevaert | 2-equivalent yellow forming couplers |
| JPS588501B2 (ja) * | 1975-01-08 | 1983-02-16 | 富士写真フイルム株式会社 | 多層カラ−感光材料 |
| DE2545756A1 (de) * | 1975-10-11 | 1977-04-21 | Agfa Gevaert Ag | Verfahren zur herstellung von 2-aequivalentgelbkupplern |
| JPS5258922A (en) * | 1975-11-10 | 1977-05-14 | Fuji Photo Film Co Ltd | Photographic coupler |
| JPS5269624A (en) * | 1975-12-09 | 1977-06-09 | Fuji Photo Film Co Ltd | Photographic coupler |
| JPS5275437A (en) * | 1975-12-20 | 1977-06-24 | Mitsubishi Paper Mills Ltd | Silver halide color photographic photosensitive material |
| JPS589942B2 (ja) * | 1975-12-29 | 1983-02-23 | 富士写真フイルム株式会社 | ゲンゾウヨクセイザイホウシユツガタカプラ− |
| JPS537232A (en) * | 1976-07-07 | 1978-01-23 | Fuji Photo Film Co Ltd | Silver halide photographic photosensitive material |
| JPS539116A (en) * | 1976-07-13 | 1978-01-27 | Fuji Photo Film Co Ltd | Silver halide photographic light sensitive material |
| JPS5313923A (en) * | 1976-07-23 | 1978-02-08 | Fuji Photo Film Co Ltd | Color photographic light sensitive material |
| CH627562A5 (de) | 1977-04-29 | 1982-01-15 | Ciba Geigy Ag | Farbphotographisches material. |
| CA1099559A (en) * | 1977-09-29 | 1981-04-21 | Mario Fryberg | 1,2,4-triazole derivatives substituted with a thio or seleno group in the 5-position |
| JPS56116029A (en) * | 1980-01-16 | 1981-09-11 | Konishiroku Photo Ind Co Ltd | Silver halide color photographic sensitive material |
| AU568488B2 (en) | 1982-02-24 | 1988-01-07 | Konishiroku Photo Industry Co., Ltd. | Light-sensitive silver halide colour photographic material |
| JPS59116647A (ja) | 1982-12-13 | 1984-07-05 | Konishiroku Photo Ind Co Ltd | ハロゲン化銀写真感光材料 |
| JPS59188641A (ja) | 1983-04-11 | 1984-10-26 | Fuji Photo Film Co Ltd | ハロゲン化銀写真乳剤 |
| JPS60143331A (ja) | 1983-12-29 | 1985-07-29 | Fuji Photo Film Co Ltd | ハロゲン化銀写真感光材料 |
| JPS61145555A (ja) * | 1984-12-19 | 1986-07-03 | Konishiroku Photo Ind Co Ltd | 写真感光材料 |
| US4879204A (en) * | 1985-01-29 | 1989-11-07 | Fuji Photo Film Co., Ltd. | Silver halide photographic element containing anhydazine compound and specific dyes |
| US4725529A (en) | 1985-04-30 | 1988-02-16 | Konishiroku Photo Industry Co., Ltd. | Developing inhibitor arrangment in light-sensitive silver halide color photographic materials |
| JPS61251852A (ja) | 1985-04-30 | 1986-11-08 | Konishiroku Photo Ind Co Ltd | ハロゲン化銀カラ−写真感光材料の処理方法 |
| JPS61255342A (ja) | 1985-05-09 | 1986-11-13 | Fuji Photo Film Co Ltd | ハロゲン化銀カラ−写真感光材料 |
| AU590563B2 (en) | 1985-05-16 | 1989-11-09 | Konishiroku Photo Industry Co., Ltd. | Method for color-developing a silver halide color photographic light-sensitive material |
| EP0204530B1 (en) | 1985-05-31 | 1991-09-11 | Konica Corporation | Method for forming direct positive color image |
| DE3682128D1 (de) | 1985-07-17 | 1991-11-28 | Konishiroku Photo Ind | Photographisches silberhalogenidmaterial. |
| FR2591355B1 (fr) * | 1985-12-09 | 1990-11-30 | Kodak Pathe | Produit photographique inversible formateur d'image en couleurs avec effets interimage ameliores |
| AU591540B2 (en) | 1985-12-28 | 1989-12-07 | Konishiroku Photo Industry Co., Ltd. | Method of processing light-sensitive silver halide color photographic material |
| US4801520A (en) * | 1986-07-18 | 1989-01-31 | Fuji Photo Film Co., Ltd. | Direct positive color light-sensitive material comprising a DIR coupler and a pyrazoloazole coupler, and a process for forming a direct positive image |
| DE69131785T2 (de) | 1990-08-20 | 2000-05-11 | Fuji Photo Film Co., Ltd. | Datenbehaltendes photographisches Filmerzeugnis und Verfahren zur Herstellung eines Farbbildes |
| DE59309713D1 (de) * | 1992-06-03 | 1999-09-09 | Agfa Gevaert Ag | Farbfotografisches Aufzeichnungsmaterial mit einem Cyan-DIR-Kuppler |
| DE4218308A1 (de) * | 1992-06-03 | 1993-12-09 | Agfa Gevaert Ag | Verfahren zur Herstellung von naphtholischen 2-Äquivalentcyankupplern |
| JPH07110558A (ja) * | 1993-10-12 | 1995-04-25 | Fuji Photo Film Co Ltd | ハロゲン化銀写真感光材料 |
| EP0711804A3 (de) | 1994-11-14 | 1999-09-22 | Ciba SC Holding AG | Kryptolichtschutzmittel |
| US5821043A (en) * | 1996-12-30 | 1998-10-13 | Eastman Kodak Company | 1,2,4-triazole-releasing pyrazolone DIR couplers |
| US5958662A (en) * | 1997-03-25 | 1999-09-28 | Eastman Kodak Company | Photographic element containing a DIR coupler |
| US6171771B1 (en) * | 1997-03-25 | 2001-01-09 | Eastman Kodak Company | Photographic element containing a DIR coupler |
| US5981158A (en) * | 1997-07-18 | 1999-11-09 | Eastman Kodak Company | Photographic element containing a DIR coupler |
| US5989798A (en) * | 1997-12-19 | 1999-11-23 | Eastman Kodak Company | Combinations of purine-releasing pyrazolone DIR couplers and pyrazolone or pyrazolotriazole imaging couplers |
| US5994038A (en) * | 1998-04-29 | 1999-11-30 | Eastman Kodak Company | Photographic element containing acetamido DIR coupler |
| US6083677A (en) * | 1998-04-29 | 2000-07-04 | Eastman Kodak Company | Photographic element containing yellow dye-forming photographic coupler |
| US5998107A (en) * | 1998-04-29 | 1999-12-07 | Eastman Kodak Company | Photographic element containing improved acylacetamido yellow dye-forming coupler |
| US6057087A (en) * | 1998-04-29 | 2000-05-02 | Eastman Kodak Company | Photographic element containing yellow coupler |
| US5998106A (en) * | 1998-04-29 | 1999-12-07 | Eastman Kodak Company | Photographic element containing cylacetamido yellow dye-forming couplers |
| GB9820392D0 (en) * | 1998-09-19 | 1998-11-11 | Eastman Kodak Co | Novel yellow couplers providing images with improved sharpness and photographic elements containing them |
| GB9828438D0 (en) | 1998-12-24 | 1999-02-17 | Eastman Kodak Co | Photographic element containing a dir coupler |
| US6319660B1 (en) | 1998-12-28 | 2001-11-20 | Eastman Kodak Company | Color photographic element containing speed improving compound |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1266229A (fr) * | 1960-08-27 | 1961-07-07 | Kodak Pathe | Nouvau procédé de photographie en couleurs et nouveaux produits pour la mise en oeuvre de ce procédé |
| US3148062A (en) * | 1959-04-06 | 1964-09-08 | Eastman Kodak Co | Photographic elements and processes using splittable couplers |
| US3617291A (en) * | 1967-10-10 | 1971-11-02 | Eastman Kodak Co | Two-equivalent couplers for photography |
| JPS4917735B1 (enExample) * | 1970-12-26 | 1974-05-02 |
-
1973
- 1973-03-23 JP JP3323873A patent/JPS5534933B2/ja not_active Expired
-
1974
- 1974-03-21 FR FR7409688A patent/FR2222674B1/fr not_active Expired
- 1974-03-22 CA CA195,932A patent/CA1025719A/en not_active Expired
- 1974-03-22 DE DE2414006A patent/DE2414006C2/de not_active Expired
- 1974-03-22 BR BR2270/74A patent/BR7402270D0/pt unknown
- 1974-03-22 GB GB1294674A patent/GB1450479A/en not_active Expired
- 1974-03-25 US US05/454,525 patent/US3933500A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2536191A1 (de) * | 1974-08-13 | 1976-03-04 | Fuji Photo Film Co Ltd | Zweiwertige purpurkuppler und diese kuppler enthaltende aufzeichnungsmaterialien |
Also Published As
| Publication number | Publication date |
|---|---|
| US3933500A (en) | 1976-01-20 |
| JPS49122335A (enExample) | 1974-11-22 |
| GB1450479A (en) | 1976-09-22 |
| CA1025719A (en) | 1978-02-07 |
| DE2414006A1 (de) | 1974-10-03 |
| FR2222674B1 (enExample) | 1981-04-17 |
| FR2222674A1 (enExample) | 1974-10-18 |
| BR7402270D0 (pt) | 1974-11-19 |
| JPS5534933B2 (enExample) | 1980-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2414006C2 (de) | Mehrschichtiges farbphotographisches Aufzeichnungsmaterial | |
| DE2703145C2 (enExample) | ||
| DE2934769C2 (enExample) | ||
| DE2659417C2 (enExample) | ||
| DE2643965C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE2421544C2 (de) | Mehrschichtiges farbphotographisches Aufzeichnungsmaterial mit einverleibten Kupplern | |
| DE2418959A1 (de) | Farbphotographisches material | |
| DE2944601C2 (enExample) | ||
| DE2417945A1 (de) | Photographisches lichtempfindliches silberhalogenidmaterial | |
| DE1800420A1 (de) | Farbstoffbildender 2-AEquivalentkuppler | |
| DE2841166A1 (de) | Photographisches, lichtempfindliches silberhalogenidmaterial | |
| DE2042581C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE2429250A1 (de) | Mehrschichtige farbphotographische materialien | |
| DE2600524C2 (enExample) | ||
| DE2406087A1 (de) | Farbphotographisches lichtempfindliches silberhalogenidmaterial | |
| DE2510538A1 (de) | Farbenphotographisches lichtempfindliches material | |
| DE2713022A1 (de) | Photographische halogensilberemulsion und photographisches lichtempfindliches material | |
| DE2730773A1 (de) | Farbempfindliches mehrschichten- material | |
| DE2650712A1 (de) | Photographischer entwickler und seine anwendung | |
| DE2748554A1 (de) | Farbphotographisches, lichtempfindliches element | |
| DE2731676A1 (de) | Photographische silberhalogenidemulsion | |
| DE3628318A1 (de) | Farbfotografisches aufzeichnungsmaterial | |
| DE3033499C2 (enExample) | ||
| DE2834310A1 (de) | Farbphotographisches lichtempfindliches material | |
| DE3630564A1 (de) | Farbfotografisches aufzeichnungsmaterial mit einem gelb-dir-kuppler |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| Q176 | The application caused the suspense of an application |
Ref document number: 2441779 Country of ref document: DE |
|
| D2 | Grant after examination | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: SOLF, A., DR.-ING., 8000 MUENCHEN ZAPF, C., DIPL.-ING., PAT.-ANW., 5600 WUPPERTAL |