DE2255654C2 - Polyester-Formmasse - Google Patents
Polyester-FormmasseInfo
- Publication number
- DE2255654C2 DE2255654C2 DE2255654A DE2255654A DE2255654C2 DE 2255654 C2 DE2255654 C2 DE 2255654C2 DE 2255654 A DE2255654 A DE 2255654A DE 2255654 A DE2255654 A DE 2255654A DE 2255654 C2 DE2255654 C2 DE 2255654C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- polyethylene terephthalate
- compositions
- amount
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000728 polyester Polymers 0.000 title claims description 54
- 238000000465 moulding Methods 0.000 title claims description 34
- 150000001875 compounds Chemical class 0.000 title description 22
- -1 polyethylene terephthalate Polymers 0.000 claims description 122
- 239000000203 mixture Substances 0.000 claims description 113
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 58
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 58
- 229920000642 polymer Polymers 0.000 claims description 48
- 239000000654 additive Substances 0.000 claims description 38
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 28
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 claims description 26
- 239000003063 flame retardant Substances 0.000 claims description 26
- 230000000996 additive effect Effects 0.000 claims description 17
- 229920001634 Copolyester Polymers 0.000 claims description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 16
- 239000012763 reinforcing filler Substances 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 10
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 8
- 229920001169 thermoplastic Polymers 0.000 claims description 8
- 239000004416 thermosoftening plastic Substances 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 229920000515 polycarbonate Polymers 0.000 claims description 6
- 239000004417 polycarbonate Substances 0.000 claims description 6
- 239000003381 stabilizer Substances 0.000 claims description 6
- 229920005862 polyol Polymers 0.000 claims description 5
- 230000003014 reinforcing effect Effects 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 239000000975 dye Substances 0.000 claims description 3
- 239000000049 pigment Substances 0.000 claims description 3
- 239000004014 plasticizer Substances 0.000 claims description 3
- 239000000377 silicon dioxide Substances 0.000 claims description 3
- 239000000956 alloy Substances 0.000 description 28
- 229910045601 alloy Inorganic materials 0.000 description 28
- 239000011521 glass Substances 0.000 description 27
- 238000000034 method Methods 0.000 description 19
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- 238000012360 testing method Methods 0.000 description 15
- 229920001577 copolymer Polymers 0.000 description 13
- 229920001707 polybutylene terephthalate Polymers 0.000 description 13
- 230000002787 reinforcement Effects 0.000 description 13
- 239000000835 fiber Substances 0.000 description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 10
- 230000008569 process Effects 0.000 description 9
- 229920005989 resin Polymers 0.000 description 9
- 239000011347 resin Substances 0.000 description 9
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 8
- 238000002156 mixing Methods 0.000 description 8
- 239000008188 pellet Substances 0.000 description 8
- 229910052698 phosphorus Inorganic materials 0.000 description 8
- 239000011574 phosphorus Substances 0.000 description 8
- 230000000704 physical effect Effects 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 229910019142 PO4 Inorganic materials 0.000 description 7
- 239000004743 Polypropylene Substances 0.000 description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 238000001746 injection moulding Methods 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 235000021317 phosphate Nutrition 0.000 description 7
- 229920001155 polypropylene Polymers 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 239000003365 glass fiber Substances 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 239000000178 monomer Substances 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 150000001463 antimony compounds Chemical class 0.000 description 5
- 229910000410 antimony oxide Inorganic materials 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 5
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 5
- 229920002223 polystyrene Polymers 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 4
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 4
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 4
- 239000005977 Ethylene Substances 0.000 description 4
- 239000004698 Polyethylene Substances 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000001361 adipic acid Substances 0.000 description 4
- 235000011037 adipic acid Nutrition 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000008119 colloidal silica Substances 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000001125 extrusion Methods 0.000 description 4
- 239000011152 fibreglass Substances 0.000 description 4
- 229910021485 fumed silica Inorganic materials 0.000 description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000002667 nucleating agent Substances 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 229920001225 polyester resin Polymers 0.000 description 4
- 239000004645 polyester resin Substances 0.000 description 4
- 229920000573 polyethylene Polymers 0.000 description 4
- 229920002959 polymer blend Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 229940106691 bisphenol a Drugs 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- CAYGQBVSOZLICD-UHFFFAOYSA-N hexabromobenzene Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1Br CAYGQBVSOZLICD-UHFFFAOYSA-N 0.000 description 3
- 229920006158 high molecular weight polymer Polymers 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 229920001955 polyphenylene ether Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 2
- BSWWXRFVMJHFBN-UHFFFAOYSA-N 2,4,6-tribromophenol Chemical compound OC1=C(Br)C=C(Br)C=C1Br BSWWXRFVMJHFBN-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 206010034962 Photopsia Diseases 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 125000001118 alkylidene group Chemical group 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000004074 biphenyls Chemical class 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000000919 ceramic Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000004455 differential thermal analysis Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000005496 eutectics Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229910000065 phosphene Inorganic materials 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- AQPHBYQUCKHJLT-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenyl)benzene Chemical group BrC1=C(Br)C(Br)=C(Br)C(Br)=C1C1=C(Br)C(Br)=C(Br)C(Br)=C1Br AQPHBYQUCKHJLT-UHFFFAOYSA-N 0.000 description 1
- NDRKXFLZSRHAJE-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)benzene Chemical group BrC1=C(Br)C(Br)=CC=C1C1=C(Br)C(Br)=C(Br)C(Br)=C1Br NDRKXFLZSRHAJE-UHFFFAOYSA-N 0.000 description 1
- DJHWAIPYZDRNMH-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2-bromophenyl)benzene Chemical group BrC1=CC=CC=C1C1=C(Br)C(Br)=C(Br)C(Br)=C1Br DJHWAIPYZDRNMH-UHFFFAOYSA-N 0.000 description 1
- QRFALSDGOMLVIR-UHFFFAOYSA-N 1,2,3,4-tetrabromobenzene Chemical class BrC1=CC=C(Br)C(Br)=C1Br QRFALSDGOMLVIR-UHFFFAOYSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- LAKHKLCGQAELGL-UHFFFAOYSA-N 1,3-dibromo-5-hexylbenzene Chemical compound CCCCCCC1=CC(Br)=CC(Br)=C1 LAKHKLCGQAELGL-UHFFFAOYSA-N 0.000 description 1
- SKLOHZRZUDVZDA-UHFFFAOYSA-N 1,3-dichloro-2-[2-(2,6-dichlorophenyl)ethyl]benzene Chemical compound ClC1=CC=CC(Cl)=C1CCC1=C(Cl)C=CC=C1Cl SKLOHZRZUDVZDA-UHFFFAOYSA-N 0.000 description 1
- MZGIQLRQZHLDMY-UHFFFAOYSA-N 1,3-dichloro-2-[2-(2,6-dichlorophenyl)pentan-2-yl]benzene Chemical compound ClC=1C=CC=C(Cl)C=1C(C)(CCC)C1=C(Cl)C=CC=C1Cl MZGIQLRQZHLDMY-UHFFFAOYSA-N 0.000 description 1
- UFSATALLDGOPCE-UHFFFAOYSA-N 1,3-dichloro-5-[2-(3,5-dichlorophenyl)propan-2-yl]benzene Chemical compound C=1C(Cl)=CC(Cl)=CC=1C(C)(C)C1=CC(Cl)=CC(Cl)=C1 UFSATALLDGOPCE-UHFFFAOYSA-N 0.000 description 1
- PADSMSXOUQYFSZ-UHFFFAOYSA-N 1-[(2,5-dioxopyrrol-1-yl)-diphenylmethyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)N1C(=O)C=CC1=O PADSMSXOUQYFSZ-UHFFFAOYSA-N 0.000 description 1
- XQUPVDVFXZDTLT-UHFFFAOYSA-N 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C(C=C1)=CC=C1CC1=CC=C(N2C(C=CC2=O)=O)C=C1 XQUPVDVFXZDTLT-UHFFFAOYSA-N 0.000 description 1
- FPYGQQPAMXFHJF-UHFFFAOYSA-N 1-bromo-2-(4-bromophenyl)benzene Chemical group C1=CC(Br)=CC=C1C1=CC=CC=C1Br FPYGQQPAMXFHJF-UHFFFAOYSA-N 0.000 description 1
- JIJCTHVVFOCUSV-UHFFFAOYSA-N 1-chloro-2-[(2-chlorophenyl)methyl]benzene Chemical compound ClC1=CC=CC=C1CC1=CC=CC=C1Cl JIJCTHVVFOCUSV-UHFFFAOYSA-N 0.000 description 1
- IBRQUKZZBXZOBA-UHFFFAOYSA-N 1-chloro-3-(3-chlorophenyl)sulfonylbenzene Chemical compound ClC1=CC=CC(S(=O)(=O)C=2C=C(Cl)C=CC=2)=C1 IBRQUKZZBXZOBA-UHFFFAOYSA-N 0.000 description 1
- IKAGDIWPCLTVRI-UHFFFAOYSA-N 1-chloro-4-[(4-chlorophenyl)-phenylmethyl]benzene Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 IKAGDIWPCLTVRI-UHFFFAOYSA-N 0.000 description 1
- AFFLGGQVNFXPEV-UHFFFAOYSA-N 1-decene Chemical compound CCCCCCCCC=C AFFLGGQVNFXPEV-UHFFFAOYSA-N 0.000 description 1
- OOLSRHZMXAYDFB-UHFFFAOYSA-N 1-ethyl-4-iodobenzene Chemical compound CCC1=CC=C(I)C=C1 OOLSRHZMXAYDFB-UHFFFAOYSA-N 0.000 description 1
- UFNIBRDIUNVOMX-UHFFFAOYSA-N 2,4'-dichlorobiphenyl Chemical group C1=CC(Cl)=CC=C1C1=CC=CC=C1Cl UFNIBRDIUNVOMX-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- YQPCHPBGAALCRT-UHFFFAOYSA-N 2-[1-(carboxymethyl)cyclohexyl]acetic acid Chemical compound OC(=O)CC1(CC(O)=O)CCCCC1 YQPCHPBGAALCRT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YTVQIZRDLKWECQ-UHFFFAOYSA-N 2-benzoylcyclohexan-1-one Chemical compound C=1C=CC=CC=1C(=O)C1CCCCC1=O YTVQIZRDLKWECQ-UHFFFAOYSA-N 0.000 description 1
- WKOZPNLVEMGPKZ-UHFFFAOYSA-N 2-chloro-1-[1-(2-chloro-4-iodophenyl)ethyl]-4-iodobenzene Chemical compound C=1C=C(I)C=C(Cl)C=1C(C)C1=CC=C(I)C=C1Cl WKOZPNLVEMGPKZ-UHFFFAOYSA-N 0.000 description 1
- NCVFZIASVZHSOI-UHFFFAOYSA-N 2-chloroethyl diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(OCCCl)OC1=CC=CC=C1 NCVFZIASVZHSOI-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- QDLYDXLYPXBEKO-UHFFFAOYSA-N 2-ethylhexyl bis(4-methylphenyl) phosphate Chemical compound C=1C=C(C)C=CC=1OP(=O)(OCC(CC)CCCC)OC1=CC=C(C)C=C1 QDLYDXLYPXBEKO-UHFFFAOYSA-N 0.000 description 1
- GQPZHNGYFYMRTD-UHFFFAOYSA-N 2-hydroxy-4-phenyl-1,3,2$l^{5}-dioxaphospholane 2-oxide Chemical compound O1P(O)(=O)OCC1C1=CC=CC=C1 GQPZHNGYFYMRTD-UHFFFAOYSA-N 0.000 description 1
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 1
- JMMZCWZIJXAGKW-UHFFFAOYSA-N 2-methylpent-2-ene Chemical compound CCC=C(C)C JMMZCWZIJXAGKW-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- CKNCVRMXCLUOJI-UHFFFAOYSA-N 3,3'-dibromobisphenol A Chemical compound C=1C=C(O)C(Br)=CC=1C(C)(C)C1=CC=C(O)C(Br)=C1 CKNCVRMXCLUOJI-UHFFFAOYSA-N 0.000 description 1
- MMINFSMURORWKH-UHFFFAOYSA-N 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione Chemical class O=C1OCCOC(=O)C2=CC=C1C=C2 MMINFSMURORWKH-UHFFFAOYSA-N 0.000 description 1
- ZVSXNPBSZYQDKJ-UHFFFAOYSA-N 3,8-dioxabicyclo[8.3.1]tetradeca-1(14),10,12-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=CC1=C2 ZVSXNPBSZYQDKJ-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- GPAPPPVRLPGFEQ-UHFFFAOYSA-N 4,4'-dichlorodiphenyl sulfone Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC=C(Cl)C=C1 GPAPPPVRLPGFEQ-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- ZHASZOJHMSGCJF-UHFFFAOYSA-N 4,6-dichloro-1-propylnaphthalene Chemical compound ClC1=CC=C2C(CCC)=CC=C(Cl)C2=C1 ZHASZOJHMSGCJF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229910000952 Be alloy Inorganic materials 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- FSFRZNGHSFMDIG-UHFFFAOYSA-N C1(=CC=CC=C1)C=1C=C(C=CC1Br)C(C)C1=CC(=C(C=C1)Br)C1=CC=CC=C1.ClC=1C=C(C=C(C1)Cl)C(C)C1=CC(=CC(=C1)Cl)Cl Chemical compound C1(=CC=CC=C1)C=1C=C(C=CC1Br)C(C)C1=CC(=C(C=C1)Br)C1=CC=CC=C1.ClC=1C=C(C=C(C1)Cl)C(C)C1=CC(=CC(=C1)Cl)Cl FSFRZNGHSFMDIG-UHFFFAOYSA-N 0.000 description 1
- VAAKMKLKGSYLDZ-UHFFFAOYSA-N CC(CCC(C)(C)C)COP(=O)(O)O Chemical compound CC(CCC(C)(C)C)COP(=O)(O)O VAAKMKLKGSYLDZ-UHFFFAOYSA-N 0.000 description 1
- LFXLFOXOUULNDN-UHFFFAOYSA-N CCCCC(CC)CC1=C(C)C=CC(OP(O)(O)=O)=C1CC(CC)CCCC Chemical compound CCCCC(CC)CC1=C(C)C=CC(OP(O)(O)=O)=C1CC(CC)CCCC LFXLFOXOUULNDN-UHFFFAOYSA-N 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- BVMWIXWOIGJRGE-UHFFFAOYSA-N NP(O)=O Chemical class NP(O)=O BVMWIXWOIGJRGE-UHFFFAOYSA-N 0.000 description 1
- 229920000459 Nitrile rubber Polymers 0.000 description 1
- 229920001890 Novodur Polymers 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- CGSLYBDCEGBZCG-UHFFFAOYSA-N Octicizer Chemical compound C=1C=CC=CC=1OP(=O)(OCC(CC)CCCC)OC1=CC=CC=C1 CGSLYBDCEGBZCG-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- FYAMXEPQQLNQDM-UHFFFAOYSA-N Tris(1-aziridinyl)phosphine oxide Chemical compound C1CN1P(N1CC1)(=O)N1CC1 FYAMXEPQQLNQDM-UHFFFAOYSA-N 0.000 description 1
- NXDJCCBHUGWQPG-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol;terephthalic acid Chemical compound OCC1CCC(CO)CC1.OC(=O)C1=CC=C(C(O)=O)C=C1 NXDJCCBHUGWQPG-UHFFFAOYSA-N 0.000 description 1
- 150000008360 acrylonitriles Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical class [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- 235000019395 ammonium persulphate Nutrition 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- JPNZKPRONVOMLL-UHFFFAOYSA-N azane;octadecanoic acid Chemical class [NH4+].CCCCCCCCCCCCCCCCCC([O-])=O JPNZKPRONVOMLL-UHFFFAOYSA-N 0.000 description 1
- UXJHQBVRZUANLK-UHFFFAOYSA-N azanylidyne(dichloro)-$l^{5}-phosphane Chemical compound ClP(Cl)#N UXJHQBVRZUANLK-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- YTFJQDNGSQJFNA-UHFFFAOYSA-N benzyl dihydrogen phosphate Chemical compound OP(O)(=O)OCC1=CC=CC=C1 YTFJQDNGSQJFNA-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- OFOXPUGNNSFGPE-UHFFFAOYSA-N bis(2,2-dimethylpropyl) phenyl phosphate Chemical compound CC(C)(C)COP(=O)(OCC(C)(C)C)OC1=CC=CC=C1 OFOXPUGNNSFGPE-UHFFFAOYSA-N 0.000 description 1
- ZXZYMQCBRZBVIC-UHFFFAOYSA-N bis(2-ethylhexyl) phenyl phosphate Chemical compound CCCCC(CC)COP(=O)(OCC(CC)CCCC)OC1=CC=CC=C1 ZXZYMQCBRZBVIC-UHFFFAOYSA-N 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- NTXGQCSETZTARF-UHFFFAOYSA-N buta-1,3-diene;prop-2-enenitrile Chemical compound C=CC=C.C=CC#N NTXGQCSETZTARF-UHFFFAOYSA-N 0.000 description 1
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical group OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 1
- PCVVBHUFWPHCAL-UHFFFAOYSA-N butane-1,4-diol;terephthalic acid Chemical compound OCCCCO.OC(=O)C1=CC=C(C(O)=O)C=C1 PCVVBHUFWPHCAL-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- MIHINWMALJZIBX-UHFFFAOYSA-N cyclohexa-2,4-dien-1-ol Chemical compound OC1CC=CC=C1 MIHINWMALJZIBX-UHFFFAOYSA-N 0.000 description 1
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical compound OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- PWAPCRSSMCLZHG-UHFFFAOYSA-N cyclopentylidene Chemical group [C]1CCCC1 PWAPCRSSMCLZHG-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000032798 delamination Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- YICSVBJRVMLQNS-UHFFFAOYSA-N dibutyl phenyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OC1=CC=CC=C1 YICSVBJRVMLQNS-UHFFFAOYSA-N 0.000 description 1
- RYSCVIAVOSESIU-UHFFFAOYSA-N didodecyl (4-methylphenyl) phosphate Chemical compound CCCCCCCCCCCCOP(=O)(OCCCCCCCCCCCC)OC1=CC=C(C)C=C1 RYSCVIAVOSESIU-UHFFFAOYSA-N 0.000 description 1
- OHZIKCOBQFCTDM-UHFFFAOYSA-N didodecyl phenyl phosphate Chemical compound CCCCCCCCCCCCOP(=O)(OCCCCCCCCCCCC)OC1=CC=CC=C1 OHZIKCOBQFCTDM-UHFFFAOYSA-N 0.000 description 1
- HBGGXOJOCNVPFY-UHFFFAOYSA-N diisononyl phthalate Chemical compound CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C HBGGXOJOCNVPFY-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical group 0.000 description 1
- JSPBAVGTJNAVBJ-UHFFFAOYSA-N ethyl diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(OCC)OC1=CC=CC=C1 JSPBAVGTJNAVBJ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000007380 fibre production Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical class ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229920000554 ionomer Polymers 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- XIWWDKTXRPGESF-MRVPVSSYSA-N methyl (2r)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate Chemical compound COC(=O)[C@H](N)CC1=CC(Br)=C(O)C(Br)=C1 XIWWDKTXRPGESF-MRVPVSSYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical class 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 235000014366 other mixer Nutrition 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 239000002367 phosphate rock Substances 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 1
- 125000005538 phosphinite group Chemical group 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 150000003012 phosphoric acid amides Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 125000002743 phosphorus functional group Chemical group 0.000 description 1
- 229920003192 poly(bis maleimide) Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920000306 polymethylpentene Polymers 0.000 description 1
- 239000011116 polymethylpentene Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920005606 polypropylene copolymer Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000019394 potassium persulphate Nutrition 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- VCWHRHVZWITKNJ-UHFFFAOYSA-N propane-1,2,3-triol;terephthalic acid Chemical compound OCC(O)CO.OC(=O)C1=CC=C(C(O)=O)C=C1 VCWHRHVZWITKNJ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000012747 synergistic agent Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
- 125000006836 terphenylene group Chemical group 0.000 description 1
- 150000001911 terphenyls Chemical class 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 210000002105 tongue Anatomy 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000001721 transfer moulding Methods 0.000 description 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 1
- UUFMRENXXJPPQO-UHFFFAOYSA-N triphenyl phosphate Chemical group C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1.C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 UUFMRENXXJPPQO-UHFFFAOYSA-N 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- OOZBTDPWFHJVEK-UHFFFAOYSA-N tris(2-nonylphenyl) phosphate Chemical compound CCCCCCCCCC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)CCCCCCCCC)OC1=CC=CC=C1CCCCCCCCC OOZBTDPWFHJVEK-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S260/00—Chemistry of carbon compounds
- Y10S260/35—Crystallization
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/199,037 US3953394A (en) | 1971-11-15 | 1971-11-15 | Polyester alloys and molding compositions containing the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2255654A1 DE2255654A1 (de) | 1973-05-24 |
| DE2255654C2 true DE2255654C2 (de) | 1986-12-04 |
Family
ID=22735945
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2255654A Expired DE2255654C2 (de) | 1971-11-15 | 1972-11-14 | Polyester-Formmasse |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3953394A (oth) |
| JP (1) | JPS4859148A (oth) |
| AU (1) | AU470744B2 (oth) |
| DE (1) | DE2255654C2 (oth) |
| FR (1) | FR2160490B1 (oth) |
| GB (1) | GB1398598A (oth) |
| IT (1) | IT970468B (oth) |
| NL (1) | NL7215285A (oth) |
Families Citing this family (181)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4013613A (en) * | 1971-10-01 | 1977-03-22 | General Electric Company | Reinforced intercrystalline thermoplastic polyester compositions |
| US4011193A (en) * | 1972-12-13 | 1977-03-08 | General Electric Company | Reinforced thermoplastic polyester compositions |
| JPS5517790B2 (oth) * | 1972-12-30 | 1980-05-14 | ||
| JPS5617381B2 (oth) * | 1973-03-24 | 1981-04-22 | ||
| US4351911A (en) * | 1973-07-02 | 1982-09-28 | General Electric Company | Foamable polyester composition |
| US4131594A (en) * | 1974-05-25 | 1978-12-26 | Teijin Limited | Fire-resistant thermoplastic polyester resin compositions and process for rendering polyesters fire-resistant |
| DE2460394C2 (de) * | 1974-12-20 | 1987-03-26 | Hoechst Ag, 6230 Frankfurt | Schrumpffähige Polyäthylenterephthalatfolie und ihre Verwendung |
| JPS5195452A (oth) * | 1975-02-19 | 1976-08-21 | ||
| DE2560492C2 (oth) * | 1975-02-22 | 1988-11-24 | Bayer Ag, 5090 Leverkusen, De | |
| DE2507674A1 (de) * | 1975-02-22 | 1976-09-09 | Bayer Ag | Schnellkristallisierende poly(aethylen/alkylen)-terephthalate |
| DE2515473C3 (de) * | 1975-04-09 | 1987-01-22 | Basf Ag, 6700 Ludwigshafen | Flammwidrige, lineare Polyester |
| DE2524121C2 (de) * | 1975-05-30 | 1986-02-06 | Basf Ag, 6700 Ludwigshafen | Verwendung von Polybutylenterephthalat-Formmassen zur Herstellung von Formteilen durch Spritzguß |
| US4131714A (en) * | 1975-12-22 | 1978-12-26 | Essex International, Inc. | Mixtures of linear polyesters used to coat metallic strands |
| CH594715A5 (oth) * | 1976-02-26 | 1978-01-31 | Ciba Geigy Ag | |
| US4011285A (en) * | 1976-05-14 | 1977-03-08 | Eastman Kodak Company | Molding composition comprising a blend of poly(tetramethylene terephthalate), a polyetherester and a radial teleblock copolymer |
| JPS52151346A (en) * | 1976-06-11 | 1977-12-15 | Teijin Ltd | Flame-retardant polyester compositions |
| US4011286A (en) * | 1976-07-16 | 1977-03-08 | Eastman Kodak Company | Polyetherester-radial teleblock copolymer blend molding composition |
| DE2751969A1 (de) * | 1976-11-24 | 1978-06-01 | Ciba Geigy Ag | Stabilisierte thermoplastische formmasse aus polyestern |
| US4113692A (en) * | 1976-12-06 | 1978-09-12 | General Electric Company | Reinforced thermoplastic compositions of polyester resins and a polycarbonate resin |
| US4124561A (en) * | 1976-12-06 | 1978-11-07 | General Electric Company | Reinforced thermoplastic polyester compositions having improved shatter resistance |
| US4125572A (en) * | 1976-12-14 | 1978-11-14 | General Electric Company | Thermoplastic molding composition |
| US4125571A (en) * | 1976-12-14 | 1978-11-14 | General Electric Company | Thermoplastic molding composition |
| US4169081A (en) * | 1976-12-16 | 1979-09-25 | General Electric Company | Process for the preparation of polyesters having stabilized melt viscosity in the presence of aromatic (poly-)carbonates |
| US4126592A (en) * | 1976-12-16 | 1978-11-21 | General Electric Company | Process for the preparation of polyesters having stabilized melt viscosity in the presence of aromatic poly(carbonates) |
| GB1592205A (en) * | 1976-12-23 | 1981-07-01 | Gen Electric | Reinforced thermoplastic compositions of polyester resins and glass fibers in combination with fine ground mica |
| US4122061A (en) * | 1976-12-23 | 1978-10-24 | General Electric Company | Impact modified polyester compositions |
| GB1592668A (en) * | 1976-12-29 | 1981-07-08 | Gen Electric | Reinforced thermoplastic polyester composition |
| DE2706123A1 (de) * | 1977-02-14 | 1978-08-17 | Bayer Ag | Schnell kristallisierende polyaethylenterephthalate und verfahren zu ihrer herstellung |
| US4115333A (en) * | 1977-03-18 | 1978-09-19 | General Electric Company | Warp-resistant reinforced thermoplastic compositions comprising polyester resins and zinc stearate |
| JPS53137251A (en) * | 1977-05-04 | 1978-11-30 | Mitsubishi Rayon Co Ltd | Reinforced resin composition having improved moldability |
| JPS6017223B2 (ja) * | 1977-05-25 | 1985-05-01 | 帝人株式会社 | ポリエステル組成物 |
| US4244859A (en) * | 1977-11-15 | 1981-01-13 | Teijin Limited | Aromatic polyester composition |
| DE2756925A1 (de) * | 1977-12-21 | 1979-06-28 | Gen Electric | Verstaerkte thermoplastische zusammensetzungen aus polyesterharzen und einem polycarbonatharz |
| US4140669A (en) * | 1977-12-30 | 1979-02-20 | General Electric Company | Warp-resistant reinforced thermoplastic compositions comprising polyester resins, talc and silica |
| GB2011921B (en) * | 1977-12-30 | 1982-08-18 | Gen Electric | Reinforced thermoplastic compositions of polyester resins and glass fibres in combination with particulate mica |
| US4386027A (en) * | 1977-12-30 | 1983-05-31 | General Electric Company | Flame-retarded thermoplastic polyester compositions having improved arc resistance and process for preparing same |
| US4203887A (en) * | 1978-01-19 | 1980-05-20 | General Electric Company | Modified polyester composition |
| US4311741A (en) * | 1978-03-30 | 1982-01-19 | Minnesota Mining And Manufacturing Company | Polyester films with improved processability and tear resistance |
| US4286011A (en) * | 1978-03-30 | 1981-08-25 | Minnesota Mining And Manufacturing Company | Polyester films with improved processability and tear resistance |
| US4332855A (en) * | 1978-04-14 | 1982-06-01 | Raychem Corporation | Polymeric compositions |
| CA1148291A (en) * | 1978-07-19 | 1983-06-14 | Frank N. Liberti | Reinforced thermoplastic molding compositions |
| US4220735A (en) * | 1978-12-18 | 1980-09-02 | General Electric Company | Modified polyester compositions |
| US4239677A (en) * | 1979-01-08 | 1980-12-16 | General Electric Company | Modified polyester compositions |
| US4271064A (en) * | 1979-01-08 | 1981-06-02 | General Electric Company | Modified polyester compositions |
| US4280948A (en) * | 1979-02-02 | 1981-07-28 | General Electric Company | Modified polyester compositions |
| US4373047A (en) * | 1979-02-12 | 1983-02-08 | General Electric Company | Flame retardant thermoplastic compositions with reduced bloom |
| GB2045775B (en) * | 1979-04-02 | 1983-06-15 | Gen Electric | Polyester compositions containing acrylic ester resin modifiers |
| US4414352A (en) * | 1979-05-01 | 1983-11-08 | General Electric Company | Thermoplastic molding compositions and process |
| BR8008657A (pt) * | 1979-05-01 | 1981-03-31 | Gen Electric | Composicao e processo de moldagem termoplastica |
| US4281088A (en) * | 1979-06-26 | 1981-07-28 | General Electric Company | Novel halobisphenolethylene polycarbonate-polyester blends |
| US4369282A (en) * | 1979-07-03 | 1983-01-18 | General Electric Company | Modified polyester compositions |
| US4267286A (en) * | 1979-07-03 | 1981-05-12 | General Electric Company | Modified polyester compositions |
| US4500603A (en) * | 1979-08-02 | 1985-02-19 | Celanese Corporation | Electrical grade extruded filled thermoplastic sheet material and process for the manufacture thereof |
| US4322333A (en) * | 1979-11-05 | 1982-03-30 | General Electric Company | Reinforced PBT-copolyaromatic/aliphatic block copolyesters |
| US4483955A (en) * | 1980-08-06 | 1984-11-20 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4444931A (en) * | 1980-08-06 | 1984-04-24 | Celanese Corporation | Polyester blends |
| US4351758A (en) * | 1980-08-06 | 1982-09-28 | Celanese Corporation | Polyester blends |
| US4425457A (en) | 1980-08-06 | 1984-01-10 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4370438A (en) * | 1981-04-09 | 1983-01-25 | Celanese Corporation | Polyester blend compositions exhibiting suppression of transesterification |
| US4373067A (en) * | 1981-08-04 | 1983-02-08 | General Electric Company | Molded articles of improved impact resistance and compositions therefor |
| US4645784A (en) * | 1981-09-18 | 1987-02-24 | Societe Nationale De L'amiante | Moulded compounding mixtures of adjustable density |
| US4393153A (en) * | 1981-10-30 | 1983-07-12 | General Electric Company | Impact modified glass/mineral reinforced polyester blends |
| US4436860A (en) | 1981-10-30 | 1984-03-13 | General Electric Company | Reinforced thermoplastic composition |
| EP0078937B1 (en) * | 1981-10-30 | 1986-06-11 | General Electric Company | Reinforced thermoplastic composition |
| US4377647A (en) * | 1981-11-16 | 1983-03-22 | Shell Oil Company | Polymer blend composition |
| US4403990A (en) * | 1981-12-02 | 1983-09-13 | Baxter Travenol Laboratories, Inc. | Support assembly for a cannula and the like |
| US4390668A (en) * | 1981-12-02 | 1983-06-28 | Baxter Travenol Laboratories, Inc. | Autoclavable thermoplastic material which is heat bondable to a cannula and the like |
| US4401792A (en) * | 1982-03-16 | 1983-08-30 | General Electric Company | Process for increasing the rate of crystallization of polyesters |
| US4448913A (en) * | 1982-10-29 | 1984-05-15 | Dart Industries Inc. | Fast crystallizing polyethylene terephthalate compositions |
| CA1203935A (en) * | 1982-11-17 | 1986-04-29 | John O. Goring | Raising the flash point of styrene-containing, free- radical curing resins |
| US4564658A (en) * | 1982-11-24 | 1986-01-14 | General Electric Company | Thermoplastic polyester-linear low density polyethylene molding compositions |
| US4476274A (en) * | 1983-01-03 | 1984-10-09 | General Electric Company | Linear low density polyethylene impact modifier for thermoplastic polyesters |
| US4451606A (en) * | 1983-02-23 | 1984-05-29 | General Electric Company | Copolymeric nucleating agent for polyester |
| US4753975A (en) * | 1983-05-11 | 1988-06-28 | Allied-Signal Inc. | Polyester molding composition containing low viscosity polyester reaction product |
| US4818812A (en) * | 1983-08-22 | 1989-04-04 | International Business Machines Corporation | Sealant for integrated circuit modules, polyester suitable therefor and preparation of polyester |
| DE3336315A1 (de) * | 1983-10-06 | 1985-04-25 | Chemische Fabrik Kalk GmbH, 5000 Köln | Polymere brombisphenol a-terephthalate, deren herstellung und anwendung |
| US4520854A (en) * | 1983-11-28 | 1985-06-04 | Jim May | Log splitter |
| GB2158079B (en) * | 1984-05-01 | 1987-09-16 | Diego Duse | Glass fibre reinforced polyester resins |
| FR2567137B1 (fr) * | 1984-07-05 | 1986-10-10 | Rhone Poulenc Spec Chim | Compositions a base de couples de polyesters thermoplastiques |
| EP0187176B1 (en) * | 1985-01-08 | 1991-03-20 | Toray Industries, Inc. | Metal-plated molding |
| US4778842A (en) * | 1985-02-15 | 1988-10-18 | Kuraray Co., Ltd. | Polyester resin compositions |
| US4824723A (en) * | 1986-06-02 | 1989-04-25 | General Electric Company | Flame resistant electrical insulating material |
| US5115016A (en) * | 1986-12-30 | 1992-05-19 | General Electric Company | Reinforced polyester molding compositions having high gloss and improved resistance to warping |
| BG45124A1 (oth) * | 1987-07-23 | 1989-04-14 | Nadka V Avramova | |
| US4935472A (en) * | 1988-03-28 | 1990-06-19 | General Electric Company | Solvent-resistant, compatible blends of polyphenylene ethers, and thermoplastic poly-ester mixtures |
| US5096967A (en) * | 1988-04-18 | 1992-03-17 | General Electric Company | Solvent-resistant, compatible blends of polyphenylene ethers and thermoplastic polyester mixtures |
| US5219915A (en) * | 1989-04-11 | 1993-06-15 | Basf Aktiengesellschaft | Glass fiber-reinforced thermoplastic molding materials based on polyesters and graft polymers |
| US5399608A (en) * | 1989-10-20 | 1995-03-21 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5149734A (en) * | 1989-10-20 | 1992-09-22 | General Electric Company | Highly filled thermoplastic polyester molding compositions |
| US5132353A (en) * | 1989-10-20 | 1992-07-21 | General Electric Company | Molding composition |
| US5214088A (en) * | 1989-10-20 | 1993-05-25 | General Electric Company | Highly dense thermoplastic molding compositions |
| DE4016416A1 (de) * | 1990-05-22 | 1991-11-28 | Bayer Ag | Flammgeschuetzte, nicht tropfende polyalkylenterephthalat-formmassen |
| US5159003A (en) * | 1990-10-09 | 1992-10-27 | Ferro Corporation | Polyester-compatible alloys of polycarbonate |
| JP3007409B2 (ja) * | 1990-11-19 | 2000-02-07 | ポリプラスチックス株式会社 | ポリブチレンテレフタレート樹脂製薄肉成形品 |
| US5180793A (en) * | 1991-12-31 | 1993-01-19 | Hoechst Celanese Corporation | Flame resistant, low pilling polyester fiber |
| US5300590A (en) * | 1992-11-30 | 1994-04-05 | General Electric Company | Macrocyclic polyester compositions convertible to linear polyesters of improved integrity |
| CA2103420A1 (en) * | 1992-12-22 | 1994-06-23 | Eileen B. Walsh | Stabilization of low molecular weight polybutylene terephthalate/polyester blends with phosphorus compounds |
| US5441997A (en) * | 1992-12-22 | 1995-08-15 | General Electric Company | High density polyester-polycarbonate molding composition |
| US5346767A (en) * | 1992-12-22 | 1994-09-13 | General Electric Company | Abrasion resistant highly filled polyester compositions |
| US5489640A (en) | 1994-09-01 | 1996-02-06 | General Electric Company | Compositions of poly(phenylene ether) and polyester resins, which exhibit improved heat resistance and flow |
| US5544495A (en) * | 1995-02-14 | 1996-08-13 | Frigid-Rigid, Inc. | Construction of refrigerated containers |
| US5674931A (en) * | 1995-04-07 | 1997-10-07 | General Electric Company | Flame retardant heavily filled thermoplastic composition |
| US5554674A (en) * | 1995-04-07 | 1996-09-10 | General Electric Company | Flame retardant molding thermoplastics |
| US6087591A (en) * | 1995-04-26 | 2000-07-11 | Nguyen; Phu D. | Insulated electrical conductors |
| US6020414A (en) * | 1996-10-23 | 2000-02-01 | Hoechst Celanese Corporation | Method and compositions for toughening polyester resins |
| US5840798A (en) * | 1997-06-06 | 1998-11-24 | General Electric Company | Glass filled polyester molding composition |
| US5981661A (en) * | 1997-08-29 | 1999-11-09 | General Electric Company | Modified weatherable thermoplastic resin molding compositions and articles molded therefrom |
| US6214277B1 (en) * | 1998-01-19 | 2001-04-10 | Starlite Co., Ltd. | Method for producing plastic composite molded parts |
| US6214916B1 (en) | 1998-04-29 | 2001-04-10 | General Electric Company | Composition for laser marking |
| US6011125A (en) * | 1998-09-25 | 2000-01-04 | General Electric Company | Amide modified polyesters |
| US6127475A (en) * | 1998-09-25 | 2000-10-03 | General Electric Company | Composition for laser marking |
| US6486251B1 (en) | 2000-02-29 | 2002-11-26 | General Electric Company | Special visual effect polycarbonate-polyester composition |
| US6482879B2 (en) | 2000-04-17 | 2002-11-19 | General Electric Company | Composition for laser marking |
| US20030114575A1 (en) * | 2000-08-25 | 2003-06-19 | General Electric Company | Fiber reinforced thermoplastic composition |
| US20020102419A1 (en) * | 2000-09-05 | 2002-08-01 | Toyo Boseki Kabushiki Kaisha | Polyester film, use thereof and metal laminated sheet made of said film, and metal can and metal lid made of the sheet |
| US6579609B1 (en) | 2000-11-08 | 2003-06-17 | General Electric Company | Metallized polyester composition |
| US8188172B2 (en) * | 2003-12-17 | 2012-05-29 | Sabic Innovative Plastics Ip B.V. | Polyester compositions, method of manufacture, and uses thereof |
| US8034870B2 (en) * | 2003-12-17 | 2011-10-11 | Sabic Innovative Plastics Ip B.V. | Flame-retardant polyester composition |
| US7812077B2 (en) * | 2003-12-17 | 2010-10-12 | Sabic Innovative Plastics Ip B.V. | Polyester compositions, method of manufacture, and uses thereof |
| US7807745B2 (en) * | 2006-01-27 | 2010-10-05 | Sabic Innovative Plastics Ip B.V. | Molding compositions containing polycarbonate and modified polybutylene terephthalate (PBT) random copolymers derived from polyethylene terephthalate (PET) |
| US20050165207A1 (en) * | 2003-12-31 | 2005-07-28 | General Electric Company | Polyester molding composition and process for its preparartion |
| US7452587B2 (en) * | 2004-08-11 | 2008-11-18 | Toray Industries, Inc. | Polyester resin composition for light-reflecting article |
| US20060202177A1 (en) * | 2005-03-11 | 2006-09-14 | Taiwan Textile Research Institute | Flame retardant composition |
| US8084550B2 (en) * | 2005-05-23 | 2011-12-27 | Sabic Innovative Plastics Ip B.V. | Low gloss thermoplastic composition |
| US20070173619A1 (en) * | 2005-05-23 | 2007-07-26 | Yu Claire Q | Low gloss thermoplastic articles |
| US20060270767A1 (en) * | 2005-05-26 | 2006-11-30 | Van Gisbergen Josephus Gerardu | Mineral filled polyester polycarbonate composition |
| US20060287429A1 (en) * | 2005-06-17 | 2006-12-21 | Gaggar Satish K | Glass fiber thermoplastic composite |
| US20070049690A1 (en) * | 2005-08-29 | 2007-03-01 | Pravin Borade | Impact modified poly(arylene ether)/polyester blends and method |
| US7435780B2 (en) * | 2005-11-29 | 2008-10-14 | Sabic Innovavtive Plastics Ip B.V. | Poly(arylene ether) compositions and methods of making the same |
| DE602007004072D1 (de) * | 2006-01-27 | 2010-02-11 | Gen Electric | Artikel aus zusammensetzungen mit modifizierten polybutylen-terephthalat-statistik-copolymeren aus polyethylen-terephthalat |
| US8680167B2 (en) * | 2006-01-27 | 2014-03-25 | Sabic Innovative Plastics Ip B.V. | Molding compositions containing fillers and modified polybutylene terephthalate (PBT) random copolymers derived from polyethylene terephthalate (PET) |
| US7923506B2 (en) * | 2006-01-27 | 2011-04-12 | Sabic Innovative Plastics Ip B.V. | Molding compositions containing modified polybutylene terephthalate (PBT) random copolymers derived from polyethylene terephthalate (PET) |
| WO2007089653A2 (en) * | 2006-01-27 | 2007-08-09 | General Electric Company | Molding compositions containing polyalkylene terephthalates and modified polybutylene terephthalate (pbt) random copolymers derived from pet |
| US7902263B2 (en) * | 2006-01-27 | 2011-03-08 | Sabic Innovative Plastics Ip B.V. | Process for making polybutylene terephthalate (PBT) from polyethylene terephthalate (PET) |
| US7795320B2 (en) * | 2006-01-27 | 2010-09-14 | Sabic Innovative Plastics Ip B.V. | Copolyetheresters derived from polyethylene terephthalate |
| US7799836B2 (en) * | 2006-03-01 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Process for making polybutylene terephthalate (PBT) from polyethylene terephthalate (PET) |
| US20070213473A1 (en) * | 2006-03-09 | 2007-09-13 | Yu Claire Q | Composition and method of use |
| US8309656B2 (en) | 2006-07-26 | 2012-11-13 | Sabic Innovative Plastics Ip B.V. | Elastomer blends containing polycarbonates and copolyetheresters derived from polyethylene terephthalate, method of manufacture, and articles therefrom |
| US7799838B2 (en) | 2006-07-26 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Elastomer blends of polyesters and copolyetheresters derived from polyethylene terephthalate, method of manufacture, and articles therefrom |
| US8158710B2 (en) * | 2006-11-27 | 2012-04-17 | Sabic Innovative Plastics Ip B.V. | Polyester blends, methods of making, and articles formed therefrom |
| US8217101B2 (en) | 2007-03-02 | 2012-07-10 | Bayer Materialscience Llc | Flame retardant thermoplastic molding composition |
| US20080248278A1 (en) * | 2007-04-02 | 2008-10-09 | General Electric Company | Fiber reinforced thermoplastic sheets with surface coverings and methods of making |
| US8092717B2 (en) * | 2007-07-12 | 2012-01-10 | Sabic Innovative Plastics Ip B.V. | Thermoplastic poly(arylene ether) / polyester blends and articles thereof |
| US8536272B2 (en) * | 2007-07-12 | 2013-09-17 | Sabic Innovative Plastics Ip B.V. | Thermoplastic poly(arylene ether)/polyester blends and method of making |
| US20090069489A1 (en) * | 2007-09-12 | 2009-03-12 | Peter Vollenberg | Polycarbonate-poly(ester-ether) copolymer composition, method of manufacture, and articles therefrom |
| US20090170985A1 (en) * | 2007-12-28 | 2009-07-02 | Rina Ai | Polyester-polyamide compositions, articles, and method of manufacture thereof |
| US7799892B2 (en) * | 2008-05-02 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Method of making polybutylene terephthalate and compositions and articles comprising the same |
| US8017697B2 (en) * | 2008-06-24 | 2011-09-13 | Sabic Innovative Plastics Ip B.V. | Poly(arylene ether)-polysiloxane composition and method |
| EP2169007B1 (en) * | 2008-09-30 | 2012-07-11 | SABIC Innovative Plastics IP B.V. | Method for preparing a poly(arylene ether) composition with improved melt flow |
| US7847032B2 (en) * | 2008-12-10 | 2010-12-07 | Sabic Innovative Plastics Ip B.V. | Poly(arylene ether) composition and extruded articles derived therefrom |
| US7910657B2 (en) * | 2008-12-30 | 2011-03-22 | Sabic Innovative Plastics Ip B.V. | Process for the manufacture of polybutylene terephthalate copolymers from polyethylene terephthalate, and compositions and articles thereof |
| US8138244B2 (en) * | 2008-12-30 | 2012-03-20 | Sabic Innovative Plastics Ip B.V. | Reinforced polyester compositions, method of manufacture, and articles thereof |
| US8017716B2 (en) | 2009-07-01 | 2011-09-13 | Sabic Innovative Plastics Ip B.V. | Morpholine-substituted poly(arylene ether) and method for the preparation thereof |
| KR101288561B1 (ko) * | 2009-12-11 | 2013-07-22 | 제일모직주식회사 | 유리섬유 강화 폴리에스테르 수지 조성물 및 이를 이용한 성형품 |
| US20110152420A1 (en) * | 2009-12-22 | 2011-06-23 | Mark Elkovitch | Poly(arylene ether)/polyamide compositions, methods, and articles |
| US8309655B2 (en) | 2009-12-22 | 2012-11-13 | Sabic Innovative Plastics Ip B.V. | Methods for the preparation of a poly(arylene ether) polysiloxane multiblock copolymer, multiblock copolymers produced thereby, and associated compositions and articles |
| US8450412B2 (en) * | 2009-12-22 | 2013-05-28 | Sabic Innovative Plastics Ip B.V. | Flame retardant polyamide composition, method, and article |
| US8716378B2 (en) | 2010-06-29 | 2014-05-06 | Sabic Innovative Plastics Ip B.V. | Flame resistant polyester compositions, method of manufacture, and articles thereof |
| US8686072B2 (en) | 2010-06-29 | 2014-04-01 | Sabic Innovative Plastics Ip B.V. | Flame resistant polyester compositions, method of manufacture, and articles therof |
| US8883279B2 (en) | 2010-09-30 | 2014-11-11 | Ticona Llc | Fluid-assisted injection molded articles and process |
| US20120246873A1 (en) * | 2011-04-01 | 2012-10-04 | Rama Konduri | Hollow articles comprising fiber-filled polyester compositions, methods of manufacture, and uses thereof |
| US20120319031A1 (en) | 2011-06-15 | 2012-12-20 | Thermal Solution Resources, Llc | Thermally conductive thermoplastic compositions |
| US8669332B2 (en) | 2011-06-27 | 2014-03-11 | Sabic Innovative Plastics Ip B.V. | Poly(arylene ether)-polysiloxane composition and method |
| US8557158B2 (en) | 2011-08-23 | 2013-10-15 | Sabic Innovative Plastics Ip B.V. | Molded article having enhanced aesthetic effect and method and system for making the molded article |
| US8722837B2 (en) | 2012-01-31 | 2014-05-13 | Sabic Innovative Plastics Ip B.V. | Poly(phenylene ether)-polysiloxane composition and method |
| KR102272782B1 (ko) | 2013-04-19 | 2021-07-08 | 코베스트로 엘엘씨 | 몰드 내 전자 인쇄 회로 기판 캡슐화 및 조립체 |
| KR101735886B1 (ko) * | 2014-05-30 | 2017-05-16 | 롯데첨단소재(주) | 열가소성 수지 조성물 및 이를 포함하는 성형품 |
| CN107250280A (zh) | 2015-02-23 | 2017-10-13 | 沙特基础工业全球技术有限公司 | 耐漏电起痕组合物、由其形成的制品及其制造方法 |
| WO2016137862A2 (en) | 2015-02-23 | 2016-09-01 | Sabic Global Technologies B.V. | Electrical tracking resistance compositions, articles formed therefrom, and methods of manufacture thereof |
| JP6843841B2 (ja) * | 2016-04-13 | 2021-03-17 | デンカ株式会社 | 人工毛用樹脂組成物及びその成形体 |
| US11512198B2 (en) * | 2017-06-21 | 2022-11-29 | Eastman Chemical Company | Polyvinyl chloride and copolyester compositions and articles made using these compositions |
| US10639873B1 (en) * | 2017-07-26 | 2020-05-05 | Toray Plastics (America), Inc. | Heat sealing polyester films with low coefficient of friction |
| WO2019217680A1 (en) * | 2018-05-11 | 2019-11-14 | Sabic Global Technologies B.V. | Reinforced polyester structural components |
| CN113170586A (zh) | 2018-10-09 | 2021-07-23 | 科思创有限公司 | 使用导热聚碳酸酯的插入模制电子模块以及模制互锁特征件 |
| US11198782B2 (en) | 2018-12-14 | 2021-12-14 | Eastman Chemical Company | Polyvinyl chloride, polycarbonate and copolyester compositions and articles made using these compositions |
| US11198781B2 (en) | 2018-12-14 | 2021-12-14 | Eastman Chemical Company | Polyvinyl chloride, polycarbonate and copolyester compositions and articles made using these compositions |
| KR20220054797A (ko) | 2019-08-28 | 2022-05-03 | 코베스트로 인텔렉쳐 프로퍼티 게엠베하 운트 콤파니 카게 | 난연성 폴리카르보네이트 조성물 및 그로부터 제조된 성형품 뿐만 아니라 물품 |
| US20230097414A1 (en) * | 2020-03-20 | 2023-03-30 | Sabic Global Technologies B.V. | Heat resistant aromatic polycarbonate - polyester composition |
| KR20230147625A (ko) | 2021-02-25 | 2023-10-23 | 코베스트로 도이칠란트 아게 | 내열성 반-전도성 열가소성 수지 조성물 |
| EP4430122B1 (en) | 2021-11-10 | 2025-12-03 | Covestro Deutschland AG | Heat-resistant thermoplastic electrostatic dissipative composition |
| TWI895798B (zh) * | 2023-09-15 | 2025-09-01 | 南亞塑膠工業股份有限公司 | 聚碳酸酯-聚乙烯對苯二甲酸酯的合金材料 |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2465319A (en) * | 1941-07-29 | 1949-03-22 | Du Pont | Polymeric linear terephthalic esters |
| US2691006A (en) * | 1948-09-21 | 1954-10-05 | Goodyear Tire & Rubber | Copolymers of two different linear polyesters |
| NL104015C (oth) | 1953-10-16 | |||
| US3382305A (en) * | 1954-10-29 | 1968-05-07 | Du Pont | Process for preparing oriented microfibers |
| US3148172A (en) * | 1956-07-19 | 1964-09-08 | Gen Electric | Polycarbonates of dihydroxyaryl ethers |
| US3005795A (en) * | 1957-12-10 | 1961-10-24 | Du Pont | Thermoplastic resins containing finely divided, fibrous polytetrafluoroethylene |
| NL295738A (oth) * | 1962-07-27 | 1900-01-01 | ||
| GB1060401A (en) * | 1963-03-28 | 1967-03-01 | Kurashiki Rayon Kk | Method of manufacturing stable block copolyesters and polyester mixtures |
| FR84238E (fr) * | 1963-04-08 | 1964-12-24 | Organico | Matières thermoplastiques améliorées et leur procédé de fabrication |
| US3368995A (en) * | 1965-08-03 | 1968-02-13 | Teijin Ltd | Fiberglass reinforced polyethylene terephthalate |
| US3437631A (en) * | 1967-02-13 | 1969-04-08 | Mobay Chemical Corp | Body protective device composed of polycarbonate resins admixed with polyolefins and pigments |
| US3466348A (en) * | 1967-03-27 | 1969-09-09 | Goodyear Tire & Rubber | Polyester melt blends |
| DE1694218A1 (de) * | 1967-11-09 | 1971-04-08 | Hoechst Ag | Thermoplastische Formmassen |
| US3639331A (en) * | 1968-03-25 | 1972-02-01 | Dart Ind Inc | Glass fiber reinforced resins containing dispersion aid |
| US3546320A (en) * | 1968-03-25 | 1970-12-08 | Sun Oil Co | Polyalkylene terephthalate molding composition |
| US3516957A (en) * | 1968-04-29 | 1970-06-23 | Eastman Kodak Co | Thermoplastic polyester composition containing organic ester mold release agent |
| US3654219A (en) * | 1968-06-19 | 1972-04-04 | William M Boyer | Novel fiber glass-reinforced resin compositions and processes for their preparation |
| CA978715A (en) * | 1969-03-12 | 1975-12-02 | John T. Allan | Resilient polyester fibers |
| BE755317A (fr) * | 1969-08-29 | 1971-02-26 | Celanese Corp | Resine de moulage et son procede de production |
| BE756520A (fr) * | 1969-09-25 | 1971-03-23 | Ici Ltd | Melanges de polymeres thermoplastiques |
| US3644267A (en) * | 1970-01-28 | 1972-02-22 | Eastman Kodak Co | Low-viscosity high-strength thermoplastic adhesive |
| US3624024A (en) * | 1970-02-24 | 1971-11-30 | Eastman Kodak Co | Flame retardant poly(tetramethylene terephthalate) molding compositions |
| US3671487A (en) * | 1971-05-05 | 1972-06-20 | Gen Electric | Glass reinforced polyester resins containing polytetrafluoroethylene and flame retardant additives |
| JPS4831247A (oth) * | 1971-08-25 | 1973-04-24 | ||
| US3988387A (en) * | 1974-03-07 | 1976-10-26 | Mitsubishi Rayon Co., Ltd. | Polyester fibers having excellent dyeability |
-
1971
- 1971-11-15 US US05/199,037 patent/US3953394A/en not_active Expired - Lifetime
-
1972
- 1972-08-16 GB GB3815472A patent/GB1398598A/en not_active Expired
- 1972-10-05 JP JP47100250A patent/JPS4859148A/ja active Pending
- 1972-11-10 NL NL7215285A patent/NL7215285A/xx not_active Application Discontinuation
- 1972-11-14 AU AU48851/72A patent/AU470744B2/en not_active Expired
- 1972-11-14 IT IT31623/72A patent/IT970468B/it active
- 1972-11-14 DE DE2255654A patent/DE2255654C2/de not_active Expired
- 1972-11-15 FR FR7240546A patent/FR2160490B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3953394B1 (oth) | 1987-06-02 |
| NL7215285A (oth) | 1973-05-17 |
| DE2255654A1 (de) | 1973-05-24 |
| JPS4859148A (oth) | 1973-08-18 |
| US3953394A (en) | 1976-04-27 |
| IT970468B (it) | 1974-04-10 |
| FR2160490B1 (oth) | 1979-05-04 |
| AU4885172A (en) | 1974-05-23 |
| AU470744B2 (en) | 1976-03-25 |
| GB1398598A (en) | 1975-06-25 |
| FR2160490A1 (oth) | 1973-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2255654C2 (de) | Polyester-Formmasse | |
| DE2248242A1 (de) | Verstaerkte interkristalline thermoplastische polyester-zusammensetzungen | |
| DE2446452C2 (de) | Thermoplastische Preßmasse | |
| DE2506094C2 (de) | Thermoplastische Formmasse | |
| DE69333179T2 (de) | Stabilisierung von Polybutylenterephthalat-Polyester Mischungen | |
| DE2515473C3 (de) | Flammwidrige, lineare Polyester | |
| DE69311223T2 (de) | Formbare kristalline Polyesterzusammensetzung | |
| DE2221772A1 (de) | Entflammungshemmende,glasverstaerkte Polyester-Harze | |
| DE2331826A1 (de) | Thermoplastische massen | |
| DE2920246A1 (de) | Polyestermasse fuer die herstellung von formkoerpern und die daraus hergestellten formkoerper | |
| DE2757323A1 (de) | Thermoplastische copolyester | |
| DE2035390A1 (de) | Formmasse zur Herstellung von Polyester formkorpern | |
| DE2364318A1 (de) | Hochmolekulare thermoplastische massen | |
| DE2655162A1 (de) | Geschaeumte thermoplastische zusammensetzungen aus einem linearen polyester und einem ionisch vernetzten copolymeren | |
| DE3000290A1 (de) | Modifizierte polyester-zusammensetzungen | |
| DE2629539A1 (de) | Thermoplastische formmassen aus einem linearen polyester und einem poly(esterurethan) | |
| DE2856076C2 (oth) | ||
| DE2242509A1 (de) | Nicht-tropfende, flammhemmende, mit glas verstaerkte polyesterharze | |
| DE3806271A1 (de) | Thermoplastische formmassen auf der basis von polyamiden und ethylencopolymerisaten | |
| DE2533578A1 (de) | Lichtstabilisierte polyesterharzzusammensetzungen | |
| DE3000282A1 (de) | Modifizierte polyester-zusammensetzungen | |
| DE69204175T2 (de) | Schnell kristallisierende Polyesterformmassen. | |
| DE3002985A1 (de) | Modifizierte polyester-zusammensetzungen | |
| DE2757557A1 (de) | Flammhemmende thermoplastische zusammensetzungen | |
| EP0613916B1 (de) | Formmasse auf der Grundlage von Polyarylenethern mit Anhydridendgruppen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent |