DE2243708A1 - Verfahren und vorrichtung zur erzeugung von glimmentladungen - Google Patents
Verfahren und vorrichtung zur erzeugung von glimmentladungenInfo
- Publication number
- DE2243708A1 DE2243708A1 DE2243708A DE2243708A DE2243708A1 DE 2243708 A1 DE2243708 A1 DE 2243708A1 DE 2243708 A DE2243708 A DE 2243708A DE 2243708 A DE2243708 A DE 2243708A DE 2243708 A1 DE2243708 A1 DE 2243708A1
- Authority
- DE
- Germany
- Prior art keywords
- electrodes
- cathode
- trap
- magnetic field
- electrode
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 35
- 150000002500 ions Chemical class 0.000 claims description 37
- 239000000463 material Substances 0.000 claims description 34
- 238000004544 sputter deposition Methods 0.000 claims description 11
- 230000003993 interaction Effects 0.000 claims description 7
- 239000000110 cooling liquid Substances 0.000 claims description 4
- 230000005855 radiation Effects 0.000 claims description 3
- 210000002381 plasma Anatomy 0.000 description 87
- 239000012212 insulator Substances 0.000 description 45
- 239000007789 gas Substances 0.000 description 30
- 238000000889 atomisation Methods 0.000 description 21
- 238000009826 distribution Methods 0.000 description 20
- 239000000498 cooling water Substances 0.000 description 18
- 238000007789 sealing Methods 0.000 description 17
- 230000008569 process Effects 0.000 description 12
- 230000008901 benefit Effects 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 10
- 239000002184 metal Substances 0.000 description 10
- 125000006850 spacer group Chemical group 0.000 description 10
- 238000000151 deposition Methods 0.000 description 9
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 8
- 230000008021 deposition Effects 0.000 description 8
- 229910001220 stainless steel Inorganic materials 0.000 description 7
- 239000010935 stainless steel Substances 0.000 description 7
- 239000004033 plastic Substances 0.000 description 6
- 229920003023 plastic Polymers 0.000 description 6
- 238000000576 coating method Methods 0.000 description 5
- 238000004804 winding Methods 0.000 description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 4
- 229910052786 argon Inorganic materials 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 230000001965 increasing effect Effects 0.000 description 4
- 238000010849 ion bombardment Methods 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- POIUWJQBRNEFGX-XAMSXPGMSA-N cathelicidin Chemical compound C([C@@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(O)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C)C1=CC=CC=C1 POIUWJQBRNEFGX-XAMSXPGMSA-N 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000011810 insulating material Substances 0.000 description 3
- 238000009413 insulation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 239000000615 nonconductor Substances 0.000 description 3
- 238000007639 printing Methods 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000010406 cathode material Substances 0.000 description 2
- 229910010293 ceramic material Inorganic materials 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 239000002826 coolant Substances 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000000696 magnetic material Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 238000007740 vapor deposition Methods 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920004142 LEXAN™ Polymers 0.000 description 1
- 239000004418 Lexan Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 239000012777 electrically insulating material Substances 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000010893 electron trap Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000036449 good health Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000004941 influx Effects 0.000 description 1
- 238000000752 ionisation method Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002663 nebulization Methods 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000005019 vapor deposition process Methods 0.000 description 1
- 239000011364 vaporized material Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J37/00—Discharge tubes with provision for introducing objects or material to be exposed to the discharge, e.g. for the purpose of examination or processing thereof
- H01J37/32—Gas-filled discharge tubes
- H01J37/34—Gas-filled discharge tubes operating with cathodic sputtering
- H01J37/3402—Gas-filled discharge tubes operating with cathodic sputtering using supplementary magnetic fields
Landscapes
- Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Plasma & Fusion (AREA)
- Chemical & Material Sciences (AREA)
- Analytical Chemistry (AREA)
- Physical Vapour Deposition (AREA)
- Plasma Technology (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US178240A US3884793A (en) | 1971-09-07 | 1971-09-07 | Electrode type glow discharge apparatus |
| US25450472A | 1972-05-18 | 1972-05-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2243708A1 true DE2243708A1 (de) | 1973-04-26 |
Family
ID=26874127
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2243708A Withdrawn DE2243708A1 (de) | 1971-09-07 | 1972-09-06 | Verfahren und vorrichtung zur erzeugung von glimmentladungen |
| DE2264436*A Withdrawn DE2264436A1 (de) | 1971-09-07 | 1972-09-06 | Verfahren zum zerstaeuben von material von zwei ausgangselektroden auf eine traegerflaeche |
| DE2264437*A Withdrawn DE2264437A1 (de) | 1971-09-07 | 1972-09-06 | Mit hochfrequenz-spannung betriebene entladungsvorrichtung |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2264436*A Withdrawn DE2264436A1 (de) | 1971-09-07 | 1972-09-06 | Verfahren zum zerstaeuben von material von zwei ausgangselektroden auf eine traegerflaeche |
| DE2264437*A Withdrawn DE2264437A1 (de) | 1971-09-07 | 1972-09-06 | Mit hochfrequenz-spannung betriebene entladungsvorrichtung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3884793A (enExample) |
| CA (1) | CA1006116A (enExample) |
| CH (1) | CH589940A5 (enExample) |
| DE (3) | DE2243708A1 (enExample) |
| FR (2) | FR2152633B1 (enExample) |
| GB (2) | GB1420061A (enExample) |
| IL (1) | IL40285A (enExample) |
| NL (1) | NL7211911A (enExample) |
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2417288A1 (de) * | 1974-01-31 | 1975-08-14 | Airco Inc | Zerstaeubungsvorrichtung |
| DE2556607A1 (de) * | 1974-12-16 | 1976-06-24 | Airco Inc | Kathodenzerstaeubungsgeraet |
| DE2655942A1 (de) * | 1976-12-10 | 1978-06-15 | Tokuda Seisakusho Kawasaki Kk | Zerstaeubungsvorrichtung |
| DE2920780A1 (de) * | 1978-08-21 | 1980-03-06 | Vac Tec Syst | Zerstaeubungsvorrichtung mit magnetischer verstaerkung |
| DE3107914A1 (de) * | 1981-03-02 | 1982-09-16 | Leybold-Heraeus GmbH, 5000 Köln | Verfahren und vorrichtung zum beschichten von formteilen durch katodenzerstaeubung |
| DE3211229A1 (de) * | 1981-03-27 | 1982-10-14 | Nihon Shinku Gijutsu K.K., Chigasaki, Kanagawa | Vorrichtung zur ferromagnetischen schnellzerstaeubung |
| DE3427587A1 (de) * | 1984-07-26 | 1986-02-06 | Leybold-Heraeus GmbH, 5000 Köln | Zerstaeubungseinrichtung fuer katodenzerstaeubungsanlagen |
| DE3442208A1 (de) * | 1984-11-19 | 1986-05-28 | Leybold-Heraeus GmbH, 5000 Köln | Verfahren und vorrichtung zum herstellen harten kohlenstoffschichten |
| DE3527626A1 (de) * | 1985-08-01 | 1987-02-05 | Leybold Heraeus Gmbh & Co Kg | Zerstaeubungskatode nach dem magnetronprinzip |
| US4810346A (en) * | 1987-08-21 | 1989-03-07 | Leybold Aktiengesellschaft | Magnetron type sputtering cathode |
| DE3908252A1 (de) * | 1989-03-14 | 1990-09-20 | Leybold Ag | Zerstaeubungskathode nach dem magnetron-prinzip |
| DE4018914C1 (enExample) * | 1990-06-13 | 1991-06-06 | Leybold Ag, 6450 Hanau, De | |
| DE4100291C1 (enExample) * | 1991-01-08 | 1991-10-02 | Leybold Ag, 6450 Hanau, De | |
| DE4135939A1 (de) * | 1991-10-31 | 1993-05-06 | Leybold Ag, 6450 Hanau, De | Zerstaeubungskathode |
| US5415757A (en) * | 1991-11-26 | 1995-05-16 | Leybold Aktiengesellschaft | Apparatus for coating a substrate with electrically nonconductive coatings |
| DE4138793C2 (de) * | 1991-11-26 | 2001-03-01 | Leybold Ag | Verfahren und Vorrichtung zum Beschichten eines Substrats, insbesondere mit elektrisch nichtleitenden Schichten |
| US7938943B2 (en) | 2006-10-17 | 2011-05-10 | Von Ardenne Anlagentechnic GmbH | Supply end block for rotary magnetron |
| DE102007049735B4 (de) * | 2006-10-17 | 2012-03-29 | Von Ardenne Anlagentechnik Gmbh | Versorgungsendblock für ein Rohrmagnetron |
Families Citing this family (62)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51117933A (en) * | 1975-04-10 | 1976-10-16 | Tokuda Seisakusho | Spattering apparatus |
| FR2324755A1 (fr) * | 1975-09-19 | 1977-04-15 | Anvar | Dispositif de pulverisation cathodique de grande vitesse de depot |
| US4046660A (en) * | 1975-12-29 | 1977-09-06 | Bell Telephone Laboratories, Incorporated | Sputter coating with charged particle flux control |
| NL7607473A (nl) * | 1976-07-07 | 1978-01-10 | Philips Nv | Verstuifinrichting en werkwijze voor het ver- stuiven met een dergelijke inrichting. |
| US4179351A (en) * | 1976-09-09 | 1979-12-18 | Hewlett-Packard Company | Cylindrical magnetron sputtering source |
| US4126530A (en) * | 1977-08-04 | 1978-11-21 | Telic Corporation | Method and apparatus for sputter cleaning and bias sputtering |
| FR2423065A1 (fr) * | 1978-04-12 | 1979-11-09 | Battelle Memorial Institute | Procede de fabrication d'electrodes pour piles a combustible, dispositif pour la mise en oeuvre du procede et electrodes resultant de ce procede |
| EP0045822B1 (en) * | 1980-08-08 | 1985-05-29 | Battelle Development Corporation | Cylindrical magnetron sputtering cathode |
| ATE10512T1 (de) * | 1980-08-08 | 1984-12-15 | Battelle Development Corporation | Vorrichtung zur beschichtung von substraten mittels hochleistungskathodenzerstaeubung sowie zerstaeuberkathode fuer diese vorrichtung. |
| US4290877A (en) * | 1980-09-08 | 1981-09-22 | The United States Of America As Represented By The Secretary Of The Interior | Sputtering apparatus for coating elongated tubes and strips |
| US4525264A (en) * | 1981-12-07 | 1985-06-25 | Ford Motor Company | Cylindrical post magnetron sputtering system |
| US4422896A (en) * | 1982-01-26 | 1983-12-27 | Materials Research Corporation | Magnetically enhanced plasma process and apparatus |
| US4525262A (en) * | 1982-01-26 | 1985-06-25 | Materials Research Corporation | Magnetron reactive bias sputtering method and apparatus |
| US4376025A (en) * | 1982-06-14 | 1983-03-08 | Battelle Development Corporation | Cylindrical cathode for magnetically-enhanced sputtering |
| US4581118A (en) * | 1983-01-26 | 1986-04-08 | Materials Research Corporation | Shaped field magnetron electrode |
| JPS60221563A (ja) * | 1984-04-17 | 1985-11-06 | Ulvac Corp | バイアススパッタ方法 |
| US4865712A (en) * | 1984-05-17 | 1989-09-12 | Varian Associates, Inc. | Apparatus for manufacturing planarized aluminum films |
| US4711767A (en) * | 1985-02-05 | 1987-12-08 | Psi Star | Plasma reactor with voltage transformer |
| US4600563A (en) * | 1985-02-05 | 1986-07-15 | Psi Star Incorporated | Plasma reactor with voltage transformer |
| US4668338A (en) * | 1985-12-30 | 1987-05-26 | Applied Materials, Inc. | Magnetron-enhanced plasma etching process |
| DE3636524A1 (de) * | 1986-10-27 | 1988-04-28 | Vtu Angel Kancev | Einrichtung zum auftragen von ueberzuegen im vakuum durch magnetronzerstaeubung |
| BE1001027A3 (nl) * | 1987-10-21 | 1989-06-13 | Bekaert Sa Nv | Werkwijze en inrichting voor het reinigen van een langwerpig metalen substraat, zoals een draad, een band, een koord, enz., alsmede volgens die werkwijze gereinigde substraten en met dergelijke substraten versterkte voorwerpen uit polymeermateriaal. |
| JP2673807B2 (ja) * | 1987-10-30 | 1997-11-05 | パイオニア株式会社 | 光磁気記録媒体の製造方法 |
| US4842703A (en) * | 1988-02-23 | 1989-06-27 | Eaton Corporation | Magnetron cathode and method for sputter coating |
| US4810347A (en) * | 1988-03-21 | 1989-03-07 | Eaton Corporation | Penning type cathode for sputter coating |
| DE3844064A1 (de) * | 1988-12-28 | 1990-07-05 | Leybold Ag | Katodenzerstaeubungsvorrichtung nach dem magnetron-prinzip mit einer hohlkatode und einem zylindrischen target |
| US4927515A (en) * | 1989-01-09 | 1990-05-22 | The Board Of Trustees Of The Leland Stanford Junior University | Circular magnetron sputtering device |
| US4957605A (en) * | 1989-04-17 | 1990-09-18 | Materials Research Corporation | Method and apparatus for sputter coating stepped wafers |
| US5178743A (en) * | 1989-06-15 | 1993-01-12 | Microelectronics And Computer Technology Corporation | Cylindrical magnetron sputtering system |
| US5073245A (en) * | 1990-07-10 | 1991-12-17 | Hedgcoth Virgle L | Slotted cylindrical hollow cathode/magnetron sputtering device |
| US5437778A (en) * | 1990-07-10 | 1995-08-01 | Telic Technologies Corporation | Slotted cylindrical hollow cathode/magnetron sputtering device |
| WO1992018663A1 (en) * | 1991-04-19 | 1992-10-29 | Surface Solutions, Incorporated | Method and apparatus for linear magnetron sputtering |
| GB2256085A (en) * | 1991-05-13 | 1992-11-25 | Integrated Plasma Ltd | Plasma deposition and etching of substrates. |
| US5228963A (en) * | 1991-07-01 | 1993-07-20 | Himont Incorporated | Hollow-cathode magnetron and method of making thin films |
| US5685961A (en) * | 1992-03-27 | 1997-11-11 | P & D Medical Coatings, Inc. | Method for fabrication of metallized medical devices |
| DE4333825C1 (de) * | 1993-09-28 | 1995-02-23 | Mat Gmbh | Vorrichtung zum Beschichten von langgestreckten biegsamen Erzeugnissen |
| US6217716B1 (en) | 1998-05-06 | 2001-04-17 | Novellus Systems, Inc. | Apparatus and method for improving target erosion in hollow cathode magnetron sputter source |
| US6432286B1 (en) | 1998-06-10 | 2002-08-13 | David A. Glocker | Conical sputtering target |
| US6066242A (en) * | 1998-06-10 | 2000-05-23 | David A. Glocker | Conical sputtering target |
| US6235170B1 (en) | 1998-06-10 | 2001-05-22 | David A. Glocker | Conical sputtering target |
| US6352430B1 (en) | 1998-10-23 | 2002-03-05 | Goodrich Corporation | Method and apparatus for cooling a CVI/CVD furnace |
| US6440220B1 (en) * | 1998-10-23 | 2002-08-27 | Goodrich Corporation | Method and apparatus for inhibiting infiltration of a reactive gas into porous refractory insulation |
| US6162298A (en) * | 1998-10-28 | 2000-12-19 | The B. F. Goodrich Company | Sealed reactant gas inlet for a CVI/CVD furnace |
| US6193853B1 (en) | 1999-02-25 | 2001-02-27 | Cametoid Limited | Magnetron sputtering method and apparatus |
| DE60013208T2 (de) | 1999-06-04 | 2005-08-11 | Goodrich Corp. | Suzeptordeckel sowohl für Gasphaseninfiltration bzw. -Beschichtung als auch Wärmebehandlung |
| DE60005888T2 (de) | 1999-06-04 | 2004-07-29 | Goodrich Corp. | Verfahren und Vorrichtung zur Druckmessung in einer CVD/CVI-Kammer |
| EP1063319B1 (en) | 1999-06-04 | 2005-12-07 | Goodrich Corporation | Method and apparatus for cooling a CVI/CVD furnace |
| TW584905B (en) | 2000-02-25 | 2004-04-21 | Tokyo Electron Ltd | Method and apparatus for depositing films |
| US6497803B2 (en) | 2000-05-31 | 2002-12-24 | Isoflux, Inc. | Unbalanced plasma generating apparatus having cylindrical symmetry |
| US6551477B2 (en) | 2000-09-25 | 2003-04-22 | Isoflux, Inc. | Interlocking cylindrical magnetron cathodes and targets |
| US6887356B2 (en) * | 2000-11-27 | 2005-05-03 | Cabot Corporation | Hollow cathode target and methods of making same |
| US6759807B2 (en) | 2002-04-04 | 2004-07-06 | Veeco Instruments, Inc. | Multi-grid ion beam source for generating a highly collimated ion beam |
| AT414215B (de) * | 2003-02-12 | 2006-10-15 | Peter Ziger | Anlage zur plasmaprozessierung |
| US20050288773A1 (en) * | 2004-01-22 | 2005-12-29 | Glocker David A | Radiopaque coating for biomedical devices |
| US8894824B2 (en) * | 2004-06-28 | 2014-11-25 | Isoflux, Inc. | Porous coatings for biomedical implants |
| JP5467735B2 (ja) * | 2007-07-02 | 2014-04-09 | 東ソー株式会社 | 円筒形スパッタリングターゲット |
| DE102008052217B3 (de) * | 2008-10-17 | 2011-03-10 | Johann Wolfgang Goethe-Universität | Elektrostatischer Ionenkompressor |
| US20140061039A1 (en) * | 2012-09-05 | 2014-03-06 | Applied Materials, Inc. | Target cooling for physical vapor deposition (pvd) processing systems |
| WO2015076162A1 (ja) * | 2013-11-22 | 2015-05-28 | 東レ株式会社 | プラズマ電極、プラズマ処理電極、cvd電極、プラズマcvd装置及び薄膜付基材の製造方法 |
| CA3063389C (en) | 2019-12-02 | 2021-03-30 | 2S Water Incorporated | Solution electrode glow discharge apparatus |
| CA3068769A1 (en) | 2020-01-20 | 2021-07-20 | 2S Water Incorporated | Liquid electrode tip |
| WO2022059278A1 (ja) * | 2020-09-16 | 2022-03-24 | 株式会社アルバック | 回転式カソードユニット用の駆動ブロック |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3282816A (en) * | 1963-09-16 | 1966-11-01 | Ibm | Process of cathode sputtering from a cylindrical cathode |
| US3369991A (en) * | 1965-01-28 | 1968-02-20 | Ibm | Apparatus for cathode sputtering including a shielded rf electrode |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3282815A (en) * | 1963-07-01 | 1966-11-01 | Ibm | Magnetic control of film deposition |
| US3507774A (en) * | 1967-06-02 | 1970-04-21 | Nat Res Corp | Low energy sputtering apparatus for operation below one micron pressure |
-
1971
- 1971-09-07 US US178240A patent/US3884793A/en not_active Expired - Lifetime
-
1972
- 1972-09-01 NL NL7211911A patent/NL7211911A/xx active Search and Examination
- 1972-09-04 GB GB4086372A patent/GB1420061A/en not_active Expired
- 1972-09-04 IL IL40285A patent/IL40285A/en unknown
- 1972-09-04 GB GB1014075A patent/GB1420062A/en not_active Expired
- 1972-09-05 CA CA150,903A patent/CA1006116A/en not_active Expired
- 1972-09-05 FR FR7231413A patent/FR2152633B1/fr not_active Expired
- 1972-09-06 DE DE2243708A patent/DE2243708A1/de not_active Withdrawn
- 1972-09-06 DE DE2264436*A patent/DE2264436A1/de not_active Withdrawn
- 1972-09-06 DE DE2264437*A patent/DE2264437A1/de not_active Withdrawn
- 1972-09-07 CH CH1313272A patent/CH589940A5/xx not_active IP Right Cessation
-
1973
- 1973-04-03 FR FR7311995A patent/FR2168124B1/fr not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3282816A (en) * | 1963-09-16 | 1966-11-01 | Ibm | Process of cathode sputtering from a cylindrical cathode |
| US3369991A (en) * | 1965-01-28 | 1968-02-20 | Ibm | Apparatus for cathode sputtering including a shielded rf electrode |
Non-Patent Citations (1)
| Title |
|---|
| Applied Physics Letters, Vol. 2, No. 12, 1963, S. 233 u. 234 * |
Cited By (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2417288C2 (de) * | 1974-01-31 | 1986-03-20 | BOC Technologies Ltd., London | Kathodenzerstäubungsvorrichtung |
| DE2417288A1 (de) * | 1974-01-31 | 1975-08-14 | Airco Inc | Zerstaeubungsvorrichtung |
| DE2556607A1 (de) * | 1974-12-16 | 1976-06-24 | Airco Inc | Kathodenzerstaeubungsgeraet |
| DE2655942A1 (de) * | 1976-12-10 | 1978-06-15 | Tokuda Seisakusho Kawasaki Kk | Zerstaeubungsvorrichtung |
| DE2920780A1 (de) * | 1978-08-21 | 1980-03-06 | Vac Tec Syst | Zerstaeubungsvorrichtung mit magnetischer verstaerkung |
| DE3107914A1 (de) * | 1981-03-02 | 1982-09-16 | Leybold-Heraeus GmbH, 5000 Köln | Verfahren und vorrichtung zum beschichten von formteilen durch katodenzerstaeubung |
| DE3211229A1 (de) * | 1981-03-27 | 1982-10-14 | Nihon Shinku Gijutsu K.K., Chigasaki, Kanagawa | Vorrichtung zur ferromagnetischen schnellzerstaeubung |
| DE3427587A1 (de) * | 1984-07-26 | 1986-02-06 | Leybold-Heraeus GmbH, 5000 Köln | Zerstaeubungseinrichtung fuer katodenzerstaeubungsanlagen |
| DE3442208C3 (de) * | 1984-11-19 | 1998-06-10 | Leybold Ag | Verfahren und Vorrichtung zum Herstellen harter Kohlenstoffschichten |
| DE3442208A1 (de) * | 1984-11-19 | 1986-05-28 | Leybold-Heraeus GmbH, 5000 Köln | Verfahren und vorrichtung zum herstellen harten kohlenstoffschichten |
| DE3527626A1 (de) * | 1985-08-01 | 1987-02-05 | Leybold Heraeus Gmbh & Co Kg | Zerstaeubungskatode nach dem magnetronprinzip |
| US4810346A (en) * | 1987-08-21 | 1989-03-07 | Leybold Aktiengesellschaft | Magnetron type sputtering cathode |
| DE3908252A1 (de) * | 1989-03-14 | 1990-09-20 | Leybold Ag | Zerstaeubungskathode nach dem magnetron-prinzip |
| DE4018914C1 (enExample) * | 1990-06-13 | 1991-06-06 | Leybold Ag, 6450 Hanau, De | |
| DE4100291C1 (enExample) * | 1991-01-08 | 1991-10-02 | Leybold Ag, 6450 Hanau, De | |
| DE4135939A1 (de) * | 1991-10-31 | 1993-05-06 | Leybold Ag, 6450 Hanau, De | Zerstaeubungskathode |
| US5415757A (en) * | 1991-11-26 | 1995-05-16 | Leybold Aktiengesellschaft | Apparatus for coating a substrate with electrically nonconductive coatings |
| DE4138793C2 (de) * | 1991-11-26 | 2001-03-01 | Leybold Ag | Verfahren und Vorrichtung zum Beschichten eines Substrats, insbesondere mit elektrisch nichtleitenden Schichten |
| US7938943B2 (en) | 2006-10-17 | 2011-05-10 | Von Ardenne Anlagentechnic GmbH | Supply end block for rotary magnetron |
| DE102007049735B4 (de) * | 2006-10-17 | 2012-03-29 | Von Ardenne Anlagentechnik Gmbh | Versorgungsendblock für ein Rohrmagnetron |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7211911A (enExample) | 1973-03-09 |
| DE2264437A1 (de) | 1973-10-31 |
| FR2152633A1 (enExample) | 1973-04-27 |
| GB1420061A (en) | 1976-01-07 |
| FR2168124A1 (enExample) | 1973-08-24 |
| FR2152633B1 (enExample) | 1978-06-02 |
| GB1420062A (en) | 1976-01-07 |
| CH589940A5 (enExample) | 1977-07-29 |
| US3884793A (en) | 1975-05-20 |
| IL40285A0 (en) | 1972-11-28 |
| IL40285A (en) | 1976-01-30 |
| DE2264436A1 (de) | 1973-12-20 |
| CA1006116A (en) | 1977-03-01 |
| FR2168124B1 (enExample) | 1976-12-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2243708A1 (de) | Verfahren und vorrichtung zur erzeugung von glimmentladungen | |
| DE3789618T2 (de) | Ionenerzeugende apparatur, dünnschichtbildende vorrichtung unter verwendung der ionenerzeugenden apparatur und ionenquelle. | |
| DE3177309T2 (de) | Mittels magnetische Mitteln verbesserte Zerstäubungsquelle. | |
| DE69019741T2 (de) | Ionenstrahlkanone. | |
| DE69320151T2 (de) | Flachen magnetronzerstäubungsanlage | |
| DE19853943B4 (de) | Katode zur Zerstäubung oder Bogenaufdampfung sowie Vorrichtung zur Beschichtung oder Ionenimplantation mit einer solchen Katode | |
| DE69128195T2 (de) | Ionenplattierung mittels magnetronsputtern | |
| DE69207212T2 (de) | Hochfrequenz-ionenquelle | |
| DE3339482A1 (de) | Magnetisches zerstaeubungstarget | |
| DE68927043T2 (de) | Plasma-schalter mit einer chrom-kathode mit strukturierter oberfläche | |
| DE3708716A1 (de) | Hochfrequenz-ionenquelle | |
| CH696972A5 (de) | Vorrichtung zur Kathodenzerstäubung. | |
| DE69209391T2 (de) | Ionenstrahl-Neutralisator und Ionen-Implantationssystem mit einem solchen. | |
| DE3782789T2 (de) | Elektronenkanone mit plasmaanode. | |
| DE4123274C2 (de) | Vorrichtung zum Beschichten von Bauteilen bzw. Formteilen durch Kathodenzerstäubung | |
| DE3881579T2 (de) | Ionenquelle. | |
| DE1153463B (de) | Plasmaerzeuger zur Erzeugung eines kontinuierlichen Plasmastrahls | |
| EP0316523A2 (de) | Zerstäubungskatode nach dem Magnetronprinzip | |
| DE3411536C2 (enExample) | ||
| DE102009018912A1 (de) | Verfahren zur Erzeugung eines Plasmastrahls sowie Plasmaquelle | |
| DE2522227A1 (de) | Verfahren und vorrichtung zur erzeugung einer glimmentladung | |
| DE2016038B2 (de) | Ionenquelle | |
| DE69124882T2 (de) | Radiofrequenz-Plasmaquelle mit kapazitiver Kopplung | |
| DE1934328A1 (de) | Vorrichtung zur wahlweisen Zerstaeubung fester Substanzen durch Ionenbeschuss nach der Plasma- oder Ionenstrahlmethode | |
| DE2655942C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8127 | New person/name/address of the applicant |
Owner name: DART INDUSTRIES INC., 60062 NORTHBROOK, ILL., US |
|
| 8139 | Disposal/non-payment of the annual fee |