DE2232532A1 - Bis-n-heterocyclische verbindungen mit chemotherapeutischen eigenschaften und verfahren zu ihrer herstellung - Google Patents
Bis-n-heterocyclische verbindungen mit chemotherapeutischen eigenschaften und verfahren zu ihrer herstellungInfo
- Publication number
- DE2232532A1 DE2232532A1 DE2232532A DE2232532A DE2232532A1 DE 2232532 A1 DE2232532 A1 DE 2232532A1 DE 2232532 A DE2232532 A DE 2232532A DE 2232532 A DE2232532 A DE 2232532A DE 2232532 A1 DE2232532 A1 DE 2232532A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- bis
- ones
- group
- meaning given
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- 230000000973 chemotherapeutic effect Effects 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 36
- -1 hydroxy, methoxy, amino Chemical group 0.000 claims description 26
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 11
- GRWMSCBKWMQPON-UHFFFAOYSA-N 2-aminobenzohydrazide Chemical class NNC(=O)C1=CC=CC=C1N GRWMSCBKWMQPON-UHFFFAOYSA-N 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 150000001299 aldehydes Chemical class 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- XWWYZFUBBJHKSP-UHFFFAOYSA-N 2,3-dihydro-1h-quinazolin-4-one Chemical class C1=CC=C2C(=O)NCNC2=C1 XWWYZFUBBJHKSP-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 150000002429 hydrazines Chemical class 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 3
- MGZUQDHNBYYFGF-UHFFFAOYSA-N 3-amino-1,2,3-benzotriazin-4-one Chemical compound C1=CC=C2C(=O)N(N)N=NC2=C1 MGZUQDHNBYYFGF-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 239000013067 intermediate product Substances 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- VYFOAVADNIHPTR-UHFFFAOYSA-N isatoic anhydride Chemical compound NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 16
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 125000001309 chloro group Chemical group Cl* 0.000 description 11
- 238000000354 decomposition reaction Methods 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 9
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 8
- 238000010992 reflux Methods 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 230000001476 alcoholic effect Effects 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000003385 bacteriostatic effect Effects 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- DMSSTTLDFWKBSX-UHFFFAOYSA-N 1h-1,2,3-benzotriazin-4-one Chemical compound C1=CC=C2C(=O)N=NNC2=C1 DMSSTTLDFWKBSX-UHFFFAOYSA-N 0.000 description 2
- 241000192125 Firmicutes Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 2
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- SRMJRXAKBYSQQO-UHFFFAOYSA-N (2-aminobenzoyl) 2-aminobenzoate Chemical class NC1=CC=CC=C1C(=O)OC(=O)C1=CC=CC=C1N SRMJRXAKBYSQQO-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- OWQPOVKKUWUEKE-UHFFFAOYSA-N 1,2,3-benzotriazine Chemical compound N1=NN=CC2=CC=CC=C21 OWQPOVKKUWUEKE-UHFFFAOYSA-N 0.000 description 1
- TXJUTRJFNRYTHH-UHFFFAOYSA-N 1h-3,1-benzoxazine-2,4-dione Chemical compound C1=CC=C2C(=O)OC(=O)NC2=C1 TXJUTRJFNRYTHH-UHFFFAOYSA-N 0.000 description 1
- RFQGAFQKNITSIA-UHFFFAOYSA-N 2-(carboxyamino)benzoic acid Chemical class OC(=O)NC1=CC=CC=C1C(O)=O RFQGAFQKNITSIA-UHFFFAOYSA-N 0.000 description 1
- FUBFWTUFPGFHOJ-UHFFFAOYSA-N 2-nitrofuran Chemical compound [O-][N+](=O)C1=CC=CO1 FUBFWTUFPGFHOJ-UHFFFAOYSA-N 0.000 description 1
- FOWINTHJQDTLJU-UHFFFAOYSA-N 3-amino-6-nitro-1,2,3-benzotriazin-4-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(N)N=NC2=C1 FOWINTHJQDTLJU-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- WWUBAHSWMPFIQZ-UHFFFAOYSA-N 6-nitro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC([N+](=O)[O-])=CC=C21 WWUBAHSWMPFIQZ-UHFFFAOYSA-N 0.000 description 1
- 244000182625 Dictamnus albus Species 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229960003116 amyl nitrite Drugs 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 239000012493 hydrazine sulfate Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940102398 methyl anthranilate Drugs 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/08—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
- C07C243/24—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids
- C07C243/38—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids with acylating carboxyl groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2232532A DE2232532A1 (de) | 1972-07-03 | 1972-07-03 | Bis-n-heterocyclische verbindungen mit chemotherapeutischen eigenschaften und verfahren zu ihrer herstellung |
| NL7309024A NL7309024A (enExample) | 1972-07-03 | 1973-06-28 | |
| HUHO1590A HU166713B (enExample) | 1972-07-03 | 1973-07-02 | |
| FR7324450A FR2190465A1 (en) | 1972-07-03 | 1973-07-03 | Bis-N-Heterocyclic cpds - by diazotising N,N'-(2-aminobenzoyl)-hydrazines, active against gram-pos bacteria |
| JP48074470A JPS4942685A (enExample) | 1972-07-03 | 1973-07-03 | |
| ZA734508A ZA734508B (en) | 1972-07-03 | 1973-07-03 | Bis-n-heterocyclic compounds with potent chemotherapeutic properties |
| BE133068A BE801849A (fr) | 1972-07-03 | 1973-07-03 | Composes bis -n-heterocycliques et medicaments qui en contiennent |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2232532A DE2232532A1 (de) | 1972-07-03 | 1972-07-03 | Bis-n-heterocyclische verbindungen mit chemotherapeutischen eigenschaften und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2232532A1 true DE2232532A1 (de) | 1974-01-31 |
Family
ID=5849519
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2232532A Pending DE2232532A1 (de) | 1972-07-03 | 1972-07-03 | Bis-n-heterocyclische verbindungen mit chemotherapeutischen eigenschaften und verfahren zu ihrer herstellung |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS4942685A (enExample) |
| BE (1) | BE801849A (enExample) |
| DE (1) | DE2232532A1 (enExample) |
| FR (1) | FR2190465A1 (enExample) |
| HU (1) | HU166713B (enExample) |
| NL (1) | NL7309024A (enExample) |
| ZA (1) | ZA734508B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN100506802C (zh) * | 2004-06-04 | 2009-07-01 | 中国科学院上海药物研究所 | 一类甲酰肽样受体-1调节剂、其制备方法和用途 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL6702189A (enExample) * | 1967-02-14 | 1968-08-15 | ||
| US3542784A (en) * | 1968-04-05 | 1970-11-24 | Norwich Pharma Co | 4-(hydroxyanilino)-2-(5-nitro-2-furyl)quinazolines |
-
1972
- 1972-07-03 DE DE2232532A patent/DE2232532A1/de active Pending
-
1973
- 1973-06-28 NL NL7309024A patent/NL7309024A/xx unknown
- 1973-07-02 HU HUHO1590A patent/HU166713B/hu unknown
- 1973-07-03 JP JP48074470A patent/JPS4942685A/ja active Pending
- 1973-07-03 FR FR7324450A patent/FR2190465A1/fr active Granted
- 1973-07-03 BE BE133068A patent/BE801849A/xx unknown
- 1973-07-03 ZA ZA734508A patent/ZA734508B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE801849A (fr) | 1974-01-03 |
| HU166713B (enExample) | 1975-05-28 |
| JPS4942685A (enExample) | 1974-04-22 |
| NL7309024A (enExample) | 1974-01-07 |
| FR2190465A1 (en) | 1974-02-01 |
| FR2190465B1 (enExample) | 1978-07-28 |
| ZA734508B (en) | 1974-06-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4594420A (en) | Perylene-3,4,9,10-tetracarboxylic acid monoanhydride monoimide and monoimidazolide compounds, processes for their preparation and their use | |
| DE2340571C3 (de) | Verfahren zur Herstellung von heterocyclischen Verbindungen | |
| DE2243955A1 (de) | Neue disazopigmente und verfahren zu deren herstellung und verwendung | |
| DE2232532A1 (de) | Bis-n-heterocyclische verbindungen mit chemotherapeutischen eigenschaften und verfahren zu ihrer herstellung | |
| DE2210261C3 (de) | Verfahren zur Herstellung von 2-Aryl-v-triazolen | |
| DE1670914B2 (de) | Verfahren zur herstellung von 2- aryl-v-triazolen | |
| DE2423548C2 (de) | Verfahren zur Herstellung von 4-Amino1,8-naphthalimid-Verbindungen | |
| CH432542A (de) | Verfahren zur Herstellung neuer Hydrazide | |
| EP0005465B1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| DE1901422A1 (de) | Trisazofarbstoffe,ihre Herstellung und Verwendung | |
| EP0315902B1 (de) | Bis-indolyl-ethylen-aldehyde | |
| DE2412975C3 (de) | Verfahren zur Herstellung von 3-Amino-2,1 -benzisothiazolen | |
| DE2436032A1 (de) | Neue aromatische o-hydroxyaldehyde, verfahren zu ihrer herstellung und ihre verwendung | |
| DE3406011A1 (de) | Verfahren zur herstellung von benzotriazolen | |
| DE1213841B (de) | Verfahren zur Herstellung von 3-Aryl-4-halogen-pyridazonen-(6) | |
| DE1695486A1 (de) | Verfahren zur Herstellung von Indolyl-(3)-essigsaeurealkylestern | |
| AT256099B (de) | Verfahren zur Herstellung neuer α-(3-Indolyl)-carbonsäuren | |
| AT223619B (de) | Verfahren zur Herstellung von 3,4-Dihydro-1,2,4-benzothiadiazin-1,1-dioxyden | |
| DE899194C (de) | Verfahren zur Herstellung von Dihydrofuran- bzw. Dihydrothiophenchinolinverbindungen | |
| DE3519455A1 (de) | Thiophenderivate | |
| AT321313B (de) | Verfahren zur Herstellung von neuen Pyrimidotriazinen | |
| AT258916B (de) | Verfahren zur Herstellung von neuen Alkyl-3-amino-5-chlor-6-X-pyrazinoaten | |
| DE1793259C3 (de) | Verfahren zur Herstellung von o-(2-Hydroxyamino-acylamino)-phenylarylketonen | |
| AT234695B (de) | Verfahren zur Herstellung von neuen 4-Chinazolinonen | |
| DE2408012A1 (de) | 4-amino-1,8-naphthalsaeureimid-3-sulfonsaeuren, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |