DE2209287B2 - - Google Patents
Info
- Publication number
- DE2209287B2 DE2209287B2 DE2209287A DE2209287A DE2209287B2 DE 2209287 B2 DE2209287 B2 DE 2209287B2 DE 2209287 A DE2209287 A DE 2209287A DE 2209287 A DE2209287 A DE 2209287A DE 2209287 B2 DE2209287 B2 DE 2209287B2
- Authority
- DE
- Germany
- Prior art keywords
- contact
- switch
- piece
- stationary
- arc
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 241000446313 Lamella Species 0.000 claims description 10
- 238000010292 electrical insulation Methods 0.000 claims description 7
- 238000007664 blowing Methods 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 238000000926 separation method Methods 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 238000007373 indentation Methods 0.000 claims 1
- 238000007789 sealing Methods 0.000 claims 1
- 230000007704 transition Effects 0.000 claims 1
- 239000007789 gas Substances 0.000 description 17
- 229910018503 SF6 Inorganic materials 0.000 description 4
- 230000001939 inductive effect Effects 0.000 description 4
- SFZCNBIFKDRMGX-UHFFFAOYSA-N sulfur hexafluoride Chemical compound FS(F)(F)(F)(F)F SFZCNBIFKDRMGX-UHFFFAOYSA-N 0.000 description 4
- 229960000909 sulfur hexafluoride Drugs 0.000 description 4
- 238000009413 insulation Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000005520 electrodynamics Effects 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229920002430 Fibre-reinforced plastic Polymers 0.000 description 1
- FNYLWPVRPXGIIP-UHFFFAOYSA-N Triamterene Chemical compound NC1=NC2=NC(N)=NC(N)=C2N=C1C1=CC=CC=C1 FNYLWPVRPXGIIP-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 239000011151 fibre-reinforced plastic Substances 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- -1 polytetrafluoroethylene Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/70—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid
- H01H33/88—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid the flow of arc-extinguishing fluid being produced or increased by movement of pistons or other pressure-producing parts
- H01H33/90—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid the flow of arc-extinguishing fluid being produced or increased by movement of pistons or other pressure-producing parts this movement being effected by or in conjunction with the contact-operating mechanism
- H01H33/91—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid the flow of arc-extinguishing fluid being produced or increased by movement of pistons or other pressure-producing parts this movement being effected by or in conjunction with the contact-operating mechanism the arc-extinguishing fluid being air or gas
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/02—Details
- H01H33/04—Means for extinguishing or preventing arc between current-carrying parts
- H01H33/12—Auxiliary contacts on to which the arc is transferred from the main contacts
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/70—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid
- H01H33/7015—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid characterised by flow directing elements associated with contacts
- H01H33/7038—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid characterised by flow directing elements associated with contacts characterised by a conducting tubular gas flow enhancing nozzle
- H01H33/7053—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid characterised by flow directing elements associated with contacts characterised by a conducting tubular gas flow enhancing nozzle having a bridging element around two hollow tubular contacts
Landscapes
- Circuit Breakers (AREA)
- Arc-Extinguishing Devices That Are Switches (AREA)
Priority Applications (20)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2209287A DE2209287C3 (de) | 1972-02-22 | 1972-02-22 | Elektrischer Druckgasschalter |
| DE2215656A DE2215656C3 (de) | 1972-02-22 | 1972-03-27 | Elektrischer Druckgasschalter |
| DE19722220897 DE2220897C3 (de) | 1972-04-25 | Elektrischer Druckgasschalter | |
| CH1541172A CH544999A (de) | 1972-02-22 | 1972-10-20 | Elektrischer Druckgasschalter |
| NLAANVRAGE7217042,A NL173576C (nl) | 1972-02-22 | 1972-12-14 | Elektrische persgas-schakelaar. |
| DD16765372A DD101057A5 (cg-RX-API-DMAC10.html) | 1972-02-22 | 1972-12-18 | |
| FR7301779A FR2172980B1 (cg-RX-API-DMAC10.html) | 1972-02-22 | 1973-01-18 | |
| SU1877853A SU483839A3 (ru) | 1972-02-22 | 1973-02-01 | Электрический переключатель газового типа |
| CS116673A CS167374B2 (cg-RX-API-DMAC10.html) | 1972-02-22 | 1973-02-19 | |
| IT2059273A IT979279B (it) | 1972-02-22 | 1973-02-20 | Interruttore elettrico a gas compresso |
| JP2116573A JPS5650371B2 (cg-RX-API-DMAC10.html) | 1972-02-22 | 1973-02-21 | |
| US00334934A US3789175A (en) | 1972-02-22 | 1973-02-22 | Electric compressed-gas circuit breaker |
| FR7308951A FR2177804B2 (cg-RX-API-DMAC10.html) | 1972-02-22 | 1973-03-13 | |
| US00344043A US3855437A (en) | 1972-02-22 | 1973-03-22 | Electric compressed-gas circuit breaker |
| CH443473A CH557591A (de) | 1972-02-22 | 1973-03-27 | Elektrischer druckgasschalter. |
| GB1477573A GB1394545A (en) | 1972-02-22 | 1973-03-27 | Electrical switch |
| FR7312020A FR2181860B2 (cg-RX-API-DMAC10.html) | 1972-02-22 | 1973-04-03 | |
| US00348276A US3854019A (en) | 1972-02-22 | 1973-04-05 | Electric compressed-gas circuit breaker |
| CH498173A CH554596A (de) | 1972-02-22 | 1973-04-06 | Elektrischer druckgasschalter. |
| GB1975073A GB1394547A (en) | 1972-02-22 | 1973-04-25 | Electrical switches |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2209287A DE2209287C3 (de) | 1972-02-22 | 1972-02-22 | Elektrischer Druckgasschalter |
| DE2215656A DE2215656C3 (de) | 1972-02-22 | 1972-03-27 | Elektrischer Druckgasschalter |
| DE19722220897 DE2220897C3 (de) | 1972-04-25 | Elektrischer Druckgasschalter |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2209287A1 DE2209287A1 (de) | 1973-09-06 |
| DE2209287B2 true DE2209287B2 (cg-RX-API-DMAC10.html) | 1974-05-02 |
| DE2209287C3 DE2209287C3 (de) | 1974-12-12 |
Family
ID=27184144
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2209287A Expired DE2209287C3 (de) | 1972-02-22 | 1972-02-22 | Elektrischer Druckgasschalter |
| DE2215656A Expired DE2215656C3 (de) | 1972-02-22 | 1972-03-27 | Elektrischer Druckgasschalter |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2215656A Expired DE2215656C3 (de) | 1972-02-22 | 1972-03-27 | Elektrischer Druckgasschalter |
Country Status (6)
| Country | Link |
|---|---|
| US (3) | US3789175A (cg-RX-API-DMAC10.html) |
| CH (3) | CH544999A (cg-RX-API-DMAC10.html) |
| DE (2) | DE2209287C3 (cg-RX-API-DMAC10.html) |
| FR (3) | FR2172980B1 (cg-RX-API-DMAC10.html) |
| GB (2) | GB1394545A (cg-RX-API-DMAC10.html) |
| NL (1) | NL173576C (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2908982A1 (de) * | 1979-03-06 | 1980-09-18 | Siemens Ag | Elektrischer druckgasschalter |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2232314C3 (de) * | 1972-06-27 | 1979-05-10 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Kontaktsystem für elektrische Hochspannungsgeräte mit einem gasförmigen Isoliermittel, insbesondere Hochspannungs-Leistungsschalter |
| DE2234067C3 (de) * | 1972-07-07 | 1982-06-16 | Siemens AG, 1000 Berlin und 8000 München | Kontaktsystem für druckgasisolierte Hochspannungsschaltgeräte |
| GB1445217A (en) * | 1973-08-02 | 1976-08-04 | Siemens Ag | Electrical circuit breaker and contacts therefor |
| DE2406143C3 (de) * | 1974-02-07 | 1978-04-20 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Elektrischer Druckgas-Leistungsschalter mit zwei feststehenden Schaltstücken und einem Brückenschaltstück |
| DE2438017C3 (de) * | 1974-08-05 | 1981-07-02 | Siemens AG, 1000 Berlin und 8000 München | Druckgasschalter |
| GB1459727A (en) * | 1974-09-17 | 1976-12-31 | Siemens Ag | Electrical gas-blast circuit breaker |
| DE2540315C3 (de) * | 1975-09-08 | 1978-12-14 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Druckgasschalter |
| US4181837A (en) * | 1976-09-15 | 1980-01-01 | Westinghouse Electric Corp. | Compressed-gas circuit interrupter having insulated contacts |
| DE2759268C3 (de) * | 1977-12-30 | 1984-08-02 | Siemens AG, 1000 Berlin und 8000 München | Druckgasschalter |
| DE2809006A1 (de) * | 1978-03-02 | 1979-09-06 | Licentia Gmbh | Druckgas-leistungsschalter |
| DE2833154C3 (de) * | 1978-07-28 | 1982-02-18 | Karl Pfisterer Elektrotechnische Spezialartikel Gmbh & Co Kg, 7000 Stuttgart | Schalter |
| FR2443740A1 (fr) * | 1978-12-08 | 1980-07-04 | Merlin Gerin | Sectionneur sous charge a depression |
| CH637241A5 (en) * | 1979-03-14 | 1983-07-15 | Sprecher & Schuh Ag | Sliding-contact device for a switch |
| FR2476381B1 (fr) * | 1980-02-16 | 1985-10-25 | Hitachi Ltd | Sectionneur isole par gaz |
| DE3113325A1 (de) * | 1981-03-30 | 1982-06-24 | Ernst Prof. Dr.techn.habil. 1000 Berlin Slamecka | Hochspannungsschaltkammer |
| DE3209968A1 (de) * | 1982-03-18 | 1983-09-29 | Siemens AG, 1000 Berlin und 8000 München | Druckgasschalter |
| DE3323865C2 (de) * | 1983-06-29 | 1991-01-03 | Ernst Prof. Dr.techn.habil. 1000 Berlin Slamecka | Hochspannungsschaltkammer |
| DE3822410C1 (en) * | 1988-07-01 | 1989-10-26 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt, De | Sulphur hexa:fluoride compressed gas switch - has thread between nozzle and cylinder to better withstand force and temp. loading without enlargement of actual mass of nozzle |
| FR2680044B1 (fr) * | 1991-08-02 | 1995-01-20 | Alsthom Gec | Disjoncteur a moyenne ou haute tension a contacts d'arc en bout. |
| DE4420386C2 (de) * | 1994-05-31 | 1998-07-02 | Siemens Ag | Druckgas-Leistungsschalter mit einer Isolierstoffdüse |
| DE19519992C2 (de) * | 1995-05-24 | 2002-03-21 | Siemens Ag | Schaltstrecke für einen mit einem Löschgas arbeitenden Hochspannungs-Leistungsschalter |
| DE19629475A1 (de) * | 1996-07-10 | 1998-01-15 | Siemens Ag | Druckgasleistungsschalter |
| JPH10223276A (ja) * | 1997-02-05 | 1998-08-21 | Mitsubishi Electric Corp | 接触子装置 |
| DE10156535C1 (de) * | 2001-11-14 | 2003-06-26 | Siemens Ag | Leistungsschalter |
| DE102010062343A1 (de) | 2010-12-02 | 2012-06-06 | Siemens Aktiengesellschaft | Elektrokontaktanordnung |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB813683A (en) * | 1955-02-04 | 1959-05-21 | English Electric Co Ltd | Improvements in and relating to gas-blast electric switchgear |
| BE445974A (cg-RX-API-DMAC10.html) * | 1941-07-18 | |||
| US2452221A (en) * | 1945-08-27 | 1948-10-26 | Pacific Electric Mfg Corp | Fluid blast arc extinguishing circuit breaker |
| FR1307668A (fr) * | 1961-12-07 | 1962-10-26 | Brown | Interrupteur pneumatique avec contact à tuyère |
| DE1197156B (de) * | 1963-03-06 | 1965-07-22 | Siemens Ag | Druckgasschalter |
| FR1386073A (fr) * | 1963-03-22 | 1965-01-15 | Siemens Ag | Disjoncteur à gaz comprimé |
| US3364327A (en) * | 1965-01-21 | 1968-01-16 | Westinghouse Electric Corp | Compressed-gas circuit breaker with movable orifice contact and configured flow director about stationary contact assembly |
| CH470068A (de) * | 1968-02-08 | 1969-03-15 | Bbc Brown Boveri & Cie | Druckgasschalter |
| FR2057152A5 (en) * | 1969-08-01 | 1971-05-21 | Merlin Gerin | Contact breaker |
-
1972
- 1972-02-22 DE DE2209287A patent/DE2209287C3/de not_active Expired
- 1972-03-27 DE DE2215656A patent/DE2215656C3/de not_active Expired
- 1972-10-20 CH CH1541172A patent/CH544999A/de not_active IP Right Cessation
- 1972-12-14 NL NLAANVRAGE7217042,A patent/NL173576C/xx not_active IP Right Cessation
-
1973
- 1973-01-18 FR FR7301779A patent/FR2172980B1/fr not_active Expired
- 1973-02-22 US US00334934A patent/US3789175A/en not_active Expired - Lifetime
- 1973-03-13 FR FR7308951A patent/FR2177804B2/fr not_active Expired
- 1973-03-22 US US00344043A patent/US3855437A/en not_active Expired - Lifetime
- 1973-03-27 CH CH443473A patent/CH557591A/xx not_active IP Right Cessation
- 1973-03-27 GB GB1477573A patent/GB1394545A/en not_active Expired
- 1973-04-03 FR FR7312020A patent/FR2181860B2/fr not_active Expired
- 1973-04-05 US US00348276A patent/US3854019A/en not_active Expired - Lifetime
- 1973-04-06 CH CH498173A patent/CH554596A/xx not_active IP Right Cessation
- 1973-04-25 GB GB1975073A patent/GB1394547A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2908982A1 (de) * | 1979-03-06 | 1980-09-18 | Siemens Ag | Elektrischer druckgasschalter |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1394547A (en) | 1975-05-21 |
| FR2172980B1 (cg-RX-API-DMAC10.html) | 1976-05-14 |
| FR2181860A2 (cg-RX-API-DMAC10.html) | 1973-12-07 |
| FR2172980A1 (cg-RX-API-DMAC10.html) | 1973-10-05 |
| NL173576C (nl) | 1983-09-01 |
| DE2215656A1 (de) | 1973-10-04 |
| DE2220897A1 (de) | 1973-11-08 |
| CH554596A (de) | 1974-09-30 |
| GB1394545A (en) | 1975-05-21 |
| DE2209287A1 (de) | 1973-09-06 |
| DE2215656C3 (de) | 1979-04-05 |
| CH557591A (de) | 1974-12-31 |
| DE2209287C3 (de) | 1974-12-12 |
| DE2215656B2 (de) | 1978-07-27 |
| US3854019A (en) | 1974-12-10 |
| NL173576B (nl) | 1983-09-01 |
| FR2177804A2 (cg-RX-API-DMAC10.html) | 1973-11-09 |
| CH544999A (de) | 1974-01-15 |
| FR2177804B2 (cg-RX-API-DMAC10.html) | 1977-02-04 |
| DE2220897B2 (de) | 1975-10-30 |
| US3789175A (en) | 1974-01-29 |
| US3855437A (en) | 1974-12-17 |
| FR2181860B2 (cg-RX-API-DMAC10.html) | 1979-03-16 |
| NL7217042A (cg-RX-API-DMAC10.html) | 1973-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2209287C3 (de) | Elektrischer Druckgasschalter | |
| EP0126929B2 (de) | Druckgasschalter | |
| DE19809088C1 (de) | Hochspannungsleistungsschalter mit einer Isolierstoffdüse | |
| DE2211617A1 (de) | Druckgasschalter | |
| DE69303568T2 (de) | Hochspannung selbst-Blaslastscharter mit Schnittkammer mit reduzierter Gaskompression | |
| DE3107525C2 (de) | Druckgas-Leistungsschalter | |
| DE2406143C3 (de) | Elektrischer Druckgas-Leistungsschalter mit zwei feststehenden Schaltstücken und einem Brückenschaltstück | |
| WO2016151002A1 (de) | Isolierdüse und elektrische schalteinrichtung mit der isolierdüse | |
| DE948707C (de) | Stromunterbrechungseinrichtung, insbesondere fuer hohe Betriebsspannungen | |
| DE2811510C2 (de) | Elektrischer Druckgasschalter | |
| DE2208035C3 (de) | Kontaktsystem für Druckgasschalter | |
| DE69106436T2 (de) | Mittelspannungsschalter. | |
| DE2628040A1 (de) | Elektrischer schalter | |
| DE2540315B2 (de) | Druckgasschalter | |
| DE3140466C2 (cg-RX-API-DMAC10.html) | ||
| DE3017980A1 (de) | Elektrischer schalter mit selbsterzeugtem loeschgasstrom | |
| EP0069694A2 (de) | Kontaktsystem für Druckgas-Leistungsschalter | |
| DE3803117A1 (de) | Stromunterbrecher fuer mit einem isoliergas gefuellte, gekapselte schaltanlagen | |
| DE2420462C3 (de) | Elektrischer Druckgasschalter | |
| DE3816811C2 (cg-RX-API-DMAC10.html) | ||
| DE2909270C2 (de) | Autopneumatischer Druckgasschalter | |
| DE2753375A1 (de) | Gasstromschalter mit einer schnellen thermischen und dielektrischen erholung | |
| DE2858054C2 (cg-RX-API-DMAC10.html) | ||
| DE1966972C3 (de) | Elektrischer Schalter | |
| EP0100749A1 (de) | Schaltkammer für einen Druckgas-Leistungsschalter |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| OI | Miscellaneous see part 1 | ||
| 8339 | Ceased/non-payment of the annual fee |