DE2152371A1 - Verfahren zur Herstellung von 1-Alkyl-2-aminomethylpyrrolidinen - Google Patents
Verfahren zur Herstellung von 1-Alkyl-2-aminomethylpyrrolidinenInfo
- Publication number
- DE2152371A1 DE2152371A1 DE19712152371 DE2152371A DE2152371A1 DE 2152371 A1 DE2152371 A1 DE 2152371A1 DE 19712152371 DE19712152371 DE 19712152371 DE 2152371 A DE2152371 A DE 2152371A DE 2152371 A1 DE2152371 A1 DE 2152371A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- hydrogenation
- reaction
- solvent
- phosgene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 21
- 238000002360 preparation method Methods 0.000 title claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 9
- 238000005984 hydrogenation reaction Methods 0.000 claims description 9
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 4
- 239000007868 Raney catalyst Substances 0.000 claims description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 4
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- -1 nitromethylene group Chemical group 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 claims 1
- 239000007810 chemical reaction solvent Substances 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 150000007522 mineralic acids Chemical class 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003235 pyrrolidines Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- UNRBEYYLYRXYCG-UHFFFAOYSA-N (1-ethylpyrrolidin-2-yl)methanamine Chemical compound CCN1CCCC1CN UNRBEYYLYRXYCG-UHFFFAOYSA-N 0.000 description 1
- ZFPGARUNNKGOBB-UHFFFAOYSA-N 1-Ethyl-2-pyrrolidinone Chemical compound CCN1CCCC1=O ZFPGARUNNKGOBB-UHFFFAOYSA-N 0.000 description 1
- MSXAUUYIGJZVTR-UHFFFAOYSA-N 1-ethyl-2-(nitromethylidene)pyrrolidine Chemical compound CCN1CCCC1=C[N+]([O-])=O MSXAUUYIGJZVTR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006414 CCl Chemical group ClC* 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1662870A CH532035A (fr) | 1970-11-10 | 1970-11-10 | Nouveau procédé de préparation de 1-alkyl-2-amino-méthylpyrrolidines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2152371A1 true DE2152371A1 (de) | 1972-06-22 |
Family
ID=4418871
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712152371 Pending DE2152371A1 (de) | 1970-11-10 | 1971-10-21 | Verfahren zur Herstellung von 1-Alkyl-2-aminomethylpyrrolidinen |
Country Status (27)
| Country | Link |
|---|---|
| AT (1) | AT311952B (enExample) |
| AU (1) | AU464960B2 (enExample) |
| BE (1) | BE773979A (enExample) |
| BG (1) | BG21605A3 (enExample) |
| CA (1) | CA940533A (enExample) |
| CH (1) | CH532035A (enExample) |
| CS (1) | CS186206B2 (enExample) |
| DE (1) | DE2152371A1 (enExample) |
| DK (1) | DK145573C (enExample) |
| ES (1) | ES396293A1 (enExample) |
| FI (1) | FI54471C (enExample) |
| FR (1) | FR2111371A5 (enExample) |
| GB (1) | GB1374818A (enExample) |
| HU (1) | HU162787B (enExample) |
| IE (1) | IE35775B1 (enExample) |
| IL (1) | IL37994A (enExample) |
| IT (1) | IT1043845B (enExample) |
| LU (1) | LU64227A1 (enExample) |
| MC (1) | MC896A1 (enExample) |
| NL (1) | NL7114901A (enExample) |
| OA (1) | OA03823A (enExample) |
| PH (1) | PH12022A (enExample) |
| PL (1) | PL81412B1 (enExample) |
| SE (1) | SE376415B (enExample) |
| YU (1) | YU34672B (enExample) |
| ZA (1) | ZA716998B (enExample) |
| ZM (1) | ZM15171A1 (enExample) |
-
1970
- 1970-11-10 CH CH1662870A patent/CH532035A/fr not_active IP Right Cessation
-
1971
- 1971-10-14 FR FR7136940A patent/FR2111371A5/fr not_active Expired
- 1971-10-15 BE BE773979A patent/BE773979A/xx not_active IP Right Cessation
- 1971-10-19 ZA ZA716998A patent/ZA716998B/xx unknown
- 1971-10-20 AU AU34790/71A patent/AU464960B2/en not_active Expired
- 1971-10-21 DE DE19712152371 patent/DE2152371A1/de active Pending
- 1971-10-22 ES ES396293A patent/ES396293A1/es not_active Expired
- 1971-10-22 IL IL37994A patent/IL37994A/xx unknown
- 1971-10-26 MC MC953A patent/MC896A1/fr unknown
- 1971-10-26 CA CA126,128A patent/CA940533A/en not_active Expired
- 1971-10-26 BG BG018861A patent/BG21605A3/xx unknown
- 1971-10-26 IE IE1354/71A patent/IE35775B1/xx unknown
- 1971-10-27 ZM ZM151/71A patent/ZM15171A1/xx unknown
- 1971-10-28 NL NL7114901A patent/NL7114901A/xx unknown
- 1971-10-29 IT IT30520/71A patent/IT1043845B/it active
- 1971-11-04 GB GB5122571A patent/GB1374818A/en not_active Expired
- 1971-11-04 CS CS7100007753A patent/CS186206B2/cs unknown
- 1971-11-05 OA OA54406A patent/OA03823A/xx unknown
- 1971-11-08 PL PL1971151433A patent/PL81412B1/pl unknown
- 1971-11-08 FI FI3193/71A patent/FI54471C/fi active
- 1971-11-08 LU LU64227D patent/LU64227A1/xx unknown
- 1971-11-09 HU HUFA897A patent/HU162787B/hu unknown
- 1971-11-09 YU YU2823/71A patent/YU34672B/xx unknown
- 1971-11-09 SE SE7114274A patent/SE376415B/xx unknown
- 1971-11-09 DK DK548871A patent/DK145573C/da not_active IP Right Cessation
- 1971-11-10 AT AT969071A patent/AT311952B/de not_active IP Right Cessation
- 1971-11-10 PH PH13000A patent/PH12022A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI54471C (fi) | 1978-12-11 |
| IT1043845B (it) | 1980-02-29 |
| IL37994A (en) | 1974-10-22 |
| LU64227A1 (enExample) | 1972-05-29 |
| DK145573B (da) | 1982-12-13 |
| FR2111371A5 (enExample) | 1972-06-02 |
| AU464960B2 (en) | 1975-09-11 |
| AT311952B (de) | 1973-12-10 |
| IE35775B1 (en) | 1976-05-12 |
| NL7114901A (enExample) | 1972-05-15 |
| CA940533A (en) | 1974-01-22 |
| YU34672B (en) | 1979-12-31 |
| SE376415B (enExample) | 1975-05-26 |
| CH532035A (fr) | 1972-12-31 |
| IE35775L (en) | 1972-05-10 |
| DK145573C (da) | 1983-05-30 |
| HU162787B (enExample) | 1973-04-28 |
| BG21605A3 (bg) | 1976-07-20 |
| YU282371A (en) | 1979-07-10 |
| MC896A1 (fr) | 1972-06-22 |
| PH12022A (en) | 1978-10-06 |
| BE773979A (fr) | 1972-04-17 |
| PL81412B1 (enExample) | 1975-08-30 |
| CS186206B2 (en) | 1978-11-30 |
| ES396293A1 (es) | 1974-05-01 |
| AU3479071A (en) | 1973-05-03 |
| GB1374818A (en) | 1974-11-20 |
| FI54471B (fi) | 1978-08-31 |
| IL37994A0 (en) | 1971-12-29 |
| OA03823A (fr) | 1971-12-24 |
| ZM15171A1 (en) | 1972-07-21 |
| ZA716998B (en) | 1972-07-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1963182A1 (de) | Neue N-Phenylindolin-Derivate und deren Verwendung als Arzneimittel | |
| DE1795841B2 (de) | l-a'-Chlort-benzyl^-di-sec-butylamino-acetyl-pyiTol, seine Salze und Verfahren zu deren Herstellung | |
| DE1941536A1 (de) | 1-Alkyl-2-aminomethylpyrrolidine sowie Verfahren zur Herstellung dieser Verbindungen und deren Zwischenprodukte | |
| DE2429935C3 (de) | Verfahren zur Herstellung von 2,2,6,6- Tetramethyl-4-oxopiperidin | |
| DE2044172C3 (de) | Pyrrolderivate, ein Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2701705A1 (de) | Neue organische verbindungen, ihre verwendung und herstellung | |
| DE1543777B2 (de) | Verfahren zur Herstellung von alpha niedrig Alkyl beta (4 hydroxy phenyl) alaninen | |
| DE2152371A1 (de) | Verfahren zur Herstellung von 1-Alkyl-2-aminomethylpyrrolidinen | |
| DE1056139B (de) | Verfahren zur Herstellung von alpha-Amino-beta-oxy-carbonsaeureaniliden | |
| EP0006180B1 (de) | 3-Phenoxybenzylidenamine und 3-Benzylbenzylidenamine, ein Verfahren zu deren Herstellung sowie deren Verwendung zur Herstellung der entsprechenden Aldehyde | |
| DE2263527B2 (de) | 2,2-Disubstituierte Phenylacetonitril-Derivate, Verfahren zu ihrer Herstellung und deren Verwendung | |
| AT214427B (de) | Verfahren zur Herstellung neuer basischer Phenoläther | |
| DE568759C (de) | Verfahren zur Darstellung von 2-Methyl-5-oxypiperidin | |
| CH396941A (de) | Verfahren zur Herstellung neuer sekundärer Amine | |
| CH677924A5 (enExample) | ||
| DE963517C (de) | Verfahren zur Herstellung von antipyretisch und analgetisch wirksamen, basisch substituierten Phenyldimethylpyrazolon-Derivaten | |
| AT216011B (de) | Verfahren zur Herstellung von neuen Oxygruppen tragenden 1-bzw. 7-Aminoalkylxanthinderivaten | |
| AT235283B (de) | Verfahren zur Herstellung neuer Indolverbindungen | |
| AT254166B (de) | Verfahren zur Herstellung von neuen 5-(3'-sek.Aminopropyl)-5H-dibenzo[a,d]cycloheptenen bzw. den 10,11-Dihydroderivaten derselben | |
| AT213864B (de) | Verfahren zur Herstellung von neuen analgetisch wirksamen α-Amino-β-oxybuttersäureamiden | |
| DE2623257A1 (de) | Verfahren zur herstellung von n-alkenyl-2-aminomethyl-pyrrolidinen | |
| CH415601A (de) | Verfahren zur Herstellung von basisch substituierten Propanolen und daraus durch Wasserabspaltung erhältlichen Alkenylaminen | |
| DE2166997B2 (de) | Verfahren zur Herstellung von 4,4-Diphenyl-piperidinen | |
| EP0074488A1 (de) | 2-Azido-3-benzyloxy-propionsäure-benzylester, Verfahren zu dessen Herstellung und dessen Verwendung | |
| DE1293148B (de) | Verfahren zur Herstellung neuer 1-Benzyl-3-isopropyl-carbazinate |