DE2108975C3 - N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel - Google Patents
N-Acyl-Diurethane sowie diese enthaltendes herbizides MittelInfo
- Publication number
- DE2108975C3 DE2108975C3 DE2108975A DE2108975A DE2108975C3 DE 2108975 C3 DE2108975 C3 DE 2108975C3 DE 2108975 A DE2108975 A DE 2108975A DE 2108975 A DE2108975 A DE 2108975A DE 2108975 C3 DE2108975 C3 DE 2108975C3
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- phenyl
- carbamate
- acetyl
- propionyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004009 herbicide Substances 0.000 title description 5
- -1 bromoacetyl Chemical group 0.000 claims description 41
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 29
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 55
- 150000001875 compounds Chemical class 0.000 description 23
- 241000196324 Embryophyta Species 0.000 description 14
- 239000004480 active ingredient Substances 0.000 description 13
- 239000003795 chemical substances by application Substances 0.000 description 11
- 230000002363 herbicidal effect Effects 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 7
- 238000007792 addition Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical class NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 241000335053 Beta vulgaris Species 0.000 description 2
- 244000056139 Brassica cretica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- 239000000460 chlorine Chemical group 0.000 description 2
- 229910052801 chlorine Chemical group 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- IULJSGIJJZZUMF-UHFFFAOYSA-N 2-hydroxybenzenesulfonic acid Chemical compound OC1=CC=CC=C1S(O)(=O)=O IULJSGIJJZZUMF-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 241001049165 Caria Species 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241001354404 Cyanus Species 0.000 description 1
- 244000214240 Galinsoga parviflora Species 0.000 description 1
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 244000303225 Lamium amplexicaule Species 0.000 description 1
- 235000009198 Lamium amplexicaule Nutrition 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 240000005498 Setaria italica Species 0.000 description 1
- 235000007226 Setaria italica Nutrition 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- BMBJSXKEXRFGAV-UHFFFAOYSA-N phenylcarbamothioic s-acid Chemical compound SC(=O)NC1=CC=CC=C1 BMBJSXKEXRFGAV-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/22—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/28—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C333/00—Derivatives of thiocarbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C333/02—Monothiocarbamic acids; Derivatives thereof
- C07C333/08—Monothiocarbamic acids; Derivatives thereof having nitrogen atoms of thiocarbamic groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (24)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2108975A DE2108975C3 (de) | 1971-02-16 | 1971-02-16 | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel |
| LU64633D LU64633A1 (enExample) | 1971-02-16 | 1972-01-20 | |
| ZA720741A ZA72741B (en) | 1971-02-16 | 1972-02-04 | Herbicidal n-acyl-biscarbamates |
| CS757A CS170176B2 (enExample) | 1971-02-16 | 1972-02-07 | |
| DK55172*#A DK133001C (da) | 1971-02-16 | 1972-02-08 | N-acylbiscarbamater til anvendelse i herbicider |
| AU38824/72A AU460282B2 (en) | 1971-02-16 | 1972-02-09 | Herbicide n-acyl-biscarbamate |
| GB628972A GB1338985A (en) | 1971-02-16 | 1972-02-10 | N-acyl-biscarbamates and herbicidal preparations containing them |
| IL38738A IL38738A (en) | 1971-02-16 | 1972-02-10 | Herbicidal n-acyl-carbamoyloxyphenyl carbamates |
| JP47014768A JPS5244371B1 (enExample) | 1971-02-16 | 1972-02-10 | |
| SE01668/72A SE368395B (enExample) | 1971-02-16 | 1972-02-11 | |
| US225626A US3904669A (en) | 1971-02-16 | 1972-02-11 | N-acyl biscarbamate herbicides |
| IT20512/72A IT948533B (it) | 1971-02-16 | 1972-02-12 | N acil biscarbammati erbicidi |
| YU0360/72A YU36695B (en) | 1971-02-16 | 1972-02-14 | Process for obtaining new herbicidl n-acyl-bis-carbamates |
| FI403/72A FI58634C (fi) | 1971-02-16 | 1972-02-14 | Herbisida n-acylbiskarbamater |
| FR7204979A FR2125913A5 (enExample) | 1971-02-16 | 1972-02-15 | |
| NO434/72A NO135471C (enExample) | 1971-02-16 | 1972-02-15 | |
| IE185/72A IE36086B1 (en) | 1971-02-16 | 1972-02-15 | N-acyl-biscarbamates and herbicidal preparations containing them |
| ES399808A ES399808A1 (es) | 1971-02-16 | 1972-02-15 | Procedimiento para la preparacion de nuevos n-acil-biscar- bamatos herbicidas. |
| HUSCHE374*1A HU164147B (enExample) | 1971-02-16 | 1972-02-15 | |
| AT126172A AT329914B (de) | 1971-02-16 | 1972-02-16 | Herbizide mittel |
| SU721749422A SU673135A3 (ru) | 1971-02-16 | 1972-02-16 | Гербицидный состав |
| NL7202061A NL7202061A (enExample) | 1971-02-16 | 1972-02-16 | |
| BE779443A BE779443A (fr) | 1971-02-16 | 1972-02-16 | Biscarbamates de n-acyle, leur preparation et leur utilisation |
| CH220572A CH567357A5 (enExample) | 1971-02-16 | 1972-02-16 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2108975A DE2108975C3 (de) | 1971-02-16 | 1971-02-16 | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2108975A1 DE2108975A1 (de) | 1972-08-24 |
| DE2108975B2 DE2108975B2 (de) | 1979-04-19 |
| DE2108975C3 true DE2108975C3 (de) | 1979-12-20 |
Family
ID=5799808
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2108975A Expired DE2108975C3 (de) | 1971-02-16 | 1971-02-16 | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3904669A (enExample) |
| JP (1) | JPS5244371B1 (enExample) |
| AT (1) | AT329914B (enExample) |
| AU (1) | AU460282B2 (enExample) |
| BE (1) | BE779443A (enExample) |
| CH (1) | CH567357A5 (enExample) |
| CS (1) | CS170176B2 (enExample) |
| DE (1) | DE2108975C3 (enExample) |
| DK (1) | DK133001C (enExample) |
| ES (1) | ES399808A1 (enExample) |
| FI (1) | FI58634C (enExample) |
| FR (1) | FR2125913A5 (enExample) |
| GB (1) | GB1338985A (enExample) |
| HU (1) | HU164147B (enExample) |
| IE (1) | IE36086B1 (enExample) |
| IL (1) | IL38738A (enExample) |
| IT (1) | IT948533B (enExample) |
| LU (1) | LU64633A1 (enExample) |
| NL (1) | NL7202061A (enExample) |
| NO (1) | NO135471C (enExample) |
| SE (1) | SE368395B (enExample) |
| SU (1) | SU673135A3 (enExample) |
| YU (1) | YU36695B (enExample) |
| ZA (1) | ZA72741B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| DE2413933A1 (de) * | 1974-03-20 | 1975-09-25 | Schering Ag | Diurethane mit selektiver herbizider wirkung |
| US4202684A (en) * | 1975-12-18 | 1980-05-13 | Schering Aktiengesellschaft | Carbanilic acid esters, process for making the same and herbicidal compositions containing same |
| GR66157B (enExample) * | 1976-08-28 | 1981-01-20 | Basf Ag | |
| DE2703838A1 (de) * | 1977-01-31 | 1978-08-10 | Basf Ag | Diurethane |
| DE2732848A1 (de) * | 1977-07-18 | 1979-02-08 | Schering Ag | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| BG28977A3 (en) | 1978-02-02 | 1980-08-15 | Montedison Spa | Fungicide means and method for fungus fighting |
| US4226613A (en) * | 1978-05-25 | 1980-10-07 | Basf Aktiengesellschaft | Bisthiocarbamic acid esters and herbicidal use thereof |
| DE2943965A1 (de) * | 1979-10-31 | 1981-05-27 | Basf Ag, 6700 Ludwigshafen | 1,2-oxazolylalkylcarbamate, ein verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| JPS56123633A (en) * | 1980-03-04 | 1981-09-28 | Tokyo Shibaura Electric Co | Electrode structure for vacuum breaker |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3546343A (en) * | 1966-01-18 | 1970-12-08 | Union Carbide Corp | 4-(methylcarbamoyloxy) carbanilates as insecticides and nematocides |
-
1971
- 1971-02-16 DE DE2108975A patent/DE2108975C3/de not_active Expired
-
1972
- 1972-01-20 LU LU64633D patent/LU64633A1/xx unknown
- 1972-02-04 ZA ZA720741A patent/ZA72741B/xx unknown
- 1972-02-07 CS CS757A patent/CS170176B2/cs unknown
- 1972-02-08 DK DK55172*#A patent/DK133001C/da not_active IP Right Cessation
- 1972-02-09 AU AU38824/72A patent/AU460282B2/en not_active Expired
- 1972-02-10 IL IL38738A patent/IL38738A/xx unknown
- 1972-02-10 JP JP47014768A patent/JPS5244371B1/ja active Pending
- 1972-02-10 GB GB628972A patent/GB1338985A/en not_active Expired
- 1972-02-11 US US225626A patent/US3904669A/en not_active Expired - Lifetime
- 1972-02-11 SE SE01668/72A patent/SE368395B/xx unknown
- 1972-02-12 IT IT20512/72A patent/IT948533B/it active
- 1972-02-14 YU YU0360/72A patent/YU36695B/xx unknown
- 1972-02-14 FI FI403/72A patent/FI58634C/fi active
- 1972-02-15 FR FR7204979A patent/FR2125913A5/fr not_active Expired
- 1972-02-15 NO NO434/72A patent/NO135471C/no unknown
- 1972-02-15 HU HUSCHE374*1A patent/HU164147B/hu unknown
- 1972-02-15 IE IE185/72A patent/IE36086B1/xx unknown
- 1972-02-15 ES ES399808A patent/ES399808A1/es not_active Expired
- 1972-02-16 CH CH220572A patent/CH567357A5/xx not_active IP Right Cessation
- 1972-02-16 AT AT126172A patent/AT329914B/de not_active IP Right Cessation
- 1972-02-16 SU SU721749422A patent/SU673135A3/ru active
- 1972-02-16 BE BE779443A patent/BE779443A/xx not_active IP Right Cessation
- 1972-02-16 NL NL7202061A patent/NL7202061A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| ES399808A1 (es) | 1974-12-01 |
| US3904669A (en) | 1975-09-09 |
| IE36086B1 (en) | 1976-08-18 |
| FI58634C (fi) | 1981-03-10 |
| DE2108975B2 (de) | 1979-04-19 |
| AU460282B2 (en) | 1975-04-24 |
| AU3882472A (en) | 1973-08-16 |
| AT329914B (de) | 1976-06-10 |
| CS170176B2 (enExample) | 1976-08-27 |
| IE36086L (en) | 1972-08-16 |
| JPS5244371B1 (enExample) | 1977-11-08 |
| HU164147B (enExample) | 1973-12-28 |
| DK133001C (da) | 1976-08-02 |
| YU36072A (en) | 1982-02-25 |
| IT948533B (it) | 1973-06-11 |
| FI58634B (fi) | 1980-11-28 |
| NO135471B (enExample) | 1977-01-03 |
| SE368395B (enExample) | 1974-07-01 |
| FR2125913A5 (enExample) | 1972-09-29 |
| SU673135A3 (ru) | 1979-07-05 |
| ZA72741B (en) | 1972-10-25 |
| IL38738A0 (en) | 1972-04-27 |
| IL38738A (en) | 1975-04-25 |
| CH567357A5 (enExample) | 1975-10-15 |
| LU64633A1 (enExample) | 1972-06-26 |
| BE779443A (fr) | 1972-08-16 |
| DE2108975A1 (de) | 1972-08-24 |
| YU36695B (en) | 1984-08-31 |
| NL7202061A (enExample) | 1972-08-18 |
| ATA126172A (de) | 1975-08-15 |
| NO135471C (enExample) | 1977-04-13 |
| GB1338985A (en) | 1973-11-28 |
| DK133001B (da) | 1976-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1567151C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel | |
| DE2944783C2 (de) | Diphenylätherverbindungen, Verfahren zu deren Herstellung und diese enthaltende Herbizide | |
| DE1518815C3 (de) | m-(UreidophenyI)-carbaminsäureester, deren Herstellung und diese enthaltende herbizide Mittel | |
| DE2108975C3 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| DE1189312B (de) | Mittel mit selektiver herbizider Wirkung | |
| CH623031A5 (enExample) | ||
| DE2151766A1 (de) | Phenoxycarbonsaeureamide | |
| DE2121957C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| DE2210540C2 (de) | Cyanphenylcarbonate, Verfahren zu deren Herstellung sowie diese enthaltende herbizide Mittel | |
| DE2557552C2 (de) | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe | |
| DE2109798C3 (de) | N-3-Carbamoyloxyphenyl-Thiolcarbamate sowie diese enthaltendes herbizides Mittel | |
| DE1913043C3 (de) | Substituierte Phenylcarbamate | |
| DE2310648C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel | |
| DE2310649C3 (de) | Diurethane sowie diese enthaltende selektive herbizide Mittel | |
| DE2843691A1 (de) | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel | |
| DE2042110C3 (de) | Substituierte Phenylthionocarbamate, Verfahren zu ihrer Herstellung und solche Carbamate enthaltende herbizide Mittel | |
| CH645344A5 (de) | N-(2-propinyl)-carbanilsaeure-(3-methoxycarbonylaminophenyl)-ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel. | |
| DE1913043B2 (de) | Substituierte phenylcarbamate | |
| DE2103388A1 (de) | p Fluor m Trifluormethylphenylharn stoffe zur Schädlingsbekämpfung | |
| DE2512940C2 (de) | N-Benzoyl-N-halogenphenyl-2-aminopropionsäure-ester, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2048660A1 (de) | N o Fluorphenylharnstoffe zur Schad hngsbekampfung | |
| DE1567163C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie herbizide und algizide Mittel enthaltend diese Verbindungen | |
| DE1793755C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| DE2819748C2 (de) | N-Äthylcarbanilsäure-(3-methoxycarbonylamino)-phenylester, Verfahren zur Herstellung dieser Verbindung sowie diese enthaltendes selektives herbizides Mittel | |
| DE2120087A1 (en) | Selective-herbicidal nitrobenzaldoxime carbamates - - for weed control in root crop culture |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |