GB1338985A - N-acyl-biscarbamates and herbicidal preparations containing them - Google Patents
N-acyl-biscarbamates and herbicidal preparations containing themInfo
- Publication number
- GB1338985A GB1338985A GB628972A GB628972A GB1338985A GB 1338985 A GB1338985 A GB 1338985A GB 628972 A GB628972 A GB 628972A GB 628972 A GB628972 A GB 628972A GB 1338985 A GB1338985 A GB 1338985A
- Authority
- GB
- United Kingdom
- Prior art keywords
- hydrocarbon radical
- radical
- substituted
- unsubstituted
- aliphatic hydrocarbon
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002363 herbicidal effect Effects 0.000 title abstract 2
- 238000002360 preparation method Methods 0.000 title 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 4
- 229910052757 nitrogen Inorganic materials 0.000 abstract 4
- 239000004215 Carbon black (E152) Substances 0.000 abstract 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 3
- 229930195733 hydrocarbon Natural products 0.000 abstract 3
- 229910052760 oxygen Inorganic materials 0.000 abstract 3
- 239000001301 oxygen Substances 0.000 abstract 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 2
- 125000005842 heteroatom Chemical group 0.000 abstract 2
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- ZRRCPKLWTBJUHI-UHFFFAOYSA-N 1-[(2,3,6-trichlorophenyl)methoxy]propan-1-ol Chemical compound CCC(O)OCC1=C(Cl)C=CC(Cl)=C1Cl ZRRCPKLWTBJUHI-UHFFFAOYSA-N 0.000 abstract 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 abstract 1
- LXILAQXSFLCWDQ-UHFFFAOYSA-N 5-amino-4-chloro-2-phenyl-1,5-dihydropyridazin-6-one Chemical compound C1=C(Cl)C(N)C(=O)NN1C1=CC=CC=C1 LXILAQXSFLCWDQ-UHFFFAOYSA-N 0.000 abstract 1
- PXRROZVNOOEPPZ-UHFFFAOYSA-N Flupropanate Chemical compound OC(=O)C(F)(F)C(F)F PXRROZVNOOEPPZ-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 239000013543 active substance Substances 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 239000004009 herbicide Substances 0.000 abstract 1
- ZTMKADLOSYKWCA-UHFFFAOYSA-N lenacil Chemical compound O=C1NC=2CCCC=2C(=O)N1C1CCCCC1 ZTMKADLOSYKWCA-UHFFFAOYSA-N 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 125000004430 oxygen atom Chemical group O* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/22—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/28—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C333/00—Derivatives of thiocarbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C333/02—Monothiocarbamic acids; Derivatives thereof
- C07C333/08—Monothiocarbamic acids; Derivatives thereof having nitrogen atoms of thiocarbamic groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2108975A DE2108975C3 (de) | 1971-02-16 | 1971-02-16 | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1338985A true GB1338985A (en) | 1973-11-28 |
Family
ID=5799808
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB628972A Expired GB1338985A (en) | 1971-02-16 | 1972-02-10 | N-acyl-biscarbamates and herbicidal preparations containing them |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3904669A (enExample) |
| JP (1) | JPS5244371B1 (enExample) |
| AT (1) | AT329914B (enExample) |
| AU (1) | AU460282B2 (enExample) |
| BE (1) | BE779443A (enExample) |
| CH (1) | CH567357A5 (enExample) |
| CS (1) | CS170176B2 (enExample) |
| DE (1) | DE2108975C3 (enExample) |
| DK (1) | DK133001C (enExample) |
| ES (1) | ES399808A1 (enExample) |
| FI (1) | FI58634C (enExample) |
| FR (1) | FR2125913A5 (enExample) |
| GB (1) | GB1338985A (enExample) |
| HU (1) | HU164147B (enExample) |
| IE (1) | IE36086B1 (enExample) |
| IL (1) | IL38738A (enExample) |
| IT (1) | IT948533B (enExample) |
| LU (1) | LU64633A1 (enExample) |
| NL (1) | NL7202061A (enExample) |
| NO (1) | NO135471C (enExample) |
| SE (1) | SE368395B (enExample) |
| SU (1) | SU673135A3 (enExample) |
| YU (1) | YU36695B (enExample) |
| ZA (1) | ZA72741B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| DE2413933A1 (de) * | 1974-03-20 | 1975-09-25 | Schering Ag | Diurethane mit selektiver herbizider wirkung |
| US4202684A (en) * | 1975-12-18 | 1980-05-13 | Schering Aktiengesellschaft | Carbanilic acid esters, process for making the same and herbicidal compositions containing same |
| GR66157B (enExample) * | 1976-08-28 | 1981-01-20 | Basf Ag | |
| DE2703838A1 (de) * | 1977-01-31 | 1978-08-10 | Basf Ag | Diurethane |
| DE2732848A1 (de) * | 1977-07-18 | 1979-02-08 | Schering Ag | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| BG28977A3 (en) | 1978-02-02 | 1980-08-15 | Montedison Spa | Fungicide means and method for fungus fighting |
| US4226613A (en) * | 1978-05-25 | 1980-10-07 | Basf Aktiengesellschaft | Bisthiocarbamic acid esters and herbicidal use thereof |
| DE2943965A1 (de) * | 1979-10-31 | 1981-05-27 | Basf Ag, 6700 Ludwigshafen | 1,2-oxazolylalkylcarbamate, ein verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| JPS56123633A (en) * | 1980-03-04 | 1981-09-28 | Tokyo Shibaura Electric Co | Electrode structure for vacuum breaker |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3546343A (en) * | 1966-01-18 | 1970-12-08 | Union Carbide Corp | 4-(methylcarbamoyloxy) carbanilates as insecticides and nematocides |
-
1971
- 1971-02-16 DE DE2108975A patent/DE2108975C3/de not_active Expired
-
1972
- 1972-01-20 LU LU64633D patent/LU64633A1/xx unknown
- 1972-02-04 ZA ZA720741A patent/ZA72741B/xx unknown
- 1972-02-07 CS CS757A patent/CS170176B2/cs unknown
- 1972-02-08 DK DK55172*#A patent/DK133001C/da not_active IP Right Cessation
- 1972-02-09 AU AU38824/72A patent/AU460282B2/en not_active Expired
- 1972-02-10 IL IL38738A patent/IL38738A/xx unknown
- 1972-02-10 JP JP47014768A patent/JPS5244371B1/ja active Pending
- 1972-02-10 GB GB628972A patent/GB1338985A/en not_active Expired
- 1972-02-11 SE SE01668/72A patent/SE368395B/xx unknown
- 1972-02-11 US US225626A patent/US3904669A/en not_active Expired - Lifetime
- 1972-02-12 IT IT20512/72A patent/IT948533B/it active
- 1972-02-14 FI FI403/72A patent/FI58634C/fi active
- 1972-02-14 YU YU0360/72A patent/YU36695B/xx unknown
- 1972-02-15 ES ES399808A patent/ES399808A1/es not_active Expired
- 1972-02-15 NO NO434/72A patent/NO135471C/no unknown
- 1972-02-15 IE IE185/72A patent/IE36086B1/xx unknown
- 1972-02-15 HU HUSCHE374*1A patent/HU164147B/hu unknown
- 1972-02-15 FR FR7204979A patent/FR2125913A5/fr not_active Expired
- 1972-02-16 AT AT126172A patent/AT329914B/de not_active IP Right Cessation
- 1972-02-16 BE BE779443A patent/BE779443A/xx not_active IP Right Cessation
- 1972-02-16 SU SU721749422A patent/SU673135A3/ru active
- 1972-02-16 NL NL7202061A patent/NL7202061A/xx not_active Application Discontinuation
- 1972-02-16 CH CH220572A patent/CH567357A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2108975C3 (de) | 1979-12-20 |
| DE2108975B2 (de) | 1979-04-19 |
| FI58634B (fi) | 1980-11-28 |
| JPS5244371B1 (enExample) | 1977-11-08 |
| ATA126172A (de) | 1975-08-15 |
| NO135471C (enExample) | 1977-04-13 |
| YU36695B (en) | 1984-08-31 |
| FR2125913A5 (enExample) | 1972-09-29 |
| NL7202061A (enExample) | 1972-08-18 |
| CH567357A5 (enExample) | 1975-10-15 |
| DK133001C (da) | 1976-08-02 |
| LU64633A1 (enExample) | 1972-06-26 |
| DE2108975A1 (de) | 1972-08-24 |
| AU460282B2 (en) | 1975-04-24 |
| US3904669A (en) | 1975-09-09 |
| ZA72741B (en) | 1972-10-25 |
| AU3882472A (en) | 1973-08-16 |
| IE36086B1 (en) | 1976-08-18 |
| IT948533B (it) | 1973-06-11 |
| CS170176B2 (enExample) | 1976-08-27 |
| SE368395B (enExample) | 1974-07-01 |
| YU36072A (en) | 1982-02-25 |
| BE779443A (fr) | 1972-08-16 |
| NO135471B (enExample) | 1977-01-03 |
| HU164147B (enExample) | 1973-12-28 |
| AT329914B (de) | 1976-06-10 |
| IE36086L (en) | 1972-08-16 |
| SU673135A3 (ru) | 1979-07-05 |
| DK133001B (da) | 1976-03-08 |
| ES399808A1 (es) | 1974-12-01 |
| IL38738A (en) | 1975-04-25 |
| FI58634C (fi) | 1981-03-10 |
| IL38738A0 (en) | 1972-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1323553A (en) | Thiophene derivatives | |
| GB1486969A (en) | Bis-(0-1-alkylthio-ethylimino)-n-methyl-carbamic acid)-n,n'-sulphides | |
| GB1377225A (en) | Acylanilino compounds and herbicidal compositions containing them | |
| GB1338985A (en) | N-acyl-biscarbamates and herbicidal preparations containing them | |
| GB1189915A (en) | Carbamic Acid Fluorides | |
| GB1287253A (en) | Fungicidal agents | |
| ES8402581A1 (es) | Un procedimiento para preparar derivados de imidazol y triazol. | |
| ES450191A1 (es) | Procedimiento para preparar composiciones activas como her- bicidas a base de compuestos de alamina sustituida en n. | |
| GB1394619A (en) | Imides | |
| GB1508772A (en) | Biologically active compositions | |
| GB1182129A (en) | Phosphoric Acid Esters and Pesticidal Preparations Containing them | |
| GB1350264A (en) | Herbicidal preparations | |
| GB1243815A (en) | Herbicidal preparations | |
| GB1255751A (en) | Herbicidal agents | |
| JPS5331638A (en) | Alkylene glycol dibenzoates and fungicides containing the same | |
| GB1314392A (en) | Derivatives of thiocarbamic acid their manufacture and their use for combating insects and representatives of the order acarina | |
| ES8107002A1 (es) | Procedimiento de obtencion de compuestos herbicidas | |
| GB1480429A (en) | Ethers and thioethers and their use as pesticides | |
| GB1348856A (en) | Insecticidal phosphoroamidothioates and compositions containing them | |
| JPS5427564A (en) | 1-branched alkylcarbonyl-3-(3,5-dihalogenophenyl) hydantoins, their preparation, and bactericides for pomicultural and horticultural uses containing the same as active agent. | |
| ES346745A1 (es) | Procedimiento para la preparacion de sulfonilamidas. | |
| GB1190384A (en) | Dinitrodihalophenyl esters and fungicidal compositions containing them | |
| GB1268612A (en) | New n-alkoxyalkylene-alkyl ureas and compositions containing them | |
| GB1455543A (en) | Substituted 4,4-dicyclohexylmethane derivatives and microbicidal preparations containing them | |
| GB1189267A (en) | Sulphenic Acid Derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |