DE2101685C3 - Monoazofarbstoffe und deren Verwendung zum Färben synthetischer PoIyamidfasermaterialien - Google Patents
Monoazofarbstoffe und deren Verwendung zum Färben synthetischer PoIyamidfasermaterialienInfo
- Publication number
- DE2101685C3 DE2101685C3 DE2101685A DE2101685A DE2101685C3 DE 2101685 C3 DE2101685 C3 DE 2101685C3 DE 2101685 A DE2101685 A DE 2101685A DE 2101685 A DE2101685 A DE 2101685A DE 2101685 C3 DE2101685 C3 DE 2101685C3
- Authority
- DE
- Germany
- Prior art keywords
- amino
- same
- ethyl
- red
- fiber materials
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 15
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 5
- 239000004952 Polyamide Substances 0.000 title description 14
- 229920002647 polyamide Polymers 0.000 title description 14
- 238000004043 dyeing Methods 0.000 title description 3
- 239000002657 fibrous material Substances 0.000 title description 3
- 239000002253 acid Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 description 19
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- VTILWYBQQRECER-UHFFFAOYSA-N 5-sulfonylcyclohexa-1,3-diene Chemical compound O=S(=O)=C1CC=CC=C1 VTILWYBQQRECER-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- -1 phenylsulfonylamino Chemical group 0.000 description 2
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical class NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- CIPVVROJHKLHJI-UHFFFAOYSA-N n,n-diethyl-3-methylaniline Chemical compound CCN(CC)C1=CC=CC(C)=C1 CIPVVROJHKLHJI-UHFFFAOYSA-N 0.000 description 1
- MMFBQHXDINNBMW-UHFFFAOYSA-N n,n-dipropylaniline Chemical compound CCCN(CCC)C1=CC=CC=C1 MMFBQHXDINNBMW-UHFFFAOYSA-N 0.000 description 1
- IPSSLEUDWUOSJJ-UHFFFAOYSA-N n-[[3-(2-methylphenyl)phenyl]methyl]ethanamine Chemical compound CCNCC1=CC=CC(C=2C(=CC=CC=2)C)=C1 IPSSLEUDWUOSJJ-UHFFFAOYSA-N 0.000 description 1
- HSZCJVZRHXPCIA-UHFFFAOYSA-N n-benzyl-n-ethylaniline Chemical compound C=1C=CC=CC=1N(CC)CC1=CC=CC=C1 HSZCJVZRHXPCIA-UHFFFAOYSA-N 0.000 description 1
- KERKSHQWMCWPBT-UHFFFAOYSA-N n-phenylacetamide;sulfurochloridic acid Chemical compound OS(Cl)(=O)=O.CC(=O)NC1=CC=CC=C1 KERKSHQWMCWPBT-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 235000015149 toffees Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2101685A DE2101685C3 (de) | 1971-01-15 | 1971-01-15 | Monoazofarbstoffe und deren Verwendung zum Färben synthetischer PoIyamidfasermaterialien |
| NL7200467A NL7200467A (Direct) | 1971-01-15 | 1972-01-12 | |
| IT19334/72A IT951878B (it) | 1971-01-15 | 1972-01-13 | Monoazocoloranti |
| CH1085573A CH568361A5 (Direct) | 1971-01-15 | 1972-01-14 | |
| JP595172A JPS5725575B1 (Direct) | 1971-01-15 | 1972-01-14 | |
| US00217961A US3852263A (en) | 1971-01-15 | 1972-01-14 | Substituted 4-(n-sulphoalkylene-aminosulphonyl)-phenyl-azo-phenyl compounds |
| FR7201284A FR2121860B1 (Direct) | 1971-01-15 | 1972-01-14 | |
| BE778077A BE778077A (fr) | 1971-01-15 | 1972-01-14 | Colorants monoazoiques |
| GB187072A GB1326171A (en) | 1971-01-15 | 1972-01-14 | Monoazoy dyestuffs |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2101685A DE2101685C3 (de) | 1971-01-15 | 1971-01-15 | Monoazofarbstoffe und deren Verwendung zum Färben synthetischer PoIyamidfasermaterialien |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2101685A1 DE2101685A1 (de) | 1972-07-20 |
| DE2101685B2 DE2101685B2 (de) | 1977-09-01 |
| DE2101685C3 true DE2101685C3 (de) | 1978-05-11 |
Family
ID=5795920
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2101685A Expired DE2101685C3 (de) | 1971-01-15 | 1971-01-15 | Monoazofarbstoffe und deren Verwendung zum Färben synthetischer PoIyamidfasermaterialien |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3852263A (Direct) |
| JP (1) | JPS5725575B1 (Direct) |
| BE (1) | BE778077A (Direct) |
| CH (1) | CH568361A5 (Direct) |
| DE (1) | DE2101685C3 (Direct) |
| FR (1) | FR2121860B1 (Direct) |
| GB (1) | GB1326171A (Direct) |
| IT (1) | IT951878B (Direct) |
| NL (1) | NL7200467A (Direct) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1032537A (en) * | 1973-04-04 | 1978-06-06 | Stefan Koller | Dyestuffs for synthetic fibres |
| DE2740846A1 (de) * | 1977-09-10 | 1979-03-22 | Bayer Ag | Wasserloesliche monoazofarbstoffe |
| US4271072A (en) * | 1977-12-20 | 1981-06-02 | American Hoechst Corporation | Azo dyestuffs containing -SO2 CH2 CH2 OSO3 H and -N(CH2 CH2 OSO3 H)2 groups |
| DE3133915A1 (de) * | 1981-08-27 | 1983-03-17 | Bayer Ag, 5090 Leverkusen | Saure monoazofarbstoffe und deren verwendung zum faerben von polyamiden |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE692367C (de) * | 1936-09-05 | 1940-06-18 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von wasserloeslichen Disazofarbstoffen |
| GB482342A (en) * | 1936-09-24 | 1938-03-24 | Ig Farbenindustrie Ag | Manufacture of disazo-dyestuffs soluble in water |
| DE723090C (de) * | 1938-11-02 | 1942-07-30 | Ig Farbenindustrie Ag | Verfahren zur Herstellung von wasserloeslichen Monoazofarbstoffen |
| US2261175A (en) * | 1939-07-01 | 1941-11-04 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2694727A (en) * | 1951-09-07 | 1954-11-16 | Gen Aniline & Film Corp | N-alkylbenzenesulfonyl-n-alkyl taurates |
| FR1435305A (fr) * | 1964-04-21 | 1966-04-15 | Basf Ag | Colorants azoïques et procédé pour leur préparation |
| US3528961A (en) * | 1966-08-16 | 1970-09-15 | Allied Chem | Monoazo dyes from e-caprolactam |
-
1971
- 1971-01-15 DE DE2101685A patent/DE2101685C3/de not_active Expired
-
1972
- 1972-01-12 NL NL7200467A patent/NL7200467A/xx unknown
- 1972-01-13 IT IT19334/72A patent/IT951878B/it active
- 1972-01-14 US US00217961A patent/US3852263A/en not_active Expired - Lifetime
- 1972-01-14 CH CH1085573A patent/CH568361A5/xx not_active IP Right Cessation
- 1972-01-14 BE BE778077A patent/BE778077A/xx unknown
- 1972-01-14 JP JP595172A patent/JPS5725575B1/ja active Pending
- 1972-01-14 GB GB187072A patent/GB1326171A/en not_active Expired
- 1972-01-14 FR FR7201284A patent/FR2121860B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7200467A (Direct) | 1972-07-18 |
| CH568361A5 (Direct) | 1975-10-31 |
| GB1326171A (en) | 1973-08-08 |
| DE2101685A1 (de) | 1972-07-20 |
| US3852263A (en) | 1974-12-03 |
| JPS5725575B1 (Direct) | 1982-05-31 |
| IT951878B (it) | 1973-07-10 |
| BE778077A (fr) | 1972-07-14 |
| DE2101685B2 (de) | 1977-09-01 |
| FR2121860B1 (Direct) | 1975-10-24 |
| FR2121860A1 (Direct) | 1972-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1544375B1 (de) | Wasserunloesliche Monoazofarbstoffe | |
| DE1644328C3 (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2443485C2 (de) | Disazofarbstoffe und deren Verwendung | |
| DE2209839C2 (de) | Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von polymeren Materialien | |
| DE2101685C3 (de) | Monoazofarbstoffe und deren Verwendung zum Färben synthetischer PoIyamidfasermaterialien | |
| DE2531445C3 (de) | Sulfogruppenfreie wasserlösliche Azofarbstoffe und deren Verwendung zum Färben und/oder Bedrucken von synthetischen Textilfasern | |
| DE1940685C3 (de) | Dispersionsfarbstoffe der Amino pyrazolreihe, Verfahren zu ihrer Her Stellung und Verwendung | |
| DE2203460C3 (de) | Monoazofarbstoffe und Verfahren zum Färben und Bedrucken | |
| DE2250083A1 (de) | Monoazofarbstoffe | |
| DE2726656A1 (de) | Braune bis violette azofarbstoffe | |
| DE2354686A1 (de) | Azofarbstoffe der isothiazolo-pyrimidinreihe | |
| DE2804599C2 (de) | Azofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2910806A1 (de) | Farbstoffe der thiazolreihe | |
| DE2748978A1 (de) | Azofarbstoffe | |
| DE2711130C2 (de) | Azofarbstoffe | |
| DE2064595A1 (en) | Monoazo dyes free of sulphonic acid groups | |
| DE2202132C3 (de) | Monoazofarbstoffe, und Verfahren zu deren Herstellung und ihre Verwendung | |
| DE2843475A1 (de) | Monoazofarbstoffe | |
| DE696313C (de) | Verfahren zum Faerben von Wolle | |
| DE2054343C3 (de) | Wasserlösliche Monoazofarbstoffe und deren Verwendung zum Färben von Fasermaterialien aus synthetischen Polyamiden | |
| DE1932246C (de) | Verfahren zur Färbung von Leder | |
| DE2065646C3 (de) | 1 zu 1-Kupferkomplexverbindungen von Monoazofarbstoffe^ Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder oder Fasern aus Wolle, Seide, Polyamiden und/oder regenerierter Cellulose | |
| DE1544375C (de) | Wasserunlösliche Monoazofarbstoffe | |
| DE1644122B2 (de) | Sulfonsaeure- und carbonsaeuregruppenfreie wasserunloesliche monoazofarbstoffe und verfahren zu ihrer herstellung | |
| AT227852B (de) | Verfahren zur Herstellung neuer wasserunlöslicher Monoazofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |