DE1795838B2 - Cephalosporinderivate - Google Patents
CephalosporinderivateInfo
- Publication number
- DE1795838B2 DE1795838B2 DE1795838A DE1795838A DE1795838B2 DE 1795838 B2 DE1795838 B2 DE 1795838B2 DE 1795838 A DE1795838 A DE 1795838A DE 1795838 A DE1795838 A DE 1795838A DE 1795838 B2 DE1795838 B2 DE 1795838B2
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- mixture
- thiomethyl
- cephem
- carboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229940124587 cephalosporin Drugs 0.000 title claims description 9
- 229930186147 Cephalosporin Natural products 0.000 title claims description 8
- 150000001780 cephalosporins Chemical class 0.000 title claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 17
- 239000003814 drug Substances 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 42
- 239000000203 mixture Substances 0.000 description 39
- -1 substituted-thiomethyl Chemical group 0.000 description 38
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 29
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000000843 powder Substances 0.000 description 24
- 239000005662 Paraffin oil Substances 0.000 description 22
- 238000002329 infrared spectrum Methods 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 239000000706 filtrate Substances 0.000 description 17
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- 238000001816 cooling Methods 0.000 description 16
- 238000001914 filtration Methods 0.000 description 16
- 238000000034 method Methods 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000002253 acid Substances 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- DYCLHZPOADTVKK-UHFFFAOYSA-N 2-(2-azaniumyl-1,3-thiazol-4-yl)acetate Chemical compound NC1=NC(CC(O)=O)=CS1 DYCLHZPOADTVKK-UHFFFAOYSA-N 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 description 6
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 description 6
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 5
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- 150000003573 thiols Chemical class 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 3
- 239000004157 Nitrosyl chloride Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 3
- 235000019392 nitrosyl chloride Nutrition 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000005185 salting out Methods 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 125000003831 tetrazolyl group Chemical group 0.000 description 3
- 238000002211 ultraviolet spectrum Methods 0.000 description 3
- XUTQHTOXGKVJPN-XCGJVMPOSA-N (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XUTQHTOXGKVJPN-XCGJVMPOSA-N 0.000 description 2
- XOHZHMUQBFJTNH-UHFFFAOYSA-N 1-methyl-2h-tetrazole-5-thione Chemical compound CN1N=NN=C1S XOHZHMUQBFJTNH-UHFFFAOYSA-N 0.000 description 2
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 229950004030 cefaloglycin Drugs 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- HCQABJQZDYSTJH-QFSRMBNQSA-N (6r)-4-acetamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CC(NC(=O)C)S[C@@H]2CC(=O)N21 HCQABJQZDYSTJH-QFSRMBNQSA-N 0.000 description 1
- ORUQLKZDLXDDDD-FFFFSGIJSA-N (6r)-7-[[2-(2-amino-1,3-thiazol-5-yl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC(N)=NC=3)[C@H]2SC1 ORUQLKZDLXDDDD-FFFFSGIJSA-N 0.000 description 1
- HJSGHKMSDOLGJJ-IOJJLOCKSA-N (6r)-7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 HJSGHKMSDOLGJJ-IOJJLOCKSA-N 0.000 description 1
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 1
- RJFPBECTFIUTHB-INEUFUBQSA-N (6r,7r)-7-azaniumyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC=C(C(O)=O)N2C(=O)[C@@H](N)[C@H]21 RJFPBECTFIUTHB-INEUFUBQSA-N 0.000 description 1
- 125000004516 1,2,4-thiadiazol-5-yl group Chemical group S1N=CN=C1* 0.000 description 1
- 125000001414 1,2,4-triazol-5-yl group Chemical group [H]N1N=C([H])N=C1[*] 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HAZSOXTUZRFCEW-UHFFFAOYSA-N 1-chloro-1-ethoxyethene Chemical group CCOC(Cl)=C HAZSOXTUZRFCEW-UHFFFAOYSA-N 0.000 description 1
- ZEWJJZKVQOMYKJ-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)acetic acid;hydrochloride Chemical compound Cl.NC1=NC(CC(O)=O)=CS1 ZEWJJZKVQOMYKJ-UHFFFAOYSA-N 0.000 description 1
- APIMXAGCLCGUGB-UHFFFAOYSA-N 2-(2-azaniumyl-1,3-thiazol-5-yl)acetate Chemical compound NC1=NC=C(CC(O)=O)S1 APIMXAGCLCGUGB-UHFFFAOYSA-N 0.000 description 1
- QMGRTPHVXPNNBK-UHFFFAOYSA-N 2-(5-methyltetrazol-1-yl)acetic acid Chemical compound CC1=NN=NN1CC(O)=O QMGRTPHVXPNNBK-UHFFFAOYSA-N 0.000 description 1
- GRWKNBPOGBTZMN-UHFFFAOYSA-N 2-benzyl-3-phenylpropane-1,2-diamine Chemical compound C=1C=CC=CC=1CC(N)(CN)CC1=CC=CC=C1 GRWKNBPOGBTZMN-UHFFFAOYSA-N 0.000 description 1
- OAZHXZJUWHKFMP-UHFFFAOYSA-N 2-methylindazole Chemical compound C1=CC=CC2=NN(C)C=C21 OAZHXZJUWHKFMP-UHFFFAOYSA-N 0.000 description 1
- LLCOQBODWBFTDD-UHFFFAOYSA-M 2h-triazole-4-thiolate Chemical compound [S-]C=1C=NNN=1 LLCOQBODWBFTDD-UHFFFAOYSA-M 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- FQOGSTGLRLMQOV-UHFFFAOYSA-N 5-nitro-3h-1,3-benzoxazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2OC(=S)NC2=C1 FQOGSTGLRLMQOV-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 241001619326 Cephalosporium Species 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- XJTZCXPEYHULLG-UHFFFAOYSA-N carbonic acid;1-chloro-2-methylpropane Chemical compound OC(O)=O.CC(C)CCl XJTZCXPEYHULLG-UHFFFAOYSA-N 0.000 description 1
- CZTQZXZIADLWOZ-CRAIPNDOSA-N cefaloridine Chemical compound O=C([C@@H](NC(=O)CC=1SC=CC=1)[C@H]1SC2)N1C(C(=O)[O-])=C2C[N+]1=CC=CC=C1 CZTQZXZIADLWOZ-CRAIPNDOSA-N 0.000 description 1
- 229960003866 cefaloridine Drugs 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- PBMIETCUUSQZCG-UHFFFAOYSA-N n'-cyclohexylmethanediimine Chemical compound N=C=NC1CCCCC1 PBMIETCUUSQZCG-UHFFFAOYSA-N 0.000 description 1
- QAFRYXRYDOBFEF-UHFFFAOYSA-N n-cyclohexylcyclohexanimine Chemical compound C1CCCCC1N=C1CCCCC1 QAFRYXRYDOBFEF-UHFFFAOYSA-N 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- DAFQZPUISLXFBF-UHFFFAOYSA-N tetraoxathiolane 5,5-dioxide Chemical compound O=S1(=O)OOOO1 DAFQZPUISLXFBF-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000001974 tryptic soy broth Substances 0.000 description 1
- 108010050327 trypticase-soy broth Proteins 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47L—DOMESTIC WASHING OR CLEANING; SUCTION CLEANERS IN GENERAL
- A47L13/00—Implements for cleaning floors, carpets, furniture, walls, or wall coverings
- A47L13/02—Scraping
- A47L13/04—Scraping with steel wool
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2397167 | 1967-04-15 | ||
| JP6842967 | 1967-10-24 | ||
| JP6951067A JPS4614736B1 (enExample) | 1967-10-28 | 1967-10-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1795838A1 DE1795838A1 (de) | 1976-07-29 |
| DE1795838B2 true DE1795838B2 (de) | 1979-07-26 |
Family
ID=27284465
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1795838A Withdrawn DE1795838B2 (de) | 1967-04-15 | 1968-04-10 | Cephalosporinderivate |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3516997A (enExample) |
| AT (1) | AT292193B (enExample) |
| CA (1) | CA928292A (enExample) |
| CH (2) | CH527215A (enExample) |
| DE (1) | DE1795838B2 (enExample) |
| ES (3) | ES352625A1 (enExample) |
| FR (1) | FR7475M (enExample) |
| GB (1) | GB1206305A (enExample) |
| NL (1) | NL164560C (enExample) |
| SE (1) | SE369908B (enExample) |
Families Citing this family (94)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1953861C2 (de) * | 1969-10-25 | 1982-12-23 | Fujisawa Pharmaceutical Co., Ltd., Osaka | 7-Tetrazolylacetamido-3-thiomethyl-3-cephem-4- carbonsäuren |
| FR2068419A1 (en) * | 1969-10-27 | 1971-08-27 | Fujisawa Pharmaceutical Co | Antibacterial cephalosporin compsns |
| BE758587A (fr) * | 1969-11-17 | 1971-05-06 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide 7-aminocephalosporanique et nouveaux produits ainsi obtenus |
| US4010264A (en) * | 1970-11-06 | 1977-03-01 | Koninklijke Nederlandsche Gist-En Spiritusfabriek N.V. | 7-[3-Substituted isoxazol-5-yl]-acetamido-cephalosporanic acids and their anti-bacterial use |
| US3687948A (en) * | 1970-11-23 | 1972-08-29 | Bristol Myers Co | 7-{8 D-(a-AMINO-a-PHENYLACETAMIDO){9 -3-(4-METHYL-1,3-OXAZOL-2-YLTHIOMETHYL-3-CEPHEM-4-CARBOXYLIC ACID AND SALTS THEREOF |
| US3855213A (en) * | 1971-02-18 | 1974-12-17 | Smith Kline French Lab | 3-heterocyclic thiomethyl-cephalosporins |
| US3972919A (en) * | 1970-12-17 | 1976-08-03 | Smithkline Corporation | p-Hydroxymethylphenylglycine |
| US3867380A (en) * | 1971-02-18 | 1975-02-18 | Smithkline Corp | 3-Heterocyclic thiomethylcephalosporins |
| CA977337A (en) * | 1971-01-18 | 1975-11-04 | Bristol-Myers Canada Limited | Preparation of 7-d-(2-amino-substituted-acetamido)-3-s-(1,2,3,-triazole-5-yl)-thiomethyl-3-cephem-4-carboxylic acid |
| IE36221B1 (en) * | 1971-04-21 | 1976-09-15 | Ciba Geigy Ag | Acylamino compounds and a process for their manufacture |
| US3757014A (en) * | 1971-05-07 | 1973-09-04 | Bristol Myers Co | Ts 1,3,4 - oxadiazol-2-yl)thiomethyl)-3-cephem-4-carboxylic acid and sal7-(d-(alpha-amino-alpha-pheyle-acetamido)) - 3-(s-(5-hydroxymethyl - |
| US4025509A (en) * | 1972-03-30 | 1977-05-24 | Ciba-Geigy Corporation | Aminopyridinium acetyl cephalosporanes |
| US3968226A (en) * | 1972-06-14 | 1976-07-06 | Smithkline Corporation | 3-Heterocyclic thiomethylcephalosporins as antibacterial agents |
| US3855212A (en) * | 1972-08-04 | 1974-12-17 | Squibb & Sons Inc | Cyanomethylth ioacetylcephalosporins |
| US3907784A (en) * | 1972-09-11 | 1975-09-23 | Lilly Co Eli | 7-Halophenylthioacetamido cephalosporins |
| JPS49124574A (enExample) * | 1972-09-15 | 1974-11-28 | ||
| US4060687A (en) * | 1972-11-13 | 1977-11-29 | Merck & Co., Inc. | Cephalosporins having a 3-α substituted alkyl grouping |
| US3957768A (en) * | 1972-11-14 | 1976-05-18 | Smithkline Corporation | 3-heterocyclicthiomethylcephalosporins |
| US4160829A (en) * | 1972-12-22 | 1979-07-10 | Gist-Brocades N.V. | Antibacterial 1,2,4-oxadiazolylacetamido cephalosporins |
| US3898217A (en) * | 1973-03-30 | 1975-08-05 | American Home Prod | 7-(1-Aminomethylcycloalkylcarboxamido)cephalosporanic |
| US4133882A (en) * | 1973-05-11 | 1979-01-09 | Smithkline Corporation | 7-Hydroxyhalophenylacetamido-3-heterocyclicthiomethyl cephalosporins |
| US3884914A (en) * | 1973-07-05 | 1975-05-20 | Smithkline Corp | Mandelamidocephalosporins with improved properties |
| US3957985A (en) * | 1973-07-05 | 1976-05-18 | Smithkline Corporation | Mandelamidocephalosporins with improved properties |
| US4022895A (en) * | 1973-08-01 | 1977-05-10 | Smithkline Corporation | Substituted phenylglycylcephalosporins |
| JPS5093989A (enExample) * | 1973-10-25 | 1975-07-26 | ||
| US4071683A (en) * | 1973-10-30 | 1978-01-31 | Bayer Aktiengesellschaft | Oxoimidazolidinylthiocarbonyl derivatives of ceph-3-em-4-carboxylic acids |
| AR205728A1 (es) * | 1973-11-14 | 1976-05-31 | Rhone Poulenc Sa | Procedimiento para preparar ((dihidro-5,6-oxa)-(di) tiino-1,4-il-2) acetamido)-7 cefalosporina y sus sales |
| US3943126A (en) * | 1973-11-15 | 1976-03-09 | Eli Lilly And Company | Process for acylating a 7-aminocephalosporin |
| US4379924A (en) * | 1973-12-25 | 1983-04-12 | Takeda Chemical Industries, Ltd. | Cephalosporin derivatives |
| NZ176206A (en) * | 1973-12-25 | 1978-03-06 | Takeda Chemical Industries Ltd | Cephalosporins |
| US3993758A (en) * | 1974-01-18 | 1976-11-23 | Beecham Group Limited | Cephalosporin compounds |
| US4205166A (en) * | 1974-02-20 | 1980-05-27 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted-3-aminoalkyl-, acylaminoalkyl-, or hydroxyalkyl-substituted heterocyclic thiomethyl-3-cephem-4-carboxylic acid derivatives and preparation thereof |
| US3929782A (en) * | 1974-03-13 | 1975-12-30 | Squibb & Sons Inc | 1,2,4-Oxadiazolonylacetyl cephalosporins |
| US3960849A (en) * | 1974-03-13 | 1976-06-01 | E. R. Squibb & Sons, Inc. | Amino-1,2,4-oxadiazolyl-3-acetyl cephalosporins |
| US4160086A (en) * | 1974-04-27 | 1979-07-03 | Beecham Group Limited | 3-Heterocyclicthio-7-α-carboxy 2-aryl acetamido cephalosporanic acid |
| US4091211A (en) * | 1974-05-05 | 1978-05-23 | Hoffmann-La Roche Inc. | Cephalosporins |
| JPS612674B2 (enExample) * | 1974-06-20 | 1986-01-27 | Meiji Seika Co | |
| US3959259A (en) * | 1974-07-08 | 1976-05-25 | E. R. Squibb & Sons, Inc. | 1,2,4-Oxadiazolonylacetyl penicillins |
| US3954745A (en) * | 1974-09-12 | 1976-05-04 | Eli Lilly And Company | Process for preparing cefazolin |
| IE41697B1 (en) * | 1974-09-27 | 1980-02-27 | Rhone Poulenc Ind | New cephalosporin derivatives their preparation and compositions containing them |
| US4182868A (en) * | 1974-10-29 | 1980-01-08 | Takeda Chemical Industries, Ltd. | 7-Methoxycephalosporin derivatives |
| US4018759A (en) * | 1974-12-03 | 1977-04-19 | Smithkline Corporation | 3-Heterocyclicthiomethylcephalosporins |
| US4286089A (en) * | 1974-12-27 | 1981-08-25 | Smithkline Corporation | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
| US4093723A (en) * | 1976-05-19 | 1978-06-06 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins |
| US3979384A (en) * | 1975-03-20 | 1976-09-07 | Merck & Co., Inc. | C-3 Substituted cephalosporins |
| US4029782A (en) * | 1975-04-28 | 1977-06-14 | Eli Lilly And Company | Cefazolin suspension for parenteral administration |
| US4126745A (en) * | 1975-04-30 | 1978-11-21 | Sankyo Company Limited | 7-Methoxycephalosporin derivatives |
| DE2620094A1 (de) * | 1975-05-12 | 1976-12-02 | Takeda Chemical Industries Ltd | Cephalosporinverbindungen und verfahren zu ihrer herstellung |
| CA1088049A (en) * | 1975-06-03 | 1980-10-21 | Takashi Masugi | 3-substituted-7-substituted alkanamido-3-cephem-4- carboxylic acid compounds and processes for preparation thereof |
| US4131672A (en) * | 1975-06-09 | 1978-12-26 | Eli Lilly And Company | Method for treating methicillin resistant Staphylococcus aureus |
| US4049806A (en) * | 1975-08-15 | 1977-09-20 | Syntex (U.S.A.) Inc. | Cephalosporin type antibacterials |
| US4048311A (en) * | 1976-01-08 | 1977-09-13 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl)cephalosporins |
| US4152433A (en) * | 1976-03-12 | 1979-05-01 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-7-substituted-2 or 3-cephem-4-carboxylic acid compounds and pharmaceutical compositions |
| US4220644A (en) * | 1976-05-03 | 1980-09-02 | Smithkline Corporation | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins |
| US4034092A (en) * | 1976-05-03 | 1977-07-05 | Smithkline Corporation | 7-Acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4165429A (en) * | 1976-06-28 | 1979-08-21 | Yamanouchi Pharmaceutical Co., Ltd. | 7α-METHOXY-CEPHALOSPORANIC ACID DERIVATIVES |
| FI771866A7 (enExample) * | 1976-06-28 | 1977-12-29 | Fujisawa Pharmaceutical Co | |
| DE2655949A1 (de) * | 1976-12-10 | 1978-06-15 | Gruenenthal Gmbh | Neue cephalosporin- und penicillinderivate, verfahren zu deren herstellung und diese produkte enthaltende arzneimittel |
| US4316037A (en) * | 1977-01-21 | 1982-02-16 | American Home Products Corporation | N-Benzyl and N-substituted benzyl tetrazole-5-carboxylic acids and the preparation thereof |
| GB1565941A (en) * | 1977-02-08 | 1980-04-23 | Toyama Chemical Co Ltd | Process for producing 7-(substituted)amino-3-substituted thiomethyl cephem carboxylic acids |
| US4115645A (en) * | 1977-05-10 | 1978-09-19 | Eli Lilly And Company | Decolorizing process for 7-amino-3-(((2-methyl-1,3,4-thiadiazol-5-yl)thio)methyl)-3-cephem-4-carboxylic acid |
| US4104470A (en) * | 1977-06-03 | 1978-08-01 | Eli Lilly And Company | Crystallization process for cefazolin sodium |
| CH648317A5 (de) * | 1977-06-10 | 1985-03-15 | Yamanouchi Pharma Co Ltd | 7alpha-methoxy-7betha-(1,3-dithietan-2- carboxamido)cephalosporansaeurederivate und verfahren zu ihrer herstellung. |
| US4229573A (en) * | 1977-06-21 | 1980-10-21 | Asahi Kasei Kogyo Kabushiki Kaisha | 7α-Methoxycephalosporin derivatives |
| US4148998A (en) * | 1977-10-04 | 1979-04-10 | Yeda Research And Development Co., Ltd. | Pyrrole cephalosporin derivatives |
| IT1192287B (it) * | 1977-11-14 | 1988-03-31 | Fujisawa Pharmaceutical Co | Derivati di acido cefalosporanico ad azione farmaceutica e relativo procedimento di preparazione |
| JPS6052711B2 (ja) * | 1978-03-09 | 1985-11-20 | 旭化成株式会社 | セフアロスポリン化合物の製法 |
| EP0004570B1 (en) * | 1978-03-09 | 1982-04-14 | Asahi Kasei Kogyo Kabushiki Kaisha | Thiol esters, process for their preparation, pharmaceutical compositions containing them and a process for preparing cephalosporin compounds using the same |
| US4314059A (en) * | 1978-03-09 | 1982-02-02 | Chisei Shibuya | Process for preparing cephalosporin compounds |
| JPS6027677B2 (ja) * | 1978-07-06 | 1985-06-29 | 富山化学工業株式会社 | 7−置換又は非置換アミノ−3−置換チオメチルセフエムカルボン酸類の新規製造法 |
| US4316016A (en) * | 1979-03-19 | 1982-02-16 | Bristol-Myers Company | Cephalosporin intermediates |
| US4223135A (en) * | 1979-03-19 | 1980-09-16 | Bristol-Myers Company | Production of cephalosporins |
| US4316017A (en) * | 1979-03-19 | 1982-02-16 | Bristol-Myers Company | Cephalosporin intermediates |
| US4663461A (en) * | 1980-08-29 | 1987-05-05 | American Home Products Corporation | Process for preparing 1-H-tetrazole-5-thiols |
| EP0070803A3 (de) * | 1981-07-16 | 1984-05-02 | Ciba-Geigy Ag | Antibiotisch wirksame Aminotriazolyl-Cephalosporinderivate und ihre Herstellung |
| ES8300334A1 (es) * | 1981-09-01 | 1982-11-01 | Gema Sa | Procedimiento para la preparacion de un acido 7-aminocefa- losporanido-3-substituido |
| MA19602A1 (fr) * | 1981-09-30 | 1983-04-01 | Ciba Geigy Ag | Composes d'amino-oxazolyle, procede pour leur preparation, preparations pharmaceutiques qui contiennent ces composes, et leur application |
| HU188874B (en) * | 1983-04-19 | 1986-05-28 | Biogal Gyogyszergyar,Hu | Process for producing new 7-acylamido-3-acylaminomethyl-ceph-3-eme-4-carboxylic acid derivatives and pharmaceutically acceptable salts thereof |
| US4576937A (en) * | 1984-02-29 | 1986-03-18 | Smithkline Beckman Corporation | 7-D-Mandelamido-3(1-sulfomethyltetrazol-5-yl)thiomethyl-3-cephem-4-carboxylic acid monosodium salt |
| KR940000112B1 (ko) * | 1990-07-05 | 1994-01-05 | 주식회사 대웅제약 | 신규의 3-치환 세펨화합물 및 그의 제조방법 |
| US5318781A (en) * | 1993-04-06 | 1994-06-07 | Hoffmann-La Roche Inc. | Absorption enhancement of antibiotics |
| GB9312853D0 (en) * | 1993-06-22 | 1993-08-04 | Euro Celtique Sa | Chemical compounds |
| US5591776A (en) * | 1994-06-24 | 1997-01-07 | Euro-Celtique, S.A. | Pheynl or benzyl-substituted rolipram-based compounds for and method of inhibiting phosphodiesterase IV |
| US5922751A (en) * | 1994-06-24 | 1999-07-13 | Euro-Celtique, S.A. | Aryl pyrazole compound for inhibiting phosphodiesterase IV and methods of using same |
| JP2001523213A (ja) * | 1994-12-13 | 2001-11-20 | ユーロ−セルティーク,エス.エイ. | 三置換チオキサンチン類 |
| DE69531506T2 (de) * | 1994-12-13 | 2004-06-24 | Euroceltique S.A. | Arylthioxanthine |
| US6025361A (en) * | 1994-12-13 | 2000-02-15 | Euro-Celtique, S.A. | Trisubstituted thioxanthines |
| US5567698A (en) * | 1995-02-15 | 1996-10-22 | Bristol-Myers Squibb Company | Pyridinium thiomethyl substituted chepholosporin derivatives |
| US6166041A (en) * | 1995-10-11 | 2000-12-26 | Euro-Celtique, S.A. | 2-heteroaryl and 2-heterocyclic benzoxazoles as PDE IV inhibitors for the treatment of asthma |
| US6075016A (en) * | 1996-04-10 | 2000-06-13 | Euro-Celtique S.A. | 6,5-fused aromatic ring systems having enhanced phosphodiesterase IV inhibitory activity |
| IT1286520B1 (it) * | 1996-12-03 | 1998-07-15 | Antibioticos Spa | Procedimento per la preparazione di intermedi utili nella sintesi di cefalosporine |
| AU2002310863A1 (en) | 2001-04-19 | 2002-11-05 | Bioferma Murcia, S.A. | Enzymatic process for preparing cephalosporanic acid derivatives using alpha-ketoacid derivatives |
| US7700581B2 (en) * | 2007-01-31 | 2010-04-20 | Guangzhou Baiyunshan Pharmaceutical Co., Ltd. | Cephalosporin compounds comprising a C3 thio-methyl moiety substituted with N-containing heterocyclic group, and a C7 thiourea acetamido group, their preparations and uses thereof |
| CN104072517A (zh) * | 2014-07-07 | 2014-10-01 | 江苏汉斯通药业有限公司 | 溴乙酰氨基头孢烷酸的生产工艺 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1012943A (en) * | 1961-05-16 | 1965-12-15 | Glaxo Lab Ltd | Improvements in or relating to antibiotics |
| US3365449A (en) * | 1964-07-23 | 1968-01-23 | Fujisawa Pharmaceutical Co | 7-(substituted thioacylamino) cephalosporanic acid and derivatives thereof |
| US3239516A (en) * | 1965-01-18 | 1966-03-08 | Lilly Co Eli | Dithiocarboxylated cephalosporins |
| US3239515A (en) * | 1965-01-18 | 1966-03-08 | Lilly Co Eli | Dithiocarboxylated cephalosporins |
-
1968
- 1968-04-08 CH CH516368A patent/CH527215A/de not_active IP Right Cessation
- 1968-04-08 CH CH836872A patent/CH557381A/xx not_active IP Right Cessation
- 1968-04-10 SE SE04835/68A patent/SE369908B/xx unknown
- 1968-04-10 DE DE1795838A patent/DE1795838B2/de not_active Withdrawn
- 1968-04-10 ES ES352625A patent/ES352625A1/es not_active Expired
- 1968-04-11 GB GB07726/68A patent/GB1206305A/en not_active Expired
- 1968-04-11 NL NL6805179.A patent/NL164560C/xx not_active IP Right Cessation
- 1968-04-12 US US721082A patent/US3516997A/en not_active Expired - Lifetime
- 1968-04-12 FR FR148055A patent/FR7475M/fr not_active Expired
- 1968-04-16 CA CA017607A patent/CA928292A/en not_active Expired
- 1968-10-18 AT AT1022268A patent/AT292193B/de not_active IP Right Cessation
-
1969
- 1969-05-16 ES ES367294A patent/ES367294A1/es not_active Expired
- 1969-05-17 ES ES367346A patent/ES367346A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT292193B (de) | 1971-08-10 |
| ES367294A1 (es) | 1971-04-01 |
| ES367346A1 (es) | 1971-05-01 |
| CA928292A (en) | 1973-06-12 |
| NL6805179A (enExample) | 1968-10-16 |
| DE1795838A1 (de) | 1976-07-29 |
| CH527215A (de) | 1972-08-31 |
| SE369908B (enExample) | 1974-09-23 |
| ES352625A1 (es) | 1970-01-01 |
| FR7475M (enExample) | 1969-12-01 |
| CH557381A (de) | 1974-12-31 |
| NL164560B (nl) | 1980-08-15 |
| GB1206305A (en) | 1970-09-23 |
| DE1770168B2 (de) | 1976-04-08 |
| NL164560C (nl) | 1981-01-15 |
| DE1770168A1 (de) | 1972-03-16 |
| US3516997A (en) | 1970-06-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795838B2 (de) | Cephalosporinderivate | |
| DE2461478C2 (de) | Cephalosporinderivate und Verfahren zu deren Herstellung | |
| CH628058A5 (de) | Verfahren zur herstellung von cephemverbindungen. | |
| CH629813A5 (de) | Verfahren zur herstellung von neuen cephalosporinderivaten. | |
| DE3486033T2 (de) | Cephalosporinderivate. | |
| DE2824559A1 (de) | 7 alpha -methoxy-7 beta-(1,3- dithietan-2-carboxamido)cephalosporansaeurederivate und verfahren zu ihrer herstellung | |
| DE2415402C2 (de) | Cephalosporansäurederivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Mittel | |
| EP0280157B1 (de) | Kristallisierte Cephem-Säureadditionssalze und Verfahren zu ihrer Herstellung | |
| DE2512284A1 (de) | Cephalosporansaeurederivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel | |
| DE3015389A1 (de) | Heterocyclische derivate von oxyimino-substituierten cephalosporinen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische und veterinaermedizinische mittel | |
| CH645648A5 (de) | Cephalosporin-verbindungen, verfahren zu deren herstellung und verwendung derselben in antibakteriell wirkenden medikamenten. | |
| EP0002774B1 (de) | Verfahren zur Acylierung von 7-Aminocephem-derivaten | |
| DE2558869C2 (de) | Cephalosporine | |
| DE1953861A1 (de) | Neue 3,7-disubstituierte Cephalosporin-Derivate | |
| DE2715038A1 (de) | Neue antibakterielle verbindungen | |
| DE2539411A1 (de) | Cephamycine, ihre salze, verfahren zu ihrer herstellung und arzneipraeparate | |
| DE2927462A1 (de) | Cephalosporin-1,1-dioxide, ihre herstellung und ihre verwendung | |
| EP0075104A2 (de) | Cephalosporinderivate, Verfahren zu deren Herstellung und Zwischenprodukte dafür sowie entsprechende pharmazeutische Präparate | |
| EP0017238B1 (de) | Cephemderivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate | |
| DE2714419C2 (de) | Cephalosporinderivate, Verfahren zu deren Herstellung und Arzneimittel | |
| WO1985004659A1 (fr) | Produits intermediaires de cephalosporine, leur procede de preparation et leur utilisation | |
| DE1770168C3 (de) | Cephalosporlnderivate | |
| DE3006916A1 (de) | Ungesaettigte 3-heterocyclische-thiomethyl-7 alpha -methoxy-7 beta -acylamido-3-cephem-4-carbonsaeure-derivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische und veterinaermedizinische zubereitungen | |
| DE2442302C2 (de) | Cephalosporine, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Mittel | |
| DE2236422C2 (de) | Cephalosporinverbindungen und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BHN | Withdrawal |