GB1206305A - 3,7-disubstituted cephalosporin compounds and preparation thereof - Google Patents
3,7-disubstituted cephalosporin compounds and preparation thereofInfo
- Publication number
- GB1206305A GB1206305A GB07726/68A GB1772668A GB1206305A GB 1206305 A GB1206305 A GB 1206305A GB 07726/68 A GB07726/68 A GB 07726/68A GB 1772668 A GB1772668 A GB 1772668A GB 1206305 A GB1206305 A GB 1206305A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alk
- formula
- methyl
- ceph
- salt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930186147 Cephalosporin Natural products 0.000 title abstract 4
- 229940124587 cephalosporin Drugs 0.000 title abstract 4
- -1 cephalosporin compounds Chemical class 0.000 title abstract 2
- 150000003839 salts Chemical class 0.000 abstract 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 abstract 3
- 150000001780 cephalosporins Chemical class 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 abstract 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 abstract 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 abstract 2
- 125000002720 diazolyl group Chemical group 0.000 abstract 2
- 229910052751 metal Inorganic materials 0.000 abstract 2
- 239000002184 metal Substances 0.000 abstract 2
- 125000001715 oxadiazolyl group Chemical group 0.000 abstract 2
- 125000002971 oxazolyl group Chemical group 0.000 abstract 2
- 125000003831 tetrazolyl group Chemical group 0.000 abstract 2
- 125000001113 thiadiazolyl group Chemical group 0.000 abstract 2
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 abstract 2
- 125000000335 thiazolyl group Chemical group 0.000 abstract 2
- 150000003573 thiols Chemical class 0.000 abstract 2
- 125000001425 triazolyl group Chemical group 0.000 abstract 2
- ZIDCHRAPAVGFGH-IYXOAMITSA-N (6R)-4-acetamido-4-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-8-oxo-7-(tetrazol-1-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N1(N=NN=C1)C1[C@@H]2N(C(=C(C(S2)(C)NC(C)=O)SC2=NN=C(S2)C)C(=O)O)C1=O ZIDCHRAPAVGFGH-IYXOAMITSA-N 0.000 abstract 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 abstract 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 abstract 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 abstract 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 abstract 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 229910052700 potassium Inorganic materials 0.000 abstract 1
- 239000011591 potassium Substances 0.000 abstract 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 abstract 1
- 125000004076 pyridyl group Chemical group 0.000 abstract 1
- 125000000714 pyrimidinyl group Chemical group 0.000 abstract 1
- 229910052708 sodium Inorganic materials 0.000 abstract 1
- 239000011734 sodium Substances 0.000 abstract 1
- 125000001544 thienyl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47L—DOMESTIC WASHING OR CLEANING; SUCTION CLEANERS IN GENERAL
- A47L13/00—Implements for cleaning floors, carpets, furniture, walls, or wall coverings
- A47L13/02—Scraping
- A47L13/04—Scraping with steel wool
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2397167 | 1967-04-15 | ||
| JP6842967 | 1967-10-24 | ||
| JP6951067A JPS4614736B1 (enExample) | 1967-10-28 | 1967-10-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1206305A true GB1206305A (en) | 1970-09-23 |
Family
ID=27284465
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB07726/68A Expired GB1206305A (en) | 1967-04-15 | 1968-04-11 | 3,7-disubstituted cephalosporin compounds and preparation thereof |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3516997A (enExample) |
| AT (1) | AT292193B (enExample) |
| CA (1) | CA928292A (enExample) |
| CH (2) | CH527215A (enExample) |
| DE (1) | DE1795838B2 (enExample) |
| ES (3) | ES352625A1 (enExample) |
| FR (1) | FR7475M (enExample) |
| GB (1) | GB1206305A (enExample) |
| NL (1) | NL164560C (enExample) |
| SE (1) | SE369908B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1984004096A1 (en) * | 1983-04-19 | 1984-10-25 | Biogal Gyogyszergyar | Novel cephalosporin derivatives, pharmaceutical compositions containing the same, their use in therapy as antibiotics and a process for the preparation of the novel compounds |
| EP0727426A3 (en) * | 1995-02-15 | 1996-10-23 | Bristol Myers Squibb Co | Cephalosporin derivatives |
Families Citing this family (92)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1953861C2 (de) * | 1969-10-25 | 1982-12-23 | Fujisawa Pharmaceutical Co., Ltd., Osaka | 7-Tetrazolylacetamido-3-thiomethyl-3-cephem-4- carbonsäuren |
| FR2068419A1 (en) * | 1969-10-27 | 1971-08-27 | Fujisawa Pharmaceutical Co | Antibacterial cephalosporin compsns |
| BE758587A (fr) * | 1969-11-17 | 1971-05-06 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide 7-aminocephalosporanique et nouveaux produits ainsi obtenus |
| US4010264A (en) * | 1970-11-06 | 1977-03-01 | Koninklijke Nederlandsche Gist-En Spiritusfabriek N.V. | 7-[3-Substituted isoxazol-5-yl]-acetamido-cephalosporanic acids and their anti-bacterial use |
| US3687948A (en) * | 1970-11-23 | 1972-08-29 | Bristol Myers Co | 7-{8 D-(a-AMINO-a-PHENYLACETAMIDO){9 -3-(4-METHYL-1,3-OXAZOL-2-YLTHIOMETHYL-3-CEPHEM-4-CARBOXYLIC ACID AND SALTS THEREOF |
| US3867380A (en) * | 1971-02-18 | 1975-02-18 | Smithkline Corp | 3-Heterocyclic thiomethylcephalosporins |
| US3972919A (en) * | 1970-12-17 | 1976-08-03 | Smithkline Corporation | p-Hydroxymethylphenylglycine |
| US3855213A (en) * | 1971-02-18 | 1974-12-17 | Smith Kline French Lab | 3-heterocyclic thiomethyl-cephalosporins |
| AU463529B2 (en) * | 1971-01-18 | 1975-07-31 | Bristol-Myers Company | Cephalosporin derivatives and process fob the preparation thereof |
| IE36221B1 (en) * | 1971-04-21 | 1976-09-15 | Ciba Geigy Ag | Acylamino compounds and a process for their manufacture |
| US3757014A (en) * | 1971-05-07 | 1973-09-04 | Bristol Myers Co | Ts 1,3,4 - oxadiazol-2-yl)thiomethyl)-3-cephem-4-carboxylic acid and sal7-(d-(alpha-amino-alpha-pheyle-acetamido)) - 3-(s-(5-hydroxymethyl - |
| US4025509A (en) * | 1972-03-30 | 1977-05-24 | Ciba-Geigy Corporation | Aminopyridinium acetyl cephalosporanes |
| US3968226A (en) * | 1972-06-14 | 1976-07-06 | Smithkline Corporation | 3-Heterocyclic thiomethylcephalosporins as antibacterial agents |
| US3855212A (en) * | 1972-08-04 | 1974-12-17 | Squibb & Sons Inc | Cyanomethylth ioacetylcephalosporins |
| US3907784A (en) * | 1972-09-11 | 1975-09-23 | Lilly Co Eli | 7-Halophenylthioacetamido cephalosporins |
| JPS49124574A (enExample) * | 1972-09-15 | 1974-11-28 | ||
| US4060687A (en) * | 1972-11-13 | 1977-11-29 | Merck & Co., Inc. | Cephalosporins having a 3-α substituted alkyl grouping |
| US3957768A (en) * | 1972-11-14 | 1976-05-18 | Smithkline Corporation | 3-heterocyclicthiomethylcephalosporins |
| US4160829A (en) * | 1972-12-22 | 1979-07-10 | Gist-Brocades N.V. | Antibacterial 1,2,4-oxadiazolylacetamido cephalosporins |
| US3898217A (en) * | 1973-03-30 | 1975-08-05 | American Home Prod | 7-(1-Aminomethylcycloalkylcarboxamido)cephalosporanic |
| US4133882A (en) * | 1973-05-11 | 1979-01-09 | Smithkline Corporation | 7-Hydroxyhalophenylacetamido-3-heterocyclicthiomethyl cephalosporins |
| US3957985A (en) * | 1973-07-05 | 1976-05-18 | Smithkline Corporation | Mandelamidocephalosporins with improved properties |
| US3884914A (en) * | 1973-07-05 | 1975-05-20 | Smithkline Corp | Mandelamidocephalosporins with improved properties |
| US4022895A (en) * | 1973-08-01 | 1977-05-10 | Smithkline Corporation | Substituted phenylglycylcephalosporins |
| JPS5093989A (enExample) * | 1973-10-25 | 1975-07-26 | ||
| US4071683A (en) * | 1973-10-30 | 1978-01-31 | Bayer Aktiengesellschaft | Oxoimidazolidinylthiocarbonyl derivatives of ceph-3-em-4-carboxylic acids |
| AR205728A1 (es) * | 1973-11-14 | 1976-05-31 | Rhone Poulenc Sa | Procedimiento para preparar ((dihidro-5,6-oxa)-(di) tiino-1,4-il-2) acetamido)-7 cefalosporina y sus sales |
| US3943126A (en) * | 1973-11-15 | 1976-03-09 | Eli Lilly And Company | Process for acylating a 7-aminocephalosporin |
| NZ176206A (en) * | 1973-12-25 | 1978-03-06 | Takeda Chemical Industries Ltd | Cephalosporins |
| US4379924A (en) * | 1973-12-25 | 1983-04-12 | Takeda Chemical Industries, Ltd. | Cephalosporin derivatives |
| US3993758A (en) * | 1974-01-18 | 1976-11-23 | Beecham Group Limited | Cephalosporin compounds |
| US4205166A (en) * | 1974-02-20 | 1980-05-27 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted-3-aminoalkyl-, acylaminoalkyl-, or hydroxyalkyl-substituted heterocyclic thiomethyl-3-cephem-4-carboxylic acid derivatives and preparation thereof |
| US3929782A (en) * | 1974-03-13 | 1975-12-30 | Squibb & Sons Inc | 1,2,4-Oxadiazolonylacetyl cephalosporins |
| US3960849A (en) * | 1974-03-13 | 1976-06-01 | E. R. Squibb & Sons, Inc. | Amino-1,2,4-oxadiazolyl-3-acetyl cephalosporins |
| US4160086A (en) * | 1974-04-27 | 1979-07-03 | Beecham Group Limited | 3-Heterocyclicthio-7-α-carboxy 2-aryl acetamido cephalosporanic acid |
| US4091211A (en) * | 1974-05-05 | 1978-05-23 | Hoffmann-La Roche Inc. | Cephalosporins |
| JPS612674B2 (enExample) * | 1974-06-20 | 1986-01-27 | Meiji Seika Co | |
| US3959259A (en) * | 1974-07-08 | 1976-05-25 | E. R. Squibb & Sons, Inc. | 1,2,4-Oxadiazolonylacetyl penicillins |
| US3954745A (en) * | 1974-09-12 | 1976-05-04 | Eli Lilly And Company | Process for preparing cefazolin |
| IE41697B1 (en) * | 1974-09-27 | 1980-02-27 | Rhone Poulenc Ind | New cephalosporin derivatives their preparation and compositions containing them |
| US4182868A (en) * | 1974-10-29 | 1980-01-08 | Takeda Chemical Industries, Ltd. | 7-Methoxycephalosporin derivatives |
| US4018759A (en) * | 1974-12-03 | 1977-04-19 | Smithkline Corporation | 3-Heterocyclicthiomethylcephalosporins |
| US4286089A (en) * | 1974-12-27 | 1981-08-25 | Smithkline Corporation | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
| US4093723A (en) * | 1976-05-19 | 1978-06-06 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins |
| US3979384A (en) * | 1975-03-20 | 1976-09-07 | Merck & Co., Inc. | C-3 Substituted cephalosporins |
| US4029782A (en) * | 1975-04-28 | 1977-06-14 | Eli Lilly And Company | Cefazolin suspension for parenteral administration |
| US4126745A (en) * | 1975-04-30 | 1978-11-21 | Sankyo Company Limited | 7-Methoxycephalosporin derivatives |
| DE2620094A1 (de) * | 1975-05-12 | 1976-12-02 | Takeda Chemical Industries Ltd | Cephalosporinverbindungen und verfahren zu ihrer herstellung |
| CA1088049A (en) * | 1975-06-03 | 1980-10-21 | Takashi Masugi | 3-substituted-7-substituted alkanamido-3-cephem-4- carboxylic acid compounds and processes for preparation thereof |
| US4131672A (en) * | 1975-06-09 | 1978-12-26 | Eli Lilly And Company | Method for treating methicillin resistant Staphylococcus aureus |
| US4049806A (en) * | 1975-08-15 | 1977-09-20 | Syntex (U.S.A.) Inc. | Cephalosporin type antibacterials |
| US4048311A (en) * | 1976-01-08 | 1977-09-13 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl)cephalosporins |
| US4152433A (en) * | 1976-03-12 | 1979-05-01 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-7-substituted-2 or 3-cephem-4-carboxylic acid compounds and pharmaceutical compositions |
| US4220644A (en) * | 1976-05-03 | 1980-09-02 | Smithkline Corporation | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins |
| US4034092A (en) * | 1976-05-03 | 1977-07-05 | Smithkline Corporation | 7-Acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| FI771866A7 (enExample) * | 1976-06-28 | 1977-12-29 | Fujisawa Pharmaceutical Co | |
| US4165429A (en) * | 1976-06-28 | 1979-08-21 | Yamanouchi Pharmaceutical Co., Ltd. | 7α-METHOXY-CEPHALOSPORANIC ACID DERIVATIVES |
| DE2655949A1 (de) * | 1976-12-10 | 1978-06-15 | Gruenenthal Gmbh | Neue cephalosporin- und penicillinderivate, verfahren zu deren herstellung und diese produkte enthaltende arzneimittel |
| US4316037A (en) * | 1977-01-21 | 1982-02-16 | American Home Products Corporation | N-Benzyl and N-substituted benzyl tetrazole-5-carboxylic acids and the preparation thereof |
| GB1565941A (en) * | 1977-02-08 | 1980-04-23 | Toyama Chemical Co Ltd | Process for producing 7-(substituted)amino-3-substituted thiomethyl cephem carboxylic acids |
| US4115645A (en) * | 1977-05-10 | 1978-09-19 | Eli Lilly And Company | Decolorizing process for 7-amino-3-(((2-methyl-1,3,4-thiadiazol-5-yl)thio)methyl)-3-cephem-4-carboxylic acid |
| US4104470A (en) * | 1977-06-03 | 1978-08-01 | Eli Lilly And Company | Crystallization process for cefazolin sodium |
| CH648317A5 (de) * | 1977-06-10 | 1985-03-15 | Yamanouchi Pharma Co Ltd | 7alpha-methoxy-7betha-(1,3-dithietan-2- carboxamido)cephalosporansaeurederivate und verfahren zu ihrer herstellung. |
| US4229573A (en) * | 1977-06-21 | 1980-10-21 | Asahi Kasei Kogyo Kabushiki Kaisha | 7α-Methoxycephalosporin derivatives |
| US4148998A (en) * | 1977-10-04 | 1979-04-10 | Yeda Research And Development Co., Ltd. | Pyrrole cephalosporin derivatives |
| IT1192287B (it) * | 1977-11-14 | 1988-03-31 | Fujisawa Pharmaceutical Co | Derivati di acido cefalosporanico ad azione farmaceutica e relativo procedimento di preparazione |
| US4314059A (en) * | 1978-03-09 | 1982-02-02 | Chisei Shibuya | Process for preparing cephalosporin compounds |
| EP0004570B1 (en) * | 1978-03-09 | 1982-04-14 | Asahi Kasei Kogyo Kabushiki Kaisha | Thiol esters, process for their preparation, pharmaceutical compositions containing them and a process for preparing cephalosporin compounds using the same |
| JPS6052711B2 (ja) * | 1978-03-09 | 1985-11-20 | 旭化成株式会社 | セフアロスポリン化合物の製法 |
| JPS6027677B2 (ja) * | 1978-07-06 | 1985-06-29 | 富山化学工業株式会社 | 7−置換又は非置換アミノ−3−置換チオメチルセフエムカルボン酸類の新規製造法 |
| US4316017A (en) * | 1979-03-19 | 1982-02-16 | Bristol-Myers Company | Cephalosporin intermediates |
| US4316016A (en) * | 1979-03-19 | 1982-02-16 | Bristol-Myers Company | Cephalosporin intermediates |
| US4223135A (en) * | 1979-03-19 | 1980-09-16 | Bristol-Myers Company | Production of cephalosporins |
| US4663461A (en) * | 1980-08-29 | 1987-05-05 | American Home Products Corporation | Process for preparing 1-H-tetrazole-5-thiols |
| EP0070803A3 (de) * | 1981-07-16 | 1984-05-02 | Ciba-Geigy Ag | Antibiotisch wirksame Aminotriazolyl-Cephalosporinderivate und ihre Herstellung |
| ES505092A0 (es) * | 1981-09-01 | 1982-11-01 | Gema Sa | Procedimiento para la preparacion de un acido 7-aminocefa- losporanido-3-substituido |
| MA19602A1 (fr) * | 1981-09-30 | 1983-04-01 | Ciba Geigy Ag | Composes d'amino-oxazolyle, procede pour leur preparation, preparations pharmaceutiques qui contiennent ces composes, et leur application |
| US4576937A (en) * | 1984-02-29 | 1986-03-18 | Smithkline Beckman Corporation | 7-D-Mandelamido-3(1-sulfomethyltetrazol-5-yl)thiomethyl-3-cephem-4-carboxylic acid monosodium salt |
| KR940000112B1 (ko) * | 1990-07-05 | 1994-01-05 | 주식회사 대웅제약 | 신규의 3-치환 세펨화합물 및 그의 제조방법 |
| US5318781A (en) * | 1993-04-06 | 1994-06-07 | Hoffmann-La Roche Inc. | Absorption enhancement of antibiotics |
| GB9312853D0 (en) * | 1993-06-22 | 1993-08-04 | Euro Celtique Sa | Chemical compounds |
| US5922751A (en) * | 1994-06-24 | 1999-07-13 | Euro-Celtique, S.A. | Aryl pyrazole compound for inhibiting phosphodiesterase IV and methods of using same |
| US5591776A (en) * | 1994-06-24 | 1997-01-07 | Euro-Celtique, S.A. | Pheynl or benzyl-substituted rolipram-based compounds for and method of inhibiting phosphodiesterase IV |
| ATE247116T1 (de) * | 1994-12-13 | 2003-08-15 | Euro Celtique Sa | Arylthioxanthine |
| DE69531555T2 (de) * | 1994-12-13 | 2004-06-17 | Euroceltique S.A. | Dreifachsubstituierte thioxanthine |
| US6025361A (en) * | 1994-12-13 | 2000-02-15 | Euro-Celtique, S.A. | Trisubstituted thioxanthines |
| US6166041A (en) * | 1995-10-11 | 2000-12-26 | Euro-Celtique, S.A. | 2-heteroaryl and 2-heterocyclic benzoxazoles as PDE IV inhibitors for the treatment of asthma |
| US6075016A (en) * | 1996-04-10 | 2000-06-13 | Euro-Celtique S.A. | 6,5-fused aromatic ring systems having enhanced phosphodiesterase IV inhibitory activity |
| IT1286520B1 (it) * | 1996-12-03 | 1998-07-15 | Antibioticos Spa | Procedimento per la preparazione di intermedi utili nella sintesi di cefalosporine |
| WO2002085914A2 (en) * | 2001-04-19 | 2002-10-31 | Bioferma Murcia, S.A. | ENZYMATIC PROCESS FOR PREPARING CEPHALOSPORANIC ACID DERIVATIVES USING α-KETOACID DERIVATIVES |
| US7700581B2 (en) * | 2007-01-31 | 2010-04-20 | Guangzhou Baiyunshan Pharmaceutical Co., Ltd. | Cephalosporin compounds comprising a C3 thio-methyl moiety substituted with N-containing heterocyclic group, and a C7 thiourea acetamido group, their preparations and uses thereof |
| CN104072517A (zh) * | 2014-07-07 | 2014-10-01 | 江苏汉斯通药业有限公司 | 溴乙酰氨基头孢烷酸的生产工艺 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1012943A (en) * | 1961-05-16 | 1965-12-15 | Glaxo Lab Ltd | Improvements in or relating to antibiotics |
| US3365449A (en) * | 1964-07-23 | 1968-01-23 | Fujisawa Pharmaceutical Co | 7-(substituted thioacylamino) cephalosporanic acid and derivatives thereof |
| US3239515A (en) * | 1965-01-18 | 1966-03-08 | Lilly Co Eli | Dithiocarboxylated cephalosporins |
| US3239516A (en) * | 1965-01-18 | 1966-03-08 | Lilly Co Eli | Dithiocarboxylated cephalosporins |
-
1968
- 1968-04-08 CH CH516368A patent/CH527215A/de not_active IP Right Cessation
- 1968-04-08 CH CH836872A patent/CH557381A/xx not_active IP Right Cessation
- 1968-04-10 DE DE1795838A patent/DE1795838B2/de not_active Withdrawn
- 1968-04-10 SE SE04835/68A patent/SE369908B/xx unknown
- 1968-04-10 ES ES352625A patent/ES352625A1/es not_active Expired
- 1968-04-11 NL NL6805179.A patent/NL164560C/xx not_active IP Right Cessation
- 1968-04-11 GB GB07726/68A patent/GB1206305A/en not_active Expired
- 1968-04-12 US US721082A patent/US3516997A/en not_active Expired - Lifetime
- 1968-04-12 FR FR148055A patent/FR7475M/fr not_active Expired
- 1968-04-16 CA CA017607A patent/CA928292A/en not_active Expired
- 1968-10-18 AT AT1022268A patent/AT292193B/de not_active IP Right Cessation
-
1969
- 1969-05-16 ES ES367294A patent/ES367294A1/es not_active Expired
- 1969-05-17 ES ES367346A patent/ES367346A1/es not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1984004096A1 (en) * | 1983-04-19 | 1984-10-25 | Biogal Gyogyszergyar | Novel cephalosporin derivatives, pharmaceutical compositions containing the same, their use in therapy as antibiotics and a process for the preparation of the novel compounds |
| EP0727426A3 (en) * | 1995-02-15 | 1996-10-23 | Bristol Myers Squibb Co | Cephalosporin derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| NL164560B (nl) | 1980-08-15 |
| CH527215A (de) | 1972-08-31 |
| DE1795838A1 (de) | 1976-07-29 |
| ES352625A1 (es) | 1970-01-01 |
| CA928292A (en) | 1973-06-12 |
| ES367346A1 (es) | 1971-05-01 |
| AT292193B (de) | 1971-08-10 |
| FR7475M (enExample) | 1969-12-01 |
| DE1770168B2 (de) | 1976-04-08 |
| US3516997A (en) | 1970-06-23 |
| NL164560C (nl) | 1981-01-15 |
| CH557381A (de) | 1974-12-31 |
| DE1795838B2 (de) | 1979-07-26 |
| SE369908B (enExample) | 1974-09-23 |
| ES367294A1 (es) | 1971-04-01 |
| DE1770168A1 (de) | 1972-03-16 |
| NL6805179A (enExample) | 1968-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1206305A (en) | 3,7-disubstituted cephalosporin compounds and preparation thereof | |
| NZ196642A (en) | Preparation of syn-isomers of certain cephalosporins | |
| IE37767L (en) | DERIVATIVES OF 7ß-AMINO-CEPHEM-3-OL-4-CARBOXYLIC ACIDS | |
| NZ199875A (en) | Cephalosporin derivatives and pharmaceutical compositions | |
| IL69246A (en) | 7-((2-aminothiazolyl-2-pyrrolidonyl or(piperidonyl)-oxyimino)acetamido)cephem carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| KR840007731A (ko) | 세팔로스포린 화합물의 제조방법 | |
| HK47993A (en) | 7-beta-(2-(amino-4-thiazolyl)-2-alkenoylamino)-3-cephem-4-carboxylic acid ester derivatives | |
| IE812915L (en) | ESTERS OF 7ß-SUBSTITUTED CEPH-3-EM-4-CARBOXYLIC ACIDS | |
| GB1460916A (en) | Preparation of 3-thiolated-7-acylamido-cephalosporanic acid derivatives | |
| IL62017A0 (en) | Crystalline salts of 3-cephem-4-carboxylic acid derivatives,their production and pharmaceutical compositions containing them | |
| GB1358027A (en) | Alpha-amino-rho-hydroxyphenylacetamidocephalosporins | |
| JPS53101393A (en) | Cephalosporin derivatives and process for their preparation | |
| GB1468102A (en) | Cephalosporin derivatives their preparation and compositions containing them | |
| GB1162247A (en) | Cephalosporanic Acid Derivatives and a Process for the Preparation thereof | |
| JPS53101392A (en) | Cephalosporin derivatives and process for their preparation | |
| GB1430908A (en) | Derivatives of cephalosporin | |
| GB1464551A (en) | Alpha-substituted amino-phenylacetamido penicillanic acid and cephalosporanic acid derivatives methods for their preparation and their use | |
| IE791164L (en) | L-cysteine derivatives. | |
| GB1507723A (en) | Acyloxymethyl cephalosporin esters | |
| GB1420728A (en) | Cephalosporins | |
| ATE30592T1 (de) | Penicillinderivate. | |
| GB1178471A (en) | 7-Phenylacetamidocephalosporanic Acid Derivatives | |
| JPS5315395A (en) | Cephalosporin derivatives and their preparation | |
| ES8104285A1 (es) | Un procedimiento para la obtencion de un derivado del acido clarulanico. | |
| EP0221719A3 (en) | Novel cephalosporin derivatives, processes for their preparation and pharmaceutical compositions containing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| 746B | Proceeding under section 46(3) patents act 1977 | ||
| 746B | Proceeding under section 46(3) patents act 1977 | ||
| PE20 | Patent expired after termination of 20 years |