DE1670030A1 - Verfahren zur Herstellung von 7-Nitro-1,4-benzodiazepinen - Google Patents
Verfahren zur Herstellung von 7-Nitro-1,4-benzodiazepinenInfo
- Publication number
- DE1670030A1 DE1670030A1 DE19681670030 DE1670030A DE1670030A1 DE 1670030 A1 DE1670030 A1 DE 1670030A1 DE 19681670030 DE19681670030 DE 19681670030 DE 1670030 A DE1670030 A DE 1670030A DE 1670030 A1 DE1670030 A1 DE 1670030A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- nitro
- solution
- general formula
- atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 5
- KAOFUQSZAJJSCB-UHFFFAOYSA-N 7-nitro-1h-1,4-benzodiazepine Chemical class N1C=CN=CC2=CC([N+](=O)[O-])=CC=C21 KAOFUQSZAJJSCB-UHFFFAOYSA-N 0.000 title description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000004795 grignard reagents Chemical class 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 239000007818 Grignard reagent Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- XZGPBNBVGKZWKY-UHFFFAOYSA-N 1-hydroxy-1,2-benzodiazepine Chemical compound N1(N=CC=CC2=C1C=CC=C2)O XZGPBNBVGKZWKY-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 239000012024 dehydrating agents Substances 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000013078 crystal Substances 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 229940049706 benzodiazepine Drugs 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical compound C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 2
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 2
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 2
- -1 7-nitro-1,5-benzodiazepines Chemical class 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- RGGLEJFUEMKQSH-UHFFFAOYSA-N 1,4-benzodiazepin-2-one Chemical compound O=C1C=NC=C2C=CC=CC2=N1 RGGLEJFUEMKQSH-UHFFFAOYSA-N 0.000 description 1
- OAPZTGKQZKPVPF-UHFFFAOYSA-N 1-(dimethoxymethyl)-2-nitrobenzene Chemical compound COC(OC)C1=CC=CC=C1[N+]([O-])=O OAPZTGKQZKPVPF-UHFFFAOYSA-N 0.000 description 1
- QEYQSYAGLRIYBE-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-1,2-benzodiazepine Chemical compound C1CCNNC2=CC=CC=C21 QEYQSYAGLRIYBE-UHFFFAOYSA-N 0.000 description 1
- FDARFCXKIRFZIV-UHFFFAOYSA-N 2-chloro-N-hydroxy-N'-phenylethanimidamide Chemical compound ClC/C(/NC1=CC=CC=C1)=N/O FDARFCXKIRFZIV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- ADSXDBCZNVXTRD-UHFFFAOYSA-N [Mg]C1=CC=CC=C1 Chemical compound [Mg]C1=CC=CC=C1 ADSXDBCZNVXTRD-UHFFFAOYSA-N 0.000 description 1
- SLYYPFDRASAEIX-UHFFFAOYSA-N [N+]=1(NC=CC=C2C=1C=CC=C2)[O-] Chemical class [N+]=1(NC=CC=C2C=1C=CC=C2)[O-] SLYYPFDRASAEIX-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 150000001557 benzodiazepines Chemical group 0.000 description 1
- 230000001914 calming effect Effects 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9393/67A GB1166944A (en) | 1967-02-28 | 1967-02-28 | Method of Producing 7-Nitrosubstituted 1,4-Benzodiazepines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1670030A1 true DE1670030A1 (de) | 1970-04-23 |
Family
ID=9871123
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681670030 Pending DE1670030A1 (de) | 1967-02-28 | 1968-02-26 | Verfahren zur Herstellung von 7-Nitro-1,4-benzodiazepinen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3553205A (en:Method) |
| JP (1) | JPS4837038B1 (en:Method) |
| BE (1) | BE711409A (en:Method) |
| CH (1) | CH490400A (en:Method) |
| DE (1) | DE1670030A1 (en:Method) |
| DK (1) | DK112319B (en:Method) |
| FI (1) | FI50122C (en:Method) |
| GB (1) | GB1166944A (en:Method) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN113698299A (zh) * | 2021-09-03 | 2021-11-26 | 温州医科大学 | 一种具有酸降解功能的中间体物质及其制备方法和该中间体制备的可聚合单体 |
-
1967
- 1967-02-28 GB GB9393/67A patent/GB1166944A/en not_active Expired
- 1967-07-25 DK DK381267AA patent/DK112319B/da unknown
-
1968
- 1968-02-20 US US706795A patent/US3553205A/en not_active Expired - Lifetime
- 1968-02-26 DE DE19681670030 patent/DE1670030A1/de active Pending
- 1968-02-26 JP JP43011837A patent/JPS4837038B1/ja active Pending
- 1968-02-26 FI FI680503A patent/FI50122C/fi active
- 1968-02-27 CH CH281668A patent/CH490400A/de not_active IP Right Cessation
- 1968-02-28 BE BE711409D patent/BE711409A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH490400A (de) | 1970-05-15 |
| GB1166944A (en) | 1969-10-15 |
| FI50122B (en:Method) | 1975-09-01 |
| DK112319B (da) | 1968-12-02 |
| FI50122C (fi) | 1975-12-10 |
| US3553205A (en) | 1971-01-05 |
| BE711409A (en:Method) | 1968-07-01 |
| JPS4837038B1 (en:Method) | 1973-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH633264A5 (de) | N-alkylpiperidin-derivate. | |
| DE1670030A1 (de) | Verfahren zur Herstellung von 7-Nitro-1,4-benzodiazepinen | |
| DE1620305A1 (de) | Verfahren zur Herstellung von 3-Aminoisoxazolderivaten | |
| AT201059B (de) | Verfahren zur Herstellung von neuen 3,5-Diketo-pyrazolidinderivaten | |
| DE833818C (de) | Verfahren zur Herstellung von neuen mono- und diquartaeren Salzen von Pyrimidylaminocinnolinen | |
| AT296316B (de) | Verfahren zur Herstellung von neuen Benzodiazepin-Derivaten und deren N-4-Oxyden | |
| CH533619A (de) | Verfahren zur Herstellung von Pyrrolderivaten | |
| DE1445872C (de) | 5 Phenyl 1,2 dihydro 3H 1,4 benzodi azepinon (2) derivate | |
| AT211821B (de) | Verfahren zur Herstellung Alkylaminoacetaryliden | |
| AT266075B (de) | Verfahren zur Herstellung von neuen Sulfonaniliden und deren Säureadditions- und Metallsalzen | |
| AT258288B (de) | Verfahren zur Herstellung von neuen Pyrroloindazolverbindungen | |
| AT206894B (de) | Verfahren zur Herstellung von neuen Carbostyrilderivaten | |
| AT242158B (de) | Verfahren zur Herstellung von neuen Benzodiazepinderivaten | |
| DE951364C (de) | Verfahren zur Herstellung von schwefelhaltigen Abkoemmlingen der Barbitursaeure | |
| AT287723B (de) | Verfahren zur Herstellung von neuen 1H-Thieno[2,3-e]-1,4-diazepinen sowie von deren N-4-Oxyden und Salzen | |
| AT284126B (de) | Verfahren zur Herstellung neuer substituierter Aminopyrimidine und deren Salze und optisch aktiven Isomere | |
| DE1770420C3 (de) | Verfahren zur Herstellung von 1,3-Dihydro-2H-1,4-benzodiazepin-2-onderivaten | |
| DE1122070C2 (de) | Verfahren zur Herstellung von diuretisch wirksamen Disulfamylanilinverbindungen | |
| AT242155B (de) | Verfahren zur Herstellung von neuen Benzodiazepinderivaten | |
| AT360007B (de) | Verfahren zur herstellung von 2-(phenylamino)- imidazolin-(2)derivaten und deren salzen | |
| AT226724B (de) | Verfahren zur Herstellung von neuen 1-Aza-thioxanthen-Derivaten | |
| AT200584B (de) | Verfahren zur Herstellung von neuen Salpetersäureestern von N-heterocyclischen Carbonsäureoxyalkylamiden | |
| AT319960B (de) | Verfahren zur Herstellung von neuen Pyridazinverbindungen | |
| DE2164104A1 (de) | lO-Carbamoyl-phenothiazin-3-Sulfonamid | |
| CH357073A (de) | Verfahren zur Herstellung von 1,4-Benzodiazepin-4-oxyden |