DE1620745A1 - Verfahren zur Herstellung von substituierten Chinolizinen - Google Patents
Verfahren zur Herstellung von substituierten ChinolizinenInfo
- Publication number
- DE1620745A1 DE1620745A1 DE19641620745 DE1620745A DE1620745A1 DE 1620745 A1 DE1620745 A1 DE 1620745A1 DE 19641620745 DE19641620745 DE 19641620745 DE 1620745 A DE1620745 A DE 1620745A DE 1620745 A1 DE1620745 A1 DE 1620745A1
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- group
- preparation
- catalyst
- reduction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 4
- 150000003250 quinolizines Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 22
- 125000000468 ketone group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 229930194542 Keto Natural products 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241000711981 Sais Species 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- -1 carbonium ion Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 150000003839 salts Chemical group 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical group CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 1
- ICBZSKCTKKUQSY-YUWZRIFDSA-N 4-[(1r,2s)-1-hydroxy-2-(methylamino)propyl]phenol;hydrochloride Chemical compound Cl.CN[C@@H](C)[C@H](O)C1=CC=C(O)C=C1 ICBZSKCTKKUQSY-YUWZRIFDSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WSNMPAVSZJSIMT-UHFFFAOYSA-N COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 Chemical class COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 WSNMPAVSZJSIMT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 244000025221 Humulus lupulus Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 241000396377 Tranes Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 101150018193 vraB gene Proteins 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/04—Ortho- or peri-condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D455/00—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D455/00—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/03—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/04—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing a quinolizine ring system condensed with only one six-membered carbocyclic ring, e.g. julolidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J5/00—Normal steroids containing carbon, hydrogen, halogen or oxygen, substituted in position 17 beta by a chain of two carbon atoms, e.g. pregnane and substituted in position 21 by only one singly bound oxygen atom, i.e. only one oxygen bound to position 21 by a single bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J75/00—Processes for the preparation of steroids in general
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Hydrogenated Pyridines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cephalosporin Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US248872A US3341543A (en) | 1963-01-02 | 1963-01-02 | Substituted quinolizines |
| US318190A US3301864A (en) | 1963-01-02 | 1963-10-23 | Substituted lactams and process for their production |
| US571385A US3341544A (en) | 1963-01-02 | 1966-08-10 | Quinoline lactams |
| US590510A US3336315A (en) | 1963-01-02 | 1966-10-31 | Substituted quinolizines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1620745A1 true DE1620745A1 (de) | 1970-09-03 |
Family
ID=27500297
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641620745 Pending DE1620745A1 (de) | 1963-01-02 | 1964-01-02 | Verfahren zur Herstellung von substituierten Chinolizinen |
Country Status (6)
| Country | Link |
|---|---|
| US (4) | US3341543A (OSRAM) |
| BE (1) | BE642060A (OSRAM) |
| DE (1) | DE1620745A1 (OSRAM) |
| DK (2) | DK114624B (OSRAM) |
| FR (2) | FR1438186A (OSRAM) |
| GB (3) | GB1085079A (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3518269A (en) * | 1967-05-04 | 1970-06-30 | Warner Lambert Pharmaceutical | 1-oxime substituted quinolizines |
| US4042592A (en) * | 1974-05-08 | 1977-08-16 | Kanebo, Ltd. | Novel dibenzo[a,g]quinolizinium compounds |
| US4619937A (en) * | 1984-02-02 | 1986-10-28 | Warner-Lambert Company | Saturated bicyclic lactam acids and derivatives as cognition activators |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2954382A (en) * | 1960-09-27 | Xpreparation of hexahydrobenzoquinol- | ||
| US2525231A (en) * | 1950-10-10 | J-trimethyl-z | ||
| US3025299A (en) * | 1962-03-13 | New carbostyril derivatives | ||
| US3159638A (en) * | 1964-12-01 | Xcha-chj | ||
| US3132147A (en) * | 1964-05-05 | |||
| US2425320A (en) * | 1942-10-23 | 1947-08-12 | Koppers Co Inc | Cleaning and pickling of metals |
| US2524643A (en) * | 1947-12-04 | 1950-10-03 | Maltbie Lab Inc | 3-phenyl-2-piperidones |
| US2759943A (en) * | 1951-04-30 | 1956-08-21 | Schenley Ind Inc | Derivatives of 2-n-methyl-1, 2, 3, 4-tetrahydro-gamma-carbolines |
| US2759935A (en) * | 1953-02-18 | 1956-08-21 | Bristol Lab Inc | Substituted 3-phenyloxindoles |
| US2738350A (en) * | 1954-03-16 | 1956-03-13 | Searle & Co | 3-oxygenated 17alpha-aza-d-homoandrostenes and n-substituted derivatives thereof |
| US2883374A (en) * | 1955-08-16 | 1959-04-21 | Bayer Ag | Metal containing monoazo dyestuffs |
| US3022312A (en) * | 1956-03-19 | 1962-02-20 | Monsanto Chemicals | Method of preparing steroid derivatives |
| US2877225A (en) * | 1956-04-09 | 1959-03-10 | Ciba Pharm Prod Inc | Preparation of normal-alkyl reserpates and alkyl deserpidates |
| US3036081A (en) * | 1957-09-18 | 1962-05-22 | Roussel Uclaf | 4, 5-benzo tryptamine and process of producing same |
| GB888657A (en) * | 1958-07-14 | 1962-01-31 | J F Macfarlan & Co Ltd | Piperidine carbinols |
| US3117139A (en) * | 1959-04-23 | 1964-01-07 | Sterling Drug Inc | 4-aryl-1-carbamylalkyl-piperidines |
| US3085110A (en) * | 1959-05-25 | 1963-04-09 | Commercial Solvents Corp | Resolution of n-d-and n-1-sec-butylcyclo-hexylamine by methyl hydrogen di-benzoyl-d tartrate |
| US3024242A (en) * | 1960-09-09 | 1962-03-06 | Olin Mathieson | 3-amino-nu-nitro-2-oxo-1-piperidine-carboxamidine |
| US3156722A (en) * | 1960-12-26 | 1964-11-10 | Olin Mathieson | 2, 2-dialkylcyclopropanemethylamines |
-
1963
- 1963-01-02 US US248872A patent/US3341543A/en not_active Expired - Lifetime
- 1963-10-23 US US318190A patent/US3301864A/en not_active Expired - Lifetime
- 1963-12-30 DK DK611163AA patent/DK114624B/da unknown
- 1963-12-31 FR FR958994A patent/FR1438186A/fr not_active Expired
- 1963-12-31 GB GB40261/65A patent/GB1085079A/en not_active Expired
- 1963-12-31 FR FR958993A patent/FR3973M/fr not_active Expired
- 1963-12-31 GB GB51309/63A patent/GB1085073A/en not_active Expired
-
1964
- 1964-01-02 DE DE19641620745 patent/DE1620745A1/de active Pending
- 1964-01-02 BE BE642060A patent/BE642060A/xx unknown
- 1964-10-21 GB GB43010/64A patent/GB1085078A/en not_active Expired
-
1965
- 1965-12-27 DK DK662965AA patent/DK114977B/da unknown
-
1966
- 1966-08-10 US US571385A patent/US3341544A/en not_active Expired - Lifetime
- 1966-10-31 US US590510A patent/US3336315A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3301864A (en) | 1967-01-31 |
| US3341543A (en) | 1967-09-12 |
| FR1438186A (fr) | 1966-05-13 |
| GB1085079A (en) | 1967-09-27 |
| US3341544A (en) | 1967-09-12 |
| US3336315A (en) | 1967-08-15 |
| DK114977B (da) | 1969-08-25 |
| DK114624B (da) | 1969-07-21 |
| GB1085073A (en) | 1967-09-27 |
| GB1085078A (en) | 1967-09-27 |
| FR3973M (OSRAM) | 1966-03-07 |
| BE642060A (OSRAM) | 1964-07-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH640224A5 (de) | 2-pyrrolidonderivate, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von 4-aminohex-5-ensaeure. | |
| DE1770595A1 (de) | Substituierte Tetrahydrochinoline | |
| DE1493181A1 (de) | Verfahren zur Herstellung von 5 beta-Bisnorcholanderivaten | |
| DE2129507C3 (de) | Verfahren zur Herstellung von 8-Alkoxy-3halogenmethyl-4-acetoxy- 10-methylen-2,9dioxatricyclo(43,l,03 7 )decanen | |
| AT202152B (de) | Verfahren zur Herstellung von neuen Dimethylaminopropylidenthiaxanthenen. | |
| DE2029185A1 (en) | 2-azaquinolizidine derivs and salts neurotropic and anti - -histamine agents synthesis | |
| DE2605650A1 (de) | Verfahren zur herstellung von para-isobutyl-phenylessigsaeurederivaten | |
| DE940706C (de) | Verfahren zur Herstellung oberflaechenanaesthetisch wirksamer Alkaminester der 4-n-Butylaminosalicylsaeure | |
| AT249865B (de) | Verfahren zur Herstellung neuer Pyrazolverbindungen der Pregnanreihe | |
| DE953171C (de) | Verfahren zur Herstellung von neuen, fungiciden und protozoociden Aralkylarylketonenund deren Salzen | |
| AT265530B (de) | Verfahren zur Herstellung von neuen Isochinolinderivaten | |
| DE1545786A1 (de) | Verfahren zur Herstellung von Carbonsaeure-N-methylpiperaziden | |
| AT218518B (de) | Verfahren zur Herstellung von neuen alkylsubstituierten, basischen Tetralonderivaten | |
| DE1445059A1 (de) | Verfahren zur Herstellung von neuen pharmakologisch wertvollen Carbostyrilderivaten | |
| AT201584B (de) | Verfahren zur Herstellung neuer Anilide und deren Salze | |
| AT202133B (de) | Verfahren zur Herstellung von gemischten, sekundären Aminen und deren Salzen | |
| AT226710B (de) | Verfahren zur Herstellung von neuen Dihydrochinoxalonen-(2) und von deren Salzen | |
| AT363483B (de) | Verfahren zur herstellung von neuen oxepanderivaten | |
| AT267533B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT235280B (de) | Verfahren zur Herstellung neuer Indolderivate | |
| AT266833B (de) | Verfahren zur Herstellung von neuen 1-[4-Oxo-4-(4-fluor-phenyl)-butyl]-piperidinen sowie von deren Säureadditionssalzen | |
| AT201059B (de) | Verfahren zur Herstellung von neuen 3,5-Diketo-pyrazolidinderivaten | |
| AT265540B (de) | Verfahren zur Herstellung von neuen Steroiden | |
| DE1420954C (de) | Halogensubstituierte 5-Phenyl-2-aminooxazolon-(4)-derivate und Verfahren zu deren Herstellung | |
| AT167093B (de) | Verfahren zur Herstellung des neuen, antiepileptisch wirkenden 1,3,3-Trimethyl-2,4-dioxopiperidins |