DE1595915C3 - Pyrrolidinderivate - Google Patents
PyrrolidinderivateInfo
- Publication number
- DE1595915C3 DE1595915C3 DE1595915A DEM0063725A DE1595915C3 DE 1595915 C3 DE1595915 C3 DE 1595915C3 DE 1595915 A DE1595915 A DE 1595915A DE M0063725 A DEM0063725 A DE M0063725A DE 1595915 C3 DE1595915 C3 DE 1595915C3
- Authority
- DE
- Germany
- Prior art keywords
- methoxy
- acid
- ethyl
- mol
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003235 pyrrolidines Chemical class 0.000 title claims description 6
- 239000002253 acid Substances 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- 238000003756 stirring Methods 0.000 description 19
- 239000000203 mixture Substances 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- 239000007787 solid Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- UNRBEYYLYRXYCG-UHFFFAOYSA-N (1-ethylpyrrolidin-2-yl)methanamine Chemical compound CCN1CCCC1CN UNRBEYYLYRXYCG-UHFFFAOYSA-N 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 230000003474 anti-emetic effect Effects 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- NBFYWQQYIJTQQV-UHFFFAOYSA-N 5-ethylsulfonyl-2-methoxybenzoic acid Chemical compound CCS(=O)(=O)C1=CC=C(OC)C(C(O)=O)=C1 NBFYWQQYIJTQQV-UHFFFAOYSA-N 0.000 description 5
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000001110 calcium chloride Substances 0.000 description 5
- 229910001628 calcium chloride Inorganic materials 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- CVZUPRDSNNBZLH-UHFFFAOYSA-N 2-methoxy-5-nitrobenzoic acid Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C(O)=O CVZUPRDSNNBZLH-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- FKCMADOPPWWGNZ-YUMQZZPRSA-N [(2r)-1-[(2s)-2-amino-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid Chemical compound CC(C)[C@H](N)C(=O)N1CCC[C@H]1B(O)O FKCMADOPPWWGNZ-YUMQZZPRSA-N 0.000 description 4
- 125000004442 acylamino group Chemical group 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 4
- NFODTGKNJTZWLV-UHFFFAOYSA-N 2-methoxy-5-nitrobenzoyl chloride Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C(Cl)=O NFODTGKNJTZWLV-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical class C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- JUFKJRCMBLLXNH-UHFFFAOYSA-N (1-methylpyrrolidin-2-yl)methanamine Chemical compound CN1CCCC1CN JUFKJRCMBLLXNH-UHFFFAOYSA-N 0.000 description 2
- BGRJTUBHPOOWDU-NSHDSACASA-N (S)-(-)-sulpiride Chemical compound CCN1CCC[C@H]1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-NSHDSACASA-N 0.000 description 2
- FNDCOFKQOCGHEI-UHFFFAOYSA-N 2-methoxy-5-sulfanylbenzoic acid Chemical compound COC1=CC=C(S)C=C1C(O)=O FNDCOFKQOCGHEI-UHFFFAOYSA-N 0.000 description 2
- VEZPIKNMMOCDRD-UHFFFAOYSA-N 3,5-dichloro-2-methoxybenzoyl chloride Chemical compound COC1=C(Cl)C=C(Cl)C=C1C(Cl)=O VEZPIKNMMOCDRD-UHFFFAOYSA-N 0.000 description 2
- YBCOOGQGBVDQSB-UHFFFAOYSA-N 4-acetamido-5-chloro-2-methoxybenzoyl chloride Chemical compound COC1=CC(NC(C)=O)=C(Cl)C=C1C(Cl)=O YBCOOGQGBVDQSB-UHFFFAOYSA-N 0.000 description 2
- JBDMIOCVPSFJPW-UHFFFAOYSA-N 5-bromo-2-methoxybenzoyl chloride Chemical compound COC1=CC=C(Br)C=C1C(Cl)=O JBDMIOCVPSFJPW-UHFFFAOYSA-N 0.000 description 2
- 244000186140 Asperula odorata Species 0.000 description 2
- BOLLTSUCKRNILK-UHFFFAOYSA-N COC1=C(C(=S)O)C=C(C=C1)CC Chemical compound COC1=C(C(=S)O)C=C(C=C1)CC BOLLTSUCKRNILK-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 235000008526 Galium odoratum Nutrition 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 241000786363 Rhampholeon spectrum Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 206010047700 Vomiting Diseases 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- -1 amino compound Chemical class 0.000 description 2
- 239000002111 antiemetic agent Substances 0.000 description 2
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 2
- 229960004046 apomorphine Drugs 0.000 description 2
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 2
- 229940008406 diethyl sulfate Drugs 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229960004889 salicylic acid Drugs 0.000 description 2
- 229960004940 sulpiride Drugs 0.000 description 2
- 230000008673 vomiting Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JDIIGWSSTNUWGK-UHFFFAOYSA-N 1h-imidazol-3-ium;chloride Chemical compound [Cl-].[NH2+]1C=CN=C1 JDIIGWSSTNUWGK-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- AUVSCSCAPKFMEK-UHFFFAOYSA-N 3,5-dichloro-2-methoxybenzoic acid Chemical compound COC1=C(Cl)C=C(Cl)C=C1C(O)=O AUVSCSCAPKFMEK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MXNBDFWNYRNIBH-UHFFFAOYSA-N 3-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1 MXNBDFWNYRNIBH-UHFFFAOYSA-N 0.000 description 1
- CNHPODBJQHZAIY-UHFFFAOYSA-N 4-acetamido-2-methoxy-5-nitrobenzoyl chloride Chemical compound COC1=CC(NC(C)=O)=C([N+]([O-])=O)C=C1C(Cl)=O CNHPODBJQHZAIY-UHFFFAOYSA-N 0.000 description 1
- GOXCIWMHHSVOKW-UHFFFAOYSA-N 4-acetamido-5-chloro-2-methoxybenzoic acid Chemical compound COC1=CC(NC(C)=O)=C(Cl)C=C1C(O)=O GOXCIWMHHSVOKW-UHFFFAOYSA-N 0.000 description 1
- YTNLUMMYZOKSNG-UHFFFAOYSA-N 4-amino-3,5-dichloro-2-methoxybenzoic acid Chemical compound COC1=C(Cl)C(N)=C(Cl)C=C1C(O)=O YTNLUMMYZOKSNG-UHFFFAOYSA-N 0.000 description 1
- JFDUXZIRWBYBAQ-UHFFFAOYSA-N 5-bromo-2-methoxybenzoic acid Chemical compound COC1=CC=C(Br)C=C1C(O)=O JFDUXZIRWBYBAQ-UHFFFAOYSA-N 0.000 description 1
- GSFGGUVBFJQNQQ-UHFFFAOYSA-N 5-ethylsulfonyl-2-methoxybenzoyl chloride Chemical compound CCS(=O)(=O)C1=CC=C(OC)C(C(Cl)=O)=C1 GSFGGUVBFJQNQQ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- RCADRYUUNJGKBV-UHFFFAOYSA-N COC(C(Cl)=C(C(Cl)=C1)N)=C1C(Cl)=O Chemical compound COC(C(Cl)=C(C(Cl)=C1)N)=C1C(Cl)=O RCADRYUUNJGKBV-UHFFFAOYSA-N 0.000 description 1
- BZSSZOIPPWHDSQ-UHFFFAOYSA-N COC1=C(C(=O)Cl)C=C(C=C1Cl)F Chemical compound COC1=C(C(=O)Cl)C=C(C=C1Cl)F BZSSZOIPPWHDSQ-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 230000000506 psychotropic effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/08—Preparation of nitro compounds by substitution of hydrogen atoms by nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/04—Formation of amino groups in compounds containing carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/36—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids
- C07C303/40—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids by reactions not involving the formation of sulfonamide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C315/00—Preparation of sulfones; Preparation of sulfoxides
- C07C315/02—Preparation of sulfones; Preparation of sulfoxides by formation of sulfone or sulfoxide groups by oxidation of sulfides, or by formation of sulfone groups by oxidation of sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/09—Preparation of carboxylic acids or their salts, halides or anhydrides from carboxylic acid esters or lactones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/347—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups
- C07C51/363—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/26—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quick-Acting Or Multi-Walled Pipe Joints (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US337162A US3342826A (en) | 1964-01-13 | 1964-01-13 | Heterocyclic aminoalkyl benzamides |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1595915A1 DE1595915A1 (de) | 1970-02-12 |
| DE1595915B2 DE1595915B2 (de) | 1974-07-11 |
| DE1595915C3 true DE1595915C3 (de) | 1980-02-21 |
Family
ID=23319376
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1595915A Expired DE1595915C3 (de) | 1964-01-13 | 1965-01-08 | Pyrrolidinderivate |
| DE19651795723 Pending DE1795723A1 (de) | 1964-01-13 | 1965-01-08 | 2-alkoxybenzamide |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651795723 Pending DE1795723A1 (de) | 1964-01-13 | 1965-01-08 | 2-alkoxybenzamide |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3342826A (enExample) |
| BE (1) | BE658250A (enExample) |
| BR (1) | BR6566161D0 (enExample) |
| CH (1) | CH468377A (enExample) |
| DE (2) | DE1595915C3 (enExample) |
| DK (1) | DK124402B (enExample) |
| ES (1) | ES308289A1 (enExample) |
| FI (1) | FI48273C (enExample) |
| FR (2) | FR1472025A (enExample) |
| GB (1) | GB1088531A (enExample) |
| IL (1) | IL22669A (enExample) |
| NL (1) | NL6500326A (enExample) |
| NO (1) | NO119533B (enExample) |
| OA (1) | OA01859A (enExample) |
| SE (1) | SE340452B (enExample) |
Families Citing this family (79)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3885033A (en) * | 1967-04-03 | 1975-05-20 | Ile De France | Method of anesthetizing a mammal by administration of a substituted 2-arylalkyloxy benzamide |
| US3723416A (en) * | 1967-04-03 | 1973-03-27 | Ile De France | Substituted 2-arylalkyloxy benzamides |
| US3865946A (en) * | 1967-04-03 | 1975-02-11 | Ile De France | Method of anesthetizing a mammal by administration of a substituted 2-arylalkyloxy benzamide |
| US3891671A (en) * | 1968-08-01 | 1975-06-24 | Ile De France | N-(2-pyrrolidyl or piperidyl alkyl)-4-hydroxy benzamides |
| USRE29828E (en) * | 1968-12-23 | 1978-11-07 | A. H. Robins Company, Inc. | 1-Substituted-3-amidopyrrolidines |
| JPS4864066A (enExample) * | 1971-12-09 | 1973-09-05 | ||
| US3963745A (en) * | 1972-04-03 | 1976-06-15 | A. H. Robins Company, Incorporated | Method for controlling emesis with N-(1-substituted-3-pyrrolidinyl)benzamides and thiobenzamides |
| US4279822A (en) * | 1972-04-03 | 1981-07-21 | A. H. Robins Company, Inc. | N-(1-Substituted-3-pyrrolidinyl)benzamides |
| US3966957A (en) * | 1972-04-03 | 1976-06-29 | A. H. Robins Company, Incorporated | Method for controlling emesis with N-(1-substituted-3-pyrrolidinyl)benzamides and thiobenzamides |
| CH584688A5 (enExample) * | 1972-06-23 | 1977-02-15 | Delmar Chem | |
| US3862139A (en) * | 1972-06-23 | 1975-01-21 | Delmar Chem | Heterocyclic benzamide compounds |
| BE793689A (fr) * | 1972-07-19 | 1973-05-02 | Renfag Sa | Procede de preparation d'acides 2-alcoxy-5-alcoysulfonylbenzoique |
| FR2206937B1 (enExample) * | 1972-11-22 | 1977-01-14 | Ile De France | |
| FR2219156B1 (enExample) * | 1973-02-28 | 1977-12-30 | Ile De France | |
| FR2219940B1 (enExample) * | 1973-03-01 | 1976-09-10 | Ile De France | |
| CH605793A5 (fr) * | 1974-03-05 | 1978-10-13 | Soc Et Scient Et Ind | Procédé de préparation de nouveaux N-(1benzylpyrrollidinil 2-alkyl) benzamides substitués |
| GB1507462A (en) * | 1974-03-21 | 1978-04-12 | Gallardo Antonio Sa | N-heterocyclic substituted benzamides methods for their preparation and compositions containing them |
| US4189495A (en) * | 1974-09-17 | 1980-02-19 | Synthelabo | 2-Methoxy-benzamide derivatives |
| US4172143A (en) * | 1974-12-18 | 1979-10-23 | Synthelabo | 2-Methoxy-benzamide derivatives |
| US4158060A (en) * | 1974-12-18 | 1979-06-12 | Synthelabo | 2-Methoxy-benzamide derivatives |
| US4002757A (en) * | 1974-12-26 | 1977-01-11 | A. H. Robins Company, Incorporated | N-(1-substituted-3-pyrrolidinyl)-4-quinolinecarboxamides |
| US4052361A (en) * | 1974-12-30 | 1977-10-04 | American Cyanamid Company | N-(2,2-dimethyl-6,6-di(lower alkyl)-4-piperidinyl)-amides of hindered 3,5-dialkyl-4-hydroxybenzoic acids and use as light stabilizers in polyolefins |
| US4048058A (en) * | 1975-08-13 | 1977-09-13 | Standard Oil Company (Indiana) | Methods to be used in reforming processes employing multi-metallic catalysts |
| US4056535A (en) * | 1975-07-09 | 1977-11-01 | Stanford Research Institute | N-substituted 3-aminopyrrolidines |
| GB1561350A (en) * | 1976-11-05 | 1980-02-20 | May & Baker Ltd | Benzamide derivatives |
| US4163789A (en) * | 1976-02-17 | 1979-08-07 | Anphar, S.A. | Anti-psychotic (cycloalkenylalkylpiperidino) benzamides |
| US4035373A (en) * | 1976-02-23 | 1977-07-12 | The University Of Toledo | Preparation of piperidinyl-alkyl-benzamides |
| US4049821A (en) * | 1976-05-12 | 1977-09-20 | A. H. Robins Company, Inc. | Method of treating allergy |
| US4186135A (en) * | 1976-08-04 | 1980-01-29 | Societe D'etudes Scientifiques Et Industrielles De L'ile-De-France | Substituted 2,3-alkylene bis (oxy) benzamides and derivatives and method of preparation |
| GB1586468A (en) * | 1976-10-29 | 1981-03-18 | Anphar Sa | Piperidine derivatives |
| GB1574418A (en) * | 1976-11-16 | 1980-09-03 | Anphar Sa | Piperidine derivatives |
| NZ186175A (en) * | 1977-01-27 | 1980-03-05 | Shionogi & Co | Meta-sulphonamidobenzamide derivatives |
| DE2730174C2 (de) * | 1977-07-04 | 1981-12-10 | Ludwig Merckle Kg Chem. Pharm. Fabrik, 7902 Blaubeuren | Aminobenzoesäurederivate und Arzneimittel enthaltend solche Aminobenzoesäurederivate |
| US4143150A (en) * | 1977-08-19 | 1979-03-06 | A. H. Robins Company, Inc. | Derivatives of oxanilic acid |
| US4207327A (en) * | 1977-08-19 | 1980-06-10 | A. H. Robins Company, Inc. | N-(4-Pyrazolidinyl)benzamides and their amino precursors |
| FR2415099A1 (fr) * | 1978-01-20 | 1979-08-17 | Ile De France | Nouveaux derives de 4-amino-5-alkylsulfonyl ortho-anisamides, leurs procedes de preparation et leur application comme psychotropes |
| FR2440946A2 (fr) * | 1978-01-20 | 1980-06-06 | Ile De France | Nouveaux benzamides heterocycliques substitues, leurs procedes de preparation et leur application comme modificateurs du comportement |
| SE411118B (sv) * | 1978-03-23 | 1979-12-03 | Astra Laekemedel Ab | Ett forfarande for framstellning av 2,6-dialkoxibensamider med terapentiska egenskaper |
| FR2438650A1 (fr) * | 1978-10-11 | 1980-05-09 | Ile De France | N-(1-methyl 2-pyrrolidinyl methyl) 2,3-dimethoxy 5-methylsulfamoyl benzamide et ses derives, leurs methodes de preparation et leur application dans le traitement des troubles du bas appareil urinaire |
| US4263316A (en) * | 1978-10-11 | 1981-04-21 | Societe D'etudes Scientifiques Et Industrielles De L'ile De France | N-(1-Methyl-2-pyrrolidinylmethyl)-2,3-dimethoxy-5-methylsulfamoyl benzamide and its derivatives, methods of preparing them and their application to the treatment of troubles of the lower part of the body |
| US4210660A (en) * | 1978-12-20 | 1980-07-01 | Yamanouchi Pharmaceutical Co., Ltd. | Benzamide derivatives |
| FR2446274A1 (fr) * | 1979-01-15 | 1980-08-08 | Delalande Sa | Nouveaux derives de salicylamide, leur procede de preparation et leur application en therapeutique |
| FR2447911A1 (fr) * | 1979-02-05 | 1980-08-29 | Synthelabo | Benzamides et leur application en therapeutique |
| FR2489327B1 (fr) * | 1980-08-28 | 1984-05-18 | Ile De France | N (1 allyl 2 pyrrolidinyl methyl) 2 methoxy 4 amino 5 methylsulfa moyl benzamide, son procede de preparation et son application comme medicament |
| SE8101536L (sv) * | 1981-03-11 | 1982-09-12 | Astra Laekemedel Ab | Bensamid-derivat |
| US4470977A (en) * | 1981-06-04 | 1984-09-11 | Adria Laboratories, Inc. | Antiemetic and antipsychotic agents |
| US4962115A (en) * | 1981-10-01 | 1990-10-09 | Janssen Pharmaceutica N.V. | Novel N-(3-hydroxy-4-piperidinyl)benzamide derivatives |
| FI74707C (fi) * | 1982-06-29 | 1988-03-10 | Sandoz Ag | Foerfarande foer framstaellning av terapeutiskt anvaendbara alkylenoeverbryggade piperidylestrar eller -amider av bicykliska karboxylsyror. |
| SE8205135D0 (sv) * | 1982-09-09 | 1982-09-09 | Astra Laekemedel Ab | Benzamido-derivatives |
| JPS59186969A (ja) * | 1983-04-08 | 1984-10-23 | Yoshitomi Pharmaceut Ind Ltd | ベンゾフラン−およびベンゾピランカルボキサミド誘導体 |
| DE3429830A1 (de) * | 1983-08-26 | 1985-03-07 | Sandoz-Patent-GmbH, 7850 Lörrach | Automatische carbonsaeure- und sulfonsaeureester oder -amide |
| CA1297877C (en) * | 1983-12-22 | 1992-03-24 | Daniel Lednicer | Benzofurancarboxamides useful as antiemetic or antipsychotic agents |
| US5175173A (en) * | 1983-12-22 | 1992-12-29 | Sun Jung Hui | Carboxamides useful as antiemetic or antipsychotic agents |
| US4888353A (en) * | 1986-02-28 | 1989-12-19 | Erbamont, Inc. | Carboxamides useful as antiemetic or antipsychotic agents |
| FR2556964A1 (fr) * | 1983-12-23 | 1985-06-28 | Ile De France | Nouvelles formes galeniques du sulpiride utilisables par voie orale |
| DE3445377A1 (de) * | 1983-12-23 | 1985-07-04 | Sandoz-Patent-GmbH, 7850 Lörrach | Carbocylische und heterocyclische carbonsaeureester und -amide von ueberbrueckten und nicht ueberbrueckten cyclischen stickstoffhaltigen aminen oder alkoholen |
| US5240957A (en) * | 1984-01-31 | 1993-08-31 | Astra Lakemedel Akteibolag | Oxysalicylamido derivatives |
| SE8503054D0 (sv) * | 1985-06-19 | 1985-06-19 | Astra Laekemedel Ab | Catecholcarboxamides |
| FR2584605B1 (fr) * | 1985-07-15 | 1988-06-17 | Ile De France | Application du n-(1-allyl-2-pyrrolidinylmethyl) 2-methoxy 4-amino 5-methylsulfamoyl benzamide dans le traitement de la maladie de parkinson |
| GB8519707D0 (en) | 1985-08-06 | 1985-09-11 | Fordonal Sa | Chemical compounds |
| FR2592042B1 (fr) * | 1985-12-19 | 1988-03-25 | Ile De France | Nouveaux ortho-anisamides, leur procede d'obtention, et leurs applications therapeutiques |
| US4772459A (en) * | 1986-09-09 | 1988-09-20 | Erbamont, Inc. | Method for controlling emesis caused by chemotherapeutic agents and antiemetic agents useful therein |
| JPH0768185B2 (ja) * | 1986-12-23 | 1995-07-26 | セントラル硝子株式会社 | ニトロ置換4―トリフルオロメチル安息香酸の製造方法 |
| GB8708833D0 (en) * | 1987-04-13 | 1987-05-20 | Lilly S A E | Organic compounds |
| US4751236A (en) * | 1987-05-20 | 1988-06-14 | Avihou Mishniot | Method for treating genital herpes |
| ATE82124T1 (de) * | 1987-06-17 | 1992-11-15 | Delagrange Lab | Anwendung von n-(2-(diaethylamino)aethyl>-2-methoxy-4((1-h-4,5ihydro-2-imidazolyl)amino>-5- chlorobenzamid als anxiolytisches und antipsychotisches mittel. |
| EP0320630A1 (en) * | 1987-11-19 | 1989-06-21 | The Vanderbilt University | Enantiometric iodobenzamides |
| US5154913A (en) * | 1987-11-19 | 1992-10-13 | Vanderbilt University | Radioiodinated benzamines method of their use as radioimaging agents |
| US4952574A (en) * | 1988-09-26 | 1990-08-28 | Riker Laboratories, Inc. | Antiarrhythmic substituted N-(2-piperidylmethyl)benzamides |
| GB8823041D0 (en) * | 1988-09-30 | 1988-11-09 | Lilly Sa | Organic compounds & their use as pharmaceuticals |
| GB8823042D0 (en) * | 1988-09-30 | 1988-11-09 | Lilly Sa | Organic compounds & their use as pharmaceuticals |
| GB8823040D0 (en) * | 1988-09-30 | 1988-11-09 | Lilly Sa | Organic compounds & their use as pharmaceuticals |
| US5254569A (en) * | 1991-01-14 | 1993-10-19 | The Du Pont Merck Pharmaceutical Company | (Amidomethyl)nitrogen heterocyclic analgesics |
| JP3026845B2 (ja) * | 1991-02-20 | 2000-03-27 | 日清製粉株式会社 | ピペリジン誘導体 |
| US5290796A (en) * | 1992-11-20 | 1994-03-01 | Sterling Winthrop Inc. | Substituted 3-piperidinealkanamines and alkanamides and compositions and method of use thereof |
| US6673829B2 (en) | 2001-09-14 | 2004-01-06 | Novo Nordisk A/S | Aminoazetidine,-pyrrolidine and -piperidine derivatives |
| JP4619655B2 (ja) * | 2001-09-14 | 2011-01-26 | ハイ・ポイント・ファーマスーティカルズ、エルエルシー | 新規アミノアゼチジン、−ピロリジンおよび−ピペリジン誘導体 |
| WO2003055857A1 (en) * | 2001-12-28 | 2003-07-10 | Farmaceutsko-Hemijska Industrija 'zdravlje' | A process for synthesis of heterocyclic aminoalkyl benzamides |
| PE20061318A1 (es) * | 2005-04-22 | 2006-12-28 | Wyeth Corp | Nuevas combinaciones terapeuticas para el tratamiento o la prevencion de trastornos psicoticos |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2748134A (en) * | 1956-05-29 | Amide-like derivatives of piperidine | ||
| US2691025A (en) * | 1951-03-30 | 1954-10-05 | Sterling Drug Inc | N-(tertiary-aminoalkyl)-2, 4-disubstituted-benzamides and their preparation |
| US2691041A (en) * | 1953-05-21 | 1954-10-05 | Sterling Drug Inc | N-(tertiary-aminoalkyl)-2-substituted-4-nitrobenzamides and their salts |
| GB797476A (en) * | 1955-09-09 | 1958-07-02 | Bristol Lab Inc | Amides of trialkoxybenzoic acids |
| FR36F (fr) * | 1961-07-25 | 1963-08-30 | Ile De France | Médicaments antiémétiques nouveaux. |
| NL281394A (enExample) * | 1961-07-25 |
-
1964
- 1964-01-13 US US337162A patent/US3342826A/en not_active Expired - Lifetime
- 1964-12-25 IL IL22669A patent/IL22669A/en unknown
-
1965
- 1965-01-04 GB GB284/65A patent/GB1088531A/en not_active Expired
- 1965-01-08 DE DE1595915A patent/DE1595915C3/de not_active Expired
- 1965-01-08 DE DE19651795723 patent/DE1795723A1/de active Pending
- 1965-01-09 FI FI40/65A patent/FI48273C/fi active
- 1965-01-12 BR BR166161/65A patent/BR6566161D0/pt unknown
- 1965-01-12 NL NL6500326A patent/NL6500326A/xx unknown
- 1965-01-12 ES ES0308289A patent/ES308289A1/es not_active Expired
- 1965-01-12 FR FR1653A patent/FR1472025A/fr not_active Expired
- 1965-01-12 SE SE00358/65A patent/SE340452B/xx unknown
- 1965-01-12 NO NO156308A patent/NO119533B/no unknown
- 1965-01-12 CH CH38665A patent/CH468377A/de unknown
- 1965-01-12 DK DK14265AA patent/DK124402B/da unknown
- 1965-01-13 BE BE658250D patent/BE658250A/xx unknown
- 1965-04-01 FR FR11640A patent/FR4879M/fr not_active Expired
- 1965-11-16 OA OA52253A patent/OA01859A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES308289A1 (es) | 1965-06-16 |
| CH468377A (de) | 1969-02-15 |
| DE1595915A1 (de) | 1970-02-12 |
| OA01859A (fr) | 1970-01-14 |
| FR4879M (enExample) | 1967-03-06 |
| DK124402B (da) | 1972-10-16 |
| BR6566161D0 (pt) | 1973-08-02 |
| BE658250A (enExample) | 1965-07-13 |
| FI48273B (enExample) | 1974-04-30 |
| US3342826A (en) | 1967-09-19 |
| NL6500326A (enExample) | 1965-07-14 |
| IL22669A (en) | 1969-03-27 |
| DE1595915B2 (de) | 1974-07-11 |
| DE1795723A1 (de) | 1974-08-29 |
| FI48273C (fi) | 1979-12-14 |
| FR1472025A (fr) | 1967-03-10 |
| SE340452B (enExample) | 1971-11-22 |
| NO119533B (enExample) | 1970-06-01 |
| GB1088531A (en) | 1967-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1595915C3 (de) | Pyrrolidinderivate | |
| DE2203373C3 (de) | Neue 2- [(2- Alkylbenzofuran-3-yl)-methyl] -A2 -imidazoline | |
| DE2419970A1 (de) | Tertiaere cyclische amine und verfahren zu ihrer herstellung | |
| DE2511891A1 (de) | Neue derivate des 2,6-dioxopiperazins, verfahren zu ihrer herstellung, diese verbindungen enthaltende arzneimittel sowie verfahren zu deren herstellung | |
| DE2446100C3 (de) | Phenoxyalkancarbonsäureamide von Thiazolidincarbonsäuren, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE1618465B2 (de) | Phenylessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1960910B2 (de) | Benzylidenamino-oxyalkancarbonsäuren und deren Derivate, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE2818351A1 (de) | Benzoesaeurederivate, verfahren zu ihrer herstellung und ihre therapeutische verwendung | |
| DE1795653B2 (de) | Verfahren zur Herstellung von 2-Methoxy-4,5-azimidobenzamiden Ausscheidung aus: 1795110 | |
| DE1493797C3 (de) | Verfahren zur Herstellung von neuen substituierten Malonsäuremonohydraziden | |
| DE2166270C3 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| AT209895B (de) | Verfahren zur Herstellung von 3-Amino-2,4,6-trijodbenzoylverbindungen | |
| DE1493513C3 (de) | Sulfamylanthranilsäuren, deren therapeutisch verwendbare Salze, Verfahren zu ihrer Herstellung und diese enthaltenden pharmazeutischen Präparate | |
| DE2029991C3 (de) | 2-Hydroxy-5-aminobenzamide, Verfahren zu ihrer Herstellung und Arzneimittel, die diese Verbindungen enthalten | |
| DE1670143C3 (enExample) | ||
| DE2836062A1 (de) | N-(4-pyrazolidinyl)benzamide und deren salze und sie enthaltende pharmazeutische zubereitungen | |
| DE2533863A1 (de) | Basische 1-aryl-2-oxo-2,4,5,6,7,7 alpha-hexahydroindolderivate, verfahren zu ihrer herstellung und arzneimittel | |
| DE1620190C (de) | 4-(2-Carbo-alpha-glyceryloxyphenylamino)-8-chlorchinolin, seine Salze und ein Verfahren zu ihrer Herstellung | |
| DE1445629C (de) | Neue Piperazinderivate | |
| DE2410307C2 (de) | 2-(2-Thioäthyl)-4-carboxy-thiazolidin-Derivate | |
| AT368153B (de) | Verfahren zur herstellung des neuen n-(1'-allylpyrrolidin-2'-yl-methyl)-2-methoxy-4,5- azimidobenzamides und seiner saeureadditionssalze | |
| DE968561C (de) | Verfahren zur Herstellung von am Aminostickstoff substituierten Monoaminoacylaniliden | |
| DE1166782B (de) | Verfahren zur Herstellung von substituierten aromatischen Dicarbonsaeureimiden und deren Salzen | |
| AT366371B (de) | Verfahren zur herstellung von neuen n-(4pyrazolidinyl)benzamiden, deren salzen und optischaktiven formen | |
| DE2235915C3 (de) | N-eckige Klammer auf 3-Pyrrolidinyliden-(2'-amino-2,4,6-trijodbenzoyl eckige Klammer zu - aminosäuren, deren Herstellung und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| OI | Miscellaneous see part 1 |