DE1445531C3 - In 5 Stellung substituierte 2 Benzol sulfonamidopynmidine und Verfahren zu deren Herstellung - Google Patents
In 5 Stellung substituierte 2 Benzol sulfonamidopynmidine und Verfahren zu deren HerstellungInfo
- Publication number
- DE1445531C3 DE1445531C3 DE1445531A DE1445531A DE1445531C3 DE 1445531 C3 DE1445531 C3 DE 1445531C3 DE 1445531 A DE1445531 A DE 1445531A DE 1445531 A DE1445531 A DE 1445531A DE 1445531 C3 DE1445531 C3 DE 1445531C3
- Authority
- DE
- Germany
- Prior art keywords
- pyrimidine
- general formula
- ethyl
- benzamido
- given above
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 title description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 title description 3
- 238000002360 preparation method Methods 0.000 title description 3
- HLBLNLYCFFWMFF-UHFFFAOYSA-N n-pyrimidin-2-ylbenzenesulfonamide Chemical group C=1C=CC=CC=1S(=O)(=O)NC1=NC=CC=N1 HLBLNLYCFFWMFF-UHFFFAOYSA-N 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 8
- 125000003368 amide group Chemical group 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- -1 alkylene radical Chemical group 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 229940124530 sulfonamide Drugs 0.000 description 4
- 150000003456 sulfonamides Chemical class 0.000 description 4
- BRSRNTJGTDYRFT-UHFFFAOYSA-N 2-(benzenesulfonyl)guanidine Chemical compound NC(N)=NS(=O)(=O)C1=CC=CC=C1 BRSRNTJGTDYRFT-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 150000005695 2-halopyrimidines Chemical class 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 125000003047 N-acetyl group Chemical group 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 230000003178 anti-diabetic effect Effects 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000008331 benzenesulfonamides Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- STIAPHVBRDNOAJ-UHFFFAOYSA-N carbamimidoylazanium;carbonate Chemical compound NC(N)=N.NC(N)=N.OC(O)=O STIAPHVBRDNOAJ-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000005695 dehalogenation reaction Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 125000004954 trialkylamino group Chemical group 0.000 description 2
- 150000008319 1H-pyrimidin-2-ones Chemical class 0.000 description 1
- FYERTDTXGGOMGT-UHFFFAOYSA-N 2,2-diethoxyethylbenzene Chemical compound CCOC(OCC)CC1=CC=CC=C1 FYERTDTXGGOMGT-UHFFFAOYSA-N 0.000 description 1
- 150000005006 2-aminopyrimidines Chemical class 0.000 description 1
- WJMTYHPVECLEHE-UHFFFAOYSA-N 5-(4-chlorophenyl)pyrimidine Chemical compound C1=CC(Cl)=CC=C1C1=CN=CN=C1 WJMTYHPVECLEHE-UHFFFAOYSA-N 0.000 description 1
- KAHHAPNRIQLSFT-UHFFFAOYSA-N 5-methoxypyrimidin-2-amine Chemical compound COC1=CN=C(N)N=C1 KAHHAPNRIQLSFT-UHFFFAOYSA-N 0.000 description 1
- LVXOXXGCJHYEOS-UHFFFAOYSA-N 5-phenylpyrimidine Chemical compound C1=CC=CC=C1C1=CN=CN=C1 LVXOXXGCJHYEOS-UHFFFAOYSA-N 0.000 description 1
- JCKHSOMIXYGMOX-UHFFFAOYSA-N 5-propoxypyrimidin-2-amine Chemical compound CCCOC1=CN=C(N)N=C1 JCKHSOMIXYGMOX-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- KKYYWENDEZDOPG-UHFFFAOYSA-N CC(C=C(C=C1)NC(C2=CC=CC=C2)=O)=C1S(NC(N=C1)=NC=C1OCCOC)(=O)=O Chemical compound CC(C=C(C=C1)NC(C2=CC=CC=C2)=O)=C1S(NC(N=C1)=NC=C1OCCOC)(=O)=O KKYYWENDEZDOPG-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- WSMYVTOQOOLQHP-UHFFFAOYSA-N Malondialdehyde Chemical compound O=CCC=O WSMYVTOQOOLQHP-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- DMHSEFCHUZHWLA-UHFFFAOYSA-N N-[[4-(diaminomethylideneamino)sulfonylphenyl]methyl]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)S(=O)(=O)NC(=N)N DMHSEFCHUZHWLA-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000144952 Peromyscus californicus Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- HJKGBRPNSJADMB-UHFFFAOYSA-N beta-Phenylpyridine Natural products C1=CC=CC=C1C1=CC=CN=C1 HJKGBRPNSJADMB-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- UKKHWKNEQBGLMI-UHFFFAOYSA-N n-pyrimidin-2-ylacetamide Chemical class CC(=O)NC1=NC=CC=N1 UKKHWKNEQBGLMI-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000001010 sulfinic acid amide group Chemical group 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/69—Benzenesulfonamido-pyrimidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heat-Pump Type And Storage Water Heaters (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0076848 | 1964-05-20 | ||
| DEB84050A DE1254153B (de) | 1964-05-20 | 1965-10-09 | Verfahren zur Herstellung von neuen 2-Benzolsulfonamido-pyrimidinen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1445531A1 DE1445531A1 (de) | 1969-03-20 |
| DE1445531B2 DE1445531B2 (de) | 1973-02-15 |
| DE1445531C3 true DE1445531C3 (de) | 1973-10-31 |
Family
ID=25967088
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1445531A Expired DE1445531C3 (de) | 1964-05-20 | 1964-05-20 | In 5 Stellung substituierte 2 Benzol sulfonamidopynmidine und Verfahren zu deren Herstellung |
| DEB84050A Pending DE1254153B (de) | 1964-05-20 | 1965-10-09 | Verfahren zur Herstellung von neuen 2-Benzolsulfonamido-pyrimidinen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB84050A Pending DE1254153B (de) | 1964-05-20 | 1965-10-09 | Verfahren zur Herstellung von neuen 2-Benzolsulfonamido-pyrimidinen |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3377351A (enExample) |
| BE (1) | BE664178A (enExample) |
| BR (1) | BR6569749D0 (enExample) |
| CH (2) | CH471796A (enExample) |
| DE (2) | DE1445531C3 (enExample) |
| DK (1) | DK112318B (enExample) |
| FI (2) | FI43878C (enExample) |
| FR (3) | FR1464602A (enExample) |
| GB (2) | GB1034300A (enExample) |
| IL (1) | IL23556A (enExample) |
| NL (3) | NL6506379A (enExample) |
| NO (1) | NO116415B (enExample) |
| SE (4) | SE317383B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670168C3 (de) * | 1966-11-29 | 1975-04-10 | Boehringer Mannheim Gmbh, 6800 Mannheim | 2-Benzolsulfonamido-4-methyl-5alkyl-pyrimidine und Verfahren zu ihrer Herstellung |
| DE1695855C3 (de) * | 1967-12-30 | 1979-07-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 4-(5-Isobutyl-2-pyrimidinyl)-sulfonamidophenylessigsäure-(2-methoxy-5chloranilid) und dessen Salze mit physiologisch verträglichen Basen |
| US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3198706A (en) * | 1956-07-31 | 1965-08-03 | Hoechst Ag | Methods of reducing blood sugar and compositions therefor |
| DE1101428B (de) * | 1959-07-08 | 1961-03-09 | Schering Ag | Verfahren zur Herstellung langwirkender Aminobenzolsulfonsaeure-amidderivate |
| US3275635A (en) * | 1960-10-18 | 1966-09-27 | Schering Ag | Certain 2-benzenesulfonamide-5-alkyl (or alkoxy) pyrimidine compounds |
-
0
- NL NL129627D patent/NL129627C/xx active
-
1964
- 1964-05-20 DE DE1445531A patent/DE1445531C3/de not_active Expired
-
1965
- 1965-05-17 IL IL23556A patent/IL23556A/en unknown
- 1965-05-18 FI FI651195A patent/FI43878C/fi active
- 1965-05-18 CH CH695765A patent/CH471796A/de not_active IP Right Cessation
- 1965-05-19 BE BE664178D patent/BE664178A/xx unknown
- 1965-05-19 NL NL6506379A patent/NL6506379A/xx unknown
- 1965-05-19 BR BR169749/65A patent/BR6569749D0/pt unknown
- 1965-05-19 FR FR17592A patent/FR1464602A/fr not_active Expired
- 1965-05-19 SE SE6532/65A patent/SE317383B/xx unknown
- 1965-05-19 NO NO158120A patent/NO116415B/no unknown
- 1965-05-19 GB GB21194/65A patent/GB1034300A/en not_active Expired
- 1965-08-19 FR FR28820A patent/FR4724M/fr not_active Expired
- 1965-10-09 DE DEB84050A patent/DE1254153B/de active Pending
-
1966
- 1966-08-22 DK DK429366AA patent/DK112318B/da unknown
- 1966-09-23 US US581445A patent/US3377351A/en not_active Expired - Lifetime
- 1966-10-06 CH CH1442166A patent/CH490389A/de unknown
- 1966-10-06 FR FR78998A patent/FR91332E/fr not_active Expired
- 1966-10-06 FI FI662625A patent/FI46963C/fi active
- 1966-10-07 NL NL666614126A patent/NL146810B/xx unknown
- 1966-10-07 GB GB44908/66A patent/GB1092500A/en not_active Expired
-
1967
- 1967-06-19 SE SE08615/67A patent/SE325890B/xx unknown
- 1967-06-19 SE SE08616/67A patent/SE325891B/xx unknown
- 1967-06-19 SE SE08617/67A patent/SE325892B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1445531A1 (de) | 1969-03-20 |
| NL6506379A (enExample) | 1965-11-22 |
| CH490389A (de) | 1970-05-15 |
| FI43878B (enExample) | 1971-03-31 |
| IL23556A (en) | 1968-12-26 |
| SE325891B (enExample) | 1970-07-13 |
| FI46963B (enExample) | 1973-05-02 |
| BE664178A (enExample) | 1965-11-19 |
| FI43878C (fi) | 1971-07-12 |
| FR91332E (fr) | 1968-05-24 |
| GB1034300A (en) | 1966-06-29 |
| CH471796A (de) | 1969-04-30 |
| SE317383B (enExample) | 1969-11-17 |
| SE325890B (enExample) | 1970-07-13 |
| GB1092500A (en) | 1967-11-29 |
| NL6614126A (enExample) | 1967-04-10 |
| FR4724M (enExample) | 1967-01-02 |
| DK112318B (da) | 1968-12-02 |
| DE1254153B (de) | 1967-11-16 |
| NL146810B (nl) | 1975-08-15 |
| FI46963C (fi) | 1973-08-10 |
| DE1445531B2 (de) | 1973-02-15 |
| NL129627C (enExample) | |
| NO116415B (enExample) | 1969-03-24 |
| FR1464602A (fr) | 1967-01-06 |
| US3377351A (en) | 1968-04-09 |
| BR6569749D0 (pt) | 1973-08-02 |
| SE325892B (enExample) | 1970-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1445531C3 (de) | In 5 Stellung substituierte 2 Benzol sulfonamidopynmidine und Verfahren zu deren Herstellung | |
| EP0470616A2 (de) | Substituierte Pyrimidin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Reagenzien | |
| DE1670168C3 (de) | 2-Benzolsulfonamido-4-methyl-5alkyl-pyrimidine und Verfahren zu ihrer Herstellung | |
| CH560197A5 (en) | 2-alkylthio-4,6-bis (subst amino)-5-nitropyrimidines - - herbicides | |
| DE1301817B (de) | Verfahren zur Herstellung von in 5-Stellung substituierten 2-Benzolsulfonamidopyrimidinen | |
| DE1670282B2 (de) | Antidiabetisch wirksame hydrindensulfonylamino-pyrimidine sowie verfahren zu deren herstellung | |
| DE946804C (de) | Verfahren zur Herstellung von schwefelhaltigen Abkoemmlingen der Barbitursaeure | |
| DE2836945A1 (de) | Derivate des 1,2,4-triazols | |
| DE2406972C3 (de) | Verfahren zur Herstellung von 5-Sulfamoylanthranilsäuren | |
| DE943706C (de) | Verfahren zur Herstellung von 2, 4-Diamino-5-benzylpyrimidinabkoemmlingen | |
| EP0151939B1 (de) | Verfahren zur Herstellung von Pyrimidindionen und Dihydroxypyrimidinen, sowie neue Pyrimidindione und Dihydroxypyrimidine | |
| DE1445709C (de) | Verfahren zur Herstellung von O,O Dialkyl thionothiolphosphonsaureestern bzw Alkyl O alkylthionothiolphosphonsaure estern | |
| DE2022746A1 (de) | Blutzuckersenkende Sulfonylaminopyrimidine und Verfahren zu deren Herstellung | |
| DE1670282C3 (de) | Antidiabetisch wirksame Hydrindensulfonylamino-pyrimidine sowie Verfahren zu deren Herstellung | |
| DE1795656A1 (de) | Neue antidiabetisch wirksame sulfonamide und verfahren zu deren herstellung | |
| DE737931C (de) | Verfahren zur Herstellung von 2, 4-Diaminochinazolin | |
| DE2055523C3 (de) | 03.07.70 Japan 58217-70 Verfahren zur Herstellung von 2lsopropyl-und2-Phenyl-6-methyl-4(3H)pyrimidon | |
| AT228209B (de) | Verfahren zur Herstellung von neuen Sulfonamiden | |
| DE1670188A1 (de) | Verfahren zur Herstellung von neuen antidiabetisch wirksamen Sulfonamiden | |
| DE2003840A1 (de) | 3-Phenyl-4-acyloxycarbostyrile,Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE1795842C2 (de) | Antidiabetisch wirksame Sulfonamide sowie Verfahren zu deren Herstellung | |
| CH473811A (de) | Verfahren zur Herstellung von neuen antidiabetisch wirksamen Sulfonamiden | |
| AT233568B (de) | Verfahren zur Herstellung von Sulfonamiden | |
| DE1670179A1 (de) | Verfahren zur Herstellung von neuen antidiabetisch wirksamen Sulfonamiden | |
| DE2107557A1 (de) | Benzolsulfonamidopyrimidine und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EHJ | Ceased/non-payment of the annual fee |