DE1251656B - Diazotypiematerial das eine o-Ammo benzoldiazoverbmdung enthalt - Google Patents
Diazotypiematerial das eine o-Ammo benzoldiazoverbmdung enthaltInfo
- Publication number
- DE1251656B DE1251656B DENDAT1251656D DE1251656DA DE1251656B DE 1251656 B DE1251656 B DE 1251656B DE NDAT1251656 D DENDAT1251656 D DE NDAT1251656D DE 1251656D A DE1251656D A DE 1251656DA DE 1251656 B DE1251656 B DE 1251656B
- Authority
- DE
- Germany
- Prior art keywords
- diazo
- group
- methoxy
- compound
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 58
- 150000008049 diazo compounds Chemical group 0.000 claims description 50
- -1 o-aminobenzene diazo compound Chemical class 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- 125000003277 amino group Chemical group 0.000 claims description 11
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 10
- 125000004442 acylamino group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 7
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 7
- 125000004306 triazinyl group Chemical group 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 150000001450 anions Chemical group 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- 125000005422 alkyl sulfonamido group Chemical group 0.000 claims description 2
- 125000005421 aryl sulfonamido group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 75
- 150000003839 salts Chemical class 0.000 description 42
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 39
- 239000011592 zinc chloride Substances 0.000 description 37
- 235000005074 zinc chloride Nutrition 0.000 description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- 239000007788 liquid Substances 0.000 description 21
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 18
- 238000010521 absorption reaction Methods 0.000 description 18
- 230000005855 radiation Effects 0.000 description 18
- 239000012954 diazonium Substances 0.000 description 17
- 239000010410 layer Substances 0.000 description 17
- 239000000987 azo dye Substances 0.000 description 16
- 150000001875 compounds Chemical class 0.000 description 16
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 15
- 150000001989 diazonium salts Chemical class 0.000 description 15
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 14
- 229920002689 polyvinyl acetate Polymers 0.000 description 14
- 239000011118 polyvinyl acetate Substances 0.000 description 14
- 150000002828 nitro derivatives Chemical class 0.000 description 12
- 229920002301 cellulose acetate Polymers 0.000 description 11
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 10
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 10
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 10
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 10
- 229960001553 phloroglucinol Drugs 0.000 description 10
- 239000011975 tartaric acid Substances 0.000 description 10
- 235000002906 tartaric acid Nutrition 0.000 description 10
- 239000006185 dispersion Substances 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 244000215068 Acacia senegal Species 0.000 description 8
- 229920000084 Gum arabic Polymers 0.000 description 8
- 239000000205 acacia gum Substances 0.000 description 8
- 235000010489 acacia gum Nutrition 0.000 description 8
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 8
- 230000001235 sensitizing effect Effects 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 8
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 239000010408 film Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 6
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 6
- 239000004327 boric acid Substances 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- UBBWNGKHQOYDKU-UHFFFAOYSA-N 4-benzamido-2,5-dimethoxybenzenediazonium;chloride Chemical compound [Cl-].COC1=CC([N+]#N)=C(OC)C=C1NC(=O)C1=CC=CC=C1 UBBWNGKHQOYDKU-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- 239000000976 ink Substances 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 206010034972 Photosensitivity reaction Diseases 0.000 description 3
- 206010070834 Sensitisation Diseases 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229940037003 alum Drugs 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 3
- 125000002791 glucosyl group Chemical group C1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZPBSAMLXSQCSOX-UHFFFAOYSA-N naphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 ZPBSAMLXSQCSOX-UHFFFAOYSA-N 0.000 description 3
- 230000036211 photosensitivity Effects 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 229940100486 rice starch Drugs 0.000 description 3
- 230000008313 sensitization Effects 0.000 description 3
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 2
- SKMDJPLCXWZTCN-UHFFFAOYSA-N 4-chloro-1-ethoxy-2-nitrobenzene Chemical compound CCOC1=CC=C(Cl)C=C1[N+]([O-])=O SKMDJPLCXWZTCN-UHFFFAOYSA-N 0.000 description 2
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- CZMRCDWAGMRECN-UHFFFAOYSA-N Rohrzucker Natural products OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2O)C(O)C1O CZMRCDWAGMRECN-UHFFFAOYSA-N 0.000 description 2
- 239000004280 Sodium formate Substances 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000008378 aryl ethers Chemical class 0.000 description 2
- 125000005615 azonium group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- ZHBQARHZUMHTRK-UHFFFAOYSA-N n-(2-methoxyphenyl)benzamide Chemical compound COC1=CC=CC=C1NC(=O)C1=CC=CC=C1 ZHBQARHZUMHTRK-UHFFFAOYSA-N 0.000 description 2
- HGVDYDIWZCHHKB-UHFFFAOYSA-N n-(5-chloro-2-methoxy-4-nitrophenyl)benzamide Chemical compound COC1=CC([N+]([O-])=O)=C(Cl)C=C1NC(=O)C1=CC=CC=C1 HGVDYDIWZCHHKB-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 238000010421 pencil drawing Methods 0.000 description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 2
- 235000019254 sodium formate Nutrition 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- RZKKOBGFCAHLCZ-UHFFFAOYSA-N 1,4-dichloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1Cl RZKKOBGFCAHLCZ-UHFFFAOYSA-N 0.000 description 1
- QJGDGUBLGKFNDB-UHFFFAOYSA-N 1-azido-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1N=[N+]=[N-] QJGDGUBLGKFNDB-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- URGSMJLDEFDWNX-UHFFFAOYSA-N 1-butylnaphthalene Chemical compound C1=CC=C2C(CCCC)=CC=CC2=C1 URGSMJLDEFDWNX-UHFFFAOYSA-N 0.000 description 1
- FKQKQCBLRSMFKX-UHFFFAOYSA-N 1-chloro-4-cyclopentyloxybenzene Chemical compound C1=CC(Cl)=CC=C1OC1CCCC1 FKQKQCBLRSMFKX-UHFFFAOYSA-N 0.000 description 1
- AYSSZUUOEVGWCK-UHFFFAOYSA-M 2-aminobenzenediazonium;chloride Chemical compound [Cl-].NC1=CC=CC=C1[N+]#N AYSSZUUOEVGWCK-UHFFFAOYSA-M 0.000 description 1
- OGMZKEIKYQBMGV-UHFFFAOYSA-N 2-butylheptyl hydrogen sulfate Chemical compound CCCCCC(CCCC)COS(=O)(=O)O OGMZKEIKYQBMGV-UHFFFAOYSA-N 0.000 description 1
- MHGOKSLTIUHUBF-UHFFFAOYSA-M 2-ethylhexyl sulfate(1-) Chemical compound CCCCC(CC)COS([O-])(=O)=O MHGOKSLTIUHUBF-UHFFFAOYSA-M 0.000 description 1
- ZTFYJIXFKGPCHV-UHFFFAOYSA-N 2-propan-2-ylnaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(C(C)C)=CC=C21 ZTFYJIXFKGPCHV-UHFFFAOYSA-N 0.000 description 1
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 1
- NZVGQLAXTXOAET-UHFFFAOYSA-N 4-benzamido-2,5-diethoxybenzenediazonium;chloride Chemical compound [Cl-].CCOC1=CC([N+]#N)=C(OCC)C=C1NC(=O)C1=CC=CC=C1 NZVGQLAXTXOAET-UHFFFAOYSA-N 0.000 description 1
- RUFOHZDEBFYQSV-UHFFFAOYSA-N 4-methoxy-3-nitroaniline Chemical compound COC1=CC=C(N)C=C1[N+]([O-])=O RUFOHZDEBFYQSV-UHFFFAOYSA-N 0.000 description 1
- GCEHTHHPWNJJPA-UHFFFAOYSA-N 4-methoxy-n-methyl-3-nitroaniline Chemical compound CNC1=CC=C(OC)C([N+]([O-])=O)=C1 GCEHTHHPWNJJPA-UHFFFAOYSA-N 0.000 description 1
- TZKMULPQFAJXLV-UHFFFAOYSA-N 4-methylbenzenesulfonyl chloride;sodium Chemical compound [Na].CC1=CC=C(S(Cl)(=O)=O)C=C1 TZKMULPQFAJXLV-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- WLJSUJOESWTGEX-UHFFFAOYSA-N 5-chloro-2-(4-chlorophenoxy)aniline Chemical compound NC1=CC(Cl)=CC=C1OC1=CC=C(Cl)C=C1 WLJSUJOESWTGEX-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- WYOSWXMNLJGWCB-UHFFFAOYSA-N N-[2-methoxy-5-(methylamino)-4-nitrophenyl]benzamide Chemical compound COC=1C(=CC(=C(C1)[N+](=O)[O-])NC)NC(C1=CC=CC=C1)=O WYOSWXMNLJGWCB-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- AKASBVWSPOYTRP-UHFFFAOYSA-N [Cl-].C(C)(=O)NC1=CC(=C(C=C1OCC)[N+]#N)OCC Chemical compound [Cl-].C(C)(=O)NC1=CC(=C(C=C1OCC)[N+]#N)OCC AKASBVWSPOYTRP-UHFFFAOYSA-N 0.000 description 1
- OQOQMZYFIHGZFC-UHFFFAOYSA-N [Cl-].C1(=CC=CC=C1)CC(=O)NC1=CC(=C(C=C1OC)[N+]#N)OC Chemical compound [Cl-].C1(=CC=CC=C1)CC(=O)NC1=CC(=C(C=C1OC)[N+]#N)OC OQOQMZYFIHGZFC-UHFFFAOYSA-N 0.000 description 1
- FZQSLXQPHPOTHG-UHFFFAOYSA-N [K+].[K+].O1B([O-])OB2OB([O-])OB1O2 Chemical compound [K+].[K+].O1B([O-])OB2OB([O-])OB1O2 FZQSLXQPHPOTHG-UHFFFAOYSA-N 0.000 description 1
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- PWAXUOGZOSVGBO-UHFFFAOYSA-N adipoyl chloride Chemical compound ClC(=O)CCCCC(Cl)=O PWAXUOGZOSVGBO-UHFFFAOYSA-N 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WRUAHXANJKHFIL-UHFFFAOYSA-N benzene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(S(O)(=O)=O)=C1 WRUAHXANJKHFIL-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 230000001808 coupling effect Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- JZLZCBGFXWWBBC-UHFFFAOYSA-N ethyl n-(2-methoxy-4-nitrophenyl)carbamate Chemical compound CCOC(=O)NC1=CC=C([N+]([O-])=O)C=C1OC JZLZCBGFXWWBBC-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 229910001510 metal chloride Inorganic materials 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- AUNYWGYRPIHMLM-UHFFFAOYSA-N n,1-diphenylmethanesulfonamide Chemical compound C=1C=CC=CC=1NS(=O)(=O)CC1=CC=CC=C1 AUNYWGYRPIHMLM-UHFFFAOYSA-N 0.000 description 1
- GFLADJWUPYTLDK-UHFFFAOYSA-N n-(5-chloro-2-ethoxyphenyl)acetamide Chemical compound CCOC1=CC=C(Cl)C=C1NC(C)=O GFLADJWUPYTLDK-UHFFFAOYSA-N 0.000 description 1
- DDMBNZJOOOQXBF-UHFFFAOYSA-N n-(5-chloro-2-ethoxyphenyl)benzamide Chemical compound CCOC1=CC=C(Cl)C=C1NC(=O)C1=CC=CC=C1 DDMBNZJOOOQXBF-UHFFFAOYSA-N 0.000 description 1
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- VNVXHHXFIDRQDE-UHFFFAOYSA-N octanoyl bromide Chemical compound CCCCCCCC(Br)=O VNVXHHXFIDRQDE-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K potassium phosphate Substances [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229930182490 saponin Natural products 0.000 description 1
- 150000007949 saponins Chemical class 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
- 229940038773 trisodium citrate Drugs 0.000 description 1
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/40—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/54—Diazonium salts or diazo anhydrides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL288469 | 1963-02-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1251656B true DE1251656B (de) | 1967-10-05 |
Family
ID=19754387
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1251656D Pending DE1251656B (de) | 1963-02-01 | Diazotypiematerial das eine o-Ammo benzoldiazoverbmdung enthalt |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3338713A (enExample) |
| BE (1) | BE643153A (enExample) |
| CH (1) | CH461267A (enExample) |
| DE (1) | DE1251656B (enExample) |
| DK (1) | DK114878B (enExample) |
| ES (1) | ES295910A1 (enExample) |
| FI (1) | FI40438B (enExample) |
| GB (1) | GB1045242A (enExample) |
| NL (2) | NL121032C (enExample) |
| SE (1) | SE315496B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2325579A1 (de) * | 1972-05-26 | 1973-12-13 | Oce Van Der Grinten Nv | Verfahren und vorrichtung zur herstellung von diazotypiekopien |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL133921C (enExample) * | 1964-06-01 | 1972-04-17 | ||
| NL131666C (enExample) * | 1965-07-01 | |||
| NL132069C (enExample) * | 1965-07-02 | |||
| US3463639A (en) * | 1965-12-15 | 1969-08-26 | Addressograph Multigraph | Benzene diazonium salts useful in diazotype materials having ortho carboxamido substitution |
| US3547637A (en) * | 1966-07-06 | 1970-12-15 | Keuffel & Esser Co | Light-sensitive diazotype material |
| US3868255A (en) * | 1969-07-23 | 1975-02-25 | Gaf Corp | Diazonium salts and diazotype materials |
| US4043816A (en) * | 1972-05-26 | 1977-08-23 | Oce-Van Der Grinten N.V. | Photographic process for making diazotype copies utilizing small quantity of liquid developer |
| US4306007A (en) * | 1978-03-13 | 1981-12-15 | Am International, Inc. | Process of making and using fade-resistant diazo microfilm |
| CH626877A5 (enExample) * | 1978-08-22 | 1981-12-15 | Aerni Leuch Ag |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB521492A (en) * | 1938-09-20 | 1940-05-23 | S C & P Harding Ltd | Improvements in the production of diazotype light-sensitive layers |
| US2326782A (en) * | 1941-04-16 | 1943-08-17 | Keuffel & Esser Co | Photosensitive material |
| FR1001352A (fr) * | 1946-04-24 | 1952-02-22 | Francolor Sa | Colorants pour la photographie en couleurs |
| US2665985A (en) * | 1949-10-26 | 1954-01-12 | Keuffel & Esser Co | Light-sensitive diazo compounds and photoprint material prepared therefrom |
| NL107375C (enExample) * | 1957-06-17 |
-
0
- NL NL288469D patent/NL288469A/xx unknown
- DE DENDAT1251656D patent/DE1251656B/de active Pending
- NL NL121032D patent/NL121032C/xx active
-
1964
- 1964-01-15 DK DK20364AA patent/DK114878B/da unknown
- 1964-01-16 FI FI0089/64A patent/FI40438B/fi active
- 1964-01-20 SE SE658/64A patent/SE315496B/xx unknown
- 1964-01-21 GB GB2596/64A patent/GB1045242A/en not_active Expired
- 1964-01-27 US US340534A patent/US3338713A/en not_active Expired - Lifetime
- 1964-01-30 BE BE643153D patent/BE643153A/xx unknown
- 1964-01-31 ES ES295910A patent/ES295910A1/es not_active Expired
- 1964-02-03 CH CH122664A patent/CH461267A/de unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2325579A1 (de) * | 1972-05-26 | 1973-12-13 | Oce Van Der Grinten Nv | Verfahren und vorrichtung zur herstellung von diazotypiekopien |
Also Published As
| Publication number | Publication date |
|---|---|
| NL288469A (enExample) | |
| CH461267A (de) | 1968-08-15 |
| NL121032C (enExample) | |
| US3338713A (en) | 1967-08-29 |
| DK114878B (da) | 1969-08-11 |
| SE315496B (enExample) | 1969-09-29 |
| FI40438B (enExample) | 1968-09-30 |
| GB1045242A (en) | 1966-10-12 |
| ES295910A1 (es) | 1964-03-16 |
| BE643153A (enExample) | 1964-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1251656B (de) | Diazotypiematerial das eine o-Ammo benzoldiazoverbmdung enthalt | |
| DE1547655B2 (de) | Diazotypiematerial | |
| DE1256065B (de) | Lichtempfindliches Material, das eine o-Aminobenzoldiazoverbindung enthaelt | |
| DE864657C (de) | Material fuer die Herstellung von Diazotypien | |
| DE1472798C3 (de) | Diazotypiematerial | |
| DE1768687C3 (de) | Mercaptosubstituierte Diazoverbindungen und diese enthaltendes lichtempfindliches Material | |
| DE1172952B (de) | Diazotypiematerial | |
| DE1693191A1 (de) | Diazotypiematerial | |
| DE1597631C3 (de) | Verfahren zur Herstellung von Bildkopien | |
| AT251416B (de) | Diazotypiematerial | |
| DE1522448B2 (de) | Diazoverbindungen, verfahren zu deren herstellung und diese enthaltende diazotypiematerialien | |
| DE1597516C3 (de) | Lichtempfindliches Diazotypie-Material | |
| DE2130481A1 (de) | Neue Diazoniumverbindungen sowie mit diesen hergestelltes Diazotypiematerial | |
| DE1522447C3 (de) | Diazoverbindungen, Verfahren zu deren Herste lung und diese enthaltende Diazotypiematerial | |
| DE1962391C2 (de) | Benzoldiazoniumverbindungen und deren Verwendung | |
| DE1522447B2 (de) | Diazoverbindungen, verfahren zu deren herstellung und diese enthaltende diazotypiematerialien | |
| DE1155331B (de) | Diazotypiematerial | |
| DE1522448C3 (de) | Diazoverbindungen, Verfahren zu deren Herstellung und diese enthaltende Diazotypiematerialien | |
| DE1814283C3 (de) | Diazotypiematerial | |
| DE1547655C3 (de) | Diazotypiematerial | |
| DE2226532C2 (de) | Benzoldiazoniumverbindungen und ein mit diesen Verbindungen hergestelltes Diazotypiematerial | |
| DE1472805C (de) | Diazotypiematerial | |
| AT236225B (de) | Zweikomponenten-Diazotypiematerial | |
| DE1814402A1 (de) | Durch Erwaermen entwickelbares Kopiermaterial | |
| DE1814283B2 (de) | Diazotypiematerial |