DE1234704B - Verfahren zur Herstellung von komplexen Mangansalzen der AEthylenbisdithiocarbaminsaeure - Google Patents
Verfahren zur Herstellung von komplexen Mangansalzen der AEthylenbisdithiocarbaminsaeureInfo
- Publication number
- DE1234704B DE1234704B DER32644A DER0032644A DE1234704B DE 1234704 B DE1234704 B DE 1234704B DE R32644 A DER32644 A DE R32644A DE R0032644 A DER0032644 A DE R0032644A DE 1234704 B DE1234704 B DE 1234704B
- Authority
- DE
- Germany
- Prior art keywords
- maneb
- complex
- manganese
- water
- salts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 14
- AWYFNIZYMPNGAI-UHFFFAOYSA-N ethylenebis(dithiocarbamic acid) Chemical class SC(=S)NCCNC(S)=S AWYFNIZYMPNGAI-UHFFFAOYSA-N 0.000 title claims description 10
- 150000002696 manganese Chemical class 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 150000003839 salts Chemical class 0.000 claims description 65
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 36
- 239000011701 zinc Substances 0.000 claims description 27
- 229910052725 zinc Inorganic materials 0.000 claims description 26
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 17
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 17
- YAUCKEPYKXHCFF-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;manganese Chemical compound [Mn].NC(=S)SCCSC(N)=S YAUCKEPYKXHCFF-UHFFFAOYSA-N 0.000 claims description 12
- 239000010949 copper Substances 0.000 claims description 10
- 229910052742 iron Inorganic materials 0.000 claims description 10
- 229910017052 cobalt Inorganic materials 0.000 claims description 9
- 239000010941 cobalt Substances 0.000 claims description 9
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 9
- 229910052802 copper Inorganic materials 0.000 claims description 9
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 7
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 claims description 5
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 2
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 229910001429 cobalt ion Inorganic materials 0.000 claims description 2
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 claims description 2
- 229910001431 copper ion Inorganic materials 0.000 claims description 2
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 claims 1
- 229910001447 ferric ion Inorganic materials 0.000 claims 1
- 229910001385 heavy metal Inorganic materials 0.000 claims 1
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 73
- 229920000940 maneb Polymers 0.000 description 73
- 239000000047 product Substances 0.000 description 40
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 30
- 229910052751 metal Inorganic materials 0.000 description 25
- 239000002184 metal Substances 0.000 description 25
- 241000196324 Embryophyta Species 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- 239000011572 manganese Substances 0.000 description 16
- 238000012360 testing method Methods 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000011717 all-trans-retinol Substances 0.000 description 15
- 235000019169 all-trans-retinol Nutrition 0.000 description 15
- 230000006378 damage Effects 0.000 description 15
- 239000002002 slurry Substances 0.000 description 15
- 229910052748 manganese Inorganic materials 0.000 description 14
- 239000000243 solution Substances 0.000 description 12
- 240000003768 Solanum lycopersicum Species 0.000 description 10
- 239000007795 chemical reaction product Substances 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 10
- 229910000368 zinc sulfate Inorganic materials 0.000 description 10
- 229960001763 zinc sulfate Drugs 0.000 description 10
- -1 copper Complex compound Chemical class 0.000 description 8
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 8
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 7
- 201000010099 disease Diseases 0.000 description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- 239000007921 spray Substances 0.000 description 7
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 6
- 238000010586 diagram Methods 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 238000011282 treatment Methods 0.000 description 6
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 229910021645 metal ion Inorganic materials 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 240000007087 Apium graveolens Species 0.000 description 4
- 235000011430 Malus pumila Nutrition 0.000 description 4
- 244000070406 Malus silvestris Species 0.000 description 4
- 235000015103 Malus silvestris Nutrition 0.000 description 4
- 239000000417 fungicide Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 231100000208 phytotoxic Toxicity 0.000 description 4
- 230000000885 phytotoxic effect Effects 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 150000003751 zinc Chemical class 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 4
- QRNATDQRFAUDKF-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate Chemical class NC(=S)SCCSC(N)=S QRNATDQRFAUDKF-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- 241001157813 Cercospora Species 0.000 description 3
- 240000008067 Cucumis sativus Species 0.000 description 3
- 241000221785 Erysiphales Species 0.000 description 3
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- UFMZWBIQTDUYBN-UHFFFAOYSA-N cobalt dinitrate Chemical compound [Co+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O UFMZWBIQTDUYBN-UHFFFAOYSA-N 0.000 description 3
- 229910001981 cobalt nitrate Inorganic materials 0.000 description 3
- 230000009918 complex formation Effects 0.000 description 3
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 3
- ZQURKOAMICBVAW-UHFFFAOYSA-N ethene;manganese Chemical group [Mn].C=C ZQURKOAMICBVAW-UHFFFAOYSA-N 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- DALUDRGQOYMVLD-UHFFFAOYSA-N iron manganese Chemical compound [Mn].[Fe] DALUDRGQOYMVLD-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- WJZHMLNIAZSFDO-UHFFFAOYSA-N manganese zinc Chemical compound [Mn].[Zn] WJZHMLNIAZSFDO-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical class C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 241000233622 Phytophthora infestans Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000010726 Vigna sinensis Nutrition 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 2
- 229940052810 complex b Drugs 0.000 description 2
- HPDFFVBPXCTEDN-UHFFFAOYSA-N copper manganese Chemical compound [Mn].[Cu] HPDFFVBPXCTEDN-UHFFFAOYSA-N 0.000 description 2
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 239000011790 ferrous sulphate Substances 0.000 description 2
- 235000003891 ferrous sulphate Nutrition 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- SURQXAFEQWPFPV-UHFFFAOYSA-L iron(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O SURQXAFEQWPFPV-UHFFFAOYSA-L 0.000 description 2
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 2
- 239000011702 manganese sulphate Substances 0.000 description 2
- 235000007079 manganese sulphate Nutrition 0.000 description 2
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000007873 sieving Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000013112 stability test Methods 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- MJVIZWIQHKRBPI-UHFFFAOYSA-N 1-(aziridin-1-yl)but-3-en-2-ol Chemical compound C=CC(O)CN1CC1 MJVIZWIQHKRBPI-UHFFFAOYSA-N 0.000 description 1
- CTTJWXVQRJUJQW-UHFFFAOYSA-N 2,2-dioctyl-3-sulfobutanedioic acid Chemical compound CCCCCCCCC(C(O)=O)(C(C(O)=O)S(O)(=O)=O)CCCCCCCC CTTJWXVQRJUJQW-UHFFFAOYSA-N 0.000 description 1
- JMZRZEXRYJUHEB-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;zinc Chemical compound [Zn].NC(=S)SCCSC(N)=S JMZRZEXRYJUHEB-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000000832 Ayote Nutrition 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 241000228438 Bipolaris maydis Species 0.000 description 1
- 241001465180 Botrytis Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 101710178035 Chorismate synthase 2 Proteins 0.000 description 1
- 241000688200 Cingulata Species 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 235000009849 Cucumis sativus Nutrition 0.000 description 1
- 241000219122 Cucurbita Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 1
- 101710152694 Cysteine synthase 2 Proteins 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241001191009 Gymnomyza Species 0.000 description 1
- 241000221557 Gymnosporangium Species 0.000 description 1
- 241000190714 Gymnosporangium clavipes Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 244000081841 Malus domestica Species 0.000 description 1
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 1
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 241000633856 Mycosphaerella pomi Species 0.000 description 1
- 241000190142 Neofusicoccum ribis Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000519856 Phyllosticta Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241001281805 Pseudoperonospora cubensis Species 0.000 description 1
- 235000004789 Rosa xanthina Nutrition 0.000 description 1
- 241000109329 Rosa xanthina Species 0.000 description 1
- 241000825108 Schizothyrium pomi Species 0.000 description 1
- 241001533598 Septoria Species 0.000 description 1
- 241000332749 Setosphaeria turcica Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 241000651397 Solitaria Species 0.000 description 1
- 241000143503 Stemphylium solani Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 241000221577 Uromyces appendiculatus Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 241000219977 Vigna Species 0.000 description 1
- 244000042327 Vigna sinensis Species 0.000 description 1
- 238000002083 X-ray spectrum Methods 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 235000021015 bananas Nutrition 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- MZZUATUOLXMCEY-UHFFFAOYSA-N cobalt manganese Chemical compound [Mn].[Co] MZZUATUOLXMCEY-UHFFFAOYSA-N 0.000 description 1
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 1
- 229940044175 cobalt sulfate Drugs 0.000 description 1
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- 229940076286 cupric acetate Drugs 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- XMVQMLUXHIIYLN-UHFFFAOYSA-L disodium dicarbamate Chemical compound [Na+].[Na+].C(N)([O-])=O.C(N)([O-])=O XMVQMLUXHIIYLN-UHFFFAOYSA-L 0.000 description 1
- ZDXLFJGIPWQALB-UHFFFAOYSA-M disodium;oxido(oxo)borane;chlorate Chemical compound [Na+].[Na+].[O-]B=O.[O-]Cl(=O)=O ZDXLFJGIPWQALB-UHFFFAOYSA-M 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229960000878 docusate sodium Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910001448 ferrous ion Inorganic materials 0.000 description 1
- 244000037666 field crops Species 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- CSRCNKZJIYKJOT-UHFFFAOYSA-N formaldehyde;naphthalene;sodium Chemical compound [Na].O=C.C1=CC=CC2=CC=CC=C21 CSRCNKZJIYKJOT-UHFFFAOYSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- YHGPYBQVSJBGHH-UHFFFAOYSA-H iron(3+);trisulfate;pentahydrate Chemical compound O.O.O.O.O.[Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O YHGPYBQVSJBGHH-UHFFFAOYSA-H 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229910000360 iron(III) sulfate Inorganic materials 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000011565 manganese chloride Substances 0.000 description 1
- 235000002867 manganese chloride Nutrition 0.000 description 1
- 229940099607 manganese chloride Drugs 0.000 description 1
- 229940099596 manganese sulfate Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000001338 necrotic effect Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000006069 physical mixture Substances 0.000 description 1
- 230000010152 pollination Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 235000015136 pumpkin Nutrition 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F13/00—Compounds containing elements of Groups 7 or 17 of the Periodic Table
- C07F13/005—Compounds without a metal-carbon linkage
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/12—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof containing a —O—CO—N< group, or a thio analogue thereof, neither directly attached to a ring nor the nitrogen atom being a member of a heterocyclic ring
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/12—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof containing a —O—CO—N< group, or a thio analogue thereof, neither directly attached to a ring nor the nitrogen atom being a member of a heterocyclic ring
- A01N47/14—Di-thio analogues thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Dentistry (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US108735A US3379610A (en) | 1961-05-09 | 1961-05-09 | Complex metal salts of manganese ethylenebisdithiocarbamate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1234704B true DE1234704B (de) | 1967-02-23 |
Family
ID=22323768
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER32644A Pending DE1234704B (de) | 1961-05-09 | 1962-05-05 | Verfahren zur Herstellung von komplexen Mangansalzen der AEthylenbisdithiocarbaminsaeure |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3379610A (enExample) |
| AT (2) | AT257267B (enExample) |
| BE (1) | BE617407A (enExample) |
| BR (1) | BR6237397D0 (enExample) |
| CH (1) | CH419715A (enExample) |
| CY (1) | CY452A (enExample) |
| DE (1) | DE1234704B (enExample) |
| DK (1) | DK105303C (enExample) |
| ES (1) | ES275497A1 (enExample) |
| FI (2) | FI40896B (enExample) |
| FR (1) | FR1326689A (enExample) |
| GB (1) | GB996264A (enExample) |
| MY (1) | MY6900065A (enExample) |
| NL (1) | NL277376A (enExample) |
| OA (1) | OA00075A (enExample) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2513853A1 (fr) * | 1981-05-04 | 1983-04-08 | Du Pont | Compositions fongicides aqueuses et leur preparation |
| WO2001072736A1 (en) | 2000-03-31 | 2001-10-04 | Kureha Kagaku Kogyo K.K. | Method for purification of cyclic ester |
| DE102007045920A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| EP2132989A2 (de) | 2005-06-09 | 2009-12-16 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2220940A2 (de) | 2003-10-10 | 2010-08-25 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2255649A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| WO2011006603A2 (de) | 2009-07-16 | 2011-01-20 | Bayer Cropscience Ag | Synergistische wirkstoffkombinationen mit phenyltriazolen |
| EP2356906A1 (de) | 2003-10-23 | 2011-08-17 | Bayer Cropscience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| WO2016202819A1 (en) | 2015-06-17 | 2016-12-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1618809B1 (de) * | 1961-05-09 | 1972-04-27 | Rohm & Haas | Verfahren zur Herstellung von Kupfer-Mangan-Komplexsalzen der Äthylenbisdithiocarbaminsäure und diese enthaltende fungizide Zubereitungen |
| GB1127171A (en) * | 1965-11-08 | 1968-09-11 | Robinson Bros Ltd | Ethylene bis dithiocarbamates and fungicidal compositions containing them |
| US3880900A (en) * | 1971-07-28 | 1975-04-29 | Denki Kogaku Kogyo K K | Process for preparing metal complex of alkylene bisdithiocarbamate |
| NL172325B (nl) * | 1972-07-19 | 1983-03-16 | Pennwalt Holland | Werkwijze ter bereiding van een mangaanethyleenbisdithiocarbamaatprodukt en werkwijze ter bereiding van een fungicide preparaat, dat het aldus bereide produkt bevat. |
| ZA757990B (en) * | 1975-01-30 | 1976-12-29 | Du Pont | Stabilized formulations of 2-alkoxyiminon-carbamoyl-2-cyanoacetamides |
| US4053612A (en) * | 1975-01-30 | 1977-10-11 | E. I. Du Pont De Nemours And Company | Stabilized formulations of 2-alkoxyimino-n-carbamoyl-2-cyanoacetamides |
| US4066760A (en) * | 1976-03-29 | 1978-01-03 | Kumiai Chemical Industries Ltd. | Agricultural and horticultural fungicidal compositions |
| US4243675A (en) * | 1978-10-16 | 1981-01-06 | The Dow Chemical Company | (Bis)dithiocarbamate) salts |
| US4394316A (en) * | 1980-09-11 | 1983-07-19 | Rohm And Haas Company | Copper modified mancozeb |
| HU187452B (en) * | 1982-04-20 | 1986-01-28 | Borsodi Vegyi Kombinat,Hu | Fungicides containing - as reagent - alkoxicarbonile ditiocarbamata and process for production of the reagent |
| MA19798A1 (fr) * | 1982-06-08 | 1983-12-31 | Novartis Ag | Agent de lutte contre les maladies des plantes ; sa preparation et son application a la protection des plantes . |
| FR2656198A1 (fr) * | 1989-12-22 | 1991-06-28 | Pennwalt France Sa | Compositions fongicides a base de mancozebe et d'huile minerale et leur application a l'agriculture. |
| US5021594A (en) * | 1990-03-12 | 1991-06-04 | Pennwalt France S.A. | Enhanced reduction and inhibition of ETU content in alkylenebisdithiocarbamates |
| US5073647A (en) * | 1990-04-24 | 1991-12-17 | Pennwalt France S.A. | Reduction and inhibition of etu content in alkylenebisdithiocarbamates |
| US5100915A (en) * | 1990-06-06 | 1992-03-31 | Pennwalt France S.A. | Reduction and inhibition of etu content in alkylenebisdithiocarbamates |
| US5643852A (en) * | 1993-01-13 | 1997-07-01 | North Carolina State University | Fungicidal compositions for the enhancement of turf quality |
| TW340033B (en) * | 1993-09-24 | 1998-09-11 | Basf Ag | Fungicidal mixtures |
| US5599804A (en) | 1995-04-03 | 1997-02-04 | Rhone-Poulenc, Inc. | Fungicidal compositions for the enhancement of turf quality |
| BR9610003A (pt) * | 1995-08-17 | 1999-07-06 | Basf Ag | Mistura fungicida processo para controlar fungos nocivos e uso de um composto |
| EA001210B1 (ru) | 1996-04-26 | 2000-12-25 | Басф Акциенгезельшафт | Фунгицидные смеси |
| EP0900014A1 (de) * | 1996-04-26 | 1999-03-10 | Basf Aktiengesellschaft | Fungizide mischungen |
| US6228883B1 (en) | 1997-09-18 | 2001-05-08 | Gustafson, Inc. | Seed treatment fungicides for control of plant diseases |
| DE10049804A1 (de) * | 2000-10-09 | 2002-04-18 | Bayer Ag | Wirkstoffkombinationen mit fungiziden und akariziden Eigenschaften |
| US20040039039A1 (en) * | 2001-01-16 | 2004-02-26 | Arne Ptock | Fungicidal mixtures |
| PE20060796A1 (es) | 2004-11-25 | 2006-09-29 | Basf Ag | Procedimiento para intensificar la eficiencia de etaboxam |
| DE102005015677A1 (de) | 2005-04-06 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| WO2007093535A1 (en) * | 2006-02-14 | 2007-08-23 | Basf Se | A method of using a micronutrient as safener for a triazole for controlling harmful fungi |
| EP2091331A2 (en) | 2006-09-18 | 2009-08-26 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| CA2665598A1 (en) * | 2006-10-04 | 2008-04-17 | Dow Agrosciences Llc | Bisdithiocarbamate fungicide stabilization |
| EP2164323A1 (en) | 2006-12-15 | 2010-03-24 | Rohm and Haas Company | Mixtures comprising 1-methylcyclopropene |
| BR122019020351B1 (pt) | 2007-02-06 | 2020-08-18 | Basf Se | Misturas, composição pesticida, método para controlar fungos nocivos fitopatogênicos, método para proteger plantas do ataque ou infestação pelos insetos, acarídeos ou nematôdeos e método para proteger semente |
| EP2392662A3 (en) | 2007-04-23 | 2012-03-14 | Basf Se | Plant productivity enhancement by combining chemical agents with transgenic modifications |
| US8748345B2 (en) * | 2007-05-10 | 2014-06-10 | Tessenderlo Kerley Inc. | Method and composition for improving turfgrass |
| JP2010540495A (ja) | 2007-09-26 | 2010-12-24 | ビーエーエスエフ ソシエタス・ヨーロピア | ボスカリド及びクロロタロニルを含む三成分殺菌組成物 |
| WO2010108507A2 (de) | 2009-03-25 | 2010-09-30 | Bayer Cropscience Ag | Synergistische wirkstoffkombinationen |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| PL2517562T3 (pl) * | 2009-12-22 | 2017-07-31 | Mitsui Chemicals Agro, Inc. | Kompozycja do zwalczania chorób roślin i sposób zwalczania chorób roślin poprzez zastosowanie kompozycji |
| EA201300731A1 (ru) | 2010-12-20 | 2014-01-30 | Басф Се | Пестицидно активные смеси, которые содержат соединения пиразола |
| EP2481284A3 (en) | 2011-01-27 | 2012-10-17 | Basf Se | Pesticidal mixtures |
| PL2688405T3 (pl) | 2011-03-23 | 2018-05-30 | Basf Se | Kompozycje zawierające polimerowe, jonowe związki zawierające grupy imidazoliowe |
| MX2014001866A (es) | 2011-09-02 | 2015-04-16 | Basf Se | Mezclas agricolas que comprenden compuestos de arilquinazolinona. |
| CN102657162B (zh) * | 2012-04-20 | 2014-07-30 | 关慧明 | 一种用于降低氨基甲酸盐类农药副作用的农药助剂 |
| UA114913C2 (uk) | 2012-06-20 | 2017-08-28 | Басф Се | Піразольна сполука і пестицидні суміші, які містять піразольну сполуку |
| US20150257383A1 (en) | 2012-10-12 | 2015-09-17 | Basf Se | Method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| PL2934147T3 (pl) | 2012-12-20 | 2020-06-29 | BASF Agro B.V. | Kompozycje zawierające związki triazolowe |
| MX352622B (es) | 2012-12-31 | 2017-12-01 | Dow Agrosciences Llc | Composiciones y métodos para regular la tasa de producción de ebis a partir de fungicidas ditiocarbamato. |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| WO2015036058A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| CA2963446A1 (en) | 2014-10-24 | 2016-04-28 | Basf Se | Nonampholytic, quaternizable and water-soluble polymers for modifying the surface charge of solid particles |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2861091A (en) * | 1957-04-05 | 1958-11-18 | Tennesse Corp | Manganous dimethyldithiocarbamate stabilized with zinc dimethyldithiocarbamate |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT210433B (de) * | 1958-12-02 | 1960-08-10 | Albert Ag Chem Werke | Verfahren zur Herstellung von Salzen der β-Aminoäthyldithiocarbaminsäure mit Zink, Mangan oder Gemischen beider Metalle |
-
0
- NL NL277376D patent/NL277376A/xx unknown
- BE BE617407D patent/BE617407A/xx unknown
-
1961
- 1961-05-09 US US108735A patent/US3379610A/en not_active Expired - Lifetime
- 1961-12-18 GB GB45319/61A patent/GB996264A/en not_active Expired
-
1962
- 1962-03-15 ES ES0275497A patent/ES275497A1/es not_active Expired
- 1962-03-23 AT AT237062A patent/AT257267B/de active
- 1962-03-23 BR BR137397/62A patent/BR6237397D0/pt unknown
- 1962-03-23 AT AT632663A patent/AT243276B/de active
- 1962-03-30 FI FI0691/62A patent/FI40896B/fi active
- 1962-04-18 DK DK182262AA patent/DK105303C/da active
- 1962-05-05 DE DER32644A patent/DE1234704B/de active Pending
- 1962-05-07 FR FR896727A patent/FR1326689A/fr not_active Expired
- 1962-05-09 CH CH553262A patent/CH419715A/fr unknown
-
1964
- 1964-05-05 OA OA50095A patent/OA00075A/xx unknown
-
1967
- 1967-01-23 FI FI0185/67A patent/FI41083B/fi active
-
1968
- 1968-08-24 CY CY45268A patent/CY452A/xx unknown
-
1969
- 1969-12-31 MY MY196965A patent/MY6900065A/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2861091A (en) * | 1957-04-05 | 1958-11-18 | Tennesse Corp | Manganous dimethyldithiocarbamate stabilized with zinc dimethyldithiocarbamate |
Cited By (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2513853A1 (fr) * | 1981-05-04 | 1983-04-08 | Du Pont | Compositions fongicides aqueuses et leur preparation |
| WO2001072736A1 (en) | 2000-03-31 | 2001-10-04 | Kureha Kagaku Kogyo K.K. | Method for purification of cyclic ester |
| EP2220936A2 (de) | 2003-10-10 | 2010-08-25 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2220937A2 (de) | 2003-10-10 | 2010-08-25 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2220940A2 (de) | 2003-10-10 | 2010-08-25 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2220939A2 (de) | 2003-10-10 | 2010-08-25 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2220935A2 (de) | 2003-10-10 | 2010-08-25 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2220938A2 (de) | 2003-10-10 | 2010-08-25 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| US9844220B2 (en) | 2003-10-10 | 2017-12-19 | Fmc Corporation | Synergistic fungicidal active substance combinations |
| US9288988B2 (en) | 2003-10-10 | 2016-03-22 | Fmc Corporation | Synergistic fungicidal active substance combinations |
| EP2229815A2 (de) | 2003-10-10 | 2010-09-22 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| US9049867B2 (en) | 2003-10-10 | 2015-06-09 | Bayer Intellectual Property Gmbh | Synergistic fungicidal active substance combinations |
| US9006143B2 (en) | 2003-10-10 | 2015-04-14 | Bayer Intellectual Property Gmbh | Synergistic fungicidal active substance combinations |
| US8415274B2 (en) | 2003-10-10 | 2013-04-09 | Bayer Cropscience Ag | Synergistic fungicidal active substance combinations |
| EP2796043A1 (de) | 2003-10-23 | 2014-10-29 | Bayer CropScience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2364592A1 (de) | 2003-10-23 | 2011-09-14 | Bayer Cropscience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2356905A1 (de) | 2003-10-23 | 2011-08-17 | Bayer Cropscience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2356906A1 (de) | 2003-10-23 | 2011-08-17 | Bayer Cropscience AG | Synergistische fungizide Wirkstoffkombinationen |
| EP2255648A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2263463A1 (de) | 2005-06-09 | 2010-12-22 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255654A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255657A1 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255646A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255650A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255655A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255647A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255658A1 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255653A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255652A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255645A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255656A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2258198A1 (de) | 2005-06-09 | 2010-12-08 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2258196A2 (de) | 2005-06-09 | 2010-12-08 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2258197A1 (de) | 2005-06-09 | 2010-12-08 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2260710A1 (de) | 2005-06-09 | 2010-12-15 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2260711A2 (de) | 2005-06-09 | 2010-12-15 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2260709A1 (de) | 2005-06-09 | 2010-12-15 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255659A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2263462A1 (de) | 2005-06-09 | 2010-12-22 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2269460A1 (de) | 2005-06-09 | 2011-01-05 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2272369A1 (de) | 2005-06-09 | 2011-01-12 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2272368A1 (de) | 2005-06-09 | 2011-01-12 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2132989A2 (de) | 2005-06-09 | 2009-12-16 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2279664A1 (de) | 2005-06-09 | 2011-02-02 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255651A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255649A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2255644A2 (de) | 2005-06-09 | 2010-12-01 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2253210A1 (de) | 2005-06-09 | 2010-11-24 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2253212A1 (de) | 2005-06-09 | 2010-11-24 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2253211A1 (de) | 2005-06-09 | 2010-11-24 | Bayer CropScience AG | Wirkstoffkombinationen |
| EP2253213A1 (de) | 2005-06-09 | 2010-11-24 | Bayer CropScience AG | Wirkstoffkombinationen |
| DE102007045920A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| WO2011006603A2 (de) | 2009-07-16 | 2011-01-20 | Bayer Cropscience Ag | Synergistische wirkstoffkombinationen mit phenyltriazolen |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| WO2016202819A1 (en) | 2015-06-17 | 2016-12-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations |
Also Published As
| Publication number | Publication date |
|---|---|
| ES275497A1 (es) | 1962-09-16 |
| FI41083B (enExample) | 1969-04-30 |
| OA00075A (fr) | 1966-01-15 |
| NL277376A (enExample) | |
| AT257267B (de) | 1967-09-25 |
| CY452A (en) | 1968-08-24 |
| MY6900065A (en) | 1969-12-31 |
| DK105303C (da) | 1966-09-12 |
| GB996264A (en) | 1965-06-23 |
| BE617407A (enExample) | |
| CH419715A (fr) | 1966-08-31 |
| FR1326689A (fr) | 1963-05-10 |
| FI40896B (enExample) | 1969-03-31 |
| AT243276B (de) | 1965-11-10 |
| BR6237397D0 (pt) | 1973-06-28 |
| US3379610A (en) | 1968-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1234704B (de) | Verfahren zur Herstellung von komplexen Mangansalzen der AEthylenbisdithiocarbaminsaeure | |
| DE1567027B1 (de) | Unkrautvernichtungsmittel | |
| DE69010403T2 (de) | Pflanzenschutzmittel, Verfahren zu ihrer Herstellung und ihre Verwendung, insbesondere zur Bekämpfung von Rebenmehltau. | |
| DE2555730C3 (de) | 8-Oxychinolinat-Metall-dimethyldithiocarbamat-Komplexe, Verfahren zur Herstellung derselben sowie solche enthaltende antimikrobielle Mittel | |
| DE1567131A1 (de) | Herbizide Komposition und Verfahren zu ihrer Anwendung | |
| DE2811235A1 (de) | Verfahren zur herstellung von organischen duengemitteln | |
| DE1177407B (de) | Mittel zur Bekaempfung von Pflanzenrosterregern | |
| DE2120723A1 (de) | Metallkomplexe von Dithiobiuretderivaten und ihre Verwendung | |
| CH637266A5 (de) | Fungizidsuspension mit ultrabeschraenktem volumen. | |
| DE2748450C3 (de) | Neue Benzoyl-N'-trichloräthylidenhydrazine und neue fungizide Zubereitungen | |
| DE1098281B (de) | Fungicides Mittel | |
| DE69106015T2 (de) | Neue fungizide Imidazolkomplexe. | |
| DE1109444B (de) | Mittel zum Behandeln von Kulturpflanzen oder Saatgut u. dgl. zwecks Wachstums-steigerung und Bekaempfung von Pilzen und Bakterien | |
| DE2551282C3 (de) | Fungizide mit systemischer Wirkung | |
| DD263693A5 (de) | Mittel zur verstaerkung des fruchtansatzes und ertragssteigerung der suess- und sauerkirschen sowie verfahren zur verwendung des mittels | |
| DE2165705A1 (de) | Verfahren und Mittel zur Behebung des Magnesiummangels bei Pflanzen | |
| DE1468511C (de) | Metall-Mangan-Mischsalze der Äthylenbisdithiocarbaminsäure | |
| AT329925B (de) | Systemisch wirkende fungizide | |
| DE973978C (de) | Verfahren zur Steigerung der Ernteertraege von Kulturpflanzen | |
| DE1567027C (de) | Unkrautvernichtungsmittel | |
| DE875367C (de) | Zur direkten Blattduengung mittels stickstoffhaltigen Pflanzennaehrstoffs geeignetes Duengemittelgemisch | |
| DE1150836B (de) | Organische Eisenammoniumarsenate enthaltende Fungizide | |
| CH445188A (de) | Mittel zur Eisenzufuhr an Pflanzen | |
| DD152905A1 (de) | Mittel zur ertragssteigerung bei dikotylen gemuesepflanzen | |
| DE2753426A1 (de) | Milbenbekaempfungsmittel |