DE1180759B - Verfahren zur Herstellung von bicyclischen ª€-Lactonen - Google Patents
Verfahren zur Herstellung von bicyclischen ª€-LactonenInfo
- Publication number
- DE1180759B DE1180759B DED28339A DED0028339A DE1180759B DE 1180759 B DE1180759 B DE 1180759B DE D28339 A DED28339 A DE D28339A DE D0028339 A DED0028339 A DE D0028339A DE 1180759 B DE1180759 B DE 1180759B
- Authority
- DE
- Germany
- Prior art keywords
- distilled
- lactone
- acid
- general formula
- unsaturated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 11
- 125000002619 bicyclic group Chemical group 0.000 title claims description 7
- 150000002596 lactones Chemical class 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 9
- 238000009835 boiling Methods 0.000 claims description 8
- 239000007868 Raney catalyst Substances 0.000 claims description 7
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 7
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- 229960000583 acetic acid Drugs 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- -1 cycloalkene carboxylic acid Chemical class 0.000 claims description 5
- 239000012362 glacial acetic acid Substances 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000012230 colorless oil Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 claims description 3
- 235000019341 magnesium sulphate Nutrition 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- 239000001632 sodium acetate Substances 0.000 claims description 3
- 235000017281 sodium acetate Nutrition 0.000 claims description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-N sodium;hydron;carbonate Chemical compound [Na+].OC(O)=O UIIMBOGNXHQVGW-UHFFFAOYSA-N 0.000 claims description 3
- 238000005684 Liebig rearrangement reaction Methods 0.000 claims description 2
- 229930040373 Paraformaldehyde Natural products 0.000 claims description 2
- 229920002866 paraformaldehyde Polymers 0.000 claims description 2
- BUBVLQDEIIUIQG-UHFFFAOYSA-N 3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one Chemical compound C=1C=CC=CC=1COC1C(OCC=2C=CC=CC=2)C(OCC=2C=CC=CC=2)C(=O)OC1COCC1=CC=CC=C1 BUBVLQDEIIUIQG-UHFFFAOYSA-N 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 235000019260 propionic acid Nutrition 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 241000238631 Hexapoda Species 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241000254032 Acrididae Species 0.000 description 2
- 241001674044 Blattodea Species 0.000 description 2
- NAXKFVIRJICPAO-LHNWDKRHSA-N [(1R,3S,4R,6R,7R,9S,10S,12R,13S,15S,16R,18S,19S,21S,22S,24S,25S,27S,28R,30R,31R,33S,34S,36R,37R,39R,40S,42R,44R,46S,48S,50R,52S,54S,56S)-46,48,50,52,54,56-hexakis(hydroxymethyl)-2,8,14,20,26,32,38,43,45,47,49,51,53,55-tetradecaoxa-5,11,17,23,29,35,41-heptathiapentadecacyclo[37.3.2.23,7.29,13.215,19.221,25.227,31.233,37.04,6.010,12.016,18.022,24.028,30.034,36.040,42]hexapentacontan-44-yl]methanol Chemical compound OC[C@H]1O[C@H]2O[C@H]3[C@H](CO)O[C@H](O[C@H]4[C@H](CO)O[C@H](O[C@@H]5[C@@H](CO)O[C@H](O[C@H]6[C@H](CO)O[C@H](O[C@H]7[C@H](CO)O[C@@H](O[C@H]8[C@H](CO)O[C@@H](O[C@@H]1[C@@H]1S[C@@H]21)[C@@H]1S[C@H]81)[C@H]1S[C@@H]71)[C@H]1S[C@H]61)[C@H]1S[C@@H]51)[C@H]1S[C@@H]41)[C@H]1S[C@H]31 NAXKFVIRJICPAO-LHNWDKRHSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- KDFBPHXESBPHTK-UHFFFAOYSA-N 2-(cyclohexen-1-yl)acetic acid Chemical compound OC(=O)CC1=CCCCC1 KDFBPHXESBPHTK-UHFFFAOYSA-N 0.000 description 1
- 241000238658 Blattella Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- LYEFRAMOOLOUKA-RBXMUDONSA-N Iridomyrmecin Chemical compound [C@@H]1([C@@H](C(=O)OC2)C)[C@H]2[C@@H](C)CC1 LYEFRAMOOLOUKA-RBXMUDONSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000257229 Musca <genus> Species 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241000254086 Tribolium <beetle> Species 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 125000000457 gamma-lactone group Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- LYEFRAMOOLOUKA-UHFFFAOYSA-N isoepiiridomyrmecin Natural products C1OC(=O)C(C)C2C1C(C)CC2 LYEFRAMOOLOUKA-UHFFFAOYSA-N 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 238000007273 lactonization reaction Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/94—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems condensed with rings other than six-membered or with ring systems containing such rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/76—Benzo[c]pyrans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE579766D BE579766A (enExample) | 1958-06-18 | ||
| NL240332D NL240332A (enExample) | 1958-06-18 | ||
| NL109180D NL109180C (enExample) | 1958-06-18 | ||
| DED28339A DE1180759B (de) | 1958-06-18 | 1958-06-18 | Verfahren zur Herstellung von bicyclischen ª€-Lactonen |
| DED29247A DE1193512B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von bicyclischen delta-Lactonen |
| DED29246A DE1194423B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von alpha-(2'-Oxymethyl-3'-methyl-cyclopentyl-1')-propionsaeurelacton (Iridomyrmecin) |
| DED29248A DE1145179B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von bicyclischen Laktonen |
| CH7455659A CH394700A (fr) | 1958-06-18 | 1959-06-17 | Composition insecticide |
| FR797864A FR1430853A (fr) | 1958-06-18 | 1959-06-18 | Nouveaux composés du type des lactones bicycliques à propriétés insecticides |
| GB20971/59A GB864925A (en) | 1958-06-18 | 1959-06-18 | Novel compounds of the lactone type |
| GB36401/59A GB906019A (en) | 1958-06-18 | 1959-10-27 | Process for preparing novel compounds of the lactone type |
| GB36402/59A GB864926A (en) | 1958-06-18 | 1959-10-27 | Process for preparing novel compounds of the lactone type |
| US849187A US3089877A (en) | 1958-06-18 | 1959-10-28 | Process for the production of iridomyrmecin and related compounds |
| FR808796A FR86803E (fr) | 1958-06-18 | 1959-10-29 | Nouveaux composés du type des lactones bicycliques à propriétés insecticides |
| FR808795A FR86802E (fr) | 1958-06-18 | 1959-10-29 | Nouveaux composés du type des lactones bicycliques à propriétés insecticides |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED28339A DE1180759B (de) | 1958-06-18 | 1958-06-18 | Verfahren zur Herstellung von bicyclischen ª€-Lactonen |
| DED29246A DE1194423B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von alpha-(2'-Oxymethyl-3'-methyl-cyclopentyl-1')-propionsaeurelacton (Iridomyrmecin) |
| DED29247A DE1193512B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von bicyclischen delta-Lactonen |
| DED29248A DE1145179B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von bicyclischen Laktonen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1180759B true DE1180759B (de) | 1964-11-05 |
Family
ID=27436747
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED28339A Pending DE1180759B (de) | 1958-06-18 | 1958-06-18 | Verfahren zur Herstellung von bicyclischen ª€-Lactonen |
| DED29247A Pending DE1193512B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von bicyclischen delta-Lactonen |
| DED29248A Pending DE1145179B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von bicyclischen Laktonen |
| DED29246A Pending DE1194423B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von alpha-(2'-Oxymethyl-3'-methyl-cyclopentyl-1')-propionsaeurelacton (Iridomyrmecin) |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED29247A Pending DE1193512B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von bicyclischen delta-Lactonen |
| DED29248A Pending DE1145179B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von bicyclischen Laktonen |
| DED29246A Pending DE1194423B (de) | 1958-06-18 | 1958-10-29 | Verfahren zur Herstellung von alpha-(2'-Oxymethyl-3'-methyl-cyclopentyl-1')-propionsaeurelacton (Iridomyrmecin) |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3089877A (enExample) |
| BE (1) | BE579766A (enExample) |
| CH (1) | CH394700A (enExample) |
| DE (4) | DE1180759B (enExample) |
| GB (3) | GB864925A (enExample) |
| NL (2) | NL240332A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4772728A (en) * | 1985-08-19 | 1988-09-20 | Angus Chemical Company | Method for making bicycle lactones from beta, gamma unsaturated cyclic nitriles |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1617555C3 (de) * | 1966-04-19 | 1974-09-19 | Kali-Chemie Ag, 3000 Hannover | Verfahren zur Isolierung von therapeutisch wertvollen Isovaleriansäureestern aus Valeriana- und Kentranthus-Extrakten |
| US3435053A (en) * | 1966-06-06 | 1969-03-25 | Upjohn Co | Cyclopenta(b)pyrans |
| US3524867A (en) * | 1966-06-06 | 1970-08-18 | Upjohn Co | Process for producing cyclopenta (b)pyrans |
| US3755118A (en) * | 1970-01-05 | 1973-08-28 | J Partridge | Process for preparing loganin and analogs thereof |
| DE3030477C2 (de) * | 1980-08-12 | 1986-10-16 | Dr. Willmar Schwabe GmbH & Co, 7500 Karlsruhe | Iridoid-Derivate, Verfahren zu ihrer Herstellung und deren Verwendung |
| US4511726A (en) * | 1981-12-24 | 1985-04-16 | Sumitomo Chemical Company, Limited | Production method of an insect pheromone |
| US4663346A (en) * | 1984-05-30 | 1987-05-05 | Angus Chemical Company | Insect repellent |
| US4869896A (en) * | 1984-05-30 | 1989-09-26 | Angus Chemical Company | Potentiated insect repellent composition and method |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL36839C (enExample) * | 1932-08-23 | |||
| US2542965A (en) * | 1949-02-25 | 1951-02-20 | Rohm & Haas | Preparation of dihydrocoumarins |
| FR1237103A (fr) * | 1952-06-20 | 1960-07-29 | Basf Ag | Procédé de préparation d'acides isochromanylacétiques et de leurs dérivés |
-
0
- BE BE579766D patent/BE579766A/xx unknown
- NL NL109180D patent/NL109180C/xx active
- NL NL240332D patent/NL240332A/xx unknown
-
1958
- 1958-06-18 DE DED28339A patent/DE1180759B/de active Pending
- 1958-10-29 DE DED29247A patent/DE1193512B/de active Pending
- 1958-10-29 DE DED29248A patent/DE1145179B/de active Pending
- 1958-10-29 DE DED29246A patent/DE1194423B/de active Pending
-
1959
- 1959-06-17 CH CH7455659A patent/CH394700A/fr unknown
- 1959-06-18 GB GB20971/59A patent/GB864925A/en not_active Expired
- 1959-10-27 GB GB36401/59A patent/GB906019A/en not_active Expired
- 1959-10-27 GB GB36402/59A patent/GB864926A/en not_active Expired
- 1959-10-28 US US849187A patent/US3089877A/en not_active Expired - Lifetime
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4772728A (en) * | 1985-08-19 | 1988-09-20 | Angus Chemical Company | Method for making bicycle lactones from beta, gamma unsaturated cyclic nitriles |
Also Published As
| Publication number | Publication date |
|---|---|
| NL240332A (enExample) | |
| GB864926A (en) | 1961-04-12 |
| DE1145179B (de) | 1963-03-14 |
| US3089877A (en) | 1963-05-14 |
| CH394700A (fr) | 1965-06-30 |
| BE579766A (enExample) | |
| NL109180C (enExample) | |
| GB906019A (en) | 1962-09-19 |
| DE1193512B (de) | 1965-05-26 |
| DE1194423B (de) | 1965-06-10 |
| GB864925A (en) | 1961-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1180759B (de) | Verfahren zur Herstellung von bicyclischen ª€-Lactonen | |
| DE1668603B2 (de) | Substituierte Cyclopropancarbonsäureester und Verfahren zu ihrer Herstellung | |
| DE1468529B2 (de) | Rechtsdrehendes !,S-Dioxo^-ir-carboxyäthyl)-7aß-methyl-5,6,7,7a-tetrahydroindan und Verfahren zu seiner Her- | |
| DE1618925B1 (de) | Cyclopropancarbonsäure-xyclopentenolonester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende insektizide Mittel | |
| DE574838C (de) | Verfahren zur Darstellung von cyclischen Glykolen und ihren Derivaten bzw. von Ketonen | |
| DE2941211A1 (de) | Verfahren zum cyclisieren von (gamma) - chlorcarbonsaeureestern | |
| DE2207098A1 (de) | Verfahren zur herstellung von 2,5-dimethyl-furan-3-carbon-saeureestern | |
| DE2263880C3 (de) | Hemisuccinate von dl-, d- oder 1-AUethrolon sowie deren Ephedrinsalze und Verfahren zur Aufspaltung von dl-Allethrolon | |
| DE1154463B (de) | Verfahren zur Herstellung des 2-Allyl-3-methyl-2-Cyclopentenyl-1-on-esters der 2, 2-Dichlor-3-phenyl-cyclopropan-Carbonsaeure mit insektizider Wirkung | |
| DE2535766A1 (de) | Verfahren zur Herstellung von racemischem Allethrolon | |
| DE1184774B (de) | Verfahren zur Herstellung von bicyclischen gamma-Lactonen | |
| DE2029043B2 (de) | 5-Benzyl-3-furylmethyl-cis-3,3-dimethyl-2-(2'-oxo-3'-X-cyclopentylidenmethyl)-cyclopropan-1-carboxylate, Verfahren zu deren Herstellung und insecticide Mittel mit einem Gehalt dieser Verbindungen | |
| DE1543804C (de) | Furylmethylalkohole und Verfahren zu ihrer Herstellung | |
| DE1468817C3 (de) | Verfahren zur Herstellung von Bicycle- [2,2,2] -okt-2-en-l-carbonsäuren und deren Estern | |
| DE749146C (de) | Verfahren zur Herstellung von ªŠ-Oxycarbonsaeuren | |
| DE965398C (de) | Verfahren zur Herstellung von aliphatischen Dicarbonsaeuregemischen durch Behandeln hoehermolekularer aliphatischer Monocarbonsaeuren mit Salpetersaeure | |
| DE1923822C (de) | Cyclopropancarbonsaureester | |
| DE1142595B (de) | Verfahren zur Herstellung von 4-(2,6,6-Trimethyl-cyclohexen-(1)-yl)-2-methylbuten-(3)-al-(1) | |
| DE837700C (de) | Verfahren zur Herstellung von Furanderivaten | |
| DE2016597C (de) | Cyclopropancarbonsäureester und ihre Verwendung als Insektizide | |
| DE2413969A1 (de) | Cis-chrysanthemumsaeure-3,4,5,6-tetrahydrophthalimidomethylester, verfahren zu deren herstellung und diese verbindungen enthaltende insecticide zubereitungen | |
| DE2649531A1 (de) | Verfahren zur herstellung von 2-(2,2-dihalogenvinyl)-cyclopropancarbonsaeuren | |
| DE1468928A1 (de) | Verfahren zur Herstellung von substituierten gamma-Lactonen | |
| DE1137256B (de) | Insektizides Mittel | |
| DE1288612B (de) | Verfahren zur Herstellung von substituierten Tetrahydrofuranen bzw. Tetrahydropyranen |