DE1153357B - Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen - Google Patents
Verfahren zur Herstellung von AzidobenzolsulfonylharnstoffenInfo
- Publication number
- DE1153357B DE1153357B DEF34487A DEF0034487A DE1153357B DE 1153357 B DE1153357 B DE 1153357B DE F34487 A DEF34487 A DE F34487A DE F0034487 A DEF0034487 A DE F0034487A DE 1153357 B DE1153357 B DE 1153357B
- Authority
- DE
- Germany
- Prior art keywords
- formula
- amines
- compounds
- radical
- benzenesulfonyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 5
- -1 acyclic hydrocarbon radical Chemical class 0.000 claims description 40
- 150000003839 salts Chemical class 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 13
- 235000013877 carbamide Nutrition 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 12
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 8
- 150000003672 ureas Chemical class 0.000 claims description 8
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical class NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 claims description 7
- 239000012948 isocyanate Substances 0.000 claims description 7
- 150000002513 isocyanates Chemical class 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 239000004202 carbamide Substances 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 150000002357 guanidines Chemical class 0.000 claims description 4
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 4
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 claims description 2
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical class OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 claims description 2
- JOMVGRRCEIJQFK-UHFFFAOYSA-N benzenesulfonylcarbamothioic s-acid Chemical class OC(=S)NS(=O)(=O)C1=CC=CC=C1 JOMVGRRCEIJQFK-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 150000001989 diazonium salts Chemical class 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea group Chemical group NC(=S)N UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 239000000344 soap Substances 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 15
- 238000001953 recrystallisation Methods 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 11
- 238000000354 decomposition reaction Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000000155 melt Substances 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 229910021529 ammonia Inorganic materials 0.000 description 7
- 239000008280 blood Substances 0.000 description 7
- 210000004369 blood Anatomy 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000003610 charcoal Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- KDKAGBBDVWHAOD-UHFFFAOYSA-N 1-(4-azidophenyl)sulfonyl-3-(2-methylpropyl)urea Chemical compound N(=[N+]=[N-])C1=CC=C(C=C1)S(=O)(=O)NC(=O)NCC(C)C KDKAGBBDVWHAOD-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 3
- 150000001714 carbamic acid halides Chemical class 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QYOILASCLNTXHM-UHFFFAOYSA-N 1-(4-azidophenyl)sulfonyl-3-butylurea Chemical compound N(=[N+]=[N-])C1=CC=C(C=C1)S(=O)(=O)NC(=O)NCCCC QYOILASCLNTXHM-UHFFFAOYSA-N 0.000 description 2
- NNZVKALEGZPYKL-UHFFFAOYSA-N 1-isocyanato-2-methylpropane Chemical compound CC(C)CN=C=O NNZVKALEGZPYKL-UHFFFAOYSA-N 0.000 description 2
- CFNOYMBYJXNTSH-UHFFFAOYSA-N 2-azidobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1N=[N+]=[N-] CFNOYMBYJXNTSH-UHFFFAOYSA-N 0.000 description 2
- RLLBDYRUEHTODT-UHFFFAOYSA-N 3-azidobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(N=[N+]=[N-])=C1 RLLBDYRUEHTODT-UHFFFAOYSA-N 0.000 description 2
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 2
- KSMVBYPXNKCPAJ-UHFFFAOYSA-N 4-Methylcyclohexylamine Chemical compound CC1CCC(N)CC1 KSMVBYPXNKCPAJ-UHFFFAOYSA-N 0.000 description 2
- UZEFHQIOSJWWSB-UHFFFAOYSA-N 4-azidobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(N=[N+]=[N-])C=C1 UZEFHQIOSJWWSB-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003472 antidiabetic agent Substances 0.000 description 2
- 229940125708 antidiabetic agent Drugs 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 2
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VDUYDMJCLBXKNB-UHFFFAOYSA-N methyl N-(4-azidophenyl)sulfonylcarbamate Chemical compound COC(NS(=O)(=O)C1=CC=C(C=C1)N=[N+]=[N-])=O VDUYDMJCLBXKNB-UHFFFAOYSA-N 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- QFUSOYKIDBRREL-NSCUHMNNSA-N (e)-but-2-en-1-amine Chemical compound C\C=C\CN QFUSOYKIDBRREL-NSCUHMNNSA-N 0.000 description 1
- ZBOVQUMGJGMNLW-UHFFFAOYSA-N 1-(4-azidophenyl)sulfonyl-3-cycloheptylurea Chemical compound N(=[N+]=[N-])C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCCC1 ZBOVQUMGJGMNLW-UHFFFAOYSA-N 0.000 description 1
- ILZWGJVEYVEOIB-UHFFFAOYSA-N 1-(4-azidophenyl)sulfonyl-3-cyclohexylurea Chemical compound N(=[N+]=[N-])C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 ILZWGJVEYVEOIB-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical class CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- BRSRNTJGTDYRFT-UHFFFAOYSA-N 2-(benzenesulfonyl)guanidine Chemical class NC(N)=NS(=O)(=O)C1=CC=CC=C1 BRSRNTJGTDYRFT-UHFFFAOYSA-N 0.000 description 1
- PHDUUMRDIHMMNC-UHFFFAOYSA-N 2-azidobenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1N=[N+]=[N-] PHDUUMRDIHMMNC-UHFFFAOYSA-N 0.000 description 1
- YCMLQMDWSXFTIF-UHFFFAOYSA-N 2-methylbenzenesulfonimidic acid Chemical compound CC1=CC=CC=C1S(N)(=O)=O YCMLQMDWSXFTIF-UHFFFAOYSA-N 0.000 description 1
- SOYBEXQHNURCGE-UHFFFAOYSA-N 3-ethoxypropan-1-amine Chemical compound CCOCCCN SOYBEXQHNURCGE-UHFFFAOYSA-N 0.000 description 1
- YUANZDIYFLGXAB-UHFFFAOYSA-N 3-ethylsulfanylpropan-1-amine Chemical compound CCSCCCN YUANZDIYFLGXAB-UHFFFAOYSA-N 0.000 description 1
- KKYSBGWCYXYOHA-UHFFFAOYSA-N 3-methylthiopropylamine Chemical compound CSCCCN KKYSBGWCYXYOHA-UHFFFAOYSA-N 0.000 description 1
- YUUFAJOXLZUDJG-UHFFFAOYSA-N 4-methoxybutan-1-amine Chemical compound COCCCCN YUUFAJOXLZUDJG-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 1
- WJYIASZWHGOTOU-UHFFFAOYSA-N Heptylamine Chemical class CCCCCCCN WJYIASZWHGOTOU-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 150000008331 benzenesulfonamides Chemical class 0.000 description 1
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- VDTNNGKXZGSZIP-UHFFFAOYSA-N carbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VDTNNGKXZGSZIP-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- PSVJDFLPZZXFDU-UHFFFAOYSA-N cyclohexen-1-amine Chemical compound NC1=CCCCC1 PSVJDFLPZZXFDU-UHFFFAOYSA-N 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- CZALJDQHONFVFU-UHFFFAOYSA-N isocyanatocyclopentane Chemical compound O=C=NC1CCCC1 CZALJDQHONFVFU-UHFFFAOYSA-N 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000008164 mustard oil Substances 0.000 description 1
- AGVKXDPPPSLISR-UHFFFAOYSA-N n-ethylcyclohexanamine Chemical compound CCNC1CCCCC1 AGVKXDPPPSLISR-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical class CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- XWGJFPHUCFXLBL-UHFFFAOYSA-M rongalite Chemical compound [Na+].OCS([O-])=O XWGJFPHUCFXLBL-UHFFFAOYSA-M 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/58—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE620550D BE620550A (Direct) | 1961-07-21 | ||
| NL122708D NL122708C (Direct) | 1961-07-21 | ||
| DEF34487A DE1153357B (de) | 1961-07-21 | 1961-07-21 | Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen |
| US210539A US3207766A (en) | 1961-07-21 | 1962-07-17 | New azido-benzenesulfonyl ureas and process for their manufacture |
| DK375063AA DK102904C (da) | 1961-07-21 | 1962-07-18 | Fremgangsmåde til fremstilling af azidobenzensulfonyl-urinstoffer eller deres salte. |
| DK375263AA DK107156C (da) | 1961-07-21 | 1962-07-18 | Fremgangsmåde til fremstilling af azidobenzensulfonyl-urinstoffer eller deres salte. |
| DK375463AA DK102855C (da) | 1961-07-21 | 1962-07-18 | Fremgangsmåde til fremstilling azido-benzensulfonyl-urinstoffer eller deres salte. |
| DK375363AA DK102854C (da) | 1961-07-21 | 1962-07-18 | Fremgangsmåde til fremstilling af azido-benzensulfonyl-urinstoffer eller deres salte. |
| DK375163AA DK102905C (da) | 1961-07-21 | 1962-07-18 | Fremgangsmåde til fremstilling af azidobenzensulfonyl-urinstoffer eller deres salte. |
| CH61367A CH459177A (de) | 1961-07-21 | 1962-07-19 | Verfahren zur Herstellung von neuen Azidobenzolsulfonylharnstoffen |
| CH61567A CH441277A (de) | 1961-07-21 | 1962-07-19 | Verfahren zur Herstellung von neuen Azidobenzolsulfonylharnstoffen |
| CH872162A CH429693A (de) | 1961-07-21 | 1962-07-19 | Verfahren zur Herstellung von neuen Azidobenzolsulfonylharnstoffen |
| CH61467A CH438265A (de) | 1961-07-21 | 1962-07-19 | Verfahren zur Herstellung von neuen Azidobenzolsulfonylharnstoffen |
| FR904707A FR1330400A (fr) | 1961-07-21 | 1962-07-21 | Nouvelles azidobenzènesulfonyl-urées et leur préparation |
| GB28304/62A GB1002650A (en) | 1961-07-21 | 1962-07-23 | New azido-benzenesulphonyl ureas, a process for their manufacture and pharmaceutical preparations containing them |
| FR912913A FR2096M (fr) | 1961-07-21 | 1962-10-20 | Médicament contenant une sulfonyl-urée hypoglycémiante. |
| FR912914A FR2097M (fr) | 1961-07-21 | 1962-10-20 | Médicament contenant une sulfonyl-urée. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF34487A DE1153357B (de) | 1961-07-21 | 1961-07-21 | Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1153357B true DE1153357B (de) | 1963-08-29 |
Family
ID=7095572
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF34487A Pending DE1153357B (de) | 1961-07-21 | 1961-07-21 | Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3207766A (Direct) |
| BE (1) | BE620550A (Direct) |
| CH (4) | CH459177A (Direct) |
| DE (1) | DE1153357B (Direct) |
| DK (5) | DK102855C (Direct) |
| FR (2) | FR2096M (Direct) |
| GB (1) | GB1002650A (Direct) |
| NL (1) | NL122708C (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1179200B (de) * | 1960-01-26 | 1964-10-08 | Hoechst Ag | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-methyl-cyclohexylharnstoffen |
| US7750103B2 (en) * | 2006-09-08 | 2010-07-06 | The University Of Massachusetts | Cyclooctene monomers and polymers, and water purification articles and methods utilizing them |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2254191A (en) * | 1940-08-06 | 1941-08-26 | American Cyanamid Co | P-azidobenzene compounds |
| US2907692A (en) * | 1953-02-11 | 1959-10-06 | Boehringer & Soehne Gmbh | Composition for treating diabetes and a process of administering same |
| US2977375A (en) * | 1953-02-11 | 1961-03-28 | Boehringer & Soehne Gmbh | Process of manufacturing n-sulphanilyl ureas |
| US2975212A (en) * | 1956-05-26 | 1961-03-14 | Hoechst Ag | New sulfonyl-ureas and process for their preparation |
| US2955073A (en) * | 1958-06-02 | 1960-10-04 | Burroughs Wellcome Co | Method of treating febrile convulsions |
| US3030388A (en) * | 1958-06-23 | 1962-04-17 | Parke Davis & Co | Amino acid compounds and methods for producing the same |
| US2974166A (en) * | 1959-09-15 | 1961-03-07 | Hoffmann La Roche | Certain 1-arylsulfonyl-3-(cis-2-decalyl)ureas |
| US3004889A (en) * | 1960-05-16 | 1961-10-17 | Bristol Myers Co | Cyclobutane analgesics |
-
0
- BE BE620550D patent/BE620550A/xx unknown
- NL NL122708D patent/NL122708C/xx active
-
1961
- 1961-07-21 DE DEF34487A patent/DE1153357B/de active Pending
-
1962
- 1962-07-17 US US210539A patent/US3207766A/en not_active Expired - Lifetime
- 1962-07-18 DK DK375463AA patent/DK102855C/da active
- 1962-07-18 DK DK375363AA patent/DK102854C/da active
- 1962-07-18 DK DK375163AA patent/DK102905C/da active
- 1962-07-18 DK DK375063AA patent/DK102904C/da active
- 1962-07-18 DK DK375263AA patent/DK107156C/da active
- 1962-07-19 CH CH61367A patent/CH459177A/de unknown
- 1962-07-19 CH CH61567A patent/CH441277A/de unknown
- 1962-07-19 CH CH61467A patent/CH438265A/de unknown
- 1962-07-19 CH CH872162A patent/CH429693A/de unknown
- 1962-07-23 GB GB28304/62A patent/GB1002650A/en not_active Expired
- 1962-10-20 FR FR912913A patent/FR2096M/fr active Active
- 1962-10-20 FR FR912914A patent/FR2097M/fr active Active
Also Published As
| Publication number | Publication date |
|---|---|
| NL122708C (Direct) | |
| BE620550A (Direct) | |
| DK107156C (da) | 1967-05-01 |
| FR2097M (fr) | 1963-10-21 |
| GB1002650A (en) | 1965-08-25 |
| CH441277A (de) | 1967-08-15 |
| FR2096M (fr) | 1963-10-21 |
| DK102855C (da) | 1965-10-18 |
| DK102854C (da) | 1965-10-18 |
| DK102904C (da) | 1965-10-25 |
| DK102905C (da) | 1965-10-25 |
| CH429693A (de) | 1967-02-15 |
| CH459177A (de) | 1968-07-15 |
| CH438265A (de) | 1967-06-30 |
| US3207766A (en) | 1965-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1185180B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE2621958A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| DE1493672B2 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE2238870C3 (de) | Benzolsulfonylharnstoffe | |
| DE1181208B (de) | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-cyclohexyl-harnstoffen | |
| DE1153357B (de) | Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen | |
| DE1198354B (de) | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen | |
| DE1518816B2 (de) | Benzolsulfony!harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE2157607C3 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| AT236397B (de) | Verfahren zur Herstellung von neuen Azidobenzolsulfonylharnstoffen | |
| DE1157211B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1251753B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| AT216521B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1135891B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| AT238215B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1443890C (de) | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung | |
| DE1443908C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| DE1188589B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1518846C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| AT228797B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE2948522A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| EP0029982A1 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen sowie ihre Verwendung | |
| CH419089A (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1188078B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| AT228798B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |