DE1108977B - Mittel zur Vernichtung unerwuenschten Pflanzenwuchses - Google Patents
Mittel zur Vernichtung unerwuenschten PflanzenwuchsesInfo
- Publication number
- DE1108977B DE1108977B DEB56595A DEB0056595A DE1108977B DE 1108977 B DE1108977 B DE 1108977B DE B56595 A DEB56595 A DE B56595A DE B0056595 A DEB0056595 A DE B0056595A DE 1108977 B DE1108977 B DE 1108977B
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- urea
- isobutinyl
- weight
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/26—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/18—Systems containing only non-condensed rings with a ring being at least seven-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL127932D NL127932C (Direct) | 1960-02-10 | ||
| NL261031D NL261031A (Direct) | 1960-02-10 | ||
| DEB56595A DE1108977B (de) | 1960-02-10 | 1960-02-10 | Mittel zur Vernichtung unerwuenschten Pflanzenwuchses |
| US87099A US3149955A (en) | 1960-02-10 | 1961-02-06 | Method of combatting undesirable vegetation |
| GB4495/61A GB905438A (en) | 1960-02-10 | 1961-02-07 | Herbicidal urea derivatives |
| FR852213A FR1279146A (fr) | 1960-02-10 | 1961-02-09 | Produits pour détruire des végétaux indésirables |
| DEB61573A DE1129761B (de) | 1960-02-10 | 1961-03-08 | Mittel zur Vernichtung unerwuenschten Pflanzenwuchses |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB56595A DE1108977B (de) | 1960-02-10 | 1960-02-10 | Mittel zur Vernichtung unerwuenschten Pflanzenwuchses |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1108977B true DE1108977B (de) | 1961-06-15 |
Family
ID=6971387
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB56595A Pending DE1108977B (de) | 1960-02-10 | 1960-02-10 | Mittel zur Vernichtung unerwuenschten Pflanzenwuchses |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3149955A (Direct) |
| DE (1) | DE1108977B (Direct) |
| GB (1) | GB905438A (Direct) |
| NL (2) | NL261031A (Direct) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1542699A1 (de) * | 1965-11-24 | 1970-06-04 | Boehringer Sohn Ingelheim | Herbizide Mittel |
| DE2131401C3 (de) * | 1971-06-24 | 1981-09-24 | Basf Ag, 6700 Ludwigshafen | Herbizides Gemisch auf Benzothiadiazinondioxid-Basis |
| US4305751A (en) * | 1980-04-16 | 1981-12-15 | Gulf Oil Corporation | M-Alkynylanilides and use as herbicides |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2655446A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Chemical compositions and methods |
| US2723192A (en) * | 1954-02-23 | 1955-11-08 | Du Pont | Herbicidal process and product |
| FR64618E (fr) * | 1949-12-06 | 1955-11-30 | Du Pont | Nouvelles compositions herbicides |
| US2753251A (en) * | 1954-10-26 | 1956-07-03 | Du Pont | Herbicidal halophenyl-alkyl-ureas |
| US2876088A (en) * | 1954-11-26 | 1959-03-03 | Du Pont | Process for controlling vegetation |
| DE1055287B (de) | 1957-12-05 | 1959-04-16 | Basf Ag | Pflanzenbekaempfungsmittel |
| DE1062059B (de) * | 1957-12-05 | 1959-07-23 | Basf Ag | Mittel zur Bekaempfung unerwuenschten Pflanzenwuchses |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA586059A (en) * | 1959-10-27 | Fischer Adolf | Agents for combating undesirable vegetable growth and methods of employing them | |
| US2661272A (en) * | 1950-09-21 | 1953-12-01 | Du Pont | 1-cyclohexyl-3, 3-dialkylureas and their use as herbicides |
| US2655447A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Composition and method |
| US2867520A (en) * | 1956-11-23 | 1959-01-06 | Monsanto Chemicals | 1-(chloraryl) 3-alkyl 3-alkynyl urea |
| US3035093A (en) * | 1959-04-30 | 1962-05-15 | Monsanto Chemicals | Substituted alkynyl ureas |
-
0
- NL NL127932D patent/NL127932C/xx active
- NL NL261031D patent/NL261031A/xx unknown
-
1960
- 1960-02-10 DE DEB56595A patent/DE1108977B/de active Pending
-
1961
- 1961-02-06 US US87099A patent/US3149955A/en not_active Expired - Lifetime
- 1961-02-07 GB GB4495/61A patent/GB905438A/en not_active Expired
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR64618E (fr) * | 1949-12-06 | 1955-11-30 | Du Pont | Nouvelles compositions herbicides |
| US2655446A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Chemical compositions and methods |
| US2723192A (en) * | 1954-02-23 | 1955-11-08 | Du Pont | Herbicidal process and product |
| US2753251A (en) * | 1954-10-26 | 1956-07-03 | Du Pont | Herbicidal halophenyl-alkyl-ureas |
| US2876088A (en) * | 1954-11-26 | 1959-03-03 | Du Pont | Process for controlling vegetation |
| DE1055287B (de) | 1957-12-05 | 1959-04-16 | Basf Ag | Pflanzenbekaempfungsmittel |
| DE1062059B (de) * | 1957-12-05 | 1959-07-23 | Basf Ag | Mittel zur Bekaempfung unerwuenschten Pflanzenwuchses |
Also Published As
| Publication number | Publication date |
|---|---|
| NL261031A (Direct) | |
| NL127932C (Direct) | |
| US3149955A (en) | 1964-09-22 |
| GB905438A (en) | 1962-09-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1518815C3 (de) | m-(UreidophenyI)-carbaminsäureester, deren Herstellung und diese enthaltende herbizide Mittel | |
| DE1918112A1 (de) | Phenylharnstoffe,ihre Herstellung und Verwendung als Herbizide | |
| DE1542943B2 (de) | Benzonitrilderivate und diese enthaltende herbizide Zusammensetzungen | |
| DE2945530A1 (de) | Harnstoffe mit cyclischen substituenten, ihre herstellung und verwendung als herbizide | |
| DE1108977B (de) | Mittel zur Vernichtung unerwuenschten Pflanzenwuchses | |
| DE1062059B (de) | Mittel zur Bekaempfung unerwuenschten Pflanzenwuchses | |
| DE2242420C3 (de) | Halogenacetanilide, Verfahren zu ihrer Herstellung und Selektivherbizide mit den Halogenacetaniliden als Wirkstoff | |
| CH532891A (de) | Verwendung von Phenylharnstoffen zum selektiven Bekämpfen von Unkräutern in Kulturen von Nutzpflanzen | |
| DE2436108A1 (de) | Substituierte phenylharnstoffe, verfahren zu ihrer herstellung und herbizide mittel | |
| DE2121957C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| DE1932827C3 (de) | Cycloaliphatische Imidazolidin-2-on-1-carbonsäure-amide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2048660A1 (de) | N o Fluorphenylharnstoffe zur Schad hngsbekampfung | |
| DE2103388A1 (de) | p Fluor m Trifluormethylphenylharn stoffe zur Schädlingsbekämpfung | |
| DE2638897C2 (de) | Diurethane und diese enthaltende Herbizide | |
| DE1816825C3 (de) | Neue Oximäther und diese enthaltende Schädlingsbekämpfungsmittel und Herbizide | |
| DE2638402C2 (Direct) | ||
| DE1964147A1 (de) | Neue Bicyclo[n.1.0]alkyl-Harnstoffe | |
| DE2114774C3 (de) | m-(Halogenalkenyloxy)-phenyIharnstoffe, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel | |
| DE2036968C3 (de) | 3-Chlor-4-n und i-Propoxyphenylharnstoffe, ihre Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE1668004C3 (de) | N-Arylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende herbicide Mittel | |
| DE2320362A1 (de) | Dichlorthiazolylharnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1809838C3 (de) | N-(3-Brom-4-chlorphenyl)-N'methoxy-N'-methylharnstoff und seine Verwendung als Herbizid | |
| DE1542874A1 (de) | Mittel zur Bekaempfung von Unkraeutern | |
| DE2042110C3 (de) | Substituierte Phenylthionocarbamate, Verfahren zu ihrer Herstellung und solche Carbamate enthaltende herbizide Mittel | |
| DE1911610A1 (de) | Harnstoffderivate,ihre Herstellung und Anwendung als Herbizide |