DE1076668B - Verfahren zur Herstellung von 2-Chlorbutadien-1, 3 - Google Patents
Verfahren zur Herstellung von 2-Chlorbutadien-1, 3Info
- Publication number
- DE1076668B DE1076668B DED25601A DED0025601A DE1076668B DE 1076668 B DE1076668 B DE 1076668B DE D25601 A DED25601 A DE D25601A DE D0025601 A DED0025601 A DE D0025601A DE 1076668 B DE1076668 B DE 1076668B
- Authority
- DE
- Germany
- Prior art keywords
- picric acid
- dichlorobutene
- chlorobutadiene
- salt
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 claims description 15
- XVEASTGLHPVZNA-UHFFFAOYSA-N 3,4-dichlorobut-1-ene Chemical compound ClCC(Cl)C=C XVEASTGLHPVZNA-UHFFFAOYSA-N 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 10
- 239000003513 alkali Substances 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 239000003112 inhibitor Substances 0.000 claims description 9
- 238000006116 polymerization reaction Methods 0.000 claims description 8
- 239000000243 solution Substances 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 4
- 239000012429 reaction media Substances 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- UAZUEJTXWAXSMA-UHFFFAOYSA-N 1,1-dichlorobut-1-ene Chemical class CCC=C(Cl)Cl UAZUEJTXWAXSMA-UHFFFAOYSA-N 0.000 description 1
- ASISBFQLIREUCT-UHFFFAOYSA-M C1(O)=CC=C(O)C=C1.N(=O)[O-].[Na+] Chemical compound C1(O)=CC=C(O)C=C1.N(=O)[O-].[Na+] ASISBFQLIREUCT-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229940054057 calcium picrate Drugs 0.000 description 1
- IMPNEEMVYLGDTR-UHFFFAOYSA-L calcium;2,4,6-trinitrophenolate Chemical compound [Ca+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O IMPNEEMVYLGDTR-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/25—Preparation of halogenated hydrocarbons by splitting-off hydrogen halides from halogenated hydrocarbons
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/38—Separation; Purification; Stabilisation; Use of additives
- C07C17/42—Use of additives, e.g. for stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB16338/56A GB798205A (en) | 1956-05-26 | 1956-05-26 | Preparation of chloroprene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1076668B true DE1076668B (de) | 1960-03-03 |
Family
ID=10075481
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED25601A Pending DE1076668B (de) | 1956-05-26 | 1957-05-14 | Verfahren zur Herstellung von 2-Chlorbutadien-1, 3 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2926205A (enFirst) |
| DE (1) | DE1076668B (enFirst) |
| FR (1) | FR1175230A (enFirst) |
| GB (1) | GB798205A (enFirst) |
| NL (1) | NL104413C (enFirst) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2536504C3 (de) * | 1975-08-16 | 1985-06-27 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Halogendienen |
| US5799865A (en) * | 1997-02-10 | 1998-09-01 | Westvaco Corporation | Flap closure and opening means for envelopes |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE588708C (de) * | 1930-10-22 | 1933-11-24 | Du Pont | Verfahren zur Herstellung halogenierter Butadiene |
| US2038538A (en) * | 1931-11-02 | 1936-04-28 | Du Pont | Method of preparing halobutadienes |
| DE683097C (de) * | 1936-03-29 | 1939-10-30 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von Chlor-2-butadien-1,3 |
| US2430016A (en) * | 1946-09-05 | 1947-11-04 | Shell Dev | Production of haloprenes |
| GB673611A (en) * | 1950-09-07 | 1952-06-11 | Dow Chemical Co | Stabilization of nuclear chlorostyrenes by 2,6-dinitrophenols |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA521588A (en) * | 1956-02-07 | W. Hearne George | Production of chloroprene | |
| US1950438A (en) * | 1931-02-28 | 1934-03-13 | Du Pont | Polymerized halogenated hydrocarbons and process for producing same |
| US1950440A (en) * | 1931-10-19 | 1934-03-13 | Du Pont | Halogen-substituted chemical compounds and processes for preparing same |
-
0
- NL NL104413D patent/NL104413C/xx active
-
1956
- 1956-05-26 GB GB16338/56A patent/GB798205A/en not_active Expired
-
1957
- 1957-05-07 US US657485A patent/US2926205A/en not_active Expired - Lifetime
- 1957-05-14 DE DED25601A patent/DE1076668B/de active Pending
- 1957-05-16 FR FR1175230D patent/FR1175230A/fr not_active Expired
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE588708C (de) * | 1930-10-22 | 1933-11-24 | Du Pont | Verfahren zur Herstellung halogenierter Butadiene |
| US2038538A (en) * | 1931-11-02 | 1936-04-28 | Du Pont | Method of preparing halobutadienes |
| DE683097C (de) * | 1936-03-29 | 1939-10-30 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von Chlor-2-butadien-1,3 |
| US2430016A (en) * | 1946-09-05 | 1947-11-04 | Shell Dev | Production of haloprenes |
| GB673611A (en) * | 1950-09-07 | 1952-06-11 | Dow Chemical Co | Stabilization of nuclear chlorostyrenes by 2,6-dinitrophenols |
Also Published As
| Publication number | Publication date |
|---|---|
| GB798205A (en) | 1958-07-16 |
| FR1175230A (fr) | 1959-03-23 |
| NL104413C (enFirst) | |
| US2926205A (en) | 1960-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1076668B (de) | Verfahren zur Herstellung von 2-Chlorbutadien-1, 3 | |
| DE696779C (de) | Verfahren zur Herstellung von Tetrahydrofuranen | |
| DE1543747C3 (de) | Verfahren zur Herstellung von bisquartären Alkylammoniumsulfatsalzen | |
| DE681523C (de) | Verfahren zur Herstellung quaternaerer Ammoniumverbindungen | |
| DE715199C (de) | Verfahren zur Gewinnung von Kalisalzen aus Loesungen | |
| DE884455C (de) | Verfahren zur Behandlung pflanzlicher Stoffe zur Gewinnung von Cellulose fuer die Papierherstellung | |
| DE708349C (de) | Verfahren zur Herstellung saeureamidartiger Kondensationsprodukte | |
| DE879096C (de) | Verfahren zur Herstellung von Vinylestern chemisch stabilisierter Harzsaeuren | |
| DE696810C (de) | Verfahren zur Herstellung von Ascorbinsaeure | |
| DE719436C (de) | Verfahren zur Herstellung von Cyannatrium | |
| DE1076669B (de) | Verfahren zur Herstellung von 2-Chlorbutadien-1, 3 | |
| DE2659088C3 (de) | Verfahren zur Herstellung von Dimethylacetamid | |
| DE1116215B (de) | Verfahren zur Reinigung von geringe Mengen Methylvinylketon enthaltendem Acrylsaeurenitril | |
| DE1176128B (de) | Verfahren zur Stabilisierung von Bis-(methoxy-thioformyl)-disulfid | |
| AT216484B (de) | Verfahren zur Herstellung von 2-Alkylnitraten | |
| DE636259C (de) | Verfahren zur Herstellung von Schwefelsaeureverbindungen aus polymerisierten ungesaettigten Oxyfettsaeuren | |
| DE802875C (de) | Verfahren zur Herstellung von Permanganat | |
| DE878652C (de) | Verfahren zur Herstellung von Alkylolgruppen enthaltenden Aryloxycarbonsaeuren | |
| DE887805C (de) | Herstellung von Decanen mit stark verzweigter Kohlenstoffkette | |
| DE637730C (de) | Verfahren zur Herstellung von N-Alkylderivaten des Ammoniaks | |
| DE1144251B (de) | Verfahren zur Herstellung von 2-Alkylnitraten aus Alkylenen | |
| DE582317C (de) | Verfahren zur Herstellung von Ammonnitrat | |
| DE895288C (de) | Verfahren zur Herstellung von AEthylalkohol aus aethylenhaltigen Kohlenwasserstoffgemischen | |
| DE714970C (de) | Verfahren zur Herstellung von Ameisensaeure | |
| DE925226C (de) | Verfahren zum Wasserabstossendmachen von organischem Fasermaterial, wie Textilien oder Papier |