DE1055950B - Lichtempfindliche Halogensilber-Gelatine-Aggregate und Verfahren zu ihrer Herstellung - Google Patents
Lichtempfindliche Halogensilber-Gelatine-Aggregate und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE1055950B DE1055950B DEG21762A DEG0021762A DE1055950B DE 1055950 B DE1055950 B DE 1055950B DE G21762 A DEG21762 A DE G21762A DE G0021762 A DEG0021762 A DE G0021762A DE 1055950 B DE1055950 B DE 1055950B
- Authority
- DE
- Germany
- Prior art keywords
- gelatin
- silver
- emulsion
- aggregates
- color
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000159 gelatin Polymers 0.000 title claims description 63
- 235000019322 gelatine Nutrition 0.000 title claims description 61
- 239000008273 gelatin Substances 0.000 title claims description 60
- 108010010803 Gelatin Proteins 0.000 title claims description 58
- 235000011852 gelatine desserts Nutrition 0.000 title claims description 58
- 229910052709 silver Inorganic materials 0.000 title claims description 55
- 239000004332 silver Substances 0.000 title claims description 55
- -1 silver halide Chemical class 0.000 title claims description 30
- 238000000034 method Methods 0.000 title claims description 28
- 230000008569 process Effects 0.000 title description 14
- 238000002360 preparation method Methods 0.000 title description 3
- 239000000839 emulsion Substances 0.000 claims description 50
- 230000002209 hydrophobic effect Effects 0.000 claims description 36
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 35
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 claims description 28
- 239000008187 granular material Substances 0.000 claims description 27
- 229910052736 halogen Inorganic materials 0.000 claims description 24
- 150000002367 halogens Chemical class 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 20
- 239000006185 dispersion Substances 0.000 claims description 16
- 239000000243 solution Substances 0.000 claims description 16
- 229940067107 phenylethyl alcohol Drugs 0.000 claims description 14
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 239000000463 material Substances 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 239000000084 colloidal system Substances 0.000 claims description 10
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 claims description 9
- 239000002245 particle Substances 0.000 claims description 8
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 7
- 238000001228 spectrum Methods 0.000 claims description 7
- 239000000725 suspension Substances 0.000 claims description 7
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 6
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 150000001805 chlorine compounds Chemical class 0.000 claims description 4
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 claims description 4
- 238000011161 development Methods 0.000 claims description 4
- 239000012948 isocyanate Substances 0.000 claims description 4
- 150000002513 isocyanates Chemical class 0.000 claims description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 4
- 102000004190 Enzymes Human genes 0.000 claims description 3
- 108090000790 Enzymes Proteins 0.000 claims description 3
- 239000001828 Gelatine Substances 0.000 claims description 3
- 206010034972 Photosensitivity reaction Diseases 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000011248 coating agent Substances 0.000 claims description 3
- 238000000576 coating method Methods 0.000 claims description 3
- 125000001165 hydrophobic group Chemical group 0.000 claims description 3
- 230000036211 photosensitivity Effects 0.000 claims description 3
- 230000002940 repellent Effects 0.000 claims description 3
- 239000005871 repellent Substances 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims description 3
- NXVHEHXRZVQDCR-UHFFFAOYSA-N 1-n,1-n-diethyl-2-methylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1C NXVHEHXRZVQDCR-UHFFFAOYSA-N 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 230000000295 complement effect Effects 0.000 claims description 2
- 238000012545 processing Methods 0.000 claims description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims 4
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 claims 4
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 claims 2
- 238000013019 agitation Methods 0.000 claims 2
- 229910000029 sodium carbonate Inorganic materials 0.000 claims 2
- 235000010265 sodium sulphite Nutrition 0.000 claims 2
- 125000003368 amide group Chemical group 0.000 claims 1
- 239000000758 substrate Substances 0.000 claims 1
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- 150000004820 halides Chemical class 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 9
- 239000000975 dye Substances 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 230000008901 benefit Effects 0.000 description 4
- 230000007515 enzymatic degradation Effects 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 229910021607 Silver chloride Inorganic materials 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CSMJMAQKBKGDQX-UHFFFAOYSA-N 1-isocyanatotetradecane Chemical compound CCCCCCCCCCCCCCN=C=O CSMJMAQKBKGDQX-UHFFFAOYSA-N 0.000 description 2
- TWJNQYPJQDRXPH-UHFFFAOYSA-N 2-cyanobenzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1C#N TWJNQYPJQDRXPH-UHFFFAOYSA-N 0.000 description 2
- UNSAJINGUOTTRA-UHFFFAOYSA-N 3-(3-bromophenyl)prop-2-yn-1-ol Chemical compound OCC#CC1=CC=CC(Br)=C1 UNSAJINGUOTTRA-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- TUNFSRHWOTWDNC-UHFFFAOYSA-N Myristic acid Natural products CCCCCCCCCCCCCC(O)=O TUNFSRHWOTWDNC-UHFFFAOYSA-N 0.000 description 2
- 235000021360 Myristic acid Nutrition 0.000 description 2
- 241000978776 Senegalia senegal Species 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 102000004142 Trypsin Human genes 0.000 description 2
- 108090000631 Trypsin Proteins 0.000 description 2
- 229920002494 Zein Polymers 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 230000006862 enzymatic digestion Effects 0.000 description 2
- 239000003607 modifier Substances 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KRNGJNQVZMBTAF-UHFFFAOYSA-N tetradecane-1-sulfonyl chloride Chemical compound CCCCCCCCCCCCCCS(Cl)(=O)=O KRNGJNQVZMBTAF-UHFFFAOYSA-N 0.000 description 2
- RCRYHUPTBJZEQS-UHFFFAOYSA-N tetradecanoyl tetradecanoate Chemical compound CCCCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCCCC RCRYHUPTBJZEQS-UHFFFAOYSA-N 0.000 description 2
- 239000012588 trypsin Substances 0.000 description 2
- 239000005019 zein Substances 0.000 description 2
- 229940093612 zein Drugs 0.000 description 2
- GFLXBRUGMACJLQ-UHFFFAOYSA-N 1-isocyanatohexadecane Chemical compound CCCCCCCCCCCCCCCCN=C=O GFLXBRUGMACJLQ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000004890 Hydrophobing Agent Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920002201 Oxidized cellulose Polymers 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000004931 aggregating effect Effects 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- AZZCHVHSWUYCQA-UHFFFAOYSA-N decyl carbonochloridate Chemical compound CCCCCCCCCCOC(Cl)=O AZZCHVHSWUYCQA-UHFFFAOYSA-N 0.000 description 1
- 229960002380 dibutyl phthalate Drugs 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 230000007071 enzymatic hydrolysis Effects 0.000 description 1
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- YOSVFFVBSPQTTP-UHFFFAOYSA-N hexadecane-1-sulfonyl chloride Chemical compound CCCCCCCCCCCCCCCCS(Cl)(=O)=O YOSVFFVBSPQTTP-UHFFFAOYSA-N 0.000 description 1
- ARBOVOVUTSQWSS-UHFFFAOYSA-N hexadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCC(Cl)=O ARBOVOVUTSQWSS-UHFFFAOYSA-N 0.000 description 1
- HOQUWXSARQBQCW-UHFFFAOYSA-N hexadecyl carbonochloridate Chemical compound CCCCCCCCCCCCCCCCOC(Cl)=O HOQUWXSARQBQCW-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 229920003145 methacrylic acid copolymer Polymers 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 239000011356 non-aqueous organic solvent Substances 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- VDRWNKIQBYUKGD-UHFFFAOYSA-N octadecane-1-sulfonyl chloride Chemical compound CCCCCCCCCCCCCCCCCCS(Cl)(=O)=O VDRWNKIQBYUKGD-UHFFFAOYSA-N 0.000 description 1
- WTBAHSZERDXKKZ-UHFFFAOYSA-N octadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCCCC(Cl)=O WTBAHSZERDXKKZ-UHFFFAOYSA-N 0.000 description 1
- JQDURWGNZCVESS-UHFFFAOYSA-N octadecyl carbonochloridate Chemical compound CCCCCCCCCCCCCCCCCCOC(Cl)=O JQDURWGNZCVESS-UHFFFAOYSA-N 0.000 description 1
- 229940107304 oxidized cellulose Drugs 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 150000003021 phthalic acid derivatives Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- QCXAICAYXGUSTH-UHFFFAOYSA-N tetradecanoyl isocyanate Chemical compound CCCCCCCCCCCCCC(=O)N=C=O QCXAICAYXGUSTH-UHFFFAOYSA-N 0.000 description 1
- KQHBSKZGPQPRIT-UHFFFAOYSA-N tetradecyl carbonochloridate Chemical compound CCCCCCCCCCCCCCOC(Cl)=O KQHBSKZGPQPRIT-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000004304 visual acuity Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/388—Processes for the incorporation in the emulsion of substances liberating photographically active agents or colour-coupling substances; Solvents therefor
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Pyridine Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US573799A US2965484A (en) | 1956-03-26 | 1956-03-26 | Mixed packet photographic emulsions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1055950B true DE1055950B (de) | 1959-04-23 |
Family
ID=24293436
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG21762A Pending DE1055950B (de) | 1956-03-26 | 1957-03-23 | Lichtempfindliche Halogensilber-Gelatine-Aggregate und Verfahren zu ihrer Herstellung |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US2965484A (enFirst) |
| BE (1) | BE556138A (enFirst) |
| DE (1) | DE1055950B (enFirst) |
| GB (1) | GB811907A (enFirst) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3212896A (en) * | 1961-06-07 | 1965-10-19 | Eastman Kodak Co | Dry processing of photographic emulsions |
| GB1284646A (en) * | 1969-02-04 | 1972-08-09 | Rank Xerox Ltd | Manufacturing process for liquid developing agent for electrophotography |
| US5399480A (en) * | 1993-09-14 | 1995-03-21 | Eastman Kodak Company | Attachment of gelatin-grafted polymer particles to pre-precipitated silver halide grains |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB585758A (en) * | 1944-10-30 | 1947-02-24 | John Alfred Henry Hart | Improvements in or relating to the production of photographic emulsions |
| BE478554A (enFirst) * | 1946-12-09 | |||
| US2728662A (en) * | 1947-08-13 | 1955-12-27 | Eastman Kodak Co | Method of preparing photographic emulsions |
| US2544640A (en) * | 1949-06-10 | 1951-03-13 | Eastman Kodak Co | Mixed grain photographic emulsions |
| BE543743A (enFirst) * | 1950-04-15 | |||
| US2698794A (en) * | 1950-04-15 | 1955-01-04 | Eastman Kodak Co | Mixed packet photographic emulsions |
| BE535054A (enFirst) * | 1954-01-25 |
-
0
- BE BE556138D patent/BE556138A/xx unknown
-
1956
- 1956-03-26 US US573799A patent/US2965484A/en not_active Expired - Lifetime
-
1957
- 1957-03-19 GB GB9008/57A patent/GB811907A/en not_active Expired
- 1957-03-23 DE DEG21762A patent/DE1055950B/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US2965484A (en) | 1960-12-20 |
| BE556138A (enFirst) | |
| GB811907A (en) | 1959-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0213569A2 (de) | Fotografisches Aufzeichnungsmaterial mit einem UV-Absorber und neue UV-Absorber | |
| DE1954467B2 (de) | Farbphotographische Silberhalogenidemulsion | |
| DE1008574B (de) | Verfahren zur Herstellung eines Maskenbildes in einem photographischen Mehrschichtenmaterial | |
| EP0100984B1 (de) | Fotografische Silberhalogenidemulsion | |
| EP0127063B1 (de) | Fotografisches Aufzeichnungsmaterial mit einer Vorläuferverbindung einer fotografisch wirksamen Verbindung | |
| DE3523361A1 (de) | Waermeentwicklungsverfahren und hierfuer geeignetes hilfsblatt | |
| EP0148441B1 (de) | Farbfotografisches Aufzeichnungsmaterial und Entwicklungsverfahren | |
| DE3719880A1 (de) | Farbfotografisches waermeentwicklungsverfahren | |
| DE1942079A1 (de) | Farbphotographisches Mehrschichtenmaterial | |
| DE1285882B (de) | Verfahren zum Schutze von photographischem Material vor der Einwirkung ultravioletter Strahlung | |
| DE1055950B (de) | Lichtempfindliche Halogensilber-Gelatine-Aggregate und Verfahren zu ihrer Herstellung | |
| DE2022697A1 (de) | Lichtempfindliches fotografisches Aufzeichnungsmaterial | |
| DE2934767C2 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2319489A1 (de) | Photographische entwicklungs- oder behandlungsmasse, insbesondere fuer das diffusionsuebertragungsverfahren | |
| EP0247474B1 (de) | Durch Wärmebehandlung entwickelbares farbfotografisches Aufzeichnungsmaterial | |
| EP0023888B1 (de) | Verfahren zur Herstellung maskierter positiver Farbbilder nach dem Silberfarbbleichverfahren sowie das photographische Silberfarbbleichmaterial hierfür | |
| DE1002198B (de) | Verfahren zur Herstellung von farbenphotographischen Bildern | |
| DE2453641A1 (de) | Mehrschichtiges farbphotographisches aufzeichnungsmaterial sowie verfahren zur herstellung positiver farbphotographischer bilder | |
| DE3505673C2 (de) | Photographisches direktpositives Silberhalogenidaufzeichnungsmaterial | |
| DE2645317A1 (de) | Verfahren zur erzeugung von verstaerkten farbstoffbildern | |
| EP0247478B1 (de) | Durch Wärmebehandlung entwickelbares farbfotografisches Aufzeichnungsmaterial | |
| DE4213869A1 (de) | Fotografisches material | |
| DE3636971A1 (de) | Fotografisches farbdiffusionsuebertragungsverfahren und hierfuer geeignetes farbfotografisches aufzeichnungsmaterial | |
| DE2524431A1 (de) | Verfahren zur herstellung eines positiven farbphotographischen bildes | |
| DE895407C (de) | Verfahren zur Farbkorrektur bei der Farbphotographie |