CH646151A5 - Indolverbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel. - Google Patents
Indolverbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel. Download PDFInfo
- Publication number
- CH646151A5 CH646151A5 CH919479A CH919479A CH646151A5 CH 646151 A5 CH646151 A5 CH 646151A5 CH 919479 A CH919479 A CH 919479A CH 919479 A CH919479 A CH 919479A CH 646151 A5 CH646151 A5 CH 646151A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- indole
- general formula
- compound
- groups
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 161
- 238000000034 method Methods 0.000 title claims description 57
- 238000004519 manufacturing process Methods 0.000 title description 9
- 229940126601 medicinal product Drugs 0.000 title 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 79
- -1 Indole compound Chemical class 0.000 claims description 76
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 57
- SIKJAQJRHWYJAI-UHFFFAOYSA-N benzopyrrole Natural products C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 46
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 42
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 34
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 34
- 229910052739 hydrogen Inorganic materials 0.000 claims description 33
- 239000001257 hydrogen Substances 0.000 claims description 33
- 125000006239 protecting group Chemical group 0.000 claims description 28
- 229910021529 ammonia Inorganic materials 0.000 claims description 27
- 239000002904 solvent Substances 0.000 claims description 26
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 23
- 238000002360 preparation method Methods 0.000 claims description 23
- 230000008569 process Effects 0.000 claims description 22
- 150000002475 indoles Chemical class 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 20
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 18
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- 239000004480 active ingredient Substances 0.000 claims description 15
- 229910052740 iodine Inorganic materials 0.000 claims description 15
- WKZLNEWVIAGNAW-UHFFFAOYSA-N 5-Carboxyamidotryptamine Chemical compound C1=C(C(N)=O)C=C2C(CCN)=CNC2=C1 WKZLNEWVIAGNAW-UHFFFAOYSA-N 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 12
- 230000002829 reductive effect Effects 0.000 claims description 12
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 10
- 239000003814 drug Substances 0.000 claims description 10
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 9
- 229910000037 hydrogen sulfide Inorganic materials 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- 238000006722 reduction reaction Methods 0.000 claims description 9
- 239000012279 sodium borohydride Substances 0.000 claims description 9
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000002950 monocyclic group Chemical group 0.000 claims description 8
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 8
- 230000009467 reduction Effects 0.000 claims description 8
- 150000001721 carbon Chemical group 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 claims description 6
- 150000001299 aldehydes Chemical class 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 239000003153 chemical reaction reagent Substances 0.000 claims description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 6
- 150000002828 nitro derivatives Chemical class 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- VQXINLNPICQTLR-UHFFFAOYSA-N carbonyl diazide Chemical compound [N-]=[N+]=NC(=O)N=[N+]=[N-] VQXINLNPICQTLR-UHFFFAOYSA-N 0.000 claims description 5
- 150000002576 ketones Chemical class 0.000 claims description 5
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 4
- 239000003456 ion exchange resin Substances 0.000 claims description 4
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- ABPIMNIQKNKGQJ-UHFFFAOYSA-N 3-(2-aminoethyl)-1h-indole-5-carbothioamide Chemical compound C1=C(C(N)=S)C=C2C(CCN)=CNC2=C1 ABPIMNIQKNKGQJ-UHFFFAOYSA-N 0.000 claims description 3
- QMOCSCIIDCGORV-UHFFFAOYSA-N 3-(2-morpholin-4-ylethyl)-1h-indole-5-carboxamide Chemical compound C12=CC(C(=O)N)=CC=C2NC=C1CCN1CCOCC1 QMOCSCIIDCGORV-UHFFFAOYSA-N 0.000 claims description 3
- FGNOYRGSSCGDKD-UHFFFAOYSA-N 3-[2-(2,2,2-trifluoroethylamino)ethyl]-1h-indole-5-carboxamide Chemical compound NC(=O)C1=CC=C2NC=C(CCNCC(F)(F)F)C2=C1 FGNOYRGSSCGDKD-UHFFFAOYSA-N 0.000 claims description 3
- KPXCJBKYEUTWOF-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-1h-indole-5-carboxamide Chemical compound C1=C(C(N)=O)C=C2C(CCN(C)C)=CNC2=C1 KPXCJBKYEUTWOF-UHFFFAOYSA-N 0.000 claims description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 3
- 239000007868 Raney catalyst Substances 0.000 claims description 3
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 235000019253 formic acid Nutrition 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 150000004677 hydrates Chemical class 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 claims description 3
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 3
- GQMYQEAXTITUAE-UHFFFAOYSA-N 1H-indole-5-carboxamide Chemical compound NC(=O)C1=CC=C2NC=CC2=C1 GQMYQEAXTITUAE-UHFFFAOYSA-N 0.000 claims description 2
- IPASVEYYTNTJTM-UHFFFAOYSA-N 3-(2-nitroethenyl)-1h-indole Chemical compound C1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1 IPASVEYYTNTJTM-UHFFFAOYSA-N 0.000 claims description 2
- QYBFERHZVFESPF-UHFFFAOYSA-N 3-[2-(methylamino)ethyl]-1h-indole-5-carboxamide Chemical compound C1=C(C(N)=O)C=C2C(CCNC)=CNC2=C1 QYBFERHZVFESPF-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 150000003934 aromatic aldehydes Chemical class 0.000 claims description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 238000010531 catalytic reduction reaction Methods 0.000 claims description 2
- 150000008050 dialkyl sulfates Chemical class 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 238000005932 reductive alkylation reaction Methods 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 claims 1
- 125000004344 phenylpropyl group Chemical group 0.000 claims 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims 1
- APJYDQYYACXCRM-UHFFFAOYSA-N tryptamine Chemical compound C1=CC=C2C(CCN)=CNC2=C1 APJYDQYYACXCRM-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 265
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 182
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 123
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 97
- 239000007787 solid Substances 0.000 description 94
- 235000019439 ethyl acetate Nutrition 0.000 description 91
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 90
- 239000000243 solution Substances 0.000 description 82
- 239000000203 mixture Substances 0.000 description 81
- 238000004458 analytical method Methods 0.000 description 67
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 66
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 55
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 47
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 42
- DDRJAANPRJIHGJ-UHFFFAOYSA-N creatinine Chemical compound CN1CC(=O)NC1=N DDRJAANPRJIHGJ-UHFFFAOYSA-N 0.000 description 42
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 239000003921 oil Substances 0.000 description 33
- 235000019198 oils Nutrition 0.000 description 33
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 27
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 27
- 239000000377 silicon dioxide Substances 0.000 description 27
- 229920005989 resin Polymers 0.000 description 23
- 239000011347 resin Substances 0.000 description 23
- 238000006243 chemical reaction Methods 0.000 description 22
- 229940109239 creatinine Drugs 0.000 description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 20
- 239000000284 extract Substances 0.000 description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 17
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 16
- 229920001429 chelating resin Polymers 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- MEVXSUZBFYZPHZ-UHFFFAOYSA-N 2-amino-3-methyl-4h-imidazol-5-one;sulfuric acid Chemical class OS(O)(=O)=O.CN1CC(=O)N=C1N MEVXSUZBFYZPHZ-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 239000011976 maleic acid Substances 0.000 description 14
- 229960000583 acetic acid Drugs 0.000 description 13
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 13
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 12
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 12
- 239000003826 tablet Substances 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 11
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 10
- 239000013081 microcrystal Substances 0.000 description 10
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 10
- 235000012239 silicon dioxide Nutrition 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 235000011087 fumaric acid Nutrition 0.000 description 9
- 235000011149 sulphuric acid Nutrition 0.000 description 9
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 150000003141 primary amines Chemical class 0.000 description 7
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 235000019359 magnesium stearate Nutrition 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910003445 palladium oxide Inorganic materials 0.000 description 6
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 6
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 5
- CDWFDLYRKQOGNR-UHFFFAOYSA-N 3-(2-aminoethyl)-1h-indole-5-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(CCN)=CNC2=C1 CDWFDLYRKQOGNR-UHFFFAOYSA-N 0.000 description 5
- LAERHFKPJKHOJJ-UHFFFAOYSA-N 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1h-indole-5-carbonitrile Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(C#N)C=C12 LAERHFKPJKHOJJ-UHFFFAOYSA-N 0.000 description 5
- 241000251730 Chondrichthyes Species 0.000 description 5
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000003610 charcoal Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 239000006260 foam Substances 0.000 description 5
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 150000002688 maleic acid derivatives Chemical class 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- YHYLDEVWYOFIJK-UHFFFAOYSA-N 1h-indole-5-carbonitrile Chemical compound N#CC1=CC=C2NC=CC2=C1 YHYLDEVWYOFIJK-UHFFFAOYSA-N 0.000 description 4
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000007906 compression Methods 0.000 description 4
- 230000006835 compression Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000007907 direct compression Methods 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 229940067157 phenylhydrazine Drugs 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 238000011946 reduction process Methods 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 3
- NYEZIGVQPDFDQF-UHFFFAOYSA-N 3-(2-aminoethyl)-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(CCN)=CNC2=C1 NYEZIGVQPDFDQF-UHFFFAOYSA-N 0.000 description 3
- BXTDJWZXLBXILR-UHFFFAOYSA-N 3-(3-aminopropyl)-1h-indole-5-carboxamide Chemical compound C1=C(C(N)=O)C=C2C(CCCN)=CNC2=C1 BXTDJWZXLBXILR-UHFFFAOYSA-N 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 3
- 241001440269 Cutina Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 238000006783 Fischer indole synthesis reaction Methods 0.000 description 3
- 208000019695 Migraine disease Diseases 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 3
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000007857 hydrazones Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000004971 nitroalkyl group Chemical group 0.000 description 3
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 3
- 239000010502 orange oil Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 150000004031 phenylhydrazines Chemical class 0.000 description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 230000002335 preservative effect Effects 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- RGGOWBBBHWTTRE-UHFFFAOYSA-N (4-bromophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=C(Br)C=C1 RGGOWBBBHWTTRE-UHFFFAOYSA-N 0.000 description 2
- OWIPHDZMHFOFAN-UHFFFAOYSA-N 1-benzyl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-5-carbonitrile Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC(C1=CC(=CC=C11)C#N)=CN1CC1=CC=CC=C1 OWIPHDZMHFOFAN-UHFFFAOYSA-N 0.000 description 2
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical compound NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- RCXIZBHDXKDWGU-UHFFFAOYSA-N 3-(2-aminoethyl)-1-benzylindole-5-carboxamide Chemical compound C12=CC=C(C(N)=O)C=C2C(CCN)=CN1CC1=CC=CC=C1 RCXIZBHDXKDWGU-UHFFFAOYSA-N 0.000 description 2
- SXBPAQLJVMPZDA-UHFFFAOYSA-N 3-(2-aminoethyl)-1-methylindole-5-carboxamide Chemical compound NC(=O)C1=CC=C2N(C)C=C(CCN)C2=C1 SXBPAQLJVMPZDA-UHFFFAOYSA-N 0.000 description 2
- AOLWJTOTCQDCJV-UHFFFAOYSA-N 3-(2-aminoethyl)-1h-indole-5-carboxylic acid;hydrochloride Chemical compound Cl.C1=C(C(O)=O)C=C2C(CCN)=CNC2=C1 AOLWJTOTCQDCJV-UHFFFAOYSA-N 0.000 description 2
- BHBPLYYWOXKDTI-UHFFFAOYSA-N 3-(2-aminoethyl)-2-methyl-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(CCN)=C(C)NC2=C1 BHBPLYYWOXKDTI-UHFFFAOYSA-N 0.000 description 2
- SROFDDIRDHEJFK-UHFFFAOYSA-N 3-(2-aminoethyl)-2-phenyl-1h-indole-5-carbonitrile Chemical compound N1C2=CC=C(C#N)C=C2C(CCN)=C1C1=CC=CC=C1 SROFDDIRDHEJFK-UHFFFAOYSA-N 0.000 description 2
- YJVYMDTUJCUDOX-UHFFFAOYSA-N 3-(2-aminoethyl)-2-phenyl-1h-indole-5-carboxamide Chemical compound N1C2=CC=C(C(N)=O)C=C2C(CCN)=C1C1=CC=CC=C1 YJVYMDTUJCUDOX-UHFFFAOYSA-N 0.000 description 2
- WUXUHUXHRGWPMN-UHFFFAOYSA-N 3-(2-aminoethyl)-n,n-dimethyl-1h-indole-5-carboxamide Chemical compound CN(C)C(=O)C1=CC=C2NC=C(CCN)C2=C1 WUXUHUXHRGWPMN-UHFFFAOYSA-N 0.000 description 2
- WKYJMEMMEGINLU-UHFFFAOYSA-N 3-(2-aminoethyl)-n-prop-2-enyl-1h-indole-5-carboxamide Chemical compound C1=C(C(=O)NCC=C)C=C2C(CCN)=CNC2=C1 WKYJMEMMEGINLU-UHFFFAOYSA-N 0.000 description 2
- IYHRWFAUORMEEM-UHFFFAOYSA-N 3-(2-aminopropyl)-1h-indole-5-carboxamide Chemical compound C1=C(C(N)=O)C=C2C(CC(N)C)=CNC2=C1 IYHRWFAUORMEEM-UHFFFAOYSA-N 0.000 description 2
- BJLFCYPADJBLEF-UHFFFAOYSA-N 3-(2-bromoacetyl)-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(C(=O)CBr)=CNC2=C1 BJLFCYPADJBLEF-UHFFFAOYSA-N 0.000 description 2
- VCHQUTJDTRVWTH-UHFFFAOYSA-N 3-(2-piperazin-1-ylacetyl)-1h-indole-5-carbonitrile Chemical compound C=1NC2=CC=C(C#N)C=C2C=1C(=O)CN1CCNCC1 VCHQUTJDTRVWTH-UHFFFAOYSA-N 0.000 description 2
- GRGCCVWDHCWPTH-UHFFFAOYSA-N 3-(3-aminopropyl)-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(CCCN)=CNC2=C1 GRGCCVWDHCWPTH-UHFFFAOYSA-N 0.000 description 2
- WPDPLAMXXFUHDB-UHFFFAOYSA-N 3-[(dimethylamino)methyl]-1h-indole-5-carboxamide Chemical compound C1=C(C(N)=O)C=C2C(CN(C)C)=CNC2=C1 WPDPLAMXXFUHDB-UHFFFAOYSA-N 0.000 description 2
- VRMJODDSQKEAIW-UHFFFAOYSA-N 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1h-indole-5-carbothioamide Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(C(=S)N)C=C21 VRMJODDSQKEAIW-UHFFFAOYSA-N 0.000 description 2
- KTQRSNOHMDMELI-UHFFFAOYSA-N 3-[2-(2,2,2-trifluoroethylamino)ethyl]-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(CCNCC(F)(F)F)=CNC2=C1 KTQRSNOHMDMELI-UHFFFAOYSA-N 0.000 description 2
- NYLHPZSYVXHYRD-UHFFFAOYSA-N 3-[2-(benzylamino)ethyl]-1h-indole-5-carboxamide Chemical compound C12=CC(C(=O)N)=CC=C2NC=C1CCNCC1=CC=CC=C1 NYLHPZSYVXHYRD-UHFFFAOYSA-N 0.000 description 2
- ZBAWTGBCFSHMPW-UHFFFAOYSA-N 3-[2-(dipropylamino)acetyl]-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(C(=O)CN(CCC)CCC)=CNC2=C1 ZBAWTGBCFSHMPW-UHFFFAOYSA-N 0.000 description 2
- OCLXZHZBMIIJLL-UHFFFAOYSA-N 3-[2-(dipropylamino)ethyl]-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(CCN(CCC)CCC)=CNC2=C1 OCLXZHZBMIIJLL-UHFFFAOYSA-N 0.000 description 2
- KAQFVANTMQIGFJ-UHFFFAOYSA-N 3-[2-(phenylmethoxycarbonylamino)ethyl]-1h-indole-5-carboxylic acid Chemical compound C12=CC(C(=O)O)=CC=C2NC=C1CCNC(=O)OCC1=CC=CC=C1 KAQFVANTMQIGFJ-UHFFFAOYSA-N 0.000 description 2
- ADPDMMPEFPBHIF-UHFFFAOYSA-N 3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1h-indole-5-carbonitrile Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCC1=CNC2=CC=C(C#N)C=C12 ADPDMMPEFPBHIF-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- UXDLLFIRCVPPQP-UHFFFAOYSA-N 4-hydrazinylbenzonitrile;hydrochloride Chemical compound [Cl-].[NH3+]NC1=CC=C(C#N)C=C1 UXDLLFIRCVPPQP-UHFFFAOYSA-N 0.000 description 2
- XVRIEWDDMODMGA-UHFFFAOYSA-N 5-chloropentan-2-one Chemical compound CC(=O)CCCCl XVRIEWDDMODMGA-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 2
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- HCUARRIEZVDMPT-UHFFFAOYSA-N Indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1 HCUARRIEZVDMPT-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 150000001266 acyl halides Chemical class 0.000 description 2
- AKGGYBADQZYZPD-UHFFFAOYSA-N benzylacetone Chemical compound CC(=O)CCC1=CC=CC=C1 AKGGYBADQZYZPD-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- OLNJUISKUQQNIM-UHFFFAOYSA-N indole-3-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CNC2=C1 OLNJUISKUQQNIM-UHFFFAOYSA-N 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011812 mixed powder Substances 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 238000005550 wet granulation Methods 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- KPJZHOPZRAFDTN-ZRGWGRIASA-N (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@H](CO)CC)C2)=C3C2=CN(C)C3=C1 KPJZHOPZRAFDTN-ZRGWGRIASA-N 0.000 description 1
- LAFRKWDMWGHGPG-UHFFFAOYSA-N 1,3-dioxoisoindole-2-carboxamide Chemical compound C1=CC=C2C(=O)N(C(=O)N)C(=O)C2=C1 LAFRKWDMWGHGPG-UHFFFAOYSA-N 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- ZUQXVMIIRIIGTQ-UHFFFAOYSA-N 2-(2-nitroethenyl)-1h-indole Chemical compound C1=CC=C2NC(C=C[N+](=O)[O-])=CC2=C1 ZUQXVMIIRIIGTQ-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- NMOCOWABJRWQGY-UHFFFAOYSA-N 2-(4,4-diethoxybutyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCC(OCC)OCC)C(=O)C2=C1 NMOCOWABJRWQGY-UHFFFAOYSA-N 0.000 description 1
- IIWHQNUMZZKDNR-UHFFFAOYSA-N 2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1h-indole-5-carboxamide Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CC2=CC(C(=O)N)=CC=C2N1 IIWHQNUMZZKDNR-UHFFFAOYSA-N 0.000 description 1
- YSBVEVKBIOJFOK-UHFFFAOYSA-N 2-[2-(5-bromo-1h-indol-3-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(Br)C=C21 YSBVEVKBIOJFOK-UHFFFAOYSA-N 0.000 description 1
- GHFWUFJSLPMOMV-UHFFFAOYSA-N 2-[3-(5-bromo-1h-indol-3-yl)propyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCC1=CNC2=CC=C(Br)C=C21 GHFWUFJSLPMOMV-UHFFFAOYSA-N 0.000 description 1
- SNXGUFOCQLPNMY-UHFFFAOYSA-N 2-[5-(cyclopentylcarbamoyl)-1h-indol-3-yl]ethylcarbamic acid Chemical compound C1=C2C(CCNC(=O)O)=CNC2=CC=C1C(=O)NC1CCCC1 SNXGUFOCQLPNMY-UHFFFAOYSA-N 0.000 description 1
- VUXCSBOACIENSC-UHFFFAOYSA-N 2-[5-(phenylcarbamoyl)-1h-indol-3-yl]ethylcarbamic acid Chemical compound C1=C2C(CCNC(=O)O)=CNC2=CC=C1C(=O)NC1=CC=CC=C1 VUXCSBOACIENSC-UHFFFAOYSA-N 0.000 description 1
- PEXCMMDHBIFUIJ-UHFFFAOYSA-N 2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid Chemical compound OS(O)(=O)=O.NC(=N)N(C)CC(O)=O PEXCMMDHBIFUIJ-UHFFFAOYSA-N 0.000 description 1
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 description 1
- DNLCKLGEGRKRIC-UHFFFAOYSA-M 2-iodo-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1I DNLCKLGEGRKRIC-UHFFFAOYSA-M 0.000 description 1
- QSECPQCFCWVBKM-UHFFFAOYSA-N 2-iodoethanol Chemical compound OCCI QSECPQCFCWVBKM-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- AJLNSNOFBCCJSD-UHFFFAOYSA-N 3-(2-aminoethyl)-1-benzylindole-5-carbonitrile Chemical compound C12=CC=C(C#N)C=C2C(CCN)=CN1CC1=CC=CC=C1 AJLNSNOFBCCJSD-UHFFFAOYSA-N 0.000 description 1
- GIMZXFNFJMWUTC-UHFFFAOYSA-N 3-(2-aminoethyl)-1-butylindole-5-carboxamide Chemical compound NC(=O)C1=CC=C2N(CCCC)C=C(CCN)C2=C1 GIMZXFNFJMWUTC-UHFFFAOYSA-N 0.000 description 1
- KCBDSBAWVFHFGA-UHFFFAOYSA-N 3-(2-aminoethyl)-1-methylindole-5-carbonitrile Chemical compound N#CC1=CC=C2N(C)C=C(CCN)C2=C1 KCBDSBAWVFHFGA-UHFFFAOYSA-N 0.000 description 1
- AVKDNCAJMIWWEU-UHFFFAOYSA-N 3-(2-aminoethyl)-n-(2-hydroxyethyl)-1h-indole-5-carboxamide Chemical compound C1=C(C(=O)NCCO)C=C2C(CCN)=CNC2=C1 AVKDNCAJMIWWEU-UHFFFAOYSA-N 0.000 description 1
- ADLRLURRJSGAOO-UHFFFAOYSA-N 3-(2-morpholin-4-ylethyl)-1h-indole-5-carbonitrile Chemical compound C12=CC(C#N)=CC=C2NC=C1CCN1CCOCC1 ADLRLURRJSGAOO-UHFFFAOYSA-N 0.000 description 1
- YUNFFZXVNCXVCK-UHFFFAOYSA-N 3-(2-piperazin-1-ylethyl)-1h-indole-5-carbonitrile Chemical compound C12=CC(C#N)=CC=C2NC=C1CCN1CCNCC1 YUNFFZXVNCXVCK-UHFFFAOYSA-N 0.000 description 1
- QWBXHEWLUNFJSP-UHFFFAOYSA-N 3-(2-piperazin-1-ylethyl)-1h-indole-5-carboxamide Chemical compound C12=CC(C(=O)N)=CC=C2NC=C1CCN1CCNCC1 QWBXHEWLUNFJSP-UHFFFAOYSA-N 0.000 description 1
- SVFZBYMQNWRSFL-UHFFFAOYSA-N 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1h-indole-5-carboxamide Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCC1=CNC2=CC=C(C(=O)N)C=C21 SVFZBYMQNWRSFL-UHFFFAOYSA-N 0.000 description 1
- YRDBJQWEWIMJHB-UHFFFAOYSA-N 3-[2-(2,2,2-trifluoroethylamino)acetyl]-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(C(=O)CNCC(F)(F)F)=CNC2=C1 YRDBJQWEWIMJHB-UHFFFAOYSA-N 0.000 description 1
- RIYQXWJBGBDUGD-UHFFFAOYSA-N 3-[2-(benzylideneamino)ethyl]-1h-indole-5-carboxamide Chemical compound C12=CC(C(=O)N)=CC=C2NC=C1CCN=CC1=CC=CC=C1 RIYQXWJBGBDUGD-UHFFFAOYSA-N 0.000 description 1
- DSNBRTOYUJFTAH-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C=C2C(CCN(C)C)=CNC2=C1 DSNBRTOYUJFTAH-UHFFFAOYSA-N 0.000 description 1
- DPXOFRGRKPFZOD-UHFFFAOYSA-N 3-[2-(dipropylamino)ethyl]-1H-indole-5-carboxamide Chemical compound C1=C(C(N)=O)C=C2C(CCN(CCC)CCC)=CNC2=C1 DPXOFRGRKPFZOD-UHFFFAOYSA-N 0.000 description 1
- PFYKCAQLRORFAW-UHFFFAOYSA-N 3-[2-[benzyl(methyl)amino]ethyl]-1h-indole-5-carboxamide Chemical compound C=1NC2=CC=C(C(N)=O)C=C2C=1CCN(C)CC1=CC=CC=C1 PFYKCAQLRORFAW-UHFFFAOYSA-N 0.000 description 1
- NHWRHEOCEWDYPJ-UHFFFAOYSA-N 4-(4-chlorophenyl)butan-2-one Chemical compound CC(=O)CCC1=CC=C(Cl)C=C1 NHWRHEOCEWDYPJ-UHFFFAOYSA-N 0.000 description 1
- URSUOMZVWOFEST-UHFFFAOYSA-N 4-hydrazinylbenzamide Chemical compound NNC1=CC=C(C(N)=O)C=C1 URSUOMZVWOFEST-UHFFFAOYSA-N 0.000 description 1
- DZUUSHCOMPROCJ-UHFFFAOYSA-N 4-hydrazinylbenzonitrile Chemical compound NNC1=CC=C(C#N)C=C1 DZUUSHCOMPROCJ-UHFFFAOYSA-N 0.000 description 1
- QTLVZYOFSGOZDZ-UHFFFAOYSA-N 5-benzoyl-9,9-dimethyl-6-[5-(3-nitrophenyl)furan-2-yl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one Chemical compound C1C(C)(C)CC(=O)C2=C1NC1=CC=CC=C1N(C(=O)C=1C=CC=CC=1)C2C(O1)=CC=C1C1=CC=CC([N+]([O-])=O)=C1 QTLVZYOFSGOZDZ-UHFFFAOYSA-N 0.000 description 1
- ZUMCZYHPJRNSIM-UHFFFAOYSA-N 5-bromo-3-(3-chloropropyl)-1h-indole Chemical compound C1=C(Br)C=C2C(CCCCl)=CNC2=C1 ZUMCZYHPJRNSIM-UHFFFAOYSA-N 0.000 description 1
- DGMYRPFYNFQCHM-UHFFFAOYSA-N 5-phenylpentan-2-one Chemical compound CC(=O)CCCC1=CC=CC=C1 DGMYRPFYNFQCHM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- ZNSMNVMLTJELDZ-UHFFFAOYSA-N Bis(2-chloroethyl)ether Chemical compound ClCCOCCCl ZNSMNVMLTJELDZ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- VPGRYOFKCNULNK-ACXQXYJUSA-N Deoxycorticosterone acetate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)COC(=O)C)[C@@]1(C)CC2 VPGRYOFKCNULNK-ACXQXYJUSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- 238000006824 Eschweiler-Clarke methylation reaction Methods 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- QPFYXYFORQJZEC-FOCLMDBBSA-N Phenazopyridine Chemical compound NC1=NC(N)=CC=C1\N=N\C1=CC=CC=C1 QPFYXYFORQJZEC-FOCLMDBBSA-N 0.000 description 1
- 208000003782 Raynaud disease Diseases 0.000 description 1
- 208000012322 Raynaud phenomenon Diseases 0.000 description 1
- 238000005874 Vilsmeier-Haack formylation reaction Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 229940097320 beta blocking agent Drugs 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- ZPFKRQXYKULZKP-UHFFFAOYSA-N butylidene Chemical group [CH2+]CC[CH-] ZPFKRQXYKULZKP-UHFFFAOYSA-N 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 230000001595 contractor effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000006312 cyclopentyl amino group Chemical group [H]N(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000002354 daily effect Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- KXGVEGMKQFWNSR-UHFFFAOYSA-N deoxycholic acid Natural products C1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 KXGVEGMKQFWNSR-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- ROAYSRAUMPWBQX-UHFFFAOYSA-N ethanol;sulfuric acid Chemical compound CCO.OS(O)(=O)=O ROAYSRAUMPWBQX-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- LFCZTAMKCJLTOL-UHFFFAOYSA-N ethyl n-(2,2,2-trichloroethyl)carbamate Chemical compound CCOC(=O)NCC(Cl)(Cl)Cl LFCZTAMKCJLTOL-UHFFFAOYSA-N 0.000 description 1
- KWBIXTIBYFUAGV-UHFFFAOYSA-N ethylcarbamic acid Chemical compound CCNC(O)=O KWBIXTIBYFUAGV-UHFFFAOYSA-N 0.000 description 1
- 230000003203 everyday effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- DBEYVIGIPJSTOR-FHWLQOOXSA-N fumitremorgin C Chemical compound O=C1[C@@H]2CCCN2C(=O)[C@@H]2CC(C3=CC=C(C=C3N3)OC)=C3[C@H](C=C(C)C)N21 DBEYVIGIPJSTOR-FHWLQOOXSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- IENZCGNHSIMFJE-UHFFFAOYSA-N indole-5-carboxylic acid Chemical compound OC(=O)C1=CC=C2NC=CC2=C1 IENZCGNHSIMFJE-UHFFFAOYSA-N 0.000 description 1
- NBKQRVSGHYZUOR-UHFFFAOYSA-N indoline-3-carbaldehyde Natural products C1=CC=C2C(C=O)CNC2=C1 NBKQRVSGHYZUOR-UHFFFAOYSA-N 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M isovalerate Chemical compound CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960001186 methysergide Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- QCCDLTOVEPVEJK-UHFFFAOYSA-N phenylacetone Chemical compound CC(=O)CC1=CC=CC=C1 QCCDLTOVEPVEJK-UHFFFAOYSA-N 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 229960003712 propranolol Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229940070891 pyridium Drugs 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
- C07D209/16—Tryptamines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Pain & Pain Management (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7840279 | 1978-10-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH646151A5 true CH646151A5 (de) | 1984-11-15 |
Family
ID=10500283
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH919479A CH646151A5 (de) | 1978-10-12 | 1979-10-11 | Indolverbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4252803A (enExample) |
| JP (1) | JPS5562063A (enExample) |
| AU (1) | AU531783B2 (enExample) |
| BE (1) | BE879381A (enExample) |
| CA (1) | CA1146550A (enExample) |
| CH (1) | CH646151A5 (enExample) |
| DE (1) | DE2940687A1 (enExample) |
| DK (1) | DK425579A (enExample) |
| ES (2) | ES484980A0 (enExample) |
| FI (1) | FI793071A7 (enExample) |
| FR (1) | FR2438651A1 (enExample) |
| GB (1) | GB2035310B (enExample) |
| IE (1) | IE49304B1 (enExample) |
| IT (1) | IT1142170B (enExample) |
| NL (1) | NL7907583A (enExample) |
| NZ (1) | NZ191802A (enExample) |
| SE (1) | SE448628B (enExample) |
| ZA (1) | ZA795239B (enExample) |
Families Citing this family (94)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZW19381A1 (en) * | 1980-08-12 | 1983-03-09 | Glaxo Group Ltd | Heterocyclic compounds |
| AT381491B (de) * | 1980-08-12 | 1986-10-27 | Glaxo Group Ltd | Verfahren zur herstellung von neuen indolverbindungen und ihren salzen |
| NZ197996A (en) * | 1980-08-12 | 1985-08-16 | Glaxo Group Ltd | 1-(3-(omega-aminoalkyl)-1h-indol-5-yl)alkanamides |
| GB2083463B (en) * | 1980-08-12 | 1984-05-10 | Glaxo Group Ltd | Heterocyclic compounds |
| BE889931A (fr) * | 1980-08-12 | 1982-02-11 | Glaxo Group Ltd | Derives indoliques, leur preparation et leurs applications en tant que medicaments |
| US4428962A (en) | 1981-10-30 | 1984-01-31 | Schering Corporation | Indoles in treatment of peptic ulcers |
| IT1170387B (it) * | 1982-06-07 | 1987-06-03 | Glaxo Group Ltd | Composti eterociclici, procedimento per prepararli e composizioni farmaceutiche che li contengono |
| US4582848A (en) * | 1982-06-10 | 1986-04-15 | Sandoz, Inc. | 2-substituted-3-indolamines and use thereof as anti-diabetics |
| US4803218A (en) * | 1982-09-29 | 1989-02-07 | Mcneilab, Inc. | 3-aminoalkyl-1H-indole-5-urea and amide derivatives |
| US4521606A (en) * | 1983-06-30 | 1985-06-04 | American Home Products Corp. | 5-Indolyl substituted aminoethanols |
| US4622399A (en) * | 1983-06-30 | 1986-11-11 | American Home Products Corporation | Bicyclo-heterocyclic nitrogen substituted aminoethanol derivatives |
| US4562200A (en) * | 1983-06-30 | 1985-12-31 | American Home Products Corporation | 5(Indolyl) and 5(2,3-dihydroindolyl) substituted aminoethanols and their use as anti-hypertensives |
| GB8332435D0 (en) * | 1983-12-06 | 1984-01-11 | Glaxo Group Ltd | Chemical compounds |
| GB8332437D0 (en) * | 1983-12-06 | 1984-01-11 | Glaxo Group Ltd | Chemical compounds |
| AU571922B2 (en) * | 1984-01-26 | 1988-04-28 | Schering Agrochemicals Limited | Veterinary implants comprising melatonin and derivatives thereof |
| US5026869A (en) * | 1984-02-06 | 1991-06-25 | Eli Lilly And Company | 6-substituted-4-dialkylaminotetrahydrobenz(c,d)indoles |
| GB8419575D0 (en) * | 1984-08-01 | 1984-09-05 | Glaxo Group Ltd | Chemical compounds |
| GB8431426D0 (en) * | 1984-12-13 | 1985-01-23 | Glaxo Group Ltd | Chemical compounds |
| DE3537289A1 (de) * | 1985-10-19 | 1987-04-23 | Hoechst Ag | 2-(3-brompropyl)-5,5-dimethyl-1,3-dioxan, sowie verfahren zur herstellung desselben und des 2-(4-brombutyl)-5,5-dimethyl-1,3-dioxans |
| DE3678805D1 (de) * | 1985-11-08 | 1991-05-23 | Glaxo Group Ltd | Indolderivate. |
| GB8530507D0 (en) * | 1985-12-11 | 1986-01-22 | Glaxo Group Plc | Chemical compounds |
| GB8600398D0 (en) * | 1986-01-08 | 1986-02-12 | Glaxo Group Ltd | Chemical compounds |
| GB8600397D0 (en) * | 1986-01-08 | 1986-02-12 | Glaxo Group Ltd | Chemical compounds |
| GB8607824D0 (en) * | 1986-03-27 | 1986-04-30 | Glaxo Group Ltd | Chemical compounds |
| AU601736B2 (en) * | 1986-05-23 | 1990-09-20 | Sanofi Sante Nutrition Animale Sa | Coated veterinary implants |
| GB8614287D0 (en) * | 1986-06-12 | 1986-07-16 | Glaxo Group Ltd | Chemical compounds |
| GB8719167D0 (en) * | 1987-08-13 | 1987-09-23 | Glaxo Group Ltd | Chemical compounds |
| US5225431A (en) * | 1987-10-23 | 1993-07-06 | Burroughs Wellcome Co. | Therapeutic substituted indole compounds and compositions thereof |
| GB8830312D0 (en) * | 1988-12-28 | 1989-02-22 | Lundbeck & Co As H | Heterocyclic compounds |
| US5276045A (en) * | 1989-06-16 | 1994-01-04 | Rhone-Poulenc Sante | Thioformamide derivative, process for its preparation, pharmaceutical composition thereof and treatment method |
| CA2042295A1 (fr) * | 1990-05-15 | 1991-11-16 | Jacques Chauveau | Derives de mediateurs endogenes, leurs sels, procede de preparation, applications, et compositions les renfermant |
| EG19650A (en) * | 1990-06-07 | 1995-09-30 | Wellcome Found | Derivatives of indol and their use for treatment of megraine |
| US5229409A (en) * | 1990-08-15 | 1993-07-20 | Eli Lilly And Company | 6-substituted-tetrahydrobenz[cd]indoles |
| US5578612A (en) * | 1990-10-15 | 1996-11-26 | Pfizer Inc. | Indole derivatives |
| US5545644A (en) * | 1990-10-15 | 1996-08-13 | Pfizer Inc. | Indole derivatives |
| US5559246A (en) * | 1990-10-15 | 1996-09-24 | Pfizer Inc. | Indole derivatives |
| US5559129A (en) * | 1990-10-15 | 1996-09-24 | Pfizer Inc | Indole derivatives |
| US5607951A (en) * | 1990-10-15 | 1997-03-04 | Pfizer Inc | Indole derivatives |
| DE4101686A1 (de) * | 1991-01-22 | 1992-07-23 | Merck Patent Gmbh | Indolderivate |
| SK278998B6 (sk) * | 1991-02-01 | 1998-05-06 | Merck Sharp & Dohme Limited | Deriváty imidazolu, triazolu a tetrazolu, spôsob i |
| US5244912A (en) * | 1991-03-28 | 1993-09-14 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,3,4,5-tetrahydrobenz(cd)indoles and pharmaceutical use thereof |
| US5364856A (en) * | 1991-03-28 | 1994-11-15 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,3,4,5-tetrahydrobenz[CD]indoles |
| DE69230803T2 (de) * | 1991-11-25 | 2000-12-07 | Pfizer Inc., New York | 5-(hetero- oder carbocyclylamino)-indol derivate, deren herstellung und deren verwendung als 5-ht1 agonisten |
| TW288010B (enExample) * | 1992-03-05 | 1996-10-11 | Pfizer | |
| PL172405B1 (en) | 1992-04-07 | 1997-09-30 | Pfizer | Derivatives of indole |
| US6380233B1 (en) | 1992-04-07 | 2002-04-30 | Pfizer Inc | Indole derivatives as 5-HT1 agonists |
| GB9207930D0 (en) * | 1992-04-10 | 1992-05-27 | Pfizer Ltd | Indoles |
| AU670270B2 (en) * | 1992-04-10 | 1996-07-11 | Pfizer Inc. | Acylaminoindole derivatives as 5-HT1 agonists |
| TW251284B (enExample) * | 1992-11-02 | 1995-07-11 | Pfizer | |
| GB9226566D0 (en) * | 1992-12-21 | 1993-02-17 | Smithkline Beecham Plc | Compounds |
| AU686654B2 (en) * | 1993-08-31 | 1998-02-12 | Pfizer Inc. | 5-arylindole derivatives |
| US5468768A (en) * | 1994-01-06 | 1995-11-21 | Bristol-Myers Squibb Company | Antimigraine derivatives of indolylcycloalkanylamines |
| GB9417310D0 (en) * | 1994-08-27 | 1994-10-19 | Pfizer Ltd | Therapeutic agents |
| US6200957B1 (en) | 1995-12-14 | 2001-03-13 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US5780437A (en) * | 1995-12-14 | 1998-07-14 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US5756507A (en) * | 1995-12-14 | 1998-05-26 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| NZ325569A (en) * | 1995-12-14 | 2000-05-26 | Merck & Co Inc | 2-substituted phenyl-1H-indole derivatives which are antagonists of gonadotropin releasing hormone |
| US5849764A (en) * | 1995-12-14 | 1998-12-15 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| CA2240111A1 (en) | 1995-12-14 | 1997-06-19 | Wallace T. Ashton | Antagonists of gonadotropin releasing hormone |
| EP0871624A1 (en) * | 1995-12-14 | 1998-10-21 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| EP0875513A1 (en) * | 1997-04-14 | 1998-11-04 | Eli Lilly And Company | Substituted heteroaromatic 5-HT 1F agonists |
| US6156767A (en) * | 1997-06-05 | 2000-12-05 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| EP0994708A1 (en) * | 1997-06-05 | 2000-04-26 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US6004984A (en) * | 1997-06-05 | 1999-12-21 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US5981550A (en) * | 1997-06-05 | 1999-11-09 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| JP2002502427A (ja) * | 1997-06-05 | 2002-01-22 | メルク エンド カンパニー インコーポレーテッド | ゴナドトロピン放出ホルモンの拮抗薬 |
| US6156772A (en) * | 1997-06-05 | 2000-12-05 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US5985901A (en) * | 1997-06-05 | 1999-11-16 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| CA2308454A1 (en) * | 1997-10-28 | 1999-05-06 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US6017944A (en) * | 1997-10-28 | 2000-01-25 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US6159975A (en) * | 1998-02-11 | 2000-12-12 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US6228867B1 (en) | 1998-04-02 | 2001-05-08 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US6025366A (en) * | 1998-04-02 | 2000-02-15 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US6077847A (en) * | 1998-04-02 | 2000-06-20 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US5998432A (en) * | 1998-04-02 | 1999-12-07 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US5994352A (en) * | 1998-11-13 | 1999-11-30 | Pfizer Inc. | 5-arylindole derivatives |
| AU3868800A (en) | 1999-03-10 | 2000-09-28 | Merck & Co., Inc. | 6-azaindole compounds as antagonists of gonadotropin releasing hormone |
| AU3514200A (en) | 1999-03-10 | 2000-09-28 | Merck & Co., Inc. | 6-azaindole compounds as antagonists of gonadotropin releasing hormone |
| AU3395000A (en) | 1999-03-10 | 2000-09-28 | Merck & Co., Inc. | 6-azaindole compounds as antagonists of gonadotropin releasing hormone |
| US6620824B2 (en) | 2001-04-11 | 2003-09-16 | Merck & Co., Inc. | Process for the synthesis of gonadotropin releasing hormone antagonists |
| EP2335700A1 (en) * | 2001-07-25 | 2011-06-22 | Boehringer Ingelheim (Canada) Ltd. | Hepatitis C virus polymerase inhibitors with a heterobicylic structure |
| BR0312175A (pt) | 2002-06-21 | 2005-04-05 | Suven Life Sciences Ltd | Composto, composição farmacêutica, uso de um composto, método para o tratamento e método para reduzir a morbidez e a mortalidade associadas com o excesso de peso |
| AU2003249582B2 (en) | 2002-06-21 | 2006-08-03 | Suven Life Sciences Limited | Tetracyclic arylsulfonyl indoles having serotonin receptor affinity |
| MXPA05005700A (es) | 2002-11-28 | 2005-08-16 | Suven Life Sciences Ltd | N-arilsulfonil-3-aminoalcoxiindoles. |
| CA2509982C (en) | 2002-11-28 | 2011-11-08 | Suven Life Sciences Limited | N-arylsulfonyl-3-substituted indoles having serotonin receptor affinity, process for their preparation and pharmaceutical composition containing them |
| EP1572647B1 (en) * | 2002-12-20 | 2016-09-21 | Basf Se | Synthesis of amines and intermediates for the synthesis thereof |
| US7098231B2 (en) * | 2003-01-22 | 2006-08-29 | Boehringer Ingelheim International Gmbh | Viral polymerase inhibitors |
| US7223785B2 (en) * | 2003-01-22 | 2007-05-29 | Boehringer Ingelheim International Gmbh | Viral polymerase inhibitors |
| EP2626354A1 (en) * | 2004-02-20 | 2013-08-14 | Boehringer Ingelheim International GmbH | Viral polymerase inhibitors |
| CA2618682C (en) * | 2005-08-12 | 2011-06-21 | Boehringer Ingelheim International Gmbh | Viral polymerase inhibitors |
| WO2011124704A1 (en) * | 2010-04-09 | 2011-10-13 | Ratiopharm Gmbh | Process for preparing an intermediate for silodosin |
| WO2021226416A1 (en) | 2020-05-08 | 2021-11-11 | Psilera Inc. | Novel compositions of matter and pharmaceutical compositions |
| WO2022104475A1 (en) * | 2020-11-19 | 2022-05-27 | Magicmed Industries Inc. | Nitrilated psilocybin derivatives and methods of using |
| WO2023076150A1 (en) * | 2021-10-29 | 2023-05-04 | Psilera Inc. | Modified indole compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3182071A (en) * | 1961-06-27 | 1965-05-04 | Warner Lambert Pharmaceutical | Acylated indole derivatives |
| NL7316677A (enExample) * | 1972-12-21 | 1974-06-25 | ||
| DE2314489A1 (de) * | 1973-03-23 | 1974-10-03 | Thomae Gmbh Dr K | (+)-3-(2-dimethylamino-1-propyl)-2methyl-3-phenyl-3h-indol, dessen saeureadditionssalze und verfahren zu deren herstellung |
| US3997539A (en) * | 1974-05-31 | 1976-12-14 | American Hoechst Corporation | 3-(4-Acylaminopiperazin-1-yl alkyl)indoles, precursors and processes for the preparation thereof |
-
1979
- 1979-10-02 ZA ZA00795239A patent/ZA795239B/xx unknown
- 1979-10-04 FI FI793071A patent/FI793071A7/fi not_active Application Discontinuation
- 1979-10-08 DE DE19792940687 patent/DE2940687A1/de active Granted
- 1979-10-09 NZ NZ191802A patent/NZ191802A/xx unknown
- 1979-10-09 DK DK425579A patent/DK425579A/da not_active Application Discontinuation
- 1979-10-10 US US06/083,343 patent/US4252803A/en not_active Expired - Lifetime
- 1979-10-10 GB GB7935208A patent/GB2035310B/en not_active Expired
- 1979-10-10 AU AU51657/79A patent/AU531783B2/en not_active Ceased
- 1979-10-11 IT IT50537/79A patent/IT1142170B/it active
- 1979-10-11 CH CH919479A patent/CH646151A5/de not_active IP Right Cessation
- 1979-10-11 ES ES484980A patent/ES484980A0/es active Granted
- 1979-10-11 SE SE7908443A patent/SE448628B/sv not_active IP Right Cessation
- 1979-10-12 CA CA000337443A patent/CA1146550A/en not_active Expired
- 1979-10-12 IE IE1945/79A patent/IE49304B1/en unknown
- 1979-10-12 FR FR7925446A patent/FR2438651A1/fr active Granted
- 1979-10-12 BE BE0/197621A patent/BE879381A/fr not_active IP Right Cessation
- 1979-10-12 NL NL7907583A patent/NL7907583A/xx not_active Application Discontinuation
- 1979-10-12 JP JP13094479A patent/JPS5562063A/ja active Granted
-
1980
- 1980-06-03 ES ES492114A patent/ES8106142A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES492114A0 (es) | 1981-07-16 |
| FR2438651A1 (fr) | 1980-05-09 |
| DE2940687C2 (enExample) | 1991-08-01 |
| SE448628B (sv) | 1987-03-09 |
| US4252803A (en) | 1981-02-24 |
| ES8100261A1 (es) | 1980-11-01 |
| NZ191802A (en) | 1983-02-15 |
| ES8106142A1 (es) | 1981-07-16 |
| GB2035310B (en) | 1982-12-22 |
| FR2438651B1 (enExample) | 1983-03-04 |
| ES484980A0 (es) | 1980-11-01 |
| SE7908443L (sv) | 1980-04-13 |
| IE49304B1 (en) | 1985-09-18 |
| ZA795239B (en) | 1980-11-26 |
| IE791945L (en) | 1980-04-12 |
| CA1146550A (en) | 1983-05-17 |
| BE879381A (fr) | 1980-02-01 |
| FI793071A7 (fi) | 1981-01-01 |
| JPS6358817B2 (enExample) | 1988-11-17 |
| IT7950537A0 (it) | 1979-10-11 |
| AU5165779A (en) | 1980-04-17 |
| DE2940687A1 (de) | 1980-04-30 |
| JPS5562063A (en) | 1980-05-10 |
| AU531783B2 (en) | 1983-09-08 |
| DK425579A (da) | 1980-04-13 |
| NL7907583A (nl) | 1980-04-15 |
| GB2035310A (en) | 1980-06-18 |
| IT1142170B (it) | 1986-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH646151A5 (de) | Indolverbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel. | |
| DE69127260T2 (de) | Therapeutische heterocyclische verbindungen | |
| DE3527648C2 (enExample) | ||
| DE3444572C2 (de) | Indolderivate, Verfahren zu ihrer Herstellung, sie enthaltende pharmazeutische Zubereitungen und ihre Verwendung | |
| DE69227458T2 (de) | Tryptamin analoga, ihre herstellung und anwendung als 5-ht1-artige rezeptoren oder 5-ht2 rezeptor agonisten | |
| DE3131728C2 (enExample) | ||
| DE3320521A1 (de) | Heterocyclische verbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| EP0655440A2 (de) | Indol derivate | |
| DE3310891A1 (de) | Neue indolinon-(2)-derivate, verfahren zu ihrer herstellung, diese verbindungen enthaltende arzneimittel und zwischenprodukte | |
| DE3700408A1 (de) | Indolderivate, sie enthaltende pharmazeutische zubereitungen und verfahren zu ihrer herstellung | |
| JPS62114987A (ja) | 新規4―ベンジル―1―(2h)―フタラジノン―誘導体及びその製法 | |
| DE3132882A1 (de) | Neue piperazinone, ihre herstellung und verwendung | |
| DE1695478A1 (de) | Sulfonamidotryptamine | |
| US4302589A (en) | Cis-mono and disubstituted-2-methyl-3-[(piperazinyl) and (piperidino)ethyl]indolines, intermediates for their preparation and methods of preparation | |
| DE2329430A1 (de) | 1-acyl-3-(amino-niedrig-alkyl)-indole | |
| DE3688397T2 (de) | 3-(2-aminoethyl)indol und -indolinderivate, verfahren zu ihrer herstellung und diese derivate enthaltende pharmazeutische zusammensetzungen. | |
| DE69215482T2 (de) | 2,2'-Alkylendiindolderivate, Verfahren zu ihrer Herstellung, sie enthaltende Arzneimittel und deren Verwendung als Ulcustherapeutikum | |
| DE2313227A1 (de) | Neue isoindolinderivate, ihre herstellung und die medizinischen zusammensetzungen, die sie enthalten | |
| DE2225765A1 (de) | 3- eckige Klammer auf 2-(4-Phenyl-lpiperazinyl)-äthyl eckige Klammer zu -indoline | |
| DE3132915A1 (de) | 1,5-diphenylpyrazolin-3-on-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3300522C2 (enExample) | ||
| EP0172141B1 (de) | Substituierte Pyridazinone, Verfahren zu ihrer Herstellung, pharmazeutische Präparate enthaltend diese Verbindungen und deren Verwendung | |
| DE1695228A1 (de) | Verfahren zur Herstellung von aromatischen Verbindungen | |
| EP0071950B1 (de) | Neue Heteroaryloxypropanolamine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE69111541T2 (de) | Neue Indol- und Indolin-Verbindungen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |