CH642677A5 - Bleich- und reinigungsmittel. - Google Patents
Bleich- und reinigungsmittel. Download PDFInfo
- Publication number
- CH642677A5 CH642677A5 CH869379A CH869379A CH642677A5 CH 642677 A5 CH642677 A5 CH 642677A5 CH 869379 A CH869379 A CH 869379A CH 869379 A CH869379 A CH 869379A CH 642677 A5 CH642677 A5 CH 642677A5
- Authority
- CH
- Switzerland
- Prior art keywords
- bleaching
- compound
- per
- weight
- cleaning agent
- Prior art date
Links
- 239000007844 bleaching agent Substances 0.000 title claims description 28
- 239000003599 detergent Substances 0.000 title claims description 19
- 238000004061 bleaching Methods 0.000 claims description 58
- 150000001875 compounds Chemical class 0.000 claims description 48
- 239000003795 chemical substances by application Substances 0.000 claims description 30
- -1 alkali metal cation Chemical class 0.000 claims description 29
- 239000012190 activator Substances 0.000 claims description 26
- 239000012459 cleaning agent Substances 0.000 claims description 26
- 150000004965 peroxy acids Chemical class 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- 238000005406 washing Methods 0.000 claims description 7
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 claims description 5
- 229960001922 sodium perborate Drugs 0.000 claims description 5
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 238000007086 side reaction Methods 0.000 claims description 3
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical class NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 108090000623 proteins and genes Proteins 0.000 claims 1
- 239000002738 chelating agent Substances 0.000 description 18
- 230000000694 effects Effects 0.000 description 14
- 102000004190 Enzymes Human genes 0.000 description 10
- 108090000790 Enzymes Proteins 0.000 description 10
- 235000014113 dietary fatty acids Nutrition 0.000 description 10
- 239000000194 fatty acid Substances 0.000 description 10
- 229930195729 fatty acid Natural products 0.000 description 10
- 239000011734 sodium Substances 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 239000000271 synthetic detergent Substances 0.000 description 8
- 150000004665 fatty acids Chemical class 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- 239000000654 additive Substances 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 238000005755 formation reaction Methods 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 150000002978 peroxides Chemical class 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 150000003462 sulfoxides Chemical class 0.000 description 4
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 4
- 239000004115 Sodium Silicate Substances 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 3
- 239000002304 perfume Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000003760 tallow Substances 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 244000269722 Thea sinensis Species 0.000 description 2
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 235000019864 coconut oil Nutrition 0.000 description 2
- 239000003240 coconut oil Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 125000001165 hydrophobic group Chemical group 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 2
- 229960003330 pentetic acid Drugs 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920005646 polycarboxylate Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 235000013772 propylene glycol Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- JAXNXAGNWJBENQ-UHFFFAOYSA-N 1-dimethylphosphoryldodecan-2-ol Chemical compound CCCCCCCCCCC(O)CP(C)(C)=O JAXNXAGNWJBENQ-UHFFFAOYSA-N 0.000 description 1
- SIDULKZCBGMXJL-UHFFFAOYSA-N 1-dimethylphosphoryldodecane Chemical compound CCCCCCCCCCCCP(C)(C)=O SIDULKZCBGMXJL-UHFFFAOYSA-N 0.000 description 1
- CLHYKAZPWIRRRD-UHFFFAOYSA-N 1-hydroxypropane-1-sulfonic acid Chemical compound CCC(O)S(O)(=O)=O CLHYKAZPWIRRRD-UHFFFAOYSA-N 0.000 description 1
- CJPDBKNETSCHCH-UHFFFAOYSA-N 1-methylsulfinyldodecane Chemical compound CCCCCCCCCCCCS(C)=O CJPDBKNETSCHCH-UHFFFAOYSA-N 0.000 description 1
- HYTOZULGKGUFII-UHFFFAOYSA-N 1-methylsulfinyltridecan-3-ol Chemical compound CCCCCCCCCCC(O)CCS(C)=O HYTOZULGKGUFII-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-M Superoxide Chemical class [O-][O] OUUQCZGPVNCOIJ-UHFFFAOYSA-M 0.000 description 1
- 244000297179 Syringa vulgaris Species 0.000 description 1
- 235000004338 Syringa vulgaris Nutrition 0.000 description 1
- QKGHBQJLEHAMKJ-DHGKCCLASA-N [(2r,3s,4r,5r,6s)-3,4,6-triacetyloxy-5-azidooxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@@H]1OC(C)=O QKGHBQJLEHAMKJ-DHGKCCLASA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000004973 alkali metal peroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003625 amylolytic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 230000002366 lipolytic effect Effects 0.000 description 1
- 230000002101 lytic effect Effects 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- HNEGQIOMVPPMNR-NSCUHMNNSA-N mesaconic acid Chemical compound OC(=O)C(/C)=C/C(O)=O HNEGQIOMVPPMNR-NSCUHMNNSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- HNEGQIOMVPPMNR-UHFFFAOYSA-N methylfumaric acid Natural products OC(=O)C(C)=CC(O)=O HNEGQIOMVPPMNR-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- NHLUVTZJQOJKCC-UHFFFAOYSA-N n,n-dimethylhexadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCN(C)C NHLUVTZJQOJKCC-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- ATGAWOHQWWULNK-UHFFFAOYSA-I pentapotassium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O ATGAWOHQWWULNK-UHFFFAOYSA-I 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000013966 potassium salts of fatty acid Nutrition 0.000 description 1
- FQLQNUZHYYPPBT-UHFFFAOYSA-N potassium;azane Chemical compound N.[K+] FQLQNUZHYYPPBT-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 235000013875 sodium salts of fatty acid Nutrition 0.000 description 1
- HYHAWELIVMOSBT-UHFFFAOYSA-M sodium;2-aminopentadecanoate Chemical compound [Na+].CCCCCCCCCCCCCC(N)C([O-])=O HYHAWELIVMOSBT-UHFFFAOYSA-M 0.000 description 1
- IWMMSZLFZZPTJY-UHFFFAOYSA-M sodium;3-(dodecylamino)propane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCNCCCS([O-])(=O)=O IWMMSZLFZZPTJY-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- AGGKEGLBGGJEBZ-UHFFFAOYSA-N tetramethylenedisulfotetramine Chemical compound C1N(S2(=O)=O)CN3S(=O)(=O)N1CN2C3 AGGKEGLBGGJEBZ-UHFFFAOYSA-N 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/26—Organic compounds containing nitrogen
- C11D3/33—Amino carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/36—Organic compounds containing phosphorus
- C11D3/364—Organic compounds containing phosphorus containing nitrogen
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
- C11D3/3917—Nitrogen-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7838347 | 1978-09-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH642677A5 true CH642677A5 (de) | 1984-04-30 |
Family
ID=10499946
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH869379A CH642677A5 (de) | 1978-09-27 | 1979-09-27 | Bleich- und reinigungsmittel. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4225452A (enExample) |
| JP (1) | JPS601920B2 (enExample) |
| AT (1) | AT365636B (enExample) |
| AU (1) | AU530055B2 (enExample) |
| BE (1) | BE879048A (enExample) |
| BR (1) | BR7906154A (enExample) |
| CA (1) | CA1113340A (enExample) |
| CH (1) | CH642677A5 (enExample) |
| DE (1) | DE2938731A1 (enExample) |
| DK (1) | DK149334C (enExample) |
| FI (1) | FI64639C (enExample) |
| FR (1) | FR2437442A1 (enExample) |
| IE (1) | IE49302B1 (enExample) |
| IT (1) | IT1119183B (enExample) |
| NL (1) | NL183411C (enExample) |
| NO (1) | NO150003C (enExample) |
| SE (1) | SE442412C (enExample) |
| ZA (1) | ZA795123B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1392284A (en) * | 1971-03-30 | 1975-04-30 | Unilever Ltd | Stabilisation of active oxygen releasing compounds |
| US4259200A (en) * | 1979-04-06 | 1981-03-31 | Lever Brothers Company | Bleaching and cleaning compositions |
| US4257996A (en) * | 1980-04-14 | 1981-03-24 | The Upjohn Company | Process for preparing particle board and polyisocyanate-phosphorus compound release agent composition therefor |
| FR2493294A1 (fr) * | 1980-11-04 | 1982-05-07 | Air Liquide | Compositions stabilisantes pour produits peroxydes |
| US4448705A (en) * | 1982-05-20 | 1984-05-15 | Colgate-Palmolive Company | Monoperoxyphthalic acid bleaching composition containing DTPMP |
| US4378300A (en) * | 1981-12-10 | 1983-03-29 | Colgate-Palmolive Company | Peroxygen bleaching composition |
| US4529534A (en) * | 1982-08-19 | 1985-07-16 | The Procter & Gamble Company | Peroxyacid bleach compositions |
| GB8316760D0 (en) * | 1983-06-20 | 1983-07-20 | Unilever Plc | Detergent bleach compositions |
| US4609616A (en) * | 1984-03-15 | 1986-09-02 | Agfa Gevaert Aktiengesellschaft | Bath composition for bleaching photographic recording materials and bleaching process |
| US4634551A (en) * | 1985-06-03 | 1987-01-06 | Procter & Gamble Company | Bleaching compounds and compositions comprising fatty peroxyacids salts thereof and precursors therefor having amide moieties in the fatty chain |
| GB8415909D0 (en) * | 1984-06-21 | 1984-07-25 | Procter & Gamble Ltd | Peracid compounds |
| DE3822798A1 (de) * | 1988-07-06 | 1990-01-11 | Huels Chemische Werke Ag | Verfahren zur herstellung von phlegmatisierten aliphatischen diperoxidicarbonsaeuren |
| JP2635178B2 (ja) * | 1989-09-01 | 1997-07-30 | 花王株式会社 | 漂白洗浄剤組成物 |
| ZA952081B (en) * | 1994-03-14 | 1996-12-12 | Procter & Gamble | Granular bleaching composition |
| AU702365B2 (en) * | 1994-03-14 | 1999-02-18 | Elli Marie Frasier | Granular bleaching compositions |
| US5641739A (en) * | 1995-05-01 | 1997-06-24 | The Procter & Gamble Company | Aqueous detergent compositions containing chelants which remain undissolved under acidic conditions |
| US5885362A (en) | 1995-07-27 | 1999-03-23 | Mitsubishi Chemical Corporation | Method for treating surface of substrate |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB855735A (en) * | 1958-05-09 | 1960-12-07 | Unilever Ltd | Bleaching processes and compositions |
| AT296332B (de) * | 1968-02-23 | 1972-02-10 | Benckiser Gmbh Joh A | Verfahren zur Herstellung von Aminoalkylenphosphonsäuren organischer Polyamine |
| DE1816347A1 (de) * | 1968-12-21 | 1970-06-25 | Henkel & Cie Gmbh | Waschmittel fuer Textilien aus synthetischen Fasern |
| LU61828A1 (enExample) * | 1970-10-07 | 1972-06-28 | ||
| DE2060762A1 (de) * | 1970-12-10 | 1972-06-22 | Henkel & Cie Gmbh | Mittel zur Herstellung von Kaltbleichflotten,insbesondere von kaltbleichwirksamen Waschlaugen |
| GB1392284A (en) * | 1971-03-30 | 1975-04-30 | Unilever Ltd | Stabilisation of active oxygen releasing compounds |
| BE795085A (fr) * | 1972-03-10 | 1973-05-29 | Benckiser Knapsack Gmbh | Procede de blanchiment de fibres cellulosiques seules ou en melange avec des fibres synthetiques |
| GB1561333A (en) * | 1975-11-03 | 1980-02-20 | Unilever Ltd | Bleaching assistants |
| DE2558593C2 (de) * | 1975-12-24 | 1985-07-25 | Henkel KGaA, 4000 Düsseldorf | Pulverförmige, in ihrem Benetzungsverhalten verbesserte Wasch- und Reinigungsmittel, sowie Verfahren zu deren Herstellung |
| DE2614148A1 (de) * | 1976-04-02 | 1977-10-20 | Henkel & Cie Gmbh | Oxidations-, bleich- und waschmittel mit einem gehalt an bleichaktivatoren |
| GR62863B (en) * | 1976-10-06 | 1979-07-09 | Procter & Gamble | Laundry additive product |
| FR2396114A1 (fr) * | 1977-06-29 | 1979-01-26 | Protex Manuf Prod Chimiq | Perfectionnements aux procedes de blanchiment oxydant |
| NL7815015A (nl) * | 1977-06-29 | 1979-10-31 | Procter & Gamble | Vast wasmiddel ter betere verwijdering van vet vuil. |
| EP0001853B2 (en) * | 1977-11-07 | 1986-01-29 | THE PROCTER & GAMBLE COMPANY | Detergent compositions having improved bleaching effect |
-
1979
- 1979-09-21 FI FI792936A patent/FI64639C/fi not_active IP Right Cessation
- 1979-09-24 US US06/077,962 patent/US4225452A/en not_active Expired - Lifetime
- 1979-09-24 IE IE1803/79A patent/IE49302B1/en unknown
- 1979-09-25 DE DE19792938731 patent/DE2938731A1/de active Granted
- 1979-09-26 NL NLAANVRAGE7907140,A patent/NL183411C/xx not_active IP Right Cessation
- 1979-09-26 IT IT68873/79A patent/IT1119183B/it active
- 1979-09-26 FR FR7923993A patent/FR2437442A1/fr active Granted
- 1979-09-26 AU AU51229/79A patent/AU530055B2/en not_active Ceased
- 1979-09-26 CA CA336,355A patent/CA1113340A/en not_active Expired
- 1979-09-26 ZA ZA00795123A patent/ZA795123B/xx unknown
- 1979-09-26 BR BR7906154A patent/BR7906154A/pt not_active IP Right Cessation
- 1979-09-26 NO NO793096A patent/NO150003C/no unknown
- 1979-09-26 AT AT0630979A patent/AT365636B/de not_active IP Right Cessation
- 1979-09-26 DK DK403979A patent/DK149334C/da not_active IP Right Cessation
- 1979-09-27 JP JP54124673A patent/JPS601920B2/ja not_active Expired
- 1979-09-27 SE SE7908023A patent/SE442412C/sv not_active IP Right Cessation
- 1979-09-27 CH CH869379A patent/CH642677A5/de not_active IP Right Cessation
- 1979-09-27 BE BE0/197360A patent/BE879048A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NO793096L (no) | 1980-03-28 |
| JPS601920B2 (ja) | 1985-01-18 |
| IE49302B1 (en) | 1985-09-18 |
| IT7968873A0 (it) | 1979-09-26 |
| SE7908023L (sv) | 1980-03-28 |
| DK149334B (da) | 1986-05-05 |
| AT365636B (de) | 1982-02-10 |
| NO150003C (no) | 1984-08-08 |
| IE791803L (en) | 1980-03-27 |
| AU530055B2 (en) | 1983-06-30 |
| ZA795123B (en) | 1981-05-27 |
| SE442412B (sv) | 1985-12-23 |
| DE2938731A1 (de) | 1980-04-03 |
| IT1119183B (it) | 1986-03-03 |
| BR7906154A (pt) | 1980-07-15 |
| SE442412C (sv) | 1987-11-16 |
| CA1113340A (en) | 1981-12-01 |
| AU5122979A (en) | 1980-04-03 |
| FI792936A7 (fi) | 1980-03-28 |
| FR2437442A1 (fr) | 1980-04-25 |
| FR2437442B1 (enExample) | 1983-05-27 |
| ATA630979A (de) | 1981-06-15 |
| DE2938731C2 (enExample) | 1987-11-26 |
| JPS5552397A (en) | 1980-04-16 |
| BE879048A (fr) | 1980-03-27 |
| NO150003B (no) | 1984-04-24 |
| NL7907140A (nl) | 1980-03-31 |
| NL183411B (nl) | 1988-05-16 |
| US4225452A (en) | 1980-09-30 |
| FI64639C (fi) | 1983-12-12 |
| NL183411C (nl) | 1988-10-17 |
| DK149334C (da) | 1986-10-20 |
| DK403979A (da) | 1980-03-28 |
| FI64639B (fi) | 1983-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69229957T2 (de) | Acylierte citratester als ausgangsstoffe für persäuren | |
| DE69021129T2 (de) | Bleichaktivierung und Bleichmittel-Zusammensetzungen. | |
| DE3886969T2 (de) | Quartäre Ammonium- oder Phosphonium-Peroxycarbonsäure-Prekursoren und ihre Verwendung in Detergensbleichmittelzusammensetzungen. | |
| DE69222620T2 (de) | Bleichaktivierung unter Verwendung einer Mangan- verbindung und einem organischen Ligand | |
| CH642677A5 (de) | Bleich- und reinigungsmittel. | |
| DE69019781T2 (de) | Bleichmittelzusammensetzung. | |
| EP0869171B1 (de) | Bleichaktive Metall-Komplexe | |
| DE2124526B2 (enExample) | ||
| DE2060762A1 (de) | Mittel zur Herstellung von Kaltbleichflotten,insbesondere von kaltbleichwirksamen Waschlaugen | |
| DE3245169A1 (de) | Bleich- und waschmittelzusammensetzung | |
| DE2652424A1 (de) | Peroxysaeuren und ihre verwendung | |
| DE2652423A1 (de) | Bleich- oder reinigungsmittel und verfahren zum bleichen und/oder reinigen | |
| EP0909810B1 (de) | Verwendung von Aminonitril-N-oxiden als Bleichaktivatoren | |
| CH657627A5 (de) | Stabilisierte teilchenfoermige bleich- und waschmittelzusammensetzung. | |
| EP0373546B1 (de) | Verwendung von triacylierten Ethanolaminen als flüssige, wassermischbare Peroxidaktivatoren | |
| AT394386B (de) | Bleichende koernige waschmittelzusammensetzung | |
| DE2214500C2 (de) | Bleichendes Waschmittel | |
| DE2058397C3 (de) | Detergenshaltige Mittel | |
| DE2616350C3 (enExample) | ||
| DE3807921A1 (de) | Aktivator fuer anorganische perverbindungen | |
| EP0930358B1 (de) | Verwendung von Formamidinium-Salzen als Bleichaktivatoren | |
| AT394575B (de) | Bleich- und waschmittel | |
| DE2250633A1 (de) | Wasch- und reinigungsmittelmischung mit gewebeweichmachenden eigenschaften | |
| DE2349293C3 (de) | Anionaktive und kationenaktive Tenside enthaltende Wasch- und Reinigungsmittel | |
| DE4231466A1 (de) | Aktivatoren für anorganische Perverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |