CH624407A5 - - Google Patents
Download PDFInfo
- Publication number
- CH624407A5 CH624407A5 CH596979A CH596979A CH624407A5 CH 624407 A5 CH624407 A5 CH 624407A5 CH 596979 A CH596979 A CH 596979A CH 596979 A CH596979 A CH 596979A CH 624407 A5 CH624407 A5 CH 624407A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- group
- compound
- carbon atoms
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- -1 methylenedioxy group Chemical group 0.000 claims description 4
- 241000251730 Chondrichthyes Species 0.000 claims description 3
- QANZRMGXJSNJQN-UHFFFAOYSA-N [Li]C1=C(COCC2=C(C=CC=C2)[Li])C=CC=C1.[Li] Chemical compound [Li]C1=C(COCC2=C(C=CC=C2)[Li])C=CC=C1.[Li] QANZRMGXJSNJQN-UHFFFAOYSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 2
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 238000005661 deetherification reaction Methods 0.000 claims 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- IOWGHQGLUMEZKG-UHFFFAOYSA-N (2-bromophenyl)methanol Chemical compound OCC1=CC=CC=C1Br IOWGHQGLUMEZKG-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000001430 anti-depressive effect Effects 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- LSBLTOOILFNPNO-UHFFFAOYSA-N (2-bromo-4-chlorophenyl)methanol Chemical compound OCC1=CC=C(Cl)C=C1Br LSBLTOOILFNPNO-UHFFFAOYSA-N 0.000 description 1
- HXGZPMHPSBJMKB-UHFFFAOYSA-N (2-bromo-5-fluorophenyl)methanol Chemical compound OCC1=CC(F)=CC=C1Br HXGZPMHPSBJMKB-UHFFFAOYSA-N 0.000 description 1
- OWPARZXOXYSXQB-UHFFFAOYSA-N (2-bromo-5-methylphenyl)methanol Chemical compound CC1=CC=C(Br)C(CO)=C1 OWPARZXOXYSXQB-UHFFFAOYSA-N 0.000 description 1
- HUUPVABNAQUEJW-UHFFFAOYSA-N 1-methylpiperidin-4-one Chemical compound CN1CCC(=O)CC1 HUUPVABNAQUEJW-UHFFFAOYSA-N 0.000 description 1
- SLPUTJFVMJPMKV-UHFFFAOYSA-N 1-methylpyrrolidin-3-one Chemical compound CN1CCC(=O)C1 SLPUTJFVMJPMKV-UHFFFAOYSA-N 0.000 description 1
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 description 1
- FUFZNHHSSMCXCZ-UHFFFAOYSA-N 5-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole Chemical compound FC(F)(F)C1=CC=CC(C=2N=C(ON=2)C2CCNCC2)=C1 FUFZNHHSSMCXCZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010021118 Hypotonia Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- NKWNLTSBVALPBR-UHFFFAOYSA-N [2-bromo-4-(trifluoromethyl)phenyl]methanol Chemical compound OCC1=CC=C(C(F)(F)F)C=C1Br NKWNLTSBVALPBR-UHFFFAOYSA-N 0.000 description 1
- RLGKYWLHSNOODU-UHFFFAOYSA-N [Li]C1=CC=CC=C1COCC1=CC=CC=C1[Li] Chemical compound [Li]C1=CC=CC=C1COCC1=CC=CC=C1[Li] RLGKYWLHSNOODU-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 230000036640 muscle relaxation Effects 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/10—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/10—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D263/14—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/685—Compositions containing spiro-condensed pyran compounds or derivatives thereof, as photosensitive substances
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/424,080 US3962259A (en) | 1973-12-12 | 1973-12-12 | 1,3-Dihydrospiro[isobenzofuran]s and derivatives thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH624407A5 true CH624407A5 (enExample) | 1981-07-31 |
Family
ID=23681366
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1646974A CH620214A5 (enExample) | 1973-12-12 | 1974-12-11 | |
| CH596979A CH624407A5 (enExample) | 1973-12-12 | 1979-06-26 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1646974A CH620214A5 (enExample) | 1973-12-12 | 1974-12-11 |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US3962259A (enExample) |
| JP (1) | JPS5089363A (enExample) |
| AT (2) | AT352125B (enExample) |
| BE (1) | BE823279A (enExample) |
| CA (1) | CA1051886A (enExample) |
| CH (2) | CH620214A5 (enExample) |
| DE (1) | DE2458176A1 (enExample) |
| DK (1) | DK142055B (enExample) |
| FR (1) | FR2254332B1 (enExample) |
| GB (1) | GB1495286A (enExample) |
| IE (1) | IE40297B1 (enExample) |
| IL (1) | IL46202A (enExample) |
| LU (1) | LU71460A1 (enExample) |
| NL (1) | NL7415940A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0139138A1 (en) * | 1983-08-25 | 1985-05-02 | Hoechst-Roussel Pharmaceuticals Incorporated | Spiro(benzofuran-azalkanes), a method for their preparation and their use as medicaments |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4241071A (en) * | 1977-01-27 | 1980-12-23 | American Hoechst Corporation | Antidepressant (α-phenyl-2-tolyl)azacycloalkanes |
| US4166120A (en) * | 1978-04-14 | 1979-08-28 | American Hoechst Corporation | Analgesic and tranquilizing benzoylpropyl-spiro[dihydrobenzofuran]piperidines and pyrrolidines |
| US4166119A (en) * | 1978-04-14 | 1979-08-28 | American Hoechst Corporation | Analgesic and tranquilizing spiro[dihydrobenzofuran]piperidines and pyrrolidines |
| US4263317A (en) * | 1979-09-06 | 1981-04-21 | Hoechst-Roussel Pharmaceuticals, Inc. | Spiro[cyclohexane-1,1'(3'H)-isobenzofuran]s |
| US4301292A (en) * | 1979-09-06 | 1981-11-17 | Hoechst-Roussel Pharmaceuticals, Incorporated | 1-[2-(4,5-Dihydro-4,4-dialkyl-2-oxazolyl)phenyl]-4-(dialkylamino)cyclohexanol |
| US4268515A (en) * | 1980-02-04 | 1981-05-19 | Hoechst-Roussel Pharmaceuticals Inc. | Spiro[dihydrobenzofuran-piperidines and-pyrrolidines], pharmaceutical compositions thereof and methods of use thereof |
| FR2498603A1 (fr) * | 1981-01-29 | 1982-07-30 | Delalande Sa | Nouveaux derives spiro-1 isobenzofuranniques et spiro-1 isobenzothiopheniques, leur procede de preparation et leur application en therapeutique |
| FR2519636A2 (en) * | 1982-01-14 | 1983-07-18 | Delalande Sa | Spiro iso:benzofuran and iso:benzothiophene derivs. - with anticonvulsant and analgesic activities |
| US4374137A (en) * | 1981-08-07 | 1983-02-15 | Hoechst-Roussel Pharmaceuticals Inc. | Spiro[benzofuranisoquinoline]s and their use as pharmaceuticals |
| IL96507A0 (en) * | 1989-12-08 | 1991-08-16 | Merck & Co Inc | Nitrogen-containing spirocycles and pharmaceutical compositions containing them |
| US5206240A (en) * | 1989-12-08 | 1993-04-27 | Merck & Co., Inc. | Nitrogen-containing spirocycles |
| CA2037287A1 (en) * | 1990-03-02 | 1991-09-03 | Ben E. Evans | Spirocyclic oxytocin antagonists |
| NZ243065A (en) * | 1991-06-13 | 1995-07-26 | Lundbeck & Co As H | Piperidine derivatives and pharmaceutical compositions |
| US5648352A (en) * | 1991-09-13 | 1997-07-15 | Merck & Co., Inc. | Piperazinylcamphorsulfonyl oxytocin antagonists |
| US5693643A (en) * | 1991-09-16 | 1997-12-02 | Merck & Co., Inc. | Hydantoin and succinimide-substituted derivatives of spiroindanylcamphorsulfonyl oxytocin antagonists |
| DK78692D0 (da) * | 1992-06-12 | 1992-06-12 | Lundbeck & Co As H | Dimere piperidin- og piperazinderivater |
| US5239110A (en) * | 1992-12-30 | 1993-08-24 | Sterling Winthrop, Inc. | Phenylcyclohexanol derivatives as agents for treating CNS disorders |
| WO1995028389A1 (en) * | 1994-04-15 | 1995-10-26 | Yamanouchi Pharmaceutical Co., Ltd. | Spiro compound and medicinal composition thereof |
| KR19990082330A (ko) * | 1996-02-06 | 1999-11-25 | 미즈노 마사루 | 신규 화합물 및 이의 의약 용도 |
| WO1999021543A1 (en) | 1997-10-27 | 1999-05-06 | Sumitomo Pharmaceuticals Co., Ltd. | Amide derivatives |
| US6374762B1 (en) * | 1997-10-27 | 2002-04-23 | Correct Craft, Inc. | Water sport towing apparatus |
| US6166209A (en) * | 1997-12-11 | 2000-12-26 | Hoffmann-La Roche Inc. | Piperidine derivatives |
| AU3837800A (en) * | 1999-04-21 | 2000-11-10 | Sumitomo Pharmaceuticals Company, Limited | Amide derivatives |
| AU3679800A (en) * | 1999-04-23 | 2000-11-10 | Sumitomo Pharmaceuticals Company, Limited | Apoptosis inhibitors |
| WO2002034719A1 (en) * | 2000-04-21 | 2002-05-02 | Sankyo Company, Limited | Nitrogenous saturated heterocycle compounds |
| US20030078278A1 (en) * | 2001-06-26 | 2003-04-24 | Pfizer Inc. | Spiropiperidine compounds as ligands for ORL-1 receptor |
| US7786141B2 (en) * | 2004-08-19 | 2010-08-31 | Vertex Pharmaceuticals Incorporated | Dihydrospiroindene modulators of muscarinic receptors |
| EP2364705A3 (en) * | 2004-08-19 | 2012-04-04 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| NZ555444A (en) * | 2004-11-29 | 2011-01-28 | Vertex Pharma | Modulators of muscarinic receptors |
| WO2007028638A1 (en) | 2005-09-09 | 2007-03-15 | Euro-Celtique S.A. | Fused and spirocycle compounds and the use thereof |
| WO2007076070A2 (en) * | 2005-12-22 | 2007-07-05 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| CA2643320A1 (en) | 2006-02-22 | 2007-09-07 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| RU2008137583A (ru) * | 2006-02-22 | 2010-03-27 | Вертекс Фармасьютикалз Инкорпорейшн (Us) | Спиропиперидины в качестве модуляторов мускариновых рецепторов |
| EP1847542A1 (en) * | 2006-04-21 | 2007-10-24 | Laboratorios del Dr. Esteve S.A. | Spiro[benzopyran] or spiro[benzofuran] derivatives which inhibit the sigma receptor |
| CA2656183A1 (en) * | 2006-06-29 | 2008-01-10 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| CN101553231A (zh) * | 2006-08-15 | 2009-10-07 | 弗特克斯药品有限公司 | 毒蕈碱受体调节剂 |
| CN101573121A (zh) * | 2006-08-18 | 2009-11-04 | 弗特克斯药品有限公司 | 毒蕈碱受体调节剂 |
| WO2009045519A1 (en) * | 2007-10-03 | 2009-04-09 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| EP2563764B1 (en) * | 2010-04-26 | 2015-02-25 | Merck Sharp & Dohme Corp. | Novel spiropiperidine prolylcarboxypeptidase inhibitors |
| TW201643169A (zh) | 2010-07-09 | 2016-12-16 | 艾伯維股份有限公司 | 作為s1p調節劑的螺-哌啶衍生物 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3686186A (en) * | 1970-10-05 | 1972-08-22 | William J Houlihan | Substituted isochroman or phthalan piperidenes |
-
1973
- 1973-12-12 US US05/424,080 patent/US3962259A/en not_active Expired - Lifetime
-
1974
- 1974-12-06 NL NL7415940A patent/NL7415940A/xx not_active Application Discontinuation
- 1974-12-06 IL IL46202A patent/IL46202A/xx unknown
- 1974-12-09 DE DE19742458176 patent/DE2458176A1/de not_active Withdrawn
- 1974-12-11 IE IE2547/74A patent/IE40297B1/en unknown
- 1974-12-11 AT AT988374A patent/AT352125B/de not_active IP Right Cessation
- 1974-12-11 CH CH1646974A patent/CH620214A5/de not_active IP Right Cessation
- 1974-12-11 DK DK645074AA patent/DK142055B/da unknown
- 1974-12-11 LU LU71460A patent/LU71460A1/xx unknown
- 1974-12-11 CA CA215,785A patent/CA1051886A/en not_active Expired
- 1974-12-12 BE BE151443A patent/BE823279A/xx unknown
- 1974-12-12 GB GB53743/74A patent/GB1495286A/en not_active Expired
- 1974-12-12 JP JP49142998A patent/JPS5089363A/ja active Pending
- 1974-12-12 FR FR7441007A patent/FR2254332B1/fr not_active Expired
-
1975
- 1975-07-01 US US05/592,214 patent/US3985889A/en not_active Expired - Lifetime
-
1977
- 1977-11-14 AT AT0812377A patent/AT365191B/de not_active IP Right Cessation
-
1979
- 1979-06-26 CH CH596979A patent/CH624407A5/de not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0139138A1 (en) * | 1983-08-25 | 1985-05-02 | Hoechst-Roussel Pharmaceuticals Incorporated | Spiro(benzofuran-azalkanes), a method for their preparation and their use as medicaments |
Also Published As
| Publication number | Publication date |
|---|---|
| DK142055C (enExample) | 1981-01-12 |
| FR2254332A1 (enExample) | 1975-07-11 |
| IL46202A0 (en) | 1975-03-13 |
| ATA812377A (de) | 1981-05-15 |
| IE40297B1 (en) | 1979-04-25 |
| JPS5089363A (enExample) | 1975-07-17 |
| LU71460A1 (enExample) | 1976-11-11 |
| ATA988374A (de) | 1979-02-15 |
| US3985889A (en) | 1976-10-12 |
| CH620214A5 (enExample) | 1980-11-14 |
| GB1495286A (en) | 1977-12-14 |
| AT365191B (de) | 1981-12-28 |
| CA1051886A (en) | 1979-04-03 |
| DK142055B (da) | 1980-08-18 |
| DE2458176A1 (de) | 1975-06-26 |
| IE40297L (en) | 1975-06-12 |
| BE823279A (enExample) | 1975-06-12 |
| NL7415940A (nl) | 1975-06-16 |
| AT352125B (de) | 1979-09-10 |
| US3962259A (en) | 1976-06-08 |
| IL46202A (en) | 1980-02-29 |
| DK645074A (enExample) | 1975-08-18 |
| FR2254332B1 (enExample) | 1978-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH624407A5 (enExample) | ||
| CH619228A5 (enExample) | ||
| DE69231854T2 (de) | Substituierte (s)-3-phenylpiperidin derivate, deren herstellung und deren verwendung als dopamin autorezeptor antagonisten | |
| DE69106365T2 (de) | Chinuclidinderivate. | |
| EP0004952B1 (de) | Spiro-(dihydrobenzofuranpiperidine und -pyrrolidine) und deren Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung für Arzneimittel | |
| DE69826891T2 (de) | Piperidinderivate | |
| CH462835A (de) | Verfahren zur Herstellung von neuen Triazaspirodecanen und ihren Säureadditionssalzen | |
| EP1015433B1 (de) | Substituierte 1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-10-ole, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| EP0004951A1 (de) | N-(3-Benzoyl-propyl)-spiro-(dihydrobenzofuranpiperidine und -pyrrolidine) und Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung für Arzneimittel | |
| DE2362754C2 (de) | Cyclopropylalkylaminoreste enthaltende Oxazolinverbindungen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2514914A1 (de) | Verfahren zur herstellung tertiaerer amine | |
| DE2314639A1 (de) | Pharmakodynamisch aktive aminoalkyloximaether | |
| DE2840786C2 (enExample) | ||
| DE2816380A1 (de) | Spiro eckige klammer auf indolin- 3,4'-piperidine eckige klammer zu und verwandte verbindungen | |
| DD153550A5 (de) | Verfahren zur herstellung von neuer 1,2,4-oxadiazolin-5-on-derivaten | |
| DE3315157A1 (de) | 4-phenyl-tetrahydro-furano-pyridine, verfahren zu ihrer herstellung und pharmazeutische zusammensetzungen | |
| DE1052403B (de) | Verfahren zur Herstellung von in 3-Stellung substituierten 10-{[1'-Methylpiperidyl-(4 | |
| AT347459B (de) | Verfahren zur herstellung von neuen substi- tuierten 1,3-dihydrospiro(isobenzofuranen) sowie von optischen antipoden und saeure- additionssalzen dieser verbindungen | |
| DE3103080A1 (de) | "spiro (dihydrobenzofuran-piperidine und -pyrrolidine)" | |
| DE2233088A1 (de) | Benzomorphanderivate | |
| AT253507B (de) | Verfahren zur Herstellung von neuen Triazaspiro-(4,5)-decanen und ihren Säureadditionssalzen | |
| DE1645901C3 (de) | gamma-(4-Alkylp!peridino)-p-fluorbutyrophenone und Verfahren zu ihrer Herstellung | |
| DE1445729A1 (de) | Verfahren zur Herstellung von Hexahydro-1-aryl-3-imino-3H-oxazolo-[3,4-a]pyridinen | |
| DE1568104B2 (de) | Tricyclische n-alkylierte derivate des acetamids und verfahren zu ihrer herstellung | |
| DE2127819A1 (de) | 2,6 Methano 3 benzazocine und Ver fahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |