CA1051886A - 1,3-dihydrospiro (isobenzofuran) s and derivatives thereof - Google Patents
1,3-dihydrospiro (isobenzofuran) s and derivatives thereofInfo
- Publication number
- CA1051886A CA1051886A CA215,785A CA215785A CA1051886A CA 1051886 A CA1051886 A CA 1051886A CA 215785 A CA215785 A CA 215785A CA 1051886 A CA1051886 A CA 1051886A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- isobenzofuran
- piperidine
- dihydrospiro
- hydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 title description 6
- 238000000034 method Methods 0.000 claims abstract description 88
- 150000001875 compounds Chemical class 0.000 claims abstract description 31
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 51
- 238000006243 chemical reaction Methods 0.000 claims description 38
- -1 methylene-dioxy Chemical group 0.000 claims description 31
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 18
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000003003 spiro group Chemical group 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 11
- 239000007818 Grignard reagent Substances 0.000 claims description 9
- 150000004795 grignard reagents Chemical class 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- XLCYXINIUJNTPF-UHFFFAOYSA-N 2-(2-bromophenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C(=CC=CC=2)Br)=N1 XLCYXINIUJNTPF-UHFFFAOYSA-N 0.000 claims description 8
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 8
- 230000000694 effects Effects 0.000 claims description 8
- BYOIMOJOKVUNTP-UHFFFAOYSA-N spiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C12=CC=CC=C2COC21CCNCC2 BYOIMOJOKVUNTP-UHFFFAOYSA-N 0.000 claims description 8
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 7
- 239000005977 Ethylene Substances 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- AJECYOIWECOTAK-UHFFFAOYSA-N 1'-methylspiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C1CN(C)CCC21C1=CC=CC=C1C(=O)O2 AJECYOIWECOTAK-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 6
- RNMPNVBLQHYANU-UHFFFAOYSA-N spiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C12=CC=CC=C2C(=O)OC21CCNCC2 RNMPNVBLQHYANU-UHFFFAOYSA-N 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- HUUPVABNAQUEJW-UHFFFAOYSA-N 1-methylpiperidin-4-one Chemical compound CN1CCC(=O)CC1 HUUPVABNAQUEJW-UHFFFAOYSA-N 0.000 claims description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 5
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000011777 magnesium Substances 0.000 claims description 5
- 229910052749 magnesium Inorganic materials 0.000 claims description 5
- VLNHTJQUXLOQHR-UHFFFAOYSA-N 1'-[4-(4-fluorophenyl)-4-oxobutyl]spiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC2(C3=CC=CC=C3C(=O)O2)CC1 VLNHTJQUXLOQHR-UHFFFAOYSA-N 0.000 claims description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 150000002641 lithium Chemical class 0.000 claims description 4
- 229910052744 lithium Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- RZXNEAPKBXXMQP-UHFFFAOYSA-N 1'-benzylspiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C12=CC=CC=C2C(=O)OC1(CC1)CCN1CC1=CC=CC=C1 RZXNEAPKBXXMQP-UHFFFAOYSA-N 0.000 claims description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical class NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 3
- GYSDELHGKNCJME-UHFFFAOYSA-N 2-bromo-n-(1-hydroxy-2-methylpropan-2-yl)benzamide Chemical compound OCC(C)(C)NC(=O)C1=CC=CC=C1Br GYSDELHGKNCJME-UHFFFAOYSA-N 0.000 claims description 3
- ICMJMKOIRYHDBC-UHFFFAOYSA-N 4-[2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)phenyl]-1-methylpiperidin-4-ol Chemical compound C1CN(C)CCC1(O)C1=CC=CC=C1C1=NC(C)(C)CO1 ICMJMKOIRYHDBC-UHFFFAOYSA-N 0.000 claims description 3
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 3
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- UXXLTPGCINZEFM-UHFFFAOYSA-N 1-[4-chloro-1-(4-fluorophenyl)butyl]-4-fluorobenzene Chemical compound C1=CC(F)=CC=C1C(CCCCl)C1=CC=C(F)C=C1 UXXLTPGCINZEFM-UHFFFAOYSA-N 0.000 claims description 2
- XRXMNWGCKISMOH-UHFFFAOYSA-N 2-bromobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Br XRXMNWGCKISMOH-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 claims description 2
- 239000000460 chlorine Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims description 2
- 239000012024 dehydrating agents Substances 0.000 claims description 2
- LIIZLWVDCMQADD-UHFFFAOYSA-N ethyl spiro[1h-2-benzofuran-3,4'-piperidine]-1'-carboxylate Chemical compound C1CN(C(=O)OCC)CCC21C1=CC=CC=C1CO2 LIIZLWVDCMQADD-UHFFFAOYSA-N 0.000 claims description 2
- 230000000875 corresponding effect Effects 0.000 claims 15
- 230000008569 process Effects 0.000 claims 12
- 239000000047 product Substances 0.000 claims 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 6
- 239000000126 substance Substances 0.000 claims 6
- 125000003342 alkenyl group Chemical group 0.000 claims 3
- MLOWDNZWSWEGMA-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-spiro[1h-2-benzofuran-3,4'-piperidine]-1'-ylbutan-1-one Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC2(C3=CC=CC=C3CO2)CC1 MLOWDNZWSWEGMA-UHFFFAOYSA-N 0.000 claims 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims 2
- 238000007363 ring formation reaction Methods 0.000 claims 2
- MGEGQMSBUDAOJA-UHFFFAOYSA-N 1-benzyl-4-[2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)phenyl]piperidin-4-ol Chemical compound CC1(C)COC(C=2C(=CC=CC=2)C2(O)CCN(CC=3C=CC=CC=3)CC2)=N1 MGEGQMSBUDAOJA-UHFFFAOYSA-N 0.000 claims 1
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 claims 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 claims 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- QANZRMGXJSNJQN-UHFFFAOYSA-N [Li]C1=C(COCC2=C(C=CC=C2)[Li])C=CC=C1.[Li] Chemical compound [Li]C1=C(COCC2=C(C=CC=C2)[Li])C=CC=C1.[Li] QANZRMGXJSNJQN-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000002252 acyl group Chemical group 0.000 claims 1
- 150000005215 alkyl ethers Chemical class 0.000 claims 1
- 238000003776 cleavage reaction Methods 0.000 claims 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 239000011737 fluorine Chemical group 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 1
- 230000007017 scission Effects 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 239000000730 antalgic agent Substances 0.000 abstract description 4
- 239000000543 intermediate Substances 0.000 abstract description 2
- 239000003204 tranquilizing agent Substances 0.000 abstract description 2
- 230000002936 tranquilizing effect Effects 0.000 abstract description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 40
- 239000013078 crystal Substances 0.000 description 39
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- 229960001701 chloroform Drugs 0.000 description 20
- 239000000203 mixture Substances 0.000 description 17
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000007787 solid Substances 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 239000002904 solvent Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 238000004458 analytical method Methods 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- 229940093956 potassium carbonate Drugs 0.000 description 11
- 235000011181 potassium carbonates Nutrition 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000010992 reflux Methods 0.000 description 8
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- AWNXKZVIZARMME-UHFFFAOYSA-N 1-[[5-[2-[(2-chloropyridin-4-yl)amino]pyrimidin-4-yl]-4-(cyclopropylmethyl)pyrimidin-2-yl]amino]-2-methylpropan-2-ol Chemical compound N=1C(NCC(C)(O)C)=NC=C(C=2N=C(NC=3C=C(Cl)N=CC=3)N=CC=2)C=1CC1CC1 AWNXKZVIZARMME-UHFFFAOYSA-N 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- CPIXUPDASCPXET-UHFFFAOYSA-N 1'-(3-oxo-3-phenylpropyl)spiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C1CC2(C3=CC=CC=C3C(=O)O2)CCN1CCC(=O)C1=CC=CC=C1 CPIXUPDASCPXET-UHFFFAOYSA-N 0.000 description 3
- SIQDXHZYYJAKLH-UHFFFAOYSA-N 1'-[4,4-bis(4-fluorophenyl)butyl]spiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCN1CCC2(C3=CC=CC=C3C(=O)O2)CC1 SIQDXHZYYJAKLH-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- IOWGHQGLUMEZKG-UHFFFAOYSA-N (2-bromophenyl)methanol Chemical compound OCC1=CC=CC=C1Br IOWGHQGLUMEZKG-UHFFFAOYSA-N 0.000 description 2
- BTANRVKWQNVYAZ-SCSAIBSYSA-N (2R)-butan-2-ol Chemical compound CC[C@@H](C)O BTANRVKWQNVYAZ-SCSAIBSYSA-N 0.000 description 2
- NNCNIXZKXXUHRQ-UHFFFAOYSA-N 1'-(2-phenylethyl)spiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C12=CC=CC=C2C(=O)OC1(CC1)CCN1CCC1=CC=CC=C1 NNCNIXZKXXUHRQ-UHFFFAOYSA-N 0.000 description 2
- QLXKUZHMLWYSFR-UHFFFAOYSA-N 1'-[4-(4-fluorophenyl)-4-oxobutyl]spiro[2-benzofuran-3,3'-piperidine]-1-one Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CC2(C3=CC=CC=C3C(=O)O2)CCC1 QLXKUZHMLWYSFR-UHFFFAOYSA-N 0.000 description 2
- QUZXRGPANCATEX-UHFFFAOYSA-N 2-(2-chloro-4-fluorophenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C(=CC(F)=CC=2)Cl)=N1 QUZXRGPANCATEX-UHFFFAOYSA-N 0.000 description 2
- SKXKZDUTELKKAV-UHFFFAOYSA-N 2-(6-bromo-1,3-benzodioxol-5-yl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C(=CC=3OCOC=3C=2)Br)=N1 SKXKZDUTELKKAV-UHFFFAOYSA-N 0.000 description 2
- LMMMAMQFBVGSSV-UHFFFAOYSA-N 2-bromo-n-(1-hydroxy-2-methylpropan-2-yl)-4,5-dimethoxybenzamide Chemical compound COC1=CC(Br)=C(C(=O)NC(C)(C)CO)C=C1OC LMMMAMQFBVGSSV-UHFFFAOYSA-N 0.000 description 2
- YXLYUMKNPBVOKB-UHFFFAOYSA-N 2-bromo-n-(1-hydroxy-2-methylpropan-2-yl)-5-methoxybenzamide Chemical compound COC1=CC=C(Br)C(C(=O)NC(C)(C)CO)=C1 YXLYUMKNPBVOKB-UHFFFAOYSA-N 0.000 description 2
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 2
- OBAJFBHNCQOLOB-UHFFFAOYSA-N 4-[2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)-5-methoxyphenyl]-1-methylpiperidin-4-ol Chemical compound C1CN(C)CCC1(O)C1=CC(OC)=CC=C1C1=NC(C)(C)CO1 OBAJFBHNCQOLOB-UHFFFAOYSA-N 0.000 description 2
- ODZAKGBCCCWUBT-UHFFFAOYSA-N 4-[2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)phenyl]-1-(2-phenylethyl)piperidin-4-ol Chemical compound CC1(C)COC(C=2C(=CC=CC=2)C2(O)CCN(CCC=3C=CC=CC=3)CC2)=N1 ODZAKGBCCCWUBT-UHFFFAOYSA-N 0.000 description 2
- MDRXVQCEVGOKAF-UHFFFAOYSA-N 5,6-dimethoxyspiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C1=2C=C(OC)C(OC)=CC=2C(=O)OC21CCNCC2 MDRXVQCEVGOKAF-UHFFFAOYSA-N 0.000 description 2
- RVASDLMJJGXVFX-UHFFFAOYSA-N 6-fluoro-1'-methylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1CN(C)CCC21C1=CC=C(F)C=C1CO2 RVASDLMJJGXVFX-UHFFFAOYSA-N 0.000 description 2
- MATVMNOLBQPVEY-UHFFFAOYSA-N 6-methoxy-1'-methylspiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C=1C(OC)=CC=C2C=1C(=O)OC21CCN(C)CC1 MATVMNOLBQPVEY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 2
- 238000010306 acid treatment Methods 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000036407 pain Effects 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000012289 standard assay Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- LSBLTOOILFNPNO-UHFFFAOYSA-N (2-bromo-4-chlorophenyl)methanol Chemical compound OCC1=CC=C(Cl)C=C1Br LSBLTOOILFNPNO-UHFFFAOYSA-N 0.000 description 1
- HXGZPMHPSBJMKB-UHFFFAOYSA-N (2-bromo-5-fluorophenyl)methanol Chemical compound OCC1=CC(F)=CC=C1Br HXGZPMHPSBJMKB-UHFFFAOYSA-N 0.000 description 1
- OWPARZXOXYSXQB-UHFFFAOYSA-N (2-bromo-5-methylphenyl)methanol Chemical compound CC1=CC=C(Br)C(CO)=C1 OWPARZXOXYSXQB-UHFFFAOYSA-N 0.000 description 1
- GZTFUVZVLYUPRG-IZZDOVSWSA-N (e)-3-(4-tert-butylphenyl)-n-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide Chemical compound C1=CC(C(C)(C)C)=CC=C1\C=C\C(=O)NC1=CC=C(OCCO2)C2=C1 GZTFUVZVLYUPRG-IZZDOVSWSA-N 0.000 description 1
- CMJBLJGHSMJEHO-UHFFFAOYSA-N 1',6-dimethylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1CN(C)CCC21C1=CC=C(C)C=C1CO2 CMJBLJGHSMJEHO-UHFFFAOYSA-N 0.000 description 1
- ISKRYHWOYLPLKB-UHFFFAOYSA-N 1'-(3-hydroxy-3-phenylpropyl)spiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C1CC2(C3=CC=CC=C3C(=O)O2)CCN1CCC(O)C1=CC=CC=C1 ISKRYHWOYLPLKB-UHFFFAOYSA-N 0.000 description 1
- JQZMYHGPOGEZMA-UHFFFAOYSA-N 1'-[4,4-bis(4-fluorophenyl)butyl]spiro[1h-2-benzofuran-3,4'-piperidine];hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCN1CCC2(C3=CC=CC=C3CO2)CC1 JQZMYHGPOGEZMA-UHFFFAOYSA-N 0.000 description 1
- FYQKSUZQIDWWNZ-UHFFFAOYSA-N 1'-[4-(4-fluorophenyl)-4-oxobutyl]-5,6-dimethoxyspiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C1=2C=C(OC)C(OC)=CC=2C(=O)OC1(CC1)CCN1CCCC(=O)C1=CC=C(F)C=C1 FYQKSUZQIDWWNZ-UHFFFAOYSA-N 0.000 description 1
- QOWYAZGBNNEQOA-UHFFFAOYSA-N 1'-benzyl-5,6-dimethoxyspiro[2-benzofuran-3,4'-piperidine]-1-one Chemical compound C1=2C=C(OC)C(OC)=CC=2C(=O)OC1(CC1)CCN1CC1=CC=CC=C1 QOWYAZGBNNEQOA-UHFFFAOYSA-N 0.000 description 1
- BJWNQTUJQZYZKK-UHFFFAOYSA-N 1'-methyl-5-(trifluoromethyl)spiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1CN(C)CCC21C1=CC(C(F)(F)F)=CC=C1CO2 BJWNQTUJQZYZKK-UHFFFAOYSA-N 0.000 description 1
- TZPJHVDZYSEZKG-UHFFFAOYSA-N 1'-methylspiro[1h-2-benzofuran-3,3'-pyrrolidine] Chemical compound C1N(C)CCC21C1=CC=CC=C1CO2 TZPJHVDZYSEZKG-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- BNRCAYZORAYGBE-UHFFFAOYSA-N 1,3,2-dioxazetidin-2-yl(phenyl)methanone Chemical compound C=1C=CC=CC=1C(=O)N1OCO1 BNRCAYZORAYGBE-UHFFFAOYSA-N 0.000 description 1
- OHNMYFOLDDPTQR-UHFFFAOYSA-N 1-benzyl-3-[2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)phenyl]piperidin-3-ol Chemical compound CC1(C)COC(C=2C(=CC=CC=2)C2(O)CN(CC=3C=CC=CC=3)CCC2)=N1 OHNMYFOLDDPTQR-UHFFFAOYSA-N 0.000 description 1
- LOYZVRIHVZEDMW-UHFFFAOYSA-N 1-bromo-3-methylbut-2-ene Chemical compound CC(C)=CCBr LOYZVRIHVZEDMW-UHFFFAOYSA-N 0.000 description 1
- OCNWYKFGWLGNHZ-UHFFFAOYSA-N 1-butylpiperidin-4-one Chemical compound CCCCN1CCC(=O)CC1 OCNWYKFGWLGNHZ-UHFFFAOYSA-N 0.000 description 1
- BAUWRHPMUVYFOD-UHFFFAOYSA-N 1-methylpiperidin-4-ol Chemical compound CN1CCC(O)CC1 BAUWRHPMUVYFOD-UHFFFAOYSA-N 0.000 description 1
- ILZYXPIIYMNWEE-UHFFFAOYSA-N 2-(2-bromo-4,5-dimethoxyphenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound C1=C(OC)C(OC)=CC(Br)=C1C1=NC(C)(C)CO1 ILZYXPIIYMNWEE-UHFFFAOYSA-N 0.000 description 1
- MKLPVCPLEZZAQM-UHFFFAOYSA-N 2-(2-bromo-5-methoxyphenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound COC1=CC=C(Br)C(C=2OCC(C)(C)N=2)=C1 MKLPVCPLEZZAQM-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- UCEXMJMSILZCHZ-UHFFFAOYSA-N 2-[(4-butoxybenzoyl)amino]acetic acid Chemical compound CCCCOC1=CC=C(C(=O)NCC(O)=O)C=C1 UCEXMJMSILZCHZ-UHFFFAOYSA-N 0.000 description 1
- LMFNTOPITQZOCK-UHFFFAOYSA-N 2-chloro-4-fluoro-n-(1-hydroxy-2-methylpropan-2-yl)benzamide Chemical compound OCC(C)(C)NC(=O)C1=CC=C(F)C=C1Cl LMFNTOPITQZOCK-UHFFFAOYSA-N 0.000 description 1
- POIAZJJVWRVLBO-UHFFFAOYSA-N 2-chloro-4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C(Cl)=C1 POIAZJJVWRVLBO-UHFFFAOYSA-N 0.000 description 1
- JWYXZJIPWLIKSZ-UHFFFAOYSA-N 3'-benzylspiro[1,3-dioxolane-2,8'-3-azabicyclo[3.2.1]octane] Chemical compound C=1C=CC=CC=1CN(C1)CC2CCC1C21OCCO1 JWYXZJIPWLIKSZ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- KOAMXHRRVFDWRQ-UHFFFAOYSA-N 4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC=N1 KOAMXHRRVFDWRQ-UHFFFAOYSA-N 0.000 description 1
- ZBBRFBRDGASGLA-UHFFFAOYSA-N 4-(3-chloro-1-hydroxy-6-methylcyclohexa-2,4-dien-1-yl)-1-methylpiperidin-4-ol Chemical compound ClC1=CC(C(C=C1)C)(O)C1(CCN(CC1)C)O ZBBRFBRDGASGLA-UHFFFAOYSA-N 0.000 description 1
- PEGXQOCWSVICBN-UHFFFAOYSA-N 4-[2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)phenyl]-1-methylazepan-4-ol Chemical compound C1CN(C)CCCC1(O)C1=CC=CC=C1C1=NC(C)(C)CO1 PEGXQOCWSVICBN-UHFFFAOYSA-N 0.000 description 1
- RZGAENGFJFRMLS-UHFFFAOYSA-N 6-bromo-1,3-benzodioxole-5-carbonyl chloride Chemical compound C1=C(Br)C(C(=O)Cl)=CC2=C1OCO2 RZGAENGFJFRMLS-UHFFFAOYSA-N 0.000 description 1
- QORHELIFDRVNPI-UHFFFAOYSA-N 6-bromo-n-(1-hydroxy-2-methylpropan-2-yl)-1,3-benzodioxole-5-carboxamide Chemical compound C1=C(Br)C(C(=O)NC(C)(CO)C)=CC2=C1OCO2 QORHELIFDRVNPI-UHFFFAOYSA-N 0.000 description 1
- LVOAQCRVNAPOBT-UHFFFAOYSA-N 6-methoxy-1'-methylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C=1C(OC)=CC=C2C=1COC21CCN(C)CC1 LVOAQCRVNAPOBT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000861718 Chloris <Aves> Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010021118 Hypotonia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- NKWNLTSBVALPBR-UHFFFAOYSA-N [2-bromo-4-(trifluoromethyl)phenyl]methanol Chemical compound OCC1=CC=C(C(F)(F)F)C=C1Br NKWNLTSBVALPBR-UHFFFAOYSA-N 0.000 description 1
- ZNVASENTCOLNJT-UHFFFAOYSA-N [2-chloroethoxy(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(OCCCl)C1=CC=CC=C1 ZNVASENTCOLNJT-UHFFFAOYSA-N 0.000 description 1
- RLGKYWLHSNOODU-UHFFFAOYSA-N [Li]C1=CC=CC=C1COCC1=CC=CC=C1[Li] Chemical compound [Li]C1=CC=CC=C1COCC1=CC=CC=C1[Li] RLGKYWLHSNOODU-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 239000000159 acid neutralizing agent Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- WIRUZQNBHNAMAB-UHFFFAOYSA-N benzene;cyclohexane Chemical compound C1CCCCC1.C1=CC=CC=C1 WIRUZQNBHNAMAB-UHFFFAOYSA-N 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- OXLXKYYXGYHBII-UHFFFAOYSA-N ethyl 3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carboxylate Chemical compound C1CN(C(=O)OCC)CCC21C1=CC=CC=C1C(=O)O2 OXLXKYYXGYHBII-UHFFFAOYSA-N 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical class II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- STZCRXQWRGQSJD-GEEYTBSJSA-M methyl orange Chemical compound [Na+].C1=CC(N(C)C)=CC=C1\N=N\C1=CC=C(S([O-])(=O)=O)C=C1 STZCRXQWRGQSJD-GEEYTBSJSA-M 0.000 description 1
- 229940012189 methyl orange Drugs 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 230000036640 muscle relaxation Effects 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- YDJXNYNKKXZBMP-UHFFFAOYSA-N n-phenethyl-4-piperidinone Chemical compound C1CC(=O)CCN1CCC1=CC=CC=C1 YDJXNYNKKXZBMP-UHFFFAOYSA-N 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 229940065347 propoxyphene hydrochloride Drugs 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- TZVXKRQCQSKVAY-UHFFFAOYSA-N spiro[2-benzofuran-3,3'-piperidine]-1-one Chemical compound C12=CC=CC=C2C(=O)OC21CCCNC2 TZVXKRQCQSKVAY-UHFFFAOYSA-N 0.000 description 1
- BRDKSYZPIQLKJI-UHFFFAOYSA-N spiro[2-benzofuran-3,3'-pyrrolidine]-1-one Chemical compound C12=CC=CC=C2C(=O)OC21CCNC2 BRDKSYZPIQLKJI-UHFFFAOYSA-N 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/10—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/10—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D263/14—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/685—Compositions containing spiro-condensed pyran compounds or derivatives thereof, as photosensitive substances
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/424,080 US3962259A (en) | 1973-12-12 | 1973-12-12 | 1,3-Dihydrospiro[isobenzofuran]s and derivatives thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1051886A true CA1051886A (en) | 1979-04-03 |
Family
ID=23681366
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA215,785A Expired CA1051886A (en) | 1973-12-12 | 1974-12-11 | 1,3-dihydrospiro (isobenzofuran) s and derivatives thereof |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US3962259A (enExample) |
| JP (1) | JPS5089363A (enExample) |
| AT (2) | AT352125B (enExample) |
| BE (1) | BE823279A (enExample) |
| CA (1) | CA1051886A (enExample) |
| CH (2) | CH620214A5 (enExample) |
| DE (1) | DE2458176A1 (enExample) |
| DK (1) | DK142055B (enExample) |
| FR (1) | FR2254332B1 (enExample) |
| GB (1) | GB1495286A (enExample) |
| IE (1) | IE40297B1 (enExample) |
| IL (1) | IL46202A (enExample) |
| LU (1) | LU71460A1 (enExample) |
| NL (1) | NL7415940A (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4241071A (en) * | 1977-01-27 | 1980-12-23 | American Hoechst Corporation | Antidepressant (α-phenyl-2-tolyl)azacycloalkanes |
| US4166120A (en) * | 1978-04-14 | 1979-08-28 | American Hoechst Corporation | Analgesic and tranquilizing benzoylpropyl-spiro[dihydrobenzofuran]piperidines and pyrrolidines |
| US4166119A (en) * | 1978-04-14 | 1979-08-28 | American Hoechst Corporation | Analgesic and tranquilizing spiro[dihydrobenzofuran]piperidines and pyrrolidines |
| US4301292A (en) * | 1979-09-06 | 1981-11-17 | Hoechst-Roussel Pharmaceuticals, Incorporated | 1-[2-(4,5-Dihydro-4,4-dialkyl-2-oxazolyl)phenyl]-4-(dialkylamino)cyclohexanol |
| US4263317A (en) * | 1979-09-06 | 1981-04-21 | Hoechst-Roussel Pharmaceuticals, Inc. | Spiro[cyclohexane-1,1'(3'H)-isobenzofuran]s |
| US4268515A (en) * | 1980-02-04 | 1981-05-19 | Hoechst-Roussel Pharmaceuticals Inc. | Spiro[dihydrobenzofuran-piperidines and-pyrrolidines], pharmaceutical compositions thereof and methods of use thereof |
| FR2519636A2 (en) * | 1982-01-14 | 1983-07-18 | Delalande Sa | Spiro iso:benzofuran and iso:benzothiophene derivs. - with anticonvulsant and analgesic activities |
| FR2498603A1 (fr) * | 1981-01-29 | 1982-07-30 | Delalande Sa | Nouveaux derives spiro-1 isobenzofuranniques et spiro-1 isobenzothiopheniques, leur procede de preparation et leur application en therapeutique |
| US4374137A (en) * | 1981-08-07 | 1983-02-15 | Hoechst-Roussel Pharmaceuticals Inc. | Spiro[benzofuranisoquinoline]s and their use as pharmaceuticals |
| US4452802A (en) * | 1983-08-25 | 1984-06-05 | Hoechst-Roussel Pharmaceuticals Incorporated | Antihypertensive spiro[benzofuran-azalkanes] |
| US5206240A (en) * | 1989-12-08 | 1993-04-27 | Merck & Co., Inc. | Nitrogen-containing spirocycles |
| IL96507A0 (en) * | 1989-12-08 | 1991-08-16 | Merck & Co Inc | Nitrogen-containing spirocycles and pharmaceutical compositions containing them |
| EP0450761A1 (en) * | 1990-03-02 | 1991-10-09 | Merck & Co. Inc. | Spirocyclic oxytocin antagonists |
| NZ243065A (en) * | 1991-06-13 | 1995-07-26 | Lundbeck & Co As H | Piperidine derivatives and pharmaceutical compositions |
| US5648352A (en) * | 1991-09-13 | 1997-07-15 | Merck & Co., Inc. | Piperazinylcamphorsulfonyl oxytocin antagonists |
| US5693643A (en) * | 1991-09-16 | 1997-12-02 | Merck & Co., Inc. | Hydantoin and succinimide-substituted derivatives of spiroindanylcamphorsulfonyl oxytocin antagonists |
| DK78692D0 (da) * | 1992-06-12 | 1992-06-12 | Lundbeck & Co As H | Dimere piperidin- og piperazinderivater |
| US5239110A (en) * | 1992-12-30 | 1993-08-24 | Sterling Winthrop, Inc. | Phenylcyclohexanol derivatives as agents for treating CNS disorders |
| WO1995028389A1 (en) * | 1994-04-15 | 1995-10-26 | Yamanouchi Pharmaceutical Co., Ltd. | Spiro compound and medicinal composition thereof |
| AU1618697A (en) * | 1996-02-06 | 1997-08-28 | Japan Tobacco Inc. | Novel compounds and pharmaceutical use thereof |
| ATE284684T1 (de) | 1997-10-27 | 2005-01-15 | Sumitomo Pharma | Amidderivate zur behandlung neurodegenerativer erkrankungen der netzhaut |
| US6374762B1 (en) * | 1997-10-27 | 2002-04-23 | Correct Craft, Inc. | Water sport towing apparatus |
| US6166209A (en) * | 1997-12-11 | 2000-12-26 | Hoffmann-La Roche Inc. | Piperidine derivatives |
| WO2000064859A1 (en) * | 1999-04-21 | 2000-11-02 | Sumitomo Pharmaceuticals Co., Ltd. | Amide derivatives |
| WO2000064430A1 (en) * | 1999-04-23 | 2000-11-02 | Sumitomo Pharmaceuticals Co., Ltd. | Apoptosis inhibitors |
| WO2002034719A1 (en) * | 2000-04-21 | 2002-05-02 | Sankyo Company, Limited | Nitrogenous saturated heterocycle compounds |
| US20030078278A1 (en) * | 2001-06-26 | 2003-04-24 | Pfizer Inc. | Spiropiperidine compounds as ligands for ORL-1 receptor |
| US7786141B2 (en) * | 2004-08-19 | 2010-08-31 | Vertex Pharmaceuticals Incorporated | Dihydrospiroindene modulators of muscarinic receptors |
| US7879834B2 (en) | 2004-08-19 | 2011-02-01 | Vertex Pharmaceuticals Incorporated | Spiroindoline modulators of muscarinic receptors |
| US7863449B2 (en) * | 2004-11-29 | 2011-01-04 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| EP1943250A1 (en) | 2005-09-09 | 2008-07-16 | Euro-Celtique S.A. | Fused and spirocycle compounds and the use thereof |
| AU2006330866A1 (en) * | 2005-12-22 | 2007-07-05 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| JP2009527568A (ja) | 2006-02-22 | 2009-07-30 | バーテックス ファーマシューティカルズ インコーポレイテッド | ムスカリン受容体の調節剤 |
| JP2009527569A (ja) * | 2006-02-22 | 2009-07-30 | バーテックス ファーマシューティカルズ インコーポレイテッド | ムスカリン受容体の調節剤 |
| EP1847542A1 (en) * | 2006-04-21 | 2007-10-24 | Laboratorios del Dr. Esteve S.A. | Spiro[benzopyran] or spiro[benzofuran] derivatives which inhibit the sigma receptor |
| CN101500565A (zh) * | 2006-06-29 | 2009-08-05 | 弗特克斯药品有限公司 | 毒蕈碱性受体的调节剂 |
| US7696201B2 (en) * | 2006-08-15 | 2010-04-13 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| AU2007284350A1 (en) * | 2006-08-18 | 2008-02-21 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| WO2009045519A1 (en) * | 2007-10-03 | 2009-04-09 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| EP2563764B1 (en) * | 2010-04-26 | 2015-02-25 | Merck Sharp & Dohme Corp. | Novel spiropiperidine prolylcarboxypeptidase inhibitors |
| TW201643169A (zh) | 2010-07-09 | 2016-12-16 | 艾伯維股份有限公司 | 作為s1p調節劑的螺-哌啶衍生物 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3686186A (en) * | 1970-10-05 | 1972-08-22 | William J Houlihan | Substituted isochroman or phthalan piperidenes |
-
1973
- 1973-12-12 US US05/424,080 patent/US3962259A/en not_active Expired - Lifetime
-
1974
- 1974-12-06 NL NL7415940A patent/NL7415940A/xx not_active Application Discontinuation
- 1974-12-06 IL IL46202A patent/IL46202A/xx unknown
- 1974-12-09 DE DE19742458176 patent/DE2458176A1/de not_active Withdrawn
- 1974-12-11 CH CH1646974A patent/CH620214A5/de not_active IP Right Cessation
- 1974-12-11 LU LU71460A patent/LU71460A1/xx unknown
- 1974-12-11 DK DK645074AA patent/DK142055B/da unknown
- 1974-12-11 IE IE2547/74A patent/IE40297B1/en unknown
- 1974-12-11 AT AT988374A patent/AT352125B/de not_active IP Right Cessation
- 1974-12-11 CA CA215,785A patent/CA1051886A/en not_active Expired
- 1974-12-12 JP JP49142998A patent/JPS5089363A/ja active Pending
- 1974-12-12 FR FR7441007A patent/FR2254332B1/fr not_active Expired
- 1974-12-12 BE BE151443A patent/BE823279A/xx unknown
- 1974-12-12 GB GB53743/74A patent/GB1495286A/en not_active Expired
-
1975
- 1975-07-01 US US05/592,214 patent/US3985889A/en not_active Expired - Lifetime
-
1977
- 1977-11-14 AT AT0812377A patent/AT365191B/de not_active IP Right Cessation
-
1979
- 1979-06-26 CH CH596979A patent/CH624407A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL7415940A (nl) | 1975-06-16 |
| AT365191B (de) | 1981-12-28 |
| LU71460A1 (enExample) | 1976-11-11 |
| GB1495286A (en) | 1977-12-14 |
| JPS5089363A (enExample) | 1975-07-17 |
| US3985889A (en) | 1976-10-12 |
| DK142055C (enExample) | 1981-01-12 |
| IE40297L (en) | 1975-06-12 |
| FR2254332A1 (enExample) | 1975-07-11 |
| US3962259A (en) | 1976-06-08 |
| DK142055B (da) | 1980-08-18 |
| IE40297B1 (en) | 1979-04-25 |
| FR2254332B1 (enExample) | 1978-07-21 |
| DE2458176A1 (de) | 1975-06-26 |
| DK645074A (enExample) | 1975-08-18 |
| CH624407A5 (enExample) | 1981-07-31 |
| ATA988374A (de) | 1979-02-15 |
| IL46202A0 (en) | 1975-03-13 |
| CH620214A5 (enExample) | 1980-11-14 |
| IL46202A (en) | 1980-02-29 |
| AT352125B (de) | 1979-09-10 |
| BE823279A (enExample) | 1975-06-12 |
| ATA812377A (de) | 1981-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1051886A (en) | 1,3-dihydrospiro (isobenzofuran) s and derivatives thereof | |
| US3959475A (en) | Substituted 1,3-dihydrospiro(isobenzofuran)s | |
| US4115400A (en) | 1-Azoniabicyclo[3.1.0]hexanes | |
| US4166119A (en) | Analgesic and tranquilizing spiro[dihydrobenzofuran]piperidines and pyrrolidines | |
| US4110459A (en) | Benzoylpiperidylalkylindoles in alleviating pain | |
| US4216218A (en) | Antidepressant and analgesic 4-aryloxy- and 4-arylthio-3-phenylpiperidines | |
| US4166120A (en) | Analgesic and tranquilizing benzoylpropyl-spiro[dihydrobenzofuran]piperidines and pyrrolidines | |
| CA1053230A (en) | 4-arylpiperidine derivatives and processes for the production thereof | |
| US3674799A (en) | (4'-(phenyl-3 6-dihydro-1-(2h)-pyridyl)-2-hydroxy propoxy-anilides and derivatives thereof | |
| FI60559B (fi) | Foerfarande foer framstaellning av ny-(tertiaer amino)-orto-aminobutyrofenonfoereningar | |
| US20030171370A1 (en) | Phenoxyalkylamine derivatives useful as opioid receptor agonists | |
| CA1105025A (en) | Spiro[indoline-3,4'-piperidine] s and related compounds | |
| US4312876A (en) | Antidepressive and analgesic 4-aryloxy- and 4-arylthio-3-phenylpiperidines | |
| US4409229A (en) | Antidepressive and tranquilizing substituted 1,3-dihydrospiro[benzo(c)thiophene]s | |
| US3124586A (en) | Conhz | |
| US4197239A (en) | Hexahydroazepine, piperidine and pyrrolidine derivatives | |
| US4268515A (en) | Spiro[dihydrobenzofuran-piperidines and-pyrrolidines], pharmaceutical compositions thereof and methods of use thereof | |
| US3816434A (en) | 4-(3-(4-phenyl-piperidino)-2-hydroxy-propoxy)-benzophenones | |
| GB1591723A (en) | 1-amino-2-hydroxy-3-heterocyclyloxy-propanes | |
| US4321385A (en) | [(Aryl-1-pyrryl) methyl]-piperidinols and pyrrolidinols | |
| US4302590A (en) | Intermediates for the preparation of 4-aryloxy-3-phenylpiperidines | |
| US4125538A (en) | Substituted 5-phenyl-2,3,4,5-tetrahydro-1,4-benzoxazepines | |
| US4329464A (en) | Spiro[dihydrobenzofuran-piperidines and -pyrrolidines] | |
| US4175197A (en) | 1,3,4-Trisubstituted-4-aryl-1,4,5,6-tetra-hydropyridines | |
| US4424357A (en) | Process for preparing 4-aryloxy-3-phenylpiperidines |