CH620200A5 - - Google Patents
Download PDFInfo
- Publication number
- CH620200A5 CH620200A5 CH1400075A CH1400075A CH620200A5 CH 620200 A5 CH620200 A5 CH 620200A5 CH 1400075 A CH1400075 A CH 1400075A CH 1400075 A CH1400075 A CH 1400075A CH 620200 A5 CH620200 A5 CH 620200A5
- Authority
- CH
- Switzerland
- Prior art keywords
- methyl
- urea
- butyl
- dimethyl
- methylguanidine
- Prior art date
Links
- -1 phenylamidine ureas Chemical class 0.000 description 73
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 23
- 150000001875 compounds Chemical class 0.000 description 22
- 239000000203 mixture Substances 0.000 description 22
- 238000000034 method Methods 0.000 description 16
- 235000013877 carbamide Nutrition 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 206010012735 Diarrhoea Diseases 0.000 description 14
- 239000004202 carbamide Substances 0.000 description 13
- 239000001257 hydrogen Substances 0.000 description 13
- 229910052739 hydrogen Inorganic materials 0.000 description 13
- 125000000217 alkyl group Chemical group 0.000 description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 125000005843 halogen group Chemical group 0.000 description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 8
- 150000002357 guanidines Chemical class 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 125000003545 alkoxy group Chemical group 0.000 description 7
- 150000001448 anilines Chemical class 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 6
- MGOLNIXAPIAKFM-UHFFFAOYSA-N 2-isocyanato-2-methylpropane Chemical compound CC(C)(C)N=C=O MGOLNIXAPIAKFM-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 239000004359 castor oil Substances 0.000 description 6
- 235000019438 castor oil Nutrition 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 230000005494 condensation Effects 0.000 description 6
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- 239000012948 isocyanate Substances 0.000 description 6
- 150000002513 isocyanates Chemical class 0.000 description 6
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 5
- 150000001409 amidines Chemical class 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- QRJZGVVKGFIGLI-UHFFFAOYSA-N 2-phenylguanidine Chemical compound NC(=N)NC1=CC=CC=C1 QRJZGVVKGFIGLI-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 4
- NLGKRVNANIZGNI-UHFFFAOYSA-N n,2,6-trimethylaniline Chemical compound CNC1=C(C)C=CC=C1C NLGKRVNANIZGNI-UHFFFAOYSA-N 0.000 description 4
- SGBSVLLMNHLNAP-UHFFFAOYSA-N 2-(2,6-dimethylphenyl)guanidine Chemical compound CC1=CC=CC(C)=C1NC(N)=N SGBSVLLMNHLNAP-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical class CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 3
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 230000002550 fecal effect Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002440 hydroxy compounds Chemical class 0.000 description 3
- 230000003533 narcotic effect Effects 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000003419 tautomerization reaction Methods 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 229940057054 1,3-dimethylurea Drugs 0.000 description 2
- JGOPTUOKOZUFBJ-UHFFFAOYSA-N 2-(3-chloro-4-methoxyphenyl)guanidine Chemical compound COC1=CC=C(N=C(N)N)C=C1Cl JGOPTUOKOZUFBJ-UHFFFAOYSA-N 0.000 description 2
- BCLCKENDTZITFB-UHFFFAOYSA-N 2-methyl-5-(trifluoromethyl)aniline Chemical compound CC1=CC=C(C(F)(F)F)C=C1N BCLCKENDTZITFB-UHFFFAOYSA-N 0.000 description 2
- PCAOYIXQKCKNNT-UHFFFAOYSA-N 3,4-bis(phenylmethoxy)aniline Chemical compound C=1C=CC=CC=1COC1=CC(N)=CC=C1OCC1=CC=CC=C1 PCAOYIXQKCKNNT-UHFFFAOYSA-N 0.000 description 2
- ZUVPLKVDZNDZCM-UHFFFAOYSA-N 3-chloro-2-methylaniline Chemical compound CC1=C(N)C=CC=C1Cl ZUVPLKVDZNDZCM-UHFFFAOYSA-N 0.000 description 2
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 2
- CXNVOWPRHWWCQR-UHFFFAOYSA-N 4-Chloro-ortho-toluidine Chemical compound CC1=CC(Cl)=CC=C1N CXNVOWPRHWWCQR-UHFFFAOYSA-N 0.000 description 2
- ZYTACDUBELLOAE-UHFFFAOYSA-N 4-bromo-n,2,6-trimethylaniline Chemical compound CNC1=C(C)C=C(Br)C=C1C ZYTACDUBELLOAE-UHFFFAOYSA-N 0.000 description 2
- DCKBNSOWCAMGOM-UHFFFAOYSA-N 4-chloro-n,2,6-trimethylaniline Chemical compound CNC1=C(C)C=C(Cl)C=C1C DCKBNSOWCAMGOM-UHFFFAOYSA-N 0.000 description 2
- HTAVDHOGNKKUST-UHFFFAOYSA-N 4-fluoro-n,2,6-trimethylaniline Chemical compound CNC1=C(C)C=C(F)C=C1C HTAVDHOGNKKUST-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- SQSPRWMERUQXNE-UHFFFAOYSA-N Guanylurea Chemical class NC(=N)NC(N)=O SQSPRWMERUQXNE-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- OROGSEYTTFOCAN-DNJOTXNNSA-N codeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC OROGSEYTTFOCAN-DNJOTXNNSA-N 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- HYPPXZBJBPSRLK-UHFFFAOYSA-N diphenoxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1CCC(C#N)(C=1C=CC=CC=1)C1=CC=CC=C1 HYPPXZBJBPSRLK-UHFFFAOYSA-N 0.000 description 2
- 229960004192 diphenoxylate Drugs 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002497 iodine compounds Chemical class 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 229960005181 morphine Drugs 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 1
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- VHEPZBDYOFWTSM-UHFFFAOYSA-N 1-(2,6-dimethylphenyl)-2-methylguanidine Chemical compound CNC(=N)NC1=C(C)C=CC=C1C VHEPZBDYOFWTSM-UHFFFAOYSA-N 0.000 description 1
- AACIUXJDGJQQNM-UHFFFAOYSA-N 1-(3-chlorophenyl)-1-methylguanidine Chemical compound NC(=N)N(C)C1=CC=CC(Cl)=C1 AACIUXJDGJQQNM-UHFFFAOYSA-N 0.000 description 1
- HRKXQOBEXVFOTB-UHFFFAOYSA-N 1-(4-chlorophenyl)-2-methylguanidine Chemical compound CNC(=N)NC1=CC=C(Cl)C=C1 HRKXQOBEXVFOTB-UHFFFAOYSA-N 0.000 description 1
- QXQAPNSHUJORMC-UHFFFAOYSA-N 1-chloro-4-propylbenzene Chemical compound CCCC1=CC=C(Cl)C=C1 QXQAPNSHUJORMC-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical compound NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 1
- LOOOTYOQFFOBCI-UHFFFAOYSA-N 2,4-dibromo-6-methylaniline Chemical compound CC1=CC(Br)=CC(Br)=C1N LOOOTYOQFFOBCI-UHFFFAOYSA-N 0.000 description 1
- UAISVUGQLKXPFF-UHFFFAOYSA-N 2,4-dichloro-6-methylaniline Chemical compound CC1=CC(Cl)=CC(Cl)=C1N UAISVUGQLKXPFF-UHFFFAOYSA-N 0.000 description 1
- WRTAZRGRFBCKBU-UHFFFAOYSA-N 2,5-dibromoaniline Chemical compound NC1=CC(Br)=CC=C1Br WRTAZRGRFBCKBU-UHFFFAOYSA-N 0.000 description 1
- ATDIROHVRVQMRO-UHFFFAOYSA-N 2,6-dibromo-4-methylaniline Chemical compound CC1=CC(Br)=C(N)C(Br)=C1 ATDIROHVRVQMRO-UHFFFAOYSA-N 0.000 description 1
- HMUDNHJDRNNRIE-UHFFFAOYSA-N 2,6-dichloro-4-methylaniline Chemical compound CC1=CC(Cl)=C(N)C(Cl)=C1 HMUDNHJDRNNRIE-UHFFFAOYSA-N 0.000 description 1
- FOYHNROGBXVLLX-UHFFFAOYSA-N 2,6-diethylaniline Chemical compound CCC1=CC=CC(CC)=C1N FOYHNROGBXVLLX-UHFFFAOYSA-N 0.000 description 1
- AKHBCRYOUZZLGV-UHFFFAOYSA-N 2,6-dimethyl-4-(trifluoromethyl)aniline Chemical compound CC1=CC(C(F)(F)F)=CC(C)=C1N AKHBCRYOUZZLGV-UHFFFAOYSA-N 0.000 description 1
- PNYMBNYUYXFJCQ-UHFFFAOYSA-N 2-(2,3-dichlorophenyl)guanidine Chemical compound NC(=N)NC1=CC=CC(Cl)=C1Cl PNYMBNYUYXFJCQ-UHFFFAOYSA-N 0.000 description 1
- WBIUBDRBIYBSCI-UHFFFAOYSA-N 2-(2,4-dibromo-6-methylphenyl)guanidine Chemical compound CC1=CC(Br)=CC(Br)=C1N=C(N)N WBIUBDRBIYBSCI-UHFFFAOYSA-N 0.000 description 1
- OTXXVTHTRIPTCT-UHFFFAOYSA-N 2-(2,4-dichloro-6-methylphenyl)guanidine Chemical compound CC1=CC(Cl)=CC(Cl)=C1NC(N)=N OTXXVTHTRIPTCT-UHFFFAOYSA-N 0.000 description 1
- ATHDCLLBQQCICY-UHFFFAOYSA-N 2-(2,5-dibromophenyl)guanidine Chemical compound NC(=N)NC1=CC(Br)=CC=C1Br ATHDCLLBQQCICY-UHFFFAOYSA-N 0.000 description 1
- WIRLSNHVBAZBMQ-UHFFFAOYSA-N 2-(2,6-dibromo-4-methylphenyl)guanidine Chemical compound CC1=CC(Br)=C(NC(N)=N)C(Br)=C1 WIRLSNHVBAZBMQ-UHFFFAOYSA-N 0.000 description 1
- MUZCGMOGIATOKW-UHFFFAOYSA-N 2-(2,6-dichloro-4-methylphenyl)guanidine Chemical compound CC1=CC(Cl)=C(NC(N)=N)C(Cl)=C1 MUZCGMOGIATOKW-UHFFFAOYSA-N 0.000 description 1
- AIZKLBISTDBUBR-UHFFFAOYSA-N 2-(2-chloro-4-fluoro-6-methylphenyl)guanidine Chemical compound CC1=CC(F)=CC(Cl)=C1NC(N)=N AIZKLBISTDBUBR-UHFFFAOYSA-N 0.000 description 1
- SKNZBUSGRFIODS-UHFFFAOYSA-N 2-(2-ethoxy-6-ethylphenyl)guanidine Chemical compound CCOC1=CC=CC(CC)=C1N=C(N)N SKNZBUSGRFIODS-UHFFFAOYSA-N 0.000 description 1
- DCAAFCOXDRSSNK-UHFFFAOYSA-N 2-(2-ethyl-4-fluorophenyl)guanidine Chemical compound CCC1=CC(F)=CC=C1NC(N)=N DCAAFCOXDRSSNK-UHFFFAOYSA-N 0.000 description 1
- GLBWGNBCNUUJJE-UHFFFAOYSA-N 2-(2-fluoro-4,6-dimethylphenyl)guanidine Chemical compound CC1=CC(C)=C(NC(N)=N)C(F)=C1 GLBWGNBCNUUJJE-UHFFFAOYSA-N 0.000 description 1
- STXXMCQQEVOHHE-UHFFFAOYSA-N 2-(2-methyl-4-nitrophenyl)guanidine Chemical compound CC1=CC([N+]([O-])=O)=CC=C1NC(N)=N STXXMCQQEVOHHE-UHFFFAOYSA-N 0.000 description 1
- IURKUCAZQFRGML-UHFFFAOYSA-N 2-(3,4,5-trichlorophenyl)guanidine Chemical compound NC(=N)NC1=CC(Cl)=C(Cl)C(Cl)=C1 IURKUCAZQFRGML-UHFFFAOYSA-N 0.000 description 1
- QJPHBWXNINWEME-UHFFFAOYSA-N 2-(3,4,5-triethoxyphenyl)guanidine Chemical compound CCOC1=CC(N=C(N)N)=CC(OCC)=C1OCC QJPHBWXNINWEME-UHFFFAOYSA-N 0.000 description 1
- DXUWATABALHSNY-UHFFFAOYSA-N 2-(3,4,5-trimethoxyphenyl)guanidine Chemical compound COC1=CC(NC(N)=N)=CC(OC)=C1OC DXUWATABALHSNY-UHFFFAOYSA-N 0.000 description 1
- UGLWGMDNGAUDFJ-UHFFFAOYSA-N 2-(3,4-dibromophenyl)guanidine Chemical compound NC(=N)NC1=CC=C(Br)C(Br)=C1 UGLWGMDNGAUDFJ-UHFFFAOYSA-N 0.000 description 1
- NNRSVGLUJAPMQD-UHFFFAOYSA-N 2-(3,4-dichlorophenyl)guanidine Chemical compound NC(N)=NC1=CC=C(Cl)C(Cl)=C1 NNRSVGLUJAPMQD-UHFFFAOYSA-N 0.000 description 1
- UZWVFWWLTQMFFO-UHFFFAOYSA-N 2-(3,4-difluorophenyl)guanidine Chemical compound NC(=N)NC1=CC=C(F)C(F)=C1 UZWVFWWLTQMFFO-UHFFFAOYSA-N 0.000 description 1
- KCEIBYAXTBNNRZ-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)guanidine Chemical compound COC1=CC=C(NC(N)=N)C=C1OC KCEIBYAXTBNNRZ-UHFFFAOYSA-N 0.000 description 1
- XYIOFYWCTGPTHX-UHFFFAOYSA-N 2-(3,5-dibromophenyl)guanidine Chemical compound NC(=N)NC1=CC(Br)=CC(Br)=C1 XYIOFYWCTGPTHX-UHFFFAOYSA-N 0.000 description 1
- OKRWYAVMXGRPLI-UHFFFAOYSA-N 2-(3,5-dichloro-2,6-dimethylphenyl)guanidine Chemical compound CC1=C(Cl)C=C(Cl)C(C)=C1N=C(N)N OKRWYAVMXGRPLI-UHFFFAOYSA-N 0.000 description 1
- PXNBOFBSFXZTES-UHFFFAOYSA-N 2-(3,5-dichlorophenyl)guanidine Chemical compound NC(=N)NC1=CC(Cl)=CC(Cl)=C1 PXNBOFBSFXZTES-UHFFFAOYSA-N 0.000 description 1
- UUUFHPHWWSTWSR-UHFFFAOYSA-N 2-(3,5-difluorophenyl)guanidine Chemical compound NC(N)=NC1=CC(F)=CC(F)=C1 UUUFHPHWWSTWSR-UHFFFAOYSA-N 0.000 description 1
- OBUIOEZAMTYBKF-UHFFFAOYSA-N 2-(3-bromo-4-iodophenyl)guanidine Chemical compound NC(N)=NC1=CC=C(I)C(Br)=C1 OBUIOEZAMTYBKF-UHFFFAOYSA-N 0.000 description 1
- IGACBBIDFIESIR-UHFFFAOYSA-N 2-(3-bromo-5-chlorophenyl)guanidine Chemical compound NC(=N)NC1=CC(Cl)=CC(Br)=C1 IGACBBIDFIESIR-UHFFFAOYSA-N 0.000 description 1
- YZCRXUSPPZGVKK-UHFFFAOYSA-N 2-(3-chloro-4-fluorophenyl)guanidine Chemical compound NC(N)=NC1=CC=C(F)C(Cl)=C1 YZCRXUSPPZGVKK-UHFFFAOYSA-N 0.000 description 1
- JUJWEJWVSFRABT-UHFFFAOYSA-N 2-(3-chloro-4-iodophenyl)guanidine Chemical compound NC(N)=NC1=CC=C(I)C(Cl)=C1 JUJWEJWVSFRABT-UHFFFAOYSA-N 0.000 description 1
- NDCWPJSRSBAMIH-UHFFFAOYSA-N 2-(4-bromo-2,6-dimethylphenyl)guanidine Chemical compound CC1=CC(Br)=CC(C)=C1NC(N)=N NDCWPJSRSBAMIH-UHFFFAOYSA-N 0.000 description 1
- UJBZLDQVOQFGCD-UHFFFAOYSA-N 2-(4-bromo-2-ethylphenyl)guanidine Chemical compound CCC1=CC(Br)=CC=C1NC(N)=N UJBZLDQVOQFGCD-UHFFFAOYSA-N 0.000 description 1
- IQGKMQSGJFTJLF-UHFFFAOYSA-N 2-(4-bromo-2-methylphenyl)guanidine Chemical compound CC1=CC(Br)=CC=C1NC(N)=N IQGKMQSGJFTJLF-UHFFFAOYSA-N 0.000 description 1
- ZRURDMWZMRGKNL-UHFFFAOYSA-N 2-(4-bromo-3-chlorophenyl)guanidine Chemical compound NC(=N)NC1=CC=C(Br)C(Cl)=C1 ZRURDMWZMRGKNL-UHFFFAOYSA-N 0.000 description 1
- MOVOKLZAYNUKLT-UHFFFAOYSA-N 2-(4-chloro-2,6-dimethylphenyl)guanidine Chemical compound CC1=CC(Cl)=CC(C)=C1NC(N)=N MOVOKLZAYNUKLT-UHFFFAOYSA-N 0.000 description 1
- PEVQGFIIAVVFNW-UHFFFAOYSA-N 2-(4-chloro-2-ethylphenyl)guanidine Chemical compound CCC1=CC(Cl)=CC=C1NC(N)=N PEVQGFIIAVVFNW-UHFFFAOYSA-N 0.000 description 1
- VIAIGXMIYQFRPA-UHFFFAOYSA-N 2-(4-chloro-2-methylphenyl)guanidine Chemical compound CC1=CC(Cl)=CC=C1N=C(N)N VIAIGXMIYQFRPA-UHFFFAOYSA-N 0.000 description 1
- AJFKKYSWESYNJB-UHFFFAOYSA-N 2-(4-chloro-3-iodophenyl)guanidine Chemical compound NC(N)=NC1=CC=C(Cl)C(I)=C1 AJFKKYSWESYNJB-UHFFFAOYSA-N 0.000 description 1
- VRLOKGYORYGKMZ-UHFFFAOYSA-N 2-(4-chloro-3-nitrophenyl)guanidine Chemical compound NC(N)=NC1=CC=C(Cl)C([N+]([O-])=O)=C1 VRLOKGYORYGKMZ-UHFFFAOYSA-N 0.000 description 1
- DXITYRXHXHGYLM-UHFFFAOYSA-N 2-(4-cyano-2-methylphenyl)guanidine Chemical compound CC1=CC(C#N)=CC=C1NC(N)=N DXITYRXHXHGYLM-UHFFFAOYSA-N 0.000 description 1
- JTYGEPRKVXYODF-UHFFFAOYSA-N 2-(4-fluoro-2,6-dimethylphenyl)guanidine Chemical compound CC1=CC(F)=CC(C)=C1NC(N)=N JTYGEPRKVXYODF-UHFFFAOYSA-N 0.000 description 1
- BTXMWAIHNYCCAZ-UHFFFAOYSA-N 2-(4-fluoro-2-methylphenyl)guanidine Chemical compound CC1=CC(F)=CC=C1NC(N)=N BTXMWAIHNYCCAZ-UHFFFAOYSA-N 0.000 description 1
- JYSLCVNRKCSMKD-UHFFFAOYSA-N 2-(4-fluoro-3-nitrophenyl)guanidine Chemical compound NC(N)=NC1=CC=C(F)C([N+]([O-])=O)=C1 JYSLCVNRKCSMKD-UHFFFAOYSA-N 0.000 description 1
- STTLMODNENPLQQ-UHFFFAOYSA-N 2-(4-fluorophenyl)guanidine Chemical compound NC(N)=NC1=CC=C(F)C=C1 STTLMODNENPLQQ-UHFFFAOYSA-N 0.000 description 1
- RGNCEPOKMMWWKC-UHFFFAOYSA-N 2-(5-bromo-2-methylphenyl)guanidine Chemical compound CC1=CC=C(Br)C=C1N=C(N)N RGNCEPOKMMWWKC-UHFFFAOYSA-N 0.000 description 1
- RCVCEAWHDUGLQN-UHFFFAOYSA-N 2-(5-chloro-2-methylphenyl)guanidine Chemical compound CC1=CC=C(Cl)C=C1NC(N)=N RCVCEAWHDUGLQN-UHFFFAOYSA-N 0.000 description 1
- IWICFTQITCIWQG-UHFFFAOYSA-N 2-(5-fluoro-2-methylphenyl)guanidine Chemical compound CC1=CC=C(F)C=C1NC(N)=N IWICFTQITCIWQG-UHFFFAOYSA-N 0.000 description 1
- QPHVTZLMPULLKX-UHFFFAOYSA-N 2-[2-ethyl-4-(trifluoromethyl)phenyl]guanidine Chemical compound CCC1=CC(C(F)(F)F)=CC=C1NC(N)=N QPHVTZLMPULLKX-UHFFFAOYSA-N 0.000 description 1
- LTUIDJWNHCCRDJ-UHFFFAOYSA-N 2-[2-methyl-4-(trifluoromethyl)phenyl]guanidine Chemical compound CC1=CC(C(F)(F)F)=CC=C1NC(N)=N LTUIDJWNHCCRDJ-UHFFFAOYSA-N 0.000 description 1
- GQKNDPAGNWIGCR-UHFFFAOYSA-N 2-[3-bromo-4-(trifluoromethyl)phenyl]guanidine Chemical compound NC(N)=NC1=CC=C(C(F)(F)F)C(Br)=C1 GQKNDPAGNWIGCR-UHFFFAOYSA-N 0.000 description 1
- ZYDCTNTVBGTGRR-UHFFFAOYSA-N 2-[3-chloro-4-(trifluoromethyl)phenyl]guanidine Chemical compound NC(N)=NC1=CC=C(C(F)(F)F)C(Cl)=C1 ZYDCTNTVBGTGRR-UHFFFAOYSA-N 0.000 description 1
- IUNFWMWQNWQIFS-UHFFFAOYSA-N 2-[4-(trifluoromethyl)phenyl]guanidine Chemical compound NC(=N)NC1=CC=C(C(F)(F)F)C=C1 IUNFWMWQNWQIFS-UHFFFAOYSA-N 0.000 description 1
- LKAQFOKMMXWRRQ-UHFFFAOYSA-N 2-chloro-4,6-dimethylaniline Chemical compound CC1=CC(C)=C(N)C(Cl)=C1 LKAQFOKMMXWRRQ-UHFFFAOYSA-N 0.000 description 1
- PLTNCEGFKZZXEI-UHFFFAOYSA-N 2-chloro-4-fluoro-6-methylaniline Chemical compound CC1=CC(F)=CC(Cl)=C1N PLTNCEGFKZZXEI-UHFFFAOYSA-N 0.000 description 1
- KGFABAKXVUBUED-UHFFFAOYSA-N 2-chloro-6-fluoro-4-methylaniline Chemical compound CC1=CC(F)=C(N)C(Cl)=C1 KGFABAKXVUBUED-UHFFFAOYSA-N 0.000 description 1
- WVYSGQWWYODGPY-UHFFFAOYSA-N 2-chloro-n,4-dimethylaniline Chemical compound CNC1=CC=C(C)C=C1Cl WVYSGQWWYODGPY-UHFFFAOYSA-N 0.000 description 1
- FWQUBKZCULDUQS-UHFFFAOYSA-N 2-chloro-n,6-dimethylaniline Chemical compound CNC1=C(C)C=CC=C1Cl FWQUBKZCULDUQS-UHFFFAOYSA-N 0.000 description 1
- ZNYVALSKYXOLLX-UHFFFAOYSA-N 2-ethoxy-6-ethylaniline Chemical compound CCOC1=CC=CC(CC)=C1N ZNYVALSKYXOLLX-UHFFFAOYSA-N 0.000 description 1
- YDPXZINXUVCZKH-UHFFFAOYSA-N 2-ethoxy-6-methylaniline Chemical compound CCOC1=CC=CC(C)=C1N YDPXZINXUVCZKH-UHFFFAOYSA-N 0.000 description 1
- NBDNVXCODUTURB-UHFFFAOYSA-N 2-ethyl-4-(trifluoromethyl)aniline Chemical compound CCC1=CC(C(F)(F)F)=CC=C1N NBDNVXCODUTURB-UHFFFAOYSA-N 0.000 description 1
- NBAQMIIIKQWMCC-UHFFFAOYSA-N 2-ethyl-4-fluoro-N-methylaniline Chemical compound CCC1=CC(F)=CC=C1NC NBAQMIIIKQWMCC-UHFFFAOYSA-N 0.000 description 1
- AFCGCODEEUFDAF-UHFFFAOYSA-N 2-ethyl-4-fluoroaniline Chemical compound CCC1=CC(F)=CC=C1N AFCGCODEEUFDAF-UHFFFAOYSA-N 0.000 description 1
- UWFPKMKMBZCSSP-UHFFFAOYSA-N 2-ethyl-6-methoxyaniline Chemical compound CCC1=CC=CC(OC)=C1N UWFPKMKMBZCSSP-UHFFFAOYSA-N 0.000 description 1
- JJVKJJNCIILLRP-UHFFFAOYSA-N 2-ethyl-6-methylaniline Chemical compound CCC1=CC=CC(C)=C1N JJVKJJNCIILLRP-UHFFFAOYSA-N 0.000 description 1
- GCZMXFHWTJTEJO-UHFFFAOYSA-N 2-ethyl-n,6-dimethylaniline Chemical compound CCC1=CC=CC(C)=C1NC GCZMXFHWTJTEJO-UHFFFAOYSA-N 0.000 description 1
- WUZMZSMQPYVTQK-UHFFFAOYSA-N 2-fluoro-4,6-dimethylaniline Chemical compound CC1=CC(C)=C(N)C(F)=C1 WUZMZSMQPYVTQK-UHFFFAOYSA-N 0.000 description 1
- HKOJYPPTIPJZAZ-UHFFFAOYSA-N 2-methoxy-6-methylaniline Chemical compound COC1=CC=CC(C)=C1N HKOJYPPTIPJZAZ-UHFFFAOYSA-N 0.000 description 1
- PAXQXJDYVORMOO-UHFFFAOYSA-N 2-methyl-4-(trifluoromethyl)aniline Chemical compound CC1=CC(C(F)(F)F)=CC=C1N PAXQXJDYVORMOO-UHFFFAOYSA-N 0.000 description 1
- BKJHJIPJEBLCJS-UHFFFAOYSA-N 2-methyl-6-propylaniline Chemical compound CCCC1=CC=CC(C)=C1N BKJHJIPJEBLCJS-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- HACRKYQRZABURO-UHFFFAOYSA-N 2-phenylethyl isocyanate Chemical compound O=C=NCCC1=CC=CC=C1 HACRKYQRZABURO-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- YHIXNEBCEOPTRZ-UHFFFAOYSA-N 3,4,5-trichloro-2,6-dimethylaniline Chemical compound CC1=C(N)C(C)=C(Cl)C(Cl)=C1Cl YHIXNEBCEOPTRZ-UHFFFAOYSA-N 0.000 description 1
- QYWZITSCHMIJSM-UHFFFAOYSA-N 3,4,5-trichloro-2-methylaniline Chemical compound CC1=C(N)C=C(Cl)C(Cl)=C1Cl QYWZITSCHMIJSM-UHFFFAOYSA-N 0.000 description 1
- JDCGPLMQMNRGKJ-UHFFFAOYSA-N 3,4,5-trichloro-n-methylaniline Chemical compound CNC1=CC(Cl)=C(Cl)C(Cl)=C1 JDCGPLMQMNRGKJ-UHFFFAOYSA-N 0.000 description 1
- XOGYQVITULCUGU-UHFFFAOYSA-N 3,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1 XOGYQVITULCUGU-UHFFFAOYSA-N 0.000 description 1
- WQTFKYLFKOBGSG-UHFFFAOYSA-N 3,4,5-triethoxyaniline Chemical compound CCOC1=CC(N)=CC(OCC)=C1OCC WQTFKYLFKOBGSG-UHFFFAOYSA-N 0.000 description 1
- XBSMHLZMLQNTLY-UHFFFAOYSA-N 3,4,5-trimethoxy-n-methylaniline Chemical compound CNC1=CC(OC)=C(OC)C(OC)=C1 XBSMHLZMLQNTLY-UHFFFAOYSA-N 0.000 description 1
- XEFRNCLPPFDWAC-UHFFFAOYSA-N 3,4,5-trimethoxyaniline Chemical compound COC1=CC(N)=CC(OC)=C1OC XEFRNCLPPFDWAC-UHFFFAOYSA-N 0.000 description 1
- GTVHKECVMCGKQW-UHFFFAOYSA-N 3,4,5-tris(phenylmethoxy)aniline Chemical compound C=1C=CC=CC=1COC=1C(OCC=2C=CC=CC=2)=CC(N)=CC=1OCC1=CC=CC=C1 GTVHKECVMCGKQW-UHFFFAOYSA-N 0.000 description 1
- VRYLZHQRBPKSNZ-UHFFFAOYSA-N 3,4-dibromo-n-methylaniline Chemical compound CNC1=CC=C(Br)C(Br)=C1 VRYLZHQRBPKSNZ-UHFFFAOYSA-N 0.000 description 1
- QFTJOYLPELHHCO-UHFFFAOYSA-N 3,4-dibromoaniline Chemical compound NC1=CC=C(Br)C(Br)=C1 QFTJOYLPELHHCO-UHFFFAOYSA-N 0.000 description 1
- NMIWDZYCBUCFON-UHFFFAOYSA-N 3,4-dichloro-2-methylaniline Chemical compound CC1=C(N)C=CC(Cl)=C1Cl NMIWDZYCBUCFON-UHFFFAOYSA-N 0.000 description 1
- DUSNCFKVMGTTFK-UHFFFAOYSA-N 3,4-dichloro-n-methylaniline Chemical compound CNC1=CC=C(Cl)C(Cl)=C1 DUSNCFKVMGTTFK-UHFFFAOYSA-N 0.000 description 1
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 1
- IKYZLUAAOLUOFW-UHFFFAOYSA-N 3,4-diethoxyaniline Chemical compound CCOC1=CC=C(N)C=C1OCC IKYZLUAAOLUOFW-UHFFFAOYSA-N 0.000 description 1
- AXNUZKSSQHTNPZ-UHFFFAOYSA-N 3,4-difluoroaniline Chemical compound NC1=CC=C(F)C(F)=C1 AXNUZKSSQHTNPZ-UHFFFAOYSA-N 0.000 description 1
- PGBJWAKHAFOCEL-UHFFFAOYSA-N 3,4-dimethoxy-n-methylaniline Chemical compound CNC1=CC=C(OC)C(OC)=C1 PGBJWAKHAFOCEL-UHFFFAOYSA-N 0.000 description 1
- LGDHZCLREKIGKJ-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC LGDHZCLREKIGKJ-UHFFFAOYSA-N 0.000 description 1
- RVNUUWJGSOHMRR-UHFFFAOYSA-N 3,5-dibromoaniline Chemical compound NC1=CC(Br)=CC(Br)=C1 RVNUUWJGSOHMRR-UHFFFAOYSA-N 0.000 description 1
- VUNVLQOSKWJKGU-UHFFFAOYSA-N 3,5-dichloro-2,6-dimethylaniline Chemical compound CC1=C(Cl)C=C(Cl)C(C)=C1N VUNVLQOSKWJKGU-UHFFFAOYSA-N 0.000 description 1
- OTCBGVAURJAJSJ-UHFFFAOYSA-N 3,5-dichloro-2-methylaniline Chemical compound CC1=C(N)C=C(Cl)C=C1Cl OTCBGVAURJAJSJ-UHFFFAOYSA-N 0.000 description 1
- JTUADIPAALOMFL-UHFFFAOYSA-N 3,5-dichloro-n-methylaniline Chemical compound CNC1=CC(Cl)=CC(Cl)=C1 JTUADIPAALOMFL-UHFFFAOYSA-N 0.000 description 1
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 description 1
- RVLAHRBSGLXXPZ-UHFFFAOYSA-N 3,5-difluoro-n-methylaniline Chemical compound CNC1=CC(F)=CC(F)=C1 RVLAHRBSGLXXPZ-UHFFFAOYSA-N 0.000 description 1
- KQOIBXZRCYFZSO-UHFFFAOYSA-N 3,5-difluoroaniline Chemical compound NC1=CC(F)=CC(F)=C1 KQOIBXZRCYFZSO-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- HRRMPGSFIAVSNM-UHFFFAOYSA-N 3-bromo-2,6-dimethylaniline Chemical compound CC1=CC=C(Br)C(C)=C1N HRRMPGSFIAVSNM-UHFFFAOYSA-N 0.000 description 1
- IILVSKMKMOJHMA-UHFFFAOYSA-N 3-bromo-2-methylaniline Chemical compound CC1=C(N)C=CC=C1Br IILVSKMKMOJHMA-UHFFFAOYSA-N 0.000 description 1
- VMERAUXEEDONDK-UHFFFAOYSA-N 3-bromo-4-(trifluoromethyl)aniline Chemical compound NC1=CC=C(C(F)(F)F)C(Br)=C1 VMERAUXEEDONDK-UHFFFAOYSA-N 0.000 description 1
- IHPZMGWKZMIYCU-UHFFFAOYSA-N 3-bromo-4-chloro-n-methylaniline Chemical compound CNC1=CC=C(Cl)C(Br)=C1 IHPZMGWKZMIYCU-UHFFFAOYSA-N 0.000 description 1
- FVZODFVCIDBDGS-UHFFFAOYSA-N 3-bromo-4-chloroaniline Chemical compound NC1=CC=C(Cl)C(Br)=C1 FVZODFVCIDBDGS-UHFFFAOYSA-N 0.000 description 1
- KOWPUNQBGWIERF-UHFFFAOYSA-N 3-bromo-4-fluoroaniline Chemical compound NC1=CC=C(F)C(Br)=C1 KOWPUNQBGWIERF-UHFFFAOYSA-N 0.000 description 1
- HBCBLDVYTZWYLL-UHFFFAOYSA-N 3-bromo-4-iodoaniline Chemical compound NC1=CC=C(I)C(Br)=C1 HBCBLDVYTZWYLL-UHFFFAOYSA-N 0.000 description 1
- YYBRLVWWPRAQDX-UHFFFAOYSA-N 3-bromo-5-chloroaniline Chemical compound NC1=CC(Cl)=CC(Br)=C1 YYBRLVWWPRAQDX-UHFFFAOYSA-N 0.000 description 1
- HKOSFZXROYRVJT-UHFFFAOYSA-N 3-bromo-n-methylaniline Chemical compound CNC1=CC=CC(Br)=C1 HKOSFZXROYRVJT-UHFFFAOYSA-N 0.000 description 1
- DHYHYLGCQVVLOQ-UHFFFAOYSA-N 3-bromoaniline Chemical compound NC1=CC=CC(Br)=C1 DHYHYLGCQVVLOQ-UHFFFAOYSA-N 0.000 description 1
- VDJBIPLKIGSVRG-UHFFFAOYSA-N 3-chloro-2,6-diethylaniline Chemical compound CCC1=CC=C(Cl)C(CC)=C1N VDJBIPLKIGSVRG-UHFFFAOYSA-N 0.000 description 1
- FGMXFOTYCHZCLA-UHFFFAOYSA-N 3-chloro-2,6-dimethylaniline Chemical compound CC1=CC=C(Cl)C(C)=C1N FGMXFOTYCHZCLA-UHFFFAOYSA-N 0.000 description 1
- KZAMRRANXJVDCD-UHFFFAOYSA-N 3-chloro-4-(trifluoromethyl)aniline Chemical compound NC1=CC=C(C(F)(F)F)C(Cl)=C1 KZAMRRANXJVDCD-UHFFFAOYSA-N 0.000 description 1
- FGXNONLCHGSBJS-UHFFFAOYSA-N 3-chloro-4-fluoro-n-methylaniline Chemical compound CNC1=CC=C(F)C(Cl)=C1 FGXNONLCHGSBJS-UHFFFAOYSA-N 0.000 description 1
- YSEMCVGMNUUNRK-UHFFFAOYSA-N 3-chloro-4-fluoroaniline Chemical compound NC1=CC=C(F)C(Cl)=C1 YSEMCVGMNUUNRK-UHFFFAOYSA-N 0.000 description 1
- KGDWAYMTSHDGTB-UHFFFAOYSA-N 3-chloro-4-iodo-n-methylaniline Chemical compound CNC1=CC=C(I)C(Cl)=C1 KGDWAYMTSHDGTB-UHFFFAOYSA-N 0.000 description 1
- LPIFAHAICWJMRR-UHFFFAOYSA-N 3-chloro-5-fluoroaniline Chemical compound NC1=CC(F)=CC(Cl)=C1 LPIFAHAICWJMRR-UHFFFAOYSA-N 0.000 description 1
- WFGYSQDPURFIFL-UHFFFAOYSA-N 3-chloro-n-methylaniline Chemical compound CNC1=CC=CC(Cl)=C1 WFGYSQDPURFIFL-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- BGXOKZJLFZDKAA-UHFFFAOYSA-N 3-fluoro-2,6-dimethylaniline Chemical compound CC1=CC=C(F)C(C)=C1N BGXOKZJLFZDKAA-UHFFFAOYSA-N 0.000 description 1
- SLDLVGFPFFLYBM-UHFFFAOYSA-N 3-fluoro-2-methyl-aniline Chemical compound CC1=C(N)C=CC=C1F SLDLVGFPFFLYBM-UHFFFAOYSA-N 0.000 description 1
- CRRVZRDISHOQQL-UHFFFAOYSA-N 3-fluoro-4-(trifluoromethyl)aniline Chemical compound NC1=CC=C(C(F)(F)F)C(F)=C1 CRRVZRDISHOQQL-UHFFFAOYSA-N 0.000 description 1
- KUVVJHBHRIXJKI-UHFFFAOYSA-N 3-fluoro-4-iodoaniline Chemical compound NC1=CC=C(I)C(F)=C1 KUVVJHBHRIXJKI-UHFFFAOYSA-N 0.000 description 1
- FHYDHJXZZQCXOX-UHFFFAOYSA-N 3-fluoro-n-methylaniline Chemical compound CNC1=CC=CC(F)=C1 FHYDHJXZZQCXOX-UHFFFAOYSA-N 0.000 description 1
- QZVQQUVWFIZUBQ-UHFFFAOYSA-N 3-fluoroaniline Chemical compound NC1=CC=CC(F)=C1 QZVQQUVWFIZUBQ-UHFFFAOYSA-N 0.000 description 1
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 1
- LNKBDFVSILQKSI-UHFFFAOYSA-N 4-Chloro-3-methoxyaniline Chemical compound COC1=CC(N)=CC=C1Cl LNKBDFVSILQKSI-UHFFFAOYSA-N 0.000 description 1
- ZFBKYGFPUCUYIF-UHFFFAOYSA-N 4-amino-2-chlorobenzonitrile Chemical compound NC1=CC=C(C#N)C(Cl)=C1 ZFBKYGFPUCUYIF-UHFFFAOYSA-N 0.000 description 1
- MBZDCUMFFPWLTJ-UHFFFAOYSA-N 4-amino-3-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC=C1N MBZDCUMFFPWLTJ-UHFFFAOYSA-N 0.000 description 1
- QGLAYJCJLHNIGJ-UHFFFAOYSA-N 4-bromo-2,6-dimethylaniline Chemical compound CC1=CC(Br)=CC(C)=C1N QGLAYJCJLHNIGJ-UHFFFAOYSA-N 0.000 description 1
- KYBXLTGZNKHFGH-UHFFFAOYSA-N 4-bromo-2-ethyl-n-methylaniline Chemical compound CCC1=CC(Br)=CC=C1NC KYBXLTGZNKHFGH-UHFFFAOYSA-N 0.000 description 1
- LGOZNQPHTIGMQJ-UHFFFAOYSA-N 4-bromo-2-ethylaniline Chemical compound CCC1=CC(Br)=CC=C1N LGOZNQPHTIGMQJ-UHFFFAOYSA-N 0.000 description 1
- PCHYYOCUCGCSBU-UHFFFAOYSA-N 4-bromo-2-methylaniline Chemical compound CC1=CC(Br)=CC=C1N PCHYYOCUCGCSBU-UHFFFAOYSA-N 0.000 description 1
- UMXFNWVZSGQQPG-UHFFFAOYSA-N 4-bromo-3-chloro-n-methylaniline Chemical compound CNC1=CC=C(Br)C(Cl)=C1 UMXFNWVZSGQQPG-UHFFFAOYSA-N 0.000 description 1
- QLYHPNUFNZJXOQ-UHFFFAOYSA-N 4-bromo-3-chloroaniline Chemical compound NC1=CC=C(Br)C(Cl)=C1 QLYHPNUFNZJXOQ-UHFFFAOYSA-N 0.000 description 1
- TXDUNPPIEVYUJH-UHFFFAOYSA-N 4-bromo-3-iodoaniline Chemical compound NC1=CC=C(Br)C(I)=C1 TXDUNPPIEVYUJH-UHFFFAOYSA-N 0.000 description 1
- PITHQPMZWKZGRZ-UHFFFAOYSA-N 4-bromo-3-nitroaniline Chemical compound NC1=CC=C(Br)C([N+]([O-])=O)=C1 PITHQPMZWKZGRZ-UHFFFAOYSA-N 0.000 description 1
- VCZTYYHYOULJLT-UHFFFAOYSA-N 4-bromo-n,2-dimethylaniline Chemical compound CNC1=CC=C(Br)C=C1C VCZTYYHYOULJLT-UHFFFAOYSA-N 0.000 description 1
- AYVPVDWQZAAZCM-UHFFFAOYSA-N 4-bromo-n-methylaniline Chemical compound CNC1=CC=C(Br)C=C1 AYVPVDWQZAAZCM-UHFFFAOYSA-N 0.000 description 1
- RLPKDPGRZGVHFM-UHFFFAOYSA-N 4-chloro-2,6-diethylaniline Chemical compound CCC1=CC(Cl)=CC(CC)=C1N RLPKDPGRZGVHFM-UHFFFAOYSA-N 0.000 description 1
- JCLZLZKUISPXDC-UHFFFAOYSA-N 4-chloro-2,6-dimethylaniline Chemical compound CC1=CC(Cl)=CC(C)=C1N JCLZLZKUISPXDC-UHFFFAOYSA-N 0.000 description 1
- KMYNSRFDYFGKLR-UHFFFAOYSA-N 4-chloro-2-ethyl-N-methylaniline Chemical compound CCC1=CC(Cl)=CC=C1NC KMYNSRFDYFGKLR-UHFFFAOYSA-N 0.000 description 1
- FRZVXNRFFMHYFO-UHFFFAOYSA-N 4-chloro-2-ethylaniline Chemical compound CCC1=CC(Cl)=CC=C1N FRZVXNRFFMHYFO-UHFFFAOYSA-N 0.000 description 1
- ACMJJQYSPUPMPN-UHFFFAOYSA-N 4-chloro-3-fluoroaniline Chemical compound NC1=CC=C(Cl)C(F)=C1 ACMJJQYSPUPMPN-UHFFFAOYSA-N 0.000 description 1
- AWJWTZAGRWNBFC-UHFFFAOYSA-N 4-chloro-3-iodoaniline Chemical compound NC1=CC=C(Cl)C(I)=C1 AWJWTZAGRWNBFC-UHFFFAOYSA-N 0.000 description 1
- FOHHWGVAOVDVLP-UHFFFAOYSA-N 4-chloro-3-nitroaniline Chemical compound NC1=CC=C(Cl)C([N+]([O-])=O)=C1 FOHHWGVAOVDVLP-UHFFFAOYSA-N 0.000 description 1
- OWSBCCVKVBSMGU-UHFFFAOYSA-N 4-chloro-n,2-dimethylaniline Chemical compound CNC1=CC=C(Cl)C=C1C OWSBCCVKVBSMGU-UHFFFAOYSA-N 0.000 description 1
- XCEYKKJMLOFDSS-UHFFFAOYSA-N 4-chloro-n-methylaniline Chemical compound CNC1=CC=C(Cl)C=C1 XCEYKKJMLOFDSS-UHFFFAOYSA-N 0.000 description 1
- MPNDLCBMLBACDD-UHFFFAOYSA-N 4-fluoro-2,6-dimethylaniline Chemical compound CC1=CC(F)=CC(C)=C1N MPNDLCBMLBACDD-UHFFFAOYSA-N 0.000 description 1
- KMHLGVTVACLEJE-UHFFFAOYSA-N 4-fluoro-2-methylaniline Chemical compound CC1=CC(F)=CC=C1N KMHLGVTVACLEJE-UHFFFAOYSA-N 0.000 description 1
- LLIOADBCFIXIEU-UHFFFAOYSA-N 4-fluoro-3-nitroaniline Chemical compound NC1=CC=C(F)C([N+]([O-])=O)=C1 LLIOADBCFIXIEU-UHFFFAOYSA-N 0.000 description 1
- VLWRKVBQUANIGI-UHFFFAOYSA-N 4-fluoro-n-methylaniline Chemical compound CNC1=CC=C(F)C=C1 VLWRKVBQUANIGI-UHFFFAOYSA-N 0.000 description 1
- CPBZXHWWPFPWMN-UHFFFAOYSA-N 4-fluoro-n-propylaniline Chemical compound CCCNC1=CC=C(F)C=C1 CPBZXHWWPFPWMN-UHFFFAOYSA-N 0.000 description 1
- IZVRDZGBMDYYQT-UHFFFAOYSA-N 4-iodo-n-methylaniline Chemical compound CNC1=CC=C(I)C=C1 IZVRDZGBMDYYQT-UHFFFAOYSA-N 0.000 description 1
- JBCDCYFEJQHTTA-UHFFFAOYSA-N 4-methyl-3-(trifluoromethyl)aniline Chemical compound CC1=CC=C(N)C=C1C(F)(F)F JBCDCYFEJQHTTA-UHFFFAOYSA-N 0.000 description 1
- WRZOMWDJOLIVQP-UHFFFAOYSA-N 5-Chloro-ortho-toluidine Chemical compound CC1=CC=C(Cl)C=C1N WRZOMWDJOLIVQP-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- JLCDTNNLXUMYFQ-UHFFFAOYSA-N 5-fluoro-2-methylaniline Chemical compound CC1=CC=C(F)C=C1N JLCDTNNLXUMYFQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 238000006237 Beckmann rearrangement reaction Methods 0.000 description 1
- FQPBTGIQPQTEKT-UHFFFAOYSA-N C1C(=CC=CC1(Cl)Br)N=C(N)N Chemical compound C1C(=CC=CC1(Cl)Br)N=C(N)N FQPBTGIQPQTEKT-UHFFFAOYSA-N 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical class C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 1
- IFLGTKQQNHUEKL-UHFFFAOYSA-N N,2,6-trimethyl-4-(trifluoromethyl)aniline Chemical compound CNC1=C(C=C(C=C1C)C(F)(F)F)C IFLGTKQQNHUEKL-UHFFFAOYSA-N 0.000 description 1
- JHTJATYKWPELCX-UHFFFAOYSA-N N-methyl-3,4-bis(phenylmethoxy)aniline Chemical compound CNC1=CC(=C(C=C1)OCC1=CC=CC=C1)OCC1=CC=CC=C1 JHTJATYKWPELCX-UHFFFAOYSA-N 0.000 description 1
- FULZLIGZKMKICU-UHFFFAOYSA-N N-phenylthiourea Chemical compound NC(=S)NC1=CC=CC=C1 FULZLIGZKMKICU-UHFFFAOYSA-N 0.000 description 1
- UIQMVEYFGZJHCZ-SSTWWWIQSA-N Nalorphine Chemical compound C([C@@H](N(CC1)CC=C)[C@@H]2C=C[C@@H]3O)C4=CC=C(O)C5=C4[C@@]21[C@H]3O5 UIQMVEYFGZJHCZ-SSTWWWIQSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000001078 anti-cholinergic effect Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229940044683 chemotherapy drug Drugs 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229960004126 codeine Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000001609 comparable effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 150000001912 cyanamides Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 208000001848 dysentery Diseases 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- OROGSEYTTFOCAN-UHFFFAOYSA-N hydrocodone Natural products C1C(N(CCC234)C)C2C=CC(O)C3OC2=C4C1=CC=C2OC OROGSEYTTFOCAN-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 150000002541 isothioureas Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- MCLITRXWHZUNCQ-UHFFFAOYSA-N methylcyanamide Chemical compound CNC#N MCLITRXWHZUNCQ-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- XNFHUBLEDUZDHL-UHFFFAOYSA-N n,2-dimethyl-4-(trifluoromethyl)aniline Chemical compound CNC1=CC=C(C(F)(F)F)C=C1C XNFHUBLEDUZDHL-UHFFFAOYSA-N 0.000 description 1
- GVHZQIIMGRLFMX-UHFFFAOYSA-N n-(phenylcarbamothioyl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(=S)NC1=CC=CC=C1 GVHZQIIMGRLFMX-UHFFFAOYSA-N 0.000 description 1
- OAPVPGPVBZRARK-UHFFFAOYSA-N n-ethyl-2,6-dimethylaniline Chemical compound CCNC1=C(C)C=CC=C1C OAPVPGPVBZRARK-UHFFFAOYSA-N 0.000 description 1
- MBSPOYRKNIDVOA-UHFFFAOYSA-N n-ethyl-4-fluoroaniline Chemical compound CCNC1=CC=C(F)C=C1 MBSPOYRKNIDVOA-UHFFFAOYSA-N 0.000 description 1
- LKNLVUCTBWTNPS-UHFFFAOYSA-N n-methyl-3,5-bis(trifluoromethyl)aniline Chemical compound CNC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 LKNLVUCTBWTNPS-UHFFFAOYSA-N 0.000 description 1
- SRTKIHVQZYXHHJ-UHFFFAOYSA-N n-methyl-3-(trifluoromethyl)aniline Chemical compound CNC1=CC=CC(C(F)(F)F)=C1 SRTKIHVQZYXHHJ-UHFFFAOYSA-N 0.000 description 1
- MGCCWCLGIPNIBP-UHFFFAOYSA-N n-methyl-4-(trifluoromethoxy)aniline Chemical compound CNC1=CC=C(OC(F)(F)F)C=C1 MGCCWCLGIPNIBP-UHFFFAOYSA-N 0.000 description 1
- UTUYWZJPVLDHJJ-UHFFFAOYSA-N n-methyl-4-(trifluoromethyl)aniline Chemical compound CNC1=CC=C(C(F)(F)F)C=C1 UTUYWZJPVLDHJJ-UHFFFAOYSA-N 0.000 description 1
- RQEYQVCVGXCQQN-UHFFFAOYSA-N n-methyl-4-methylsulfonylaniline Chemical compound CNC1=CC=C(S(C)(=O)=O)C=C1 RQEYQVCVGXCQQN-UHFFFAOYSA-N 0.000 description 1
- XIFJZJPMHNUGRA-UHFFFAOYSA-N n-methyl-4-nitroaniline Chemical compound CNC1=CC=C([N+]([O-])=O)C=C1 XIFJZJPMHNUGRA-UHFFFAOYSA-N 0.000 description 1
- 229960000938 nalorphine Drugs 0.000 description 1
- 239000004081 narcotic agent Substances 0.000 description 1
- 101150009274 nhr-1 gene Proteins 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000002888 oleic acid derivatives Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- WGJFJIVTTOXFHT-UHFFFAOYSA-N pentylcyanamide Chemical compound CCCCCNC#N WGJFJIVTTOXFHT-UHFFFAOYSA-N 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000004800 psychological effect Effects 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- VPAYJEUHKVESSD-UHFFFAOYSA-N trifluoroiodomethane Chemical compound FC(F)(F)I VPAYJEUHKVESSD-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 125000002256 xylenyl group Chemical class C1(C(C=CC=C1)C)(C)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/215—Radicals derived from nitrogen analogues of carbonic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/24—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/24—Derivatives of thiourea containing any of the groups, X being a hetero atom, Y being any atom
- C07C335/28—Y being a hetero atom, e.g. thiobiuret
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/34—Isothioureas having sulfur atoms of isothiourea groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/08—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring nitrogen atom
- C07D203/12—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Medicines Containing Plant Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/558,186 US4025652A (en) | 1975-03-31 | 1975-03-31 | Amidinoureas |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH620200A5 true CH620200A5 (enExample) | 1980-11-14 |
Family
ID=24228538
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1400075A CH620200A5 (enExample) | 1975-03-31 | 1975-10-29 |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4025652A (enExample) |
| AR (1) | AR215584A1 (enExample) |
| AU (1) | AU503753B2 (enExample) |
| BE (1) | BE839615A (enExample) |
| CA (1) | CA1081710A (enExample) |
| CH (1) | CH620200A5 (enExample) |
| DE (1) | DE2546744A1 (enExample) |
| ES (1) | ES446548A1 (enExample) |
| FR (1) | FR2305975A2 (enExample) |
| GB (1) | GB1541059A (enExample) |
| IL (1) | IL48209A (enExample) |
| MX (1) | MX3432E (enExample) |
| NL (1) | NL7603176A (enExample) |
| ZA (1) | ZA761927B (enExample) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4326074A (en) * | 1972-09-22 | 1982-04-20 | William H. Rorer, Inc. | Amidinoureas |
| US4488993A (en) * | 1972-09-22 | 1984-12-18 | William H. Rorer, Inc. | Amidinoureas |
| US4204000A (en) * | 1975-03-31 | 1980-05-20 | William H. Rorer, Inc. | Anti-ulcer amidinoureas |
| US4203920A (en) * | 1975-03-31 | 1980-05-20 | William H. Rorer, Inc. | Amidinoureas |
| US4218450A (en) * | 1976-03-30 | 1980-08-19 | William H. Rorer, Inc. | Method for treatment of gastrointestinal spasmodic disease conditions or symptoms in mammals |
| US4242340A (en) * | 1976-03-30 | 1980-12-30 | William H. Rorer, Inc. | Method for the treatment of diarrheal disease conditions and symptoms in mammals |
| US4209624A (en) * | 1976-10-26 | 1980-06-24 | Cooper Laboratories, Inc. | Process for preparing substituted bis(amidinoureas) |
| US4353842A (en) * | 1978-09-14 | 1982-10-12 | William H. Rorer, Inc. | Amidinoureas |
| US4418209A (en) * | 1980-04-14 | 1983-11-29 | William H. Rorer, Inc. | Amidinothioureas |
| DE3152942T1 (de) * | 1981-08-24 | 1983-12-15 | Rorer International (Overseas) Inc., 19899 Wilmington, Del. | Heterocyclisch substituierte amidinoharnstoffe und ihre therapeutische anwendung |
| EP0086193A1 (en) * | 1981-08-24 | 1983-08-24 | Rorer International (Overseas) Inc. | The treatment and prevention of scours in animals |
| US4562209A (en) * | 1981-08-24 | 1985-12-31 | William H. Rorer, Inc. | Promotion of feed efficiency in animals |
| JPS6160673A (ja) * | 1984-08-30 | 1986-03-28 | Yamanouchi Pharmaceut Co Ltd | グアニジノチアゾ−ル誘導体の製造法 |
| DE4018070A1 (de) * | 1990-06-06 | 1991-12-12 | Bayer Ag | Morpholinoharnstoff-derivate |
| US6190691B1 (en) | 1994-04-12 | 2001-02-20 | Adolor Corporation | Methods for treating inflammatory conditions |
| US5962477A (en) * | 1994-04-12 | 1999-10-05 | Adolor Corporation | Screening methods for cytokine inhibitors |
| US5849761A (en) * | 1995-09-12 | 1998-12-15 | Regents Of The University Of California | Peripherally active anti-hyperalgesic opiates |
| US6573282B1 (en) | 1995-09-12 | 2003-06-03 | Adolor Corporation | Peripherally active anti-hyperalgesic opiates |
| US5667773A (en) * | 1996-03-12 | 1997-09-16 | Adolor Corporation | Film-forming compositions of antihyperalgesic opiates and method of treating hyperalgesic conditions therewith |
| US5888494A (en) * | 1996-03-12 | 1999-03-30 | Adolor Corporation | Film-forming compositions of antihyperalgesic opiates and method of treating hyperalgesic and pruritic conditions therewith |
| US6353004B1 (en) | 1997-07-14 | 2002-03-05 | Adolor Coporation | Peripherally acting anti-pruritic opiates |
| US5849762A (en) * | 1997-07-14 | 1998-12-15 | Adolor Corporation | Peripherally acting anti-pruritic opiates |
| US20030158220A1 (en) * | 1997-11-03 | 2003-08-21 | Foss Joseph F. | Use of methylnaltrexone and related compounds to treat chronic opioid use side effects |
| PT2368553E (pt) | 2003-04-08 | 2015-03-03 | Progenics Pharm Inc | Formulações farmacêuticas contendo metilnaltrexona |
| AR057035A1 (es) * | 2005-05-25 | 2007-11-14 | Progenics Pharm Inc | SíNTESIS DE (R)-N-METILNALTREXONA, COMPOSICIONES FARMACÉUTICAS Y USOS |
| AR057325A1 (es) | 2005-05-25 | 2007-11-28 | Progenics Pharm Inc | Sintesis de (s)-n-metilnaltrexona, composiciones farmaceuticas y usos |
| TWI489984B (zh) | 2006-08-04 | 2015-07-01 | Wyeth Corp | 用於非經腸道傳輸化合物之配方及其用途 |
| TW200817048A (en) * | 2006-09-08 | 2008-04-16 | Wyeth Corp | Dry powder compound formulations and uses thereof |
| WO2008121352A2 (en) | 2007-03-29 | 2008-10-09 | Progenics Pharmaceuticals, Inc. | Crystal forms of (r) -n-methylnaltrexone bromide and uses thereof |
| DK2565195T3 (en) | 2007-03-29 | 2015-06-29 | Wyeth Llc | PERIPHERAL OPIOID RECEPTOR AND ANTAGONISTS AND USES THEREOF |
| TWI553009B (zh) | 2007-03-29 | 2016-10-11 | 普吉尼製藥公司 | 末梢性類鴉片受體拮抗劑及其用途 |
| KR101581480B1 (ko) | 2008-02-06 | 2015-12-30 | 프로제닉스 파머슈티컬스, 인코포레이티드 | (r),(r)-2,2'-비스-메틸날트렉손의 제조법 및 용도 |
| CA2676881C (en) | 2008-09-30 | 2017-04-25 | Wyeth | Peripheral opioid receptor antagonists and uses thereof |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2631152A (en) * | 1952-01-24 | 1953-03-10 | American Cyanamid Co | Guanylurea salts of penicillin |
| US3320229A (en) * | 1963-08-26 | 1967-05-16 | Stauffer Chemical Co | Complexes of guanidines with completely halogenated acetones |
| GB1194835A (en) * | 1966-07-07 | 1970-06-10 | Wellcome Found | Novel 1-Amidino-3-Phenyl-Urea Derivatives, the preparation thereof and Compositions containing the same |
| US3759991A (en) * | 1970-05-04 | 1973-09-18 | Exxon Research Engineering Co | Thiocarbamylated guanidines - growth regulant |
| PH12016A (en) * | 1972-09-22 | 1978-10-06 | Rorer Inc William H | Amidinoureas |
-
1975
- 1975-03-31 US US05/558,186 patent/US4025652A/en not_active Expired - Lifetime
- 1975-09-30 IL IL48209A patent/IL48209A/xx unknown
- 1975-10-18 DE DE19752546744 patent/DE2546744A1/de not_active Ceased
- 1975-10-29 CH CH1400075A patent/CH620200A5/de not_active IP Right Cessation
-
1976
- 1976-03-11 AR AR262512A patent/AR215584A1/es active
- 1976-03-12 FR FR7607274A patent/FR2305975A2/fr active Granted
- 1976-03-16 BE BE165207A patent/BE839615A/xx unknown
- 1976-03-24 AU AU12301/76A patent/AU503753B2/en not_active Expired
- 1976-03-26 NL NL7603176A patent/NL7603176A/xx unknown
- 1976-03-29 CA CA249,091A patent/CA1081710A/en not_active Expired
- 1976-03-30 ZA ZA761927A patent/ZA761927B/xx unknown
- 1976-03-31 GB GB13103/76A patent/GB1541059A/en not_active Expired
- 1976-03-31 MX MX000131U patent/MX3432E/es unknown
- 1976-03-31 ES ES446548A patent/ES446548A1/es not_active Expired
- 1976-11-03 US US05/738,426 patent/US4115564A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES446548A1 (es) | 1977-10-16 |
| AU503753B2 (en) | 1979-09-20 |
| AU1230176A (en) | 1977-09-29 |
| ZA761927B (en) | 1977-04-27 |
| FR2305975B2 (enExample) | 1978-12-15 |
| NL7603176A (nl) | 1976-10-04 |
| BE839615A (fr) | 1976-07-16 |
| AR215584A1 (es) | 1979-10-31 |
| IL48209A0 (en) | 1975-11-25 |
| US4025652A (en) | 1977-05-24 |
| US4115564A (en) | 1978-09-19 |
| DE2546744A1 (de) | 1977-02-17 |
| GB1541059A (en) | 1979-02-21 |
| IL48209A (en) | 1981-09-13 |
| MX3432E (es) | 1980-11-24 |
| CA1081710A (en) | 1980-07-15 |
| FR2305975A2 (fr) | 1976-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH620200A5 (enExample) | ||
| CH635823A5 (de) | Verfahren zur herstellung von neuen 1-amidin-3-substituierten-phenylharnstoffen. | |
| DE2012138B2 (de) | N-eckige klammer auf 4-(beta-pyrazin- 2-carboxyamido-aethyl)-benzolsulphonyl eckige klammer zu -n' - cycloalkylharnstoffe und diese enthaltende pharmazeutische praeparate | |
| DE2713441A1 (de) | Amidinoharnstoffe | |
| DE2345951C2 (de) | 1-(2,6-Dichlorphenylamidino)-harnstoff bzw. dessen Hydrochlorid, Verfahren zu seiner Herstellung und diesen enthaltende therapeutische Zubereitung | |
| CH628887A5 (de) | Verfahren zur herstellung von benzolsulfonylharnstoffen. | |
| DE2136763A1 (de) | Neue Benzamide Stickstoff enthaltender Heterocyclen und Verfahren zur Herstellung derselben | |
| CH558784A (de) | Verfahren zur herstellung von sulfonaniliden. | |
| DE2530680A1 (de) | Neue aminoderivate von pyrido(2,3-b) pyrazincarbonsaeuren und -carbonsaeureestern | |
| DE2238870A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| DE2629756C2 (enExample) | ||
| DE2424076A1 (de) | Derivate von 4-hydroxy-3-nitrocarbostyrilen enthaltende arzneimittel, neue 4-hydroxy-3-nitrocarbostyrile und verfahren zu ihrer herstellung | |
| DE2151487A1 (de) | Pharmazeutische Massen | |
| CH370764A (de) | Verfahren zur Herstellung von oral wirksamen Antidiabetika | |
| DE2251260A1 (de) | Verfahren zur herstellung von biguanidverbindungen | |
| AT219052B (de) | Verfahren zur Herstellung von neuen Sulfonylharnstoffen | |
| DE1670059A1 (de) | Guanidinderivate und Verfahren zu ihrer Herstellung | |
| DE1695382A1 (de) | Neue 2-substituierte 2,3-Diaminopyridine und Verfahren zu ihrer Herstellung | |
| CH374984A (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE2529860A1 (de) | Phenylamidinharnstoffe, verfahren zu ihrer herstellung und diese verbindungen enthaltende therapeutische zubereitungen | |
| AT244346B (de) | Verfahren zur Herstellung neuer bicyclischer Benzolsulfonylharnstoffe | |
| AT216521B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| AT358061B (de) | Verfahren zur herstellung von neuen (1,2- dihydro-2-oxo-nicotinamido)-alkylbenzol- sulfonylharnstoffen und von deren salzen | |
| AT266075B (de) | Verfahren zur Herstellung von neuen Sulfonaniliden und deren Säureadditions- und Metallsalzen | |
| AT226728B (de) | Verfahren zur Herstellung von neuen Benzolsulfonyl-cyclohexyl-harnstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |