CH617417A5 - - Google Patents
Download PDFInfo
- Publication number
- CH617417A5 CH617417A5 CH1532974A CH1532974A CH617417A5 CH 617417 A5 CH617417 A5 CH 617417A5 CH 1532974 A CH1532974 A CH 1532974A CH 1532974 A CH1532974 A CH 1532974A CH 617417 A5 CH617417 A5 CH 617417A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- group
- lower alkyl
- diphenylmethane
- product
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical class C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 229940054021 anxiolytics diphenylmethane derivative Drugs 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 3
- 229930195729 fatty acid Natural products 0.000 claims description 3
- 239000000194 fatty acid Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 1
- 230000003287 optical effect Effects 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 4
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- ICMAFTSLXCXHRK-UHFFFAOYSA-N Ethyl pentanoate Chemical compound CCCCC(=O)OCC ICMAFTSLXCXHRK-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- ALHOFXQMBUWICK-UHFFFAOYSA-N ethyl 2-bromo-2-methylbutanoate Chemical compound CCOC(=O)C(C)(Br)CC ALHOFXQMBUWICK-UHFFFAOYSA-N 0.000 description 1
- HRISDVQCXAJSRW-UHFFFAOYSA-N ethyl 2-bromo-2-methylpentanoate Chemical compound CCCC(C)(Br)C(=O)OCC HRISDVQCXAJSRW-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- QIIPQYDSKRYMFG-UHFFFAOYSA-N phenyl hydrogen carbonate Chemical class OC(=O)OC1=CC=CC=C1 QIIPQYDSKRYMFG-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C321/00—Thiols, sulfides, hydropolysulfides or polysulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
- C07C59/70—Ethers of hydroxy-acetic acid, e.g. substitutes on the ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/46—Oxygen atoms attached in position 4 having a hydrogen atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/08—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 1 and 3, e.g. theophylline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (23)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1532974A CH617417A5 (enExample) | 1973-12-27 | 1974-11-18 | |
| NL7416412A NL7416412A (nl) | 1973-12-27 | 1974-12-17 | Werkwijze ter bereiding van nieuwe cholesterol- gende verbindingen. |
| AT1015174A AT353776B (de) | 1973-12-27 | 1974-12-19 | Verfahren zur herstellung von neuen alkan- saeuren, deren estern und salzen |
| SE7416163A SE426582B (sv) | 1973-12-27 | 1974-12-20 | Forfarande for framstellning av foreningar med kolesterolsenkande effekt |
| DK670274A DK157005C (da) | 1973-12-27 | 1974-12-20 | Analogifremgangsmaade til fremstilling af 2-(4-benzyl-phenoxy)-alkansyrederivater |
| DE2463001A DE2463001C2 (enExample) | 1973-12-27 | 1974-12-23 | |
| IE2658/74A IE42425B1 (en) | 1973-12-27 | 1974-12-23 | Aryloxy-and arythio-alkanoates having cholesterol-reducing properties |
| DE2461069A DE2461069C3 (de) | 1973-12-27 | 1974-12-23 | 2-(4-Benzylphenoxy)-alkancarbonsäureester, Verfahren zu ihrer Herstellung und diese Ester enthaltende Arzneimittel |
| GB55755/74A GB1497266A (en) | 1973-12-27 | 1974-12-24 | Aryloxy-and arylthio-alkanoates having cholesterol-reducing properties |
| LU71561A LU71561A1 (enExample) | 1973-12-27 | 1974-12-24 | |
| CA000216758A CA1178970A (en) | 1973-12-27 | 1974-12-24 | Aryloxyalkyl containing compounds |
| SU742090104A SU612619A3 (ru) | 1973-12-27 | 1974-12-25 | Способ получени замещенных фенилов |
| JP49149036A JPS5934695B2 (ja) | 1973-12-27 | 1974-12-27 | 新規脱コレステロ−ル化合物の製法 |
| BE151969A BE823904A (fr) | 1973-12-27 | 1974-12-27 | Aryloxy et arylthio-alcanes substitues utilisables comme substances actives de medicaments |
| FR7443033A FR2255891B1 (enExample) | 1973-12-27 | 1974-12-27 | |
| AU76902/74A AU493559B2 (en) | 1974-12-31 | Aryloxy and arythio-alkanoates having cholestrol-reducing properties | |
| US05/773,144 US4153803A (en) | 1973-12-27 | 1977-03-01 | Cholesterol-lowering phenoxyalkanoic acid esters |
| US05/773,148 US4483999A (en) | 1973-12-27 | 1977-03-01 | Phenoxy alkanoic acid derivatives having the ability to lower the level of fatty substances in the blood |
| US05/773,145 US4115393A (en) | 1974-03-28 | 1977-03-01 | Pyridyl alkyl esters of substituted phenoxy alkanoic acids having the ability to reduce the level of fatty substances in the blood |
| AT459278A AT358017B (de) | 1973-12-27 | 1978-06-23 | Verfahren zur herstellung neuer phenoxyalkan- saeuren, deren ester und salze |
| US05/942,129 US4182902A (en) | 1973-12-27 | 1978-09-13 | Novel cholesterol-lowering compounds |
| CH897879A CH617656A5 (en) | 1974-11-18 | 1979-10-05 | Process for the preparation of novel diphenylmethane derivatives |
| JP5243984A JPS6140263A (ja) | 1974-11-18 | 1984-03-21 | 新規脱コレステロ−ル化合物の製法 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1814473A CH605557A5 (en) | 1973-12-27 | 1973-12-27 | Phenoxy- and phenylthio-alkanes |
| CH1532974A CH617417A5 (enExample) | 1973-12-27 | 1974-11-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH617417A5 true CH617417A5 (enExample) | 1980-05-30 |
Family
ID=25716175
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1532974A CH617417A5 (enExample) | 1973-12-27 | 1974-11-18 |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US4483999A (enExample) |
| CH (1) | CH617417A5 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6083497A (en) | 1997-11-05 | 2000-07-04 | Geltex Pharmaceuticals, Inc. | Method for treating hypercholesterolemia with unsubstituted polydiallylamine polymers |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB860303A (en) * | 1958-06-20 | 1961-02-01 | Ici Ltd | Pharmaceutical compositions comprising ª‡-aryloxy-aliphatic carboxylic acids and/or ª |
| US3379752A (en) * | 1964-05-20 | 1968-04-23 | Merck & Co Inc | Phenoxy substituted 3-hydroxyalkanoic acids and a method for their preparation |
| US3716583A (en) * | 1969-04-16 | 1973-02-13 | Sumitomo Chemical Co | Phenoxy carboxylic acid derivative |
| GB1422679A (en) * | 1972-11-16 | 1976-01-28 | Funai Pharmaceutical Ind Ltd | Substituted phenoxy-a-methylpropionic acid derivatives and a process for producing the same |
| DE2417487C2 (de) * | 1974-04-10 | 1983-01-20 | Hoechst Ag, 6000 Frankfurt | Benzyl-phenoxyalkancarbonsäuren, deren Derivate und Verfahren zu ihrer Herstellung |
-
1974
- 1974-11-18 CH CH1532974A patent/CH617417A5/de not_active IP Right Cessation
-
1977
- 1977-03-01 US US05/773,148 patent/US4483999A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4483999A (en) | 1984-11-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2726619C2 (enExample) | ||
| DE1936463A1 (de) | Substituierte Phenole | |
| DE3023122A1 (de) | Verfahren zur herstellung von alkyl-2-chlorpropionaten | |
| DE1935320A1 (de) | Verfahren zur Herstellung von Cyclopropanderivaten und die dabei erhaltenen Produkte | |
| DE3718801A1 (de) | Verfahren zur herstellung von e-2-propyl-2-pentensaeure und physiologisch vertraeglichen salzen derselben | |
| CH617417A5 (enExample) | ||
| DE2462559B2 (de) | 4-Oximino-l -oxa-3-thiacyclopentane und deren 3-Oxide bzw. 33-Dioxide sowie 3-Oximino-l-oxa-4-thiacycIohexane und deren 4-Oxide bzw. 4,4-Dioxide | |
| DE3025368A1 (de) | Verfahren zur synthese von strobilurin | |
| DE2330235B2 (de) | Verfahren zur Gewinnung von Carbonsäureestern aus den Abfallsalzlösungen der Cyclohexanonherstellung | |
| DE2417996A1 (de) | Alkylderivate von prostansaeuren und deren herstellung | |
| DE2404159C2 (de) | Verfahren zur Herstellung von 2-(4-Alkylphenyl)-propionsäuren und ihren Natrium-oder Kaliumsalzen | |
| DE2156862B2 (de) | Verfahren zur Herstellung von Gemischen aus trans-L- und cis-L-1'· Desmethyl^'-despropyM'-alkyl--lincomycinen oder -clindamycinen | |
| DE2328131B2 (de) | Neues Verfahren zur Herstellung von Prostaglandin^ a und seinen Analogen | |
| DE69008130T2 (de) | Glutarsäurederivate und ihre Herstellung. | |
| DE3134129A1 (de) | Verfahren zur trennung des racemats (1rs: 2sr)-2-amino-1-phenyl-propan-1-ol | |
| DE3816801C2 (enExample) | ||
| DE706322C (de) | Verfahren zur Herstellung von ?,ª‰-ungesaettigten Ketonen | |
| DE10331211A1 (de) | Verfahren zur Herstellung von 4-Cyano-3-hydroxybuttersäureestern | |
| DE1795740C2 (de) | 7-Chlor-7-deoxy-lincomycinderivate und pharmazeutischen Zusammensetzungen aus diesen Verbindungen und üblichen Trägerstoffen | |
| DE2625689C3 (de) | 1,3-Diphenoxypropanol-(2)-Derivate sowie Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| EP0518110B1 (de) | Verfahren zur Herstellung der reinen Enantiomere der 4-[4-(4'-tert.Butylphenyl)-2-hydroxybutoxy]-benzoesäure und ihrer Alkylester | |
| DE3046059C2 (de) | 4-Halogen-5,5-dialkoxypentansäureester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von 2,2-Dialkyl-3-formylcyclopropancarbonsäureestern | |
| AT288363B (de) | Verfahren zur Herstellung von neuen β-Aroyl- β-halogenacrylsäuren | |
| DE3901801A1 (de) | Verfahren zur herstellung von 8-hydroxyoctansaeure | |
| AT222815B (de) | Verfahren zur Herstellung von neuen Tropasäureestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |