CH551943A - N-(Lower alkyl)-phenylisopropylamines - Google Patents
N-(Lower alkyl)-phenylisopropylaminesInfo
- Publication number
- CH551943A CH551943A CH21970A CH21970A CH551943A CH 551943 A CH551943 A CH 551943A CH 21970 A CH21970 A CH 21970A CH 21970 A CH21970 A CH 21970A CH 551943 A CH551943 A CH 551943A
- Authority
- CH
- Switzerland
- Prior art keywords
- hydrogen
- lower alkyl
- general formula
- group
- nitro
- Prior art date
Links
- 125000000217 alkyl group Chemical group 0.000 title claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 15
- -1 nitro, amino Chemical group 0.000 claims abstract description 15
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 150000002367 halogens Chemical class 0.000 claims abstract description 4
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 3
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 3
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims abstract description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 11
- 150000002431 hydrogen Chemical group 0.000 claims description 8
- 230000029936 alkylation Effects 0.000 claims description 6
- 238000005804 alkylation reaction Methods 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- FRCFWPVMFJMNDP-UHFFFAOYSA-N n-propan-2-ylaniline Chemical class CC(C)NC1=CC=CC=C1 FRCFWPVMFJMNDP-UHFFFAOYSA-N 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 3
- RHCSKNNOAZULRK-UHFFFAOYSA-N mescaline Chemical compound COC1=CC(CCN)=CC(OC)=C1OC RHCSKNNOAZULRK-UHFFFAOYSA-N 0.000 abstract description 3
- MKJIEFSOBYUXJB-HOCLYGCPSA-N (3S,11bS)-9,10-dimethoxy-3-isobutyl-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-one Chemical compound C1CN2C[C@H](CC(C)C)C(=O)C[C@H]2C2=C1C=C(OC)C(OC)=C2 MKJIEFSOBYUXJB-HOCLYGCPSA-N 0.000 abstract description 2
- KBFUFOMFUNLAQS-UHFFFAOYSA-N [O-][N+](=O)[N+]#N Chemical compound [O-][N+](=O)[N+]#N KBFUFOMFUNLAQS-UHFFFAOYSA-N 0.000 abstract description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract description 2
- 229960005333 tetrabenazine Drugs 0.000 abstract description 2
- 229940035676 analgesics Drugs 0.000 abstract 1
- 239000000730 antalgic agent Substances 0.000 abstract 1
- 239000003218 coronary vasodilator agent Substances 0.000 abstract 1
- 239000012954 diazonium Substances 0.000 abstract 1
- 239000000380 hallucinogen Substances 0.000 abstract 1
- 230000003389 potentiating effect Effects 0.000 abstract 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 239000000284 extract Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- QWFZLPCCMVNBCM-UHFFFAOYSA-N 2-bromo-n-methyl-n-propan-2-ylaniline Chemical compound CC(C)N(C)C1=CC=CC=C1Br QWFZLPCCMVNBCM-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- AXWCQJBMXKXFIO-UHFFFAOYSA-N 2-bromo-n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1Br AXWCQJBMXKXFIO-UHFFFAOYSA-N 0.000 description 2
- IPTKGAPMKWJCKH-UHFFFAOYSA-N 4-bromo-n-methyl-n-propan-2-ylaniline Chemical compound CC(C)N(C)C1=CC=C(Br)C=C1 IPTKGAPMKWJCKH-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 206010052804 Drug tolerance Diseases 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 102000010909 Monoamine Oxidase Human genes 0.000 description 1
- 108010062431 Monoamine oxidase Proteins 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 230000026781 habituation Effects 0.000 description 1
- 230000003400 hallucinatory effect Effects 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- GVLGAFRNYJVHBC-UHFFFAOYSA-N hydrate;hydrobromide Chemical compound O.Br GVLGAFRNYJVHBC-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000002582 psychostimulating effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
Landscapes
- Silicon Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI000527 | 1965-02-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH551943A true CH551943A (en) | 1974-07-31 |
Family
ID=10994315
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH21970A CH551943A (en) | 1965-02-08 | 1966-02-07 | N-(Lower alkyl)-phenylisopropylamines |
| CH167366A CH491855A (de) | 1965-02-08 | 1966-02-07 | Verfahren zur Herstellung von neuen Phenylisopropyl-Derivaten |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH167366A CH491855A (de) | 1965-02-08 | 1966-02-07 | Verfahren zur Herstellung von neuen Phenylisopropyl-Derivaten |
Country Status (7)
| Country | Link |
|---|---|
| AT (3) | AT271436B (enrdf_load_stackoverflow) |
| CH (2) | CH551943A (enrdf_load_stackoverflow) |
| CS (1) | CS222201B2 (enrdf_load_stackoverflow) |
| DE (1) | DE1568245A1 (enrdf_load_stackoverflow) |
| DK (1) | DK122877B (enrdf_load_stackoverflow) |
| NL (1) | NL6601569A (enrdf_load_stackoverflow) |
| NO (1) | NO121501B (enrdf_load_stackoverflow) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU207282B (en) * | 1984-05-31 | 1993-03-29 | Chinoin Gyogyszer Es Vegyeszet | Process for producing phenyl-alkyl-amine derivatives and pharmaceutical compositions containing them |
-
1966
- 1966-02-07 DE DE19661568245 patent/DE1568245A1/de active Pending
- 1966-02-07 NO NO16159666A patent/NO121501B/no unknown
- 1966-02-07 CH CH21970A patent/CH551943A/de not_active IP Right Cessation
- 1966-02-07 CH CH167366A patent/CH491855A/de not_active IP Right Cessation
- 1966-02-08 AT AT112166A patent/AT271436B/de active
- 1966-02-08 CS CS79666A patent/CS222201B2/cs unknown
- 1966-02-08 NL NL6601569A patent/NL6601569A/xx unknown
- 1966-02-08 AT AT1058067A patent/AT269843B/de active
- 1966-02-08 AT AT1057967A patent/AT269842B/de active
- 1966-02-08 DK DK63266A patent/DK122877B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6601569A (enrdf_load_stackoverflow) | 1966-08-09 |
| DE1568245A1 (enrdf_load_stackoverflow) | 1970-10-08 |
| DK122877B (da) | 1972-04-24 |
| CS222201B2 (en) | 1983-05-27 |
| AT271436B (de) | 1969-06-10 |
| NO121501B (enrdf_load_stackoverflow) | 1971-03-08 |
| CH491855A (de) | 1970-06-15 |
| AT269843B (de) | 1969-04-10 |
| AT269842B (de) | 1969-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1194418B (de) | Verfahren zur Herstellung von neuen Dihalogen-amino-benzylaminen oder deren Saeureadditionssalzen mit physiologisch vertraeglichen Saeuren | |
| DE2100323B2 (de) | Ureido-phenoxy-2-hydroxy-3-alkylaminopropane | |
| DE916168C (de) | Verfahren zur Herstellung von Pyrrolidinoalkylphenothiazinen | |
| DE2701705A1 (de) | Neue organische verbindungen, ihre verwendung und herstellung | |
| CH551943A (en) | N-(Lower alkyl)-phenylisopropylamines | |
| DE2351281B2 (de) | Aminophenyl-äthanolamin-Derivate, deren Herstellung und Verwendung | |
| DE2602846C2 (de) | Verfahren zur Herstellung von 2-(2-Thienyl)äthylaminen | |
| DE1468920A1 (de) | Verfahren zur Herstellung von neuen Dibenzocycloheptadienderivaten | |
| AT324314B (de) | Verfahren zur herstellung von neuen 4-(m-benzoylphenyl)-butan (bzw. -buten-2)-sauren | |
| AT227690B (de) | Verfahren zur Herstellung neuer, basisch substituierter Succinimide | |
| DE950550C (de) | Verfahren zur Herstellung von basisch substituierten Phenylcycloalkenylpropanolen | |
| AT371446B (de) | Verfahren zur herstellung von neuen cis-4aphenylisochinolinderivaten und ihren saeureadditionssalzen | |
| AT360992B (de) | Verfahren zur herstellung neuer phenylazacyclo- alkane und von deren salzen und optisch aktiven verbindungen | |
| DE916055C (de) | Verfahren zur Herstellung von Aminoverbindungen | |
| DE881663C (de) | Verfahren zur Herstellung von 1-(p-Oxyphenyl)-2-(ª‡-methyl-ª†-phenyl-propylamino)-propanen | |
| DE1620536C (de) | Verfahren zur Herstellung von alpha Pyrrolidinoketonen und ihren Salzen | |
| CH524568A (de) | Verfahren zur Herstellung von neuen N-Phenylisopropyl-alkylaminen | |
| AT260914B (de) | Verfahren zur Herstellung von neuen α-(Aminoalkoxyphenyl)-α'-nitrostilbenen und deren Säureadditionssalzen bzw. quaternären Ammoniumverbindungen | |
| DE697801C (de) | Verfahren zur Herstellung von Furanverbindungen der Pyrazolonreihe | |
| AT233016B (de) | Verfahren zur Herstellung von neuen Iminodibenzylderivaten | |
| AT347423B (de) | Verfahren zur herstellung von neuen 7- aminobenzocycloheptenen und von deren salzen | |
| DE2340160A1 (de) | Norbornanderivate | |
| AT243268B (de) | Verfahren zur Herstellung von neuen Benzochinolizin-Derivaten | |
| AT237596B (de) | Verfahren zur Herstellung des neuen 1-Cyclohexyl-2-aminopropanos-(1) und dessen Salze | |
| AT205038B (de) | Verfahren zur Herstellung neuer, in 10-Stellung substituierter 11-Oxo-dibenzo-[b, f]-thia-[1]-aza-[4]-cycloheptadien-[2,6]-Verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |