CH512576A - Verwendung neuer Acrylsäurederivate zum Härten von Gelatine - Google Patents
Verwendung neuer Acrylsäurederivate zum Härten von GelatineInfo
- Publication number
- CH512576A CH512576A CH12067A CH12067A CH512576A CH 512576 A CH512576 A CH 512576A CH 12067 A CH12067 A CH 12067A CH 12067 A CH12067 A CH 12067A CH 512576 A CH512576 A CH 512576A
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- group
- ether
- acrylic acid
- hours
- Prior art date
Links
- 229920000159 gelatin Polymers 0.000 title claims abstract description 33
- 235000019322 gelatine Nutrition 0.000 title claims abstract description 33
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 title claims abstract 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 title claims abstract 3
- 239000001828 Gelatine Substances 0.000 title abstract description 10
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- 108010010803 Gelatin Proteins 0.000 claims description 23
- 239000008273 gelatin Substances 0.000 claims description 23
- 235000011852 gelatine desserts Nutrition 0.000 claims description 23
- 150000001252 acrylic acid derivatives Chemical class 0.000 claims description 10
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 abstract description 72
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract description 15
- 239000000839 emulsion Substances 0.000 abstract description 4
- 229910052760 oxygen Inorganic materials 0.000 abstract description 3
- 238000004132 cross linking Methods 0.000 abstract description 2
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 2
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 104
- 150000001875 compounds Chemical class 0.000 description 54
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 48
- 239000013078 crystal Substances 0.000 description 35
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- 239000000243 solution Substances 0.000 description 31
- 239000004848 polyfunctional curative Substances 0.000 description 26
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 22
- 239000000203 mixture Substances 0.000 description 21
- 238000002844 melting Methods 0.000 description 20
- 230000008018 melting Effects 0.000 description 20
- 239000010410 layer Substances 0.000 description 19
- 238000003756 stirring Methods 0.000 description 17
- 238000000354 decomposition reaction Methods 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 11
- FXDWBFSKZZSAHO-UHFFFAOYSA-N 3-chloropropanoyl isocyanate Chemical compound ClCCC(=O)N=C=O FXDWBFSKZZSAHO-UHFFFAOYSA-N 0.000 description 10
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical compound O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 description 9
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000012452 mother liquor Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 3
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- -1 dicarboxylic acid diamides Chemical class 0.000 description 3
- 238000009792 diffusion process Methods 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 238000005266 casting Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- WRIRWRKPLXCTFD-UHFFFAOYSA-N malonamide Chemical compound NC(=O)CC(N)=O WRIRWRKPLXCTFD-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- JLFNLZLINWHATN-UHFFFAOYSA-N pentaethylene glycol Chemical compound OCCOCCOCCOCCOCCO JLFNLZLINWHATN-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 2
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 2
- 229950006389 thiodiglycol Drugs 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
- FOVOBTLEKSQTFG-UHFFFAOYSA-N 2,5-dimethoxybenzene-1,4-diamine Chemical compound COC1=CC(N)=C(OC)C=C1N FOVOBTLEKSQTFG-UHFFFAOYSA-N 0.000 description 1
- DHXNZYCXMFBMHE-UHFFFAOYSA-N 3-bromopropanoic acid Chemical compound OC(=O)CCBr DHXNZYCXMFBMHE-UHFFFAOYSA-N 0.000 description 1
- QEYMMOKECZBKAC-UHFFFAOYSA-N 3-chloropropanoic acid Chemical compound OC(=O)CCCl QEYMMOKECZBKAC-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OLQMXOZUKITQBE-UHFFFAOYSA-N C(C=C)(=O)NC(=O)NS(=O)(=O)N=C=O Chemical compound C(C=C)(=O)NC(=O)NS(=O)(=O)N=C=O OLQMXOZUKITQBE-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- INSRQEMEVAMETL-UHFFFAOYSA-N decane-1,1-diol Chemical compound CCCCCCCCCC(O)O INSRQEMEVAMETL-UHFFFAOYSA-N 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical compound OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- VDBXLXRWMYNMHL-UHFFFAOYSA-N decanediamide Chemical compound NC(=O)CCCCCCCCC(N)=O VDBXLXRWMYNMHL-UHFFFAOYSA-N 0.000 description 1
- 230000032798 delamination Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000004662 dithiols Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- VIJMMQUAJQEELS-UHFFFAOYSA-N n,n-bis(ethenyl)ethenamine Chemical compound C=CN(C=C)C=C VIJMMQUAJQEELS-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- UCRQTPGCFCBLOX-UHFFFAOYSA-N thiophene-2,5-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)S1 UCRQTPGCFCBLOX-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/06—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with non-macromolecular additives
- G03C1/30—Hardeners
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/50—Y being a hydrogen or an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/48—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups having nitrogen atoms of sulfonamide groups further bound to another hetero atom
- C07C311/49—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups having nitrogen atoms of sulfonamide groups further bound to another hetero atom to nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ZA6800017D ZA6800017B (Direct) | 1967-01-05 | ||
| CH12067A CH512576A (de) | 1967-01-05 | 1967-01-05 | Verwendung neuer Acrylsäurederivate zum Härten von Gelatine |
| DE1720078A DE1720078C3 (de) | 1967-01-05 | 1967-11-30 | Verwendung neuer Acrylsäurederivate zum Härten von Gelatine |
| GB46/68A GB1183648A (en) | 1967-01-05 | 1968-01-01 | Acrylic Acid Derivatives for Hardening Gelatine |
| FR1549919D FR1549919A (Direct) | 1967-01-05 | 1968-01-02 | |
| US695361A US3455893A (en) | 1967-01-05 | 1968-01-03 | Process for hardening gelatine by reacting with acrylic acid derivatives |
| AT11168A AT275315B (de) | 1967-01-05 | 1968-01-04 | Härten von Gelatine |
| BE708962D BE708962A (Direct) | 1967-01-05 | 1968-01-04 | |
| NL6800125A NL6800125A (Direct) | 1967-01-05 | 1968-01-04 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH12067A CH512576A (de) | 1967-01-05 | 1967-01-05 | Verwendung neuer Acrylsäurederivate zum Härten von Gelatine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH512576A true CH512576A (de) | 1971-09-15 |
Family
ID=4179701
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH12067A CH512576A (de) | 1967-01-05 | 1967-01-05 | Verwendung neuer Acrylsäurederivate zum Härten von Gelatine |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3455893A (Direct) |
| AT (1) | AT275315B (Direct) |
| BE (1) | BE708962A (Direct) |
| CH (1) | CH512576A (Direct) |
| DE (1) | DE1720078C3 (Direct) |
| FR (1) | FR1549919A (Direct) |
| GB (1) | GB1183648A (Direct) |
| NL (1) | NL6800125A (Direct) |
| ZA (1) | ZA6800017B (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2447587A1 (de) * | 1973-10-08 | 1975-04-17 | Konishiroku Photo Ind | Verfahren zum haerten von gelatine |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH484980A (de) * | 1967-03-06 | 1970-03-13 | Ciba Geigy | Verwendung von Biscarbonsäureimiden zum Härten von Gelatine |
| BE795839A (fr) * | 1972-02-25 | 1973-08-23 | Ciba Geigy | Procede de retification de colloides hydrophiles |
| JPS53778B2 (Direct) * | 1973-03-12 | 1978-01-12 | ||
| US4039520A (en) * | 1973-03-12 | 1977-08-02 | Konishiroku Photo Industry Co., Ltd. | Gelatin hardening process |
| JPS53781B2 (Direct) * | 1973-03-28 | 1978-01-12 | ||
| CH582896A5 (Direct) * | 1973-05-07 | 1976-12-15 | Ciba Geigy Ag | |
| CH592700A5 (Direct) * | 1974-01-31 | 1977-11-15 | Ciba Geigy Ag | |
| JPS5639668B2 (Direct) * | 1974-02-13 | 1981-09-14 | ||
| GB1521540A (en) * | 1975-10-31 | 1978-08-16 | Ciba Geigy Ag | Vinyl-sulphone hardeners |
| GB1542462A (en) * | 1976-02-04 | 1979-03-21 | Ciba Geigy Ag | N-vinyl sulphonyl-or sulphinylalkyl amides ureas and sulphoxylureas and their use as cross-linking agents for hydrophilic colloids |
| JP4063746B2 (ja) * | 2003-09-26 | 2008-03-19 | 三井化学株式会社 | 新規なチオウレタン骨格を有する(メタ)アクリレート |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2486190A (en) * | 1946-07-22 | 1949-10-25 | Eastman Kodak Co | Imidized polyacrylamides |
| US2548520A (en) * | 1947-02-13 | 1951-04-10 | Eastman Kodak Co | Copolymers of proteins having unsaturated radicals united therewith |
| BE522869A (Direct) * | 1952-09-24 | |||
| BE543746A (Direct) * | 1955-08-11 | |||
| US3272640A (en) * | 1960-12-22 | 1966-09-13 | Hercules Powder Co Ltd | Water insolubilizing and insensitizing process |
-
0
- ZA ZA6800017D patent/ZA6800017B/xx unknown
-
1967
- 1967-01-05 CH CH12067A patent/CH512576A/de not_active IP Right Cessation
- 1967-11-30 DE DE1720078A patent/DE1720078C3/de not_active Expired
-
1968
- 1968-01-01 GB GB46/68A patent/GB1183648A/en not_active Expired
- 1968-01-02 FR FR1549919D patent/FR1549919A/fr not_active Expired
- 1968-01-03 US US695361A patent/US3455893A/en not_active Expired - Lifetime
- 1968-01-04 NL NL6800125A patent/NL6800125A/xx unknown
- 1968-01-04 AT AT11168A patent/AT275315B/de active
- 1968-01-04 BE BE708962D patent/BE708962A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2447587A1 (de) * | 1973-10-08 | 1975-04-17 | Konishiroku Photo Ind | Verfahren zum haerten von gelatine |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1720078B2 (de) | 1979-07-12 |
| BE708962A (Direct) | 1968-07-04 |
| US3455893A (en) | 1969-07-15 |
| FR1549919A (Direct) | 1968-12-13 |
| AT275315B (de) | 1969-10-27 |
| GB1183648A (en) | 1970-03-11 |
| DE1720078C3 (de) | 1980-03-13 |
| ZA6800017B (Direct) | |
| DE1720078A1 (de) | 1971-06-03 |
| NL6800125A (Direct) | 1968-07-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE902581C (de) | Halogensilber-Emulsionen fuer das Silber-Farbbleichverfahren | |
| DE2439551C2 (de) | Verfahren zur Härtung photographischer Schichten | |
| DE1693159A1 (de) | Verfahren zum Haerten von wasserloeslichen Polymeren | |
| CH512576A (de) | Verwendung neuer Acrylsäurederivate zum Härten von Gelatine | |
| DE2912890C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| CH626902A5 (Direct) | ||
| DE1138318B (de) | Photographische Schichten fuer das Silberfarbbleichverfahren | |
| DE2140725A1 (de) | Azofarbstoffe, ihre Herstellung und Verwendung | |
| DE2010280A1 (de) | FarbbIe ichkatalysatoren | |
| DE926713C (de) | Photographischer Entwickler, insbesondere Farbentwickler | |
| DE1794054A1 (de) | Neue Trisazofarbstoffe,ihre Herstellung und Verwendung | |
| DE2047250A1 (de) | Lichtempfindliche Materialien | |
| DE2216620C2 (de) | Photographisches Aufzeichnungsmaterial für das Silberfarbbleichverfahren | |
| DE1105375B (de) | Optische Aufheller | |
| DE1901422B2 (de) | Trisazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung in photographischen Materialien | |
| DE1472811B2 (de) | Farbpholographisches Aufzeichnungsmaterial für das Silberfarbbleichverfahren | |
| DE1643814A1 (de) | Neue Thioaether,deren Herstellung und Verwendung | |
| DE1917812A1 (de) | Photographisches lichtempfindliches Material | |
| DE1597464C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE1572183A1 (de) | Verfahren zur Erzeugung farbphotographischer Bilder mit verbesserter Lichtstabilitaet mit Hilfe von Indazolonkupplern und dadurch erhaltenes photographisches Material | |
| DE1019418B (de) | Verfahren zur Herstellung von Sensibilisierungsfarbstoffen | |
| DE1720068C3 (de) | Verwendung neuer Sulfonamide als Härtungsmittel für Gelatine | |
| CH561763A5 (en) | Difficultly soluble heterocyclic pigment prepn. - by condensing dicarboxylic acids contg. naphthylene, (di)phenylene gps. and heterocyclic diamines | |
| DE1693159C3 (de) | Verfahren zum Härten der wasserlöslichen Polymeren Gelatine und Polyvinylalkohol | |
| AT229134B (de) | Photographisches Material für das Silberfarbbleichverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |