CH433352A - Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydrochinazoline, deren Säureadditionssalzen und ihre Verwendung zur Herstellung von quaternären Ammoniumverbindungen - Google Patents
Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydrochinazoline, deren Säureadditionssalzen und ihre Verwendung zur Herstellung von quaternären AmmoniumverbindungenInfo
- Publication number
- CH433352A CH433352A CH1691766A CH1691766A CH433352A CH 433352 A CH433352 A CH 433352A CH 1691766 A CH1691766 A CH 1691766A CH 1691766 A CH1691766 A CH 1691766A CH 433352 A CH433352 A CH 433352A
- Authority
- CH
- Switzerland
- Prior art keywords
- sep
- acid amide
- acid
- formula
- production
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 8
- 150000003839 salts Chemical class 0.000 title claims description 8
- 150000003856 quaternary ammonium compounds Chemical class 0.000 title claims description 6
- XWWYZFUBBJHKSP-UHFFFAOYSA-N 2,3-dihydro-1h-quinazolin-4-one Chemical class C1=CC=C2C(=O)NCNC2=C1 XWWYZFUBBJHKSP-UHFFFAOYSA-N 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title description 5
- -1 p-methoxybenzoyl bromide Compound Chemical class 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 9
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 claims description 4
- LJYBGUDZIKWJDL-UHFFFAOYSA-N 2-[2-(dimethylamino)ethylamino]benzamide Chemical compound CN(CCNC=1C(C(=O)N)=CC=CC1)C LJYBGUDZIKWJDL-UHFFFAOYSA-N 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- PSAYJRPASWETSH-UHFFFAOYSA-N pyridine-2-carbonyl chloride Chemical compound ClC(=O)C1=CC=CC=N1 PSAYJRPASWETSH-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- ATBIAJXSKNPHEI-UHFFFAOYSA-N pyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1 ATBIAJXSKNPHEI-UHFFFAOYSA-N 0.000 claims description 2
- RVQZKNOMKUSGCI-UHFFFAOYSA-N pyridine-4-carbonyl chloride Chemical compound ClC(=O)C1=CC=NC=C1 RVQZKNOMKUSGCI-UHFFFAOYSA-N 0.000 claims description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 claims 1
- RWSFBMRNOVDKFQ-UHFFFAOYSA-N 4-chloro-2-[2-(dimethylamino)ethylamino]benzamide Chemical compound CN(CCNC=1C(C(=O)N)=CC=C(C1)Cl)C RWSFBMRNOVDKFQ-UHFFFAOYSA-N 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- 229940125773 compound 10 Drugs 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 11
- 239000002585 base Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 3
- 150000001447 alkali salts Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- GZJIGLLTICEPLV-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-[1-(dimethylamino)ethyl]-3H-quinazolin-4-one Chemical compound CN(C(C)C1=C2C(NC(=NC2=CC=C1)C1=CC=C(C=C1)Cl)=O)C GZJIGLLTICEPLV-UHFFFAOYSA-N 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 230000001387 anti-histamine Effects 0.000 description 2
- 239000000739 antihistaminic agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- VYFOAVADNIHPTR-UHFFFAOYSA-N isatoic anhydride Chemical compound NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- BZIRZJQJZBHUCN-UHFFFAOYSA-N 2-(4-bromophenyl)acetyl bromide Chemical compound BrC(=O)CC1=CC=C(Br)C=C1 BZIRZJQJZBHUCN-UHFFFAOYSA-N 0.000 description 1
- QDZAWVLWIMOXJT-UHFFFAOYSA-N 2-(4-methylphenyl)acetyl chloride Chemical compound CC1=CC=C(CC(Cl)=O)C=C1 QDZAWVLWIMOXJT-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- RALRVIPTUXSBPO-UHFFFAOYSA-N 4-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-4-ol Chemical compound C=1C=C(Cl)C(C(F)(F)F)=CC=1C1(O)CCNCC1 RALRVIPTUXSBPO-UHFFFAOYSA-N 0.000 description 1
- JRNPJSUHNBGRSF-UHFFFAOYSA-N 4-methoxybenzoyl bromide Chemical compound COC1=CC=C(C(Br)=O)C=C1 JRNPJSUHNBGRSF-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- JRIASDXJZYOBCA-UHFFFAOYSA-N 5-chloropyridine-2-carbonyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=N1 JRIASDXJZYOBCA-UHFFFAOYSA-N 0.000 description 1
- BLHOBSPLRQJLMC-UHFFFAOYSA-N 5-methoxypyridine-2-carbonyl chloride Chemical compound COC1=CC=C(C(Cl)=O)N=C1 BLHOBSPLRQJLMC-UHFFFAOYSA-N 0.000 description 1
- IPOCOANFUVSCLZ-UHFFFAOYSA-N 6-fluoropyridine-3-carbonyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=N1 IPOCOANFUVSCLZ-UHFFFAOYSA-N 0.000 description 1
- AASOBSCZLSEAQQ-UHFFFAOYSA-N 6-methylpyridine-3-carbonyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=N1 AASOBSCZLSEAQQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- LDPYVOKRTYEBKA-UHFFFAOYSA-N CN(C(C)N1C(NC(C2=CC=CC=C12)=O)C1=CC=C(C=C1)Cl)C Chemical compound CN(C(C)N1C(NC(C2=CC=CC=C12)=O)C1=CC=C(C=C1)Cl)C LDPYVOKRTYEBKA-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 229960000520 diphenhydramine Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/91—Oxygen atoms with aryl or aralkyl radicals attached in position 2 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB67728A DE1289055B (de) | 1962-06-19 | 1962-06-19 | 4-Oxo-1, 2, 3, 4-tetrahydrochinazoline |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH433352A true CH433352A (de) | 1967-04-15 |
Family
ID=6975620
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1691766A CH433352A (de) | 1962-06-19 | 1963-06-04 | Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydrochinazoline, deren Säureadditionssalzen und ihre Verwendung zur Herstellung von quaternären Ammoniumverbindungen |
| CH694663A CH433350A (de) | 1962-06-19 | 1963-06-04 | Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydrochinazoline, deren Säureadditionssalzen und ihre Verwendung zur Herstellung von quaternären Ammoniumverbindungen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH694663A CH433350A (de) | 1962-06-19 | 1963-06-04 | Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydrochinazoline, deren Säureadditionssalzen und ihre Verwendung zur Herstellung von quaternären Ammoniumverbindungen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3215697A (forum.php) |
| BE (1) | BE642073A (forum.php) |
| CH (2) | CH433352A (forum.php) |
| DE (1) | DE1289055B (forum.php) |
| DK (2) | DK105032C (forum.php) |
| FR (1) | FR2588M (forum.php) |
| GB (1) | GB1026923A (forum.php) |
| SE (2) | SE306932B (forum.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3322766A (en) * | 1964-11-13 | 1967-05-30 | Shulton Inc | 3-beta-(4-pyridyl) ethyl-2, 3-dihydro-4(1h)-quinazolinones |
| US3497514A (en) * | 1966-11-19 | 1970-02-24 | Tanabe Seiyaku Co | 1(2-tertiary aminoethyl)-2-methyl-3-aryl-4-oxo-1,2,3,4-tetrahydroquinazoline derivatives and the preparation thereof |
| FR6720M (forum.php) * | 1967-06-13 | 1969-02-17 | ||
| US3635976A (en) * | 1967-12-20 | 1972-01-18 | Pennwalt Corp | 1 - heterocyclic alkyl-1 2 3 4-tetrahydroquinazolinones and analgesic intermediates thereof |
| CN102675223B (zh) * | 2012-04-28 | 2014-08-27 | 清华大学 | 一种多取代喹唑啉及杂环并嘧啶衍生物的制备方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL70619C (forum.php) * | 1948-11-05 | |||
| US2707696A (en) * | 1951-06-30 | 1955-05-03 | Robinson Foundation Inc | Antihistaminic compositions |
| US2944056A (en) * | 1957-05-22 | 1960-07-05 | Sumitomo Chemical Co | Method of producing quinazoline derivatives |
| US3096241A (en) * | 1959-07-13 | 1963-07-02 | Wallace & Tiernan Inc | Synergistic antihistamine mixture |
-
1962
- 1962-06-19 DE DEB67728A patent/DE1289055B/de active Pending
-
1963
- 1963-06-04 CH CH1691766A patent/CH433352A/de unknown
- 1963-06-04 CH CH694663A patent/CH433350A/de unknown
- 1963-06-13 GB GB23624/63A patent/GB1026923A/en not_active Expired
- 1963-06-17 FR FR938393A patent/FR2588M/fr not_active Expired
- 1963-06-17 US US288445A patent/US3215697A/en not_active Expired - Lifetime
- 1963-06-18 DK DK288263AA patent/DK105032C/da active
- 1963-06-18 DK DK457664AA patent/DK108007C/da active
- 1963-06-19 SE SE6802/63A patent/SE306932B/xx unknown
-
1964
- 1964-01-02 BE BE642073A patent/BE642073A/xx unknown
- 1964-12-18 SE SE15378/64A patent/SE306933B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2588M (fr) | 1964-06-08 |
| BE642073A (forum.php) | 1964-07-02 |
| DE1289055B (de) | 1969-02-13 |
| CH433350A (de) | 1967-04-15 |
| DK108007C (da) | 1967-07-31 |
| US3215697A (en) | 1965-11-02 |
| DK105032C (da) | 1966-08-08 |
| GB1026923A (en) | 1966-04-20 |
| SE306932B (forum.php) | 1968-12-16 |
| SE306933B (forum.php) | 1968-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795769B2 (de) | 6,7A9-Tetrahydro-2H-pyrido [1,2-a] pyrimidinderivate, deren Salze mit Säuren und quaternär? Methosalze, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE1146057B (de) | Verfahren zur Herstellung von 5-Hydroxy-ª-methyltryptophanen und deren Salzen | |
| DE1963182A1 (de) | Neue N-Phenylindolin-Derivate und deren Verwendung als Arzneimittel | |
| DE1169939B (de) | Verfahren zur Herstellung von Dihalogen-amino-benzylaminen oder deren Saeureadditionssalzen mit physiologisch vertraeglichen Saeuren | |
| AT200578B (de) | Verfahren zur Herstellung von neuen N-Aminoalkylderivaten von Azepinen | |
| CH433352A (de) | Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydrochinazoline, deren Säureadditionssalzen und ihre Verwendung zur Herstellung von quaternären Ammoniumverbindungen | |
| DE2345951C2 (de) | 1-(2,6-Dichlorphenylamidino)-harnstoff bzw. dessen Hydrochlorid, Verfahren zu seiner Herstellung und diesen enthaltende therapeutische Zubereitung | |
| AT247869B (de) | Verfahren zur Herstellung neuer 4-Oxo-1, 2, 3, 4-tetrahydro-chinazoline, deren Säureadditionssalzen und quaternären Ammoniumverbindungen | |
| DE1445900A1 (de) | Verfahren zur Herstellung von substituierten Benzoesaeureamiden | |
| DE2649855C2 (de) | Substituierte 5-Acetyl-4-hydroxy-3-phenylamino-2H-pyran-2,6(3H)-dione, Verfahren zu deren Herstellung und deren Verwendung | |
| AT238209B (de) | Verfahren zur Herstellung neuer 4-Oxo-1, 2, 3, 4-tetrahydro-chinazoline, deren Säureadditionssalzen und quaternären Ammoniumverbindungen | |
| DE1235929B (de) | Verfahren zur Herstellung von 2-(2'-Pyrazinyl)-benzimidazol und seinen Salzen | |
| DE910654C (de) | Verfahren zur Herstellung von 2-Halogenarylamino-4-amino-1,3, 5-triazinderivaten | |
| AT266838B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT250338B (de) | Verfahren zur Herstellung neuer, basischer Derivate von substituierten Benzofuran-2-carbonsäuren und deren Salzen | |
| AT229877B (de) | Verfahren zur Herstellung neuer 7-substituierter 10-Aminoäthyldibenzo[b, e][1, 4]diazepin-11(10 H)one | |
| AT248034B (de) | Verfahren zur Herstellung von neuen Yohimbinderivaten | |
| AT255422B (de) | Verfahren zur Herstellung von neuen Iminodibenzylderivaten | |
| DE1445872C (de) | 5 Phenyl 1,2 dihydro 3H 1,4 benzodi azepinon (2) derivate | |
| DE1493828A1 (de) | Verfahren zur Herstellung von substituierten Benzamiden | |
| DE1122070C2 (de) | Verfahren zur Herstellung von diuretisch wirksamen Disulfamylanilinverbindungen | |
| DE1620206C (de) | N-Cyclopropylmethyl-6,14-endo-äthanotetrahydronororipavine und ihre Salze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Zubereitungen | |
| AT213871B (de) | Verfahren zur Herstellung von neuen 2-Phenoxy-2-phenyläthylamin-Verbindungen und deren Säureadditionssalzen | |
| AT366371B (de) | Verfahren zur herstellung von neuen n-(4pyrazolidinyl)benzamiden, deren salzen und optischaktiven formen | |
| AT355581B (de) | Verfahren zur herstellung neuer pyrido- benzodiazepinone und ihrer salze |