CH424759A - Verfahren zur Herstellung von Sulfoniumverbindungen - Google Patents
Verfahren zur Herstellung von SulfoniumverbindungenInfo
- Publication number
- CH424759A CH424759A CH532962A CH532962A CH424759A CH 424759 A CH424759 A CH 424759A CH 532962 A CH532962 A CH 532962A CH 532962 A CH532962 A CH 532962A CH 424759 A CH424759 A CH 424759A
- Authority
- CH
- Switzerland
- Prior art keywords
- parts
- acid
- sulfide
- water
- sulfonium
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 16
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 22
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 claims description 15
- 229950006389 thiodiglycol Drugs 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 12
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 3
- 125000002723 alicyclic group Chemical group 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 239000007983 Tris buffer Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- -1 Methyl vinyl Chemical group 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- KIEKAILMEJNSKU-UHFFFAOYSA-N bis(sulfanyl) sulfate Chemical compound SOS(=O)(=O)OS KIEKAILMEJNSKU-UHFFFAOYSA-N 0.000 description 3
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- LBOMXWMEUQWCNL-UHFFFAOYSA-M tris(2-hydroxyethyl)sulfanium;chloride Chemical compound [Cl-].OCC[S+](CCO)CCO LBOMXWMEUQWCNL-UHFFFAOYSA-M 0.000 description 3
- WGLYLHNRGWWZMW-UHFFFAOYSA-N 1-(2-hydroxypropylsulfanyl)propan-2-ol Chemical group CC(O)CSCC(C)O WGLYLHNRGWWZMW-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229930194542 Keto Natural products 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000011928 denatured alcohol Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- BZWKPZBXAMTXNQ-UHFFFAOYSA-N sulfurocyanidic acid Chemical compound OS(=O)(=O)C#N BZWKPZBXAMTXNQ-UHFFFAOYSA-N 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 2
- XDLNRRRJZOJTRW-UHFFFAOYSA-N thiohypochlorous acid Chemical compound ClS XDLNRRRJZOJTRW-UHFFFAOYSA-N 0.000 description 2
- KBMBVTRWEAAZEY-UHFFFAOYSA-N trisulfane Chemical compound SSS KBMBVTRWEAAZEY-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- IHWDIGHWDQPQMQ-UHFFFAOYSA-N 1-octadecylsulfanyloctadecane Chemical compound CCCCCCCCCCCCCCCCCCSCCCCCCCCCCCCCCCCCC IHWDIGHWDQPQMQ-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- LUFPJJNWMYZRQE-UHFFFAOYSA-N benzylsulfanylmethylbenzene Chemical compound C=1C=CC=CC=1CSCC1=CC=CC=C1 LUFPJJNWMYZRQE-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- XYWDPYKBIRQXQS-UHFFFAOYSA-N di-isopropyl sulphide Natural products CC(C)SC(C)C XYWDPYKBIRQXQS-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- WXEHBUMAEPOYKP-UHFFFAOYSA-N methylsulfanylethane Chemical compound CCSC WXEHBUMAEPOYKP-UHFFFAOYSA-N 0.000 description 1
- AMBKPYJJYUKNFI-UHFFFAOYSA-N methylsulfanylethene Chemical compound CSC=C AMBKPYJJYUKNFI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- AAMCVENDCXWDPJ-UHFFFAOYSA-N sulfanyl acetate Chemical compound CC(=O)OS AAMCVENDCXWDPJ-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C381/00—Compounds containing carbon and sulfur and having functional groups not covered by groups C07C301/00 - C07C337/00
- C07C381/12—Sulfonium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB16355/61A GB958527A (en) | 1961-05-05 | 1961-05-05 | Improvements in or relating to sulphonium salts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH424759A true CH424759A (de) | 1966-11-30 |
Family
ID=10075804
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH532962A CH424759A (de) | 1961-05-05 | 1962-05-04 | Verfahren zur Herstellung von Sulfoniumverbindungen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3159682A (member.php) |
| BE (1) | BE617201A (member.php) |
| CH (1) | CH424759A (member.php) |
| DE (1) | DE1174312B (member.php) |
| GB (1) | GB958527A (member.php) |
| NL (1) | NL278039A (member.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1669653B2 (de) * | 1966-06-29 | 1973-08-09 | Badische Anilin- & Soda-Fabrik Ag, 6700 Ludwigshafen | Verminderung der elektrostatischen aufladung von polyvinylchlorid |
| DE1267216B (de) * | 1966-12-13 | 1968-05-02 | Basf Ag | Verfahren zur Herstellung der Sulfoniumsalze von Carbonsaeuren |
| US3538132A (en) * | 1966-12-13 | 1970-11-03 | Basf Ag | Production of sulfonium salts of carboxylic acids or sulfonic acids |
| US3652255A (en) * | 1969-09-03 | 1972-03-28 | Basf Ag | Agents for retarding the growth of plants and changing their habit |
| US4251521A (en) * | 1979-02-07 | 1981-02-17 | Sandoz, Inc. | Alkyl diaryl sulfonium salts |
| US4729839A (en) * | 1986-05-29 | 1988-03-08 | Phillips Petroleum Company | Water soluble lubricating additives |
| DE3721740A1 (de) * | 1987-07-01 | 1989-01-12 | Basf Ag | Sulfoniumsalze mit saeurelabilen gruppierungen |
| JP2004176016A (ja) * | 2002-11-29 | 2004-06-24 | Shin Etsu Chem Co Ltd | 熱伝導性シリコーン組成物及びその成形体 |
-
0
- BE BE617201D patent/BE617201A/xx unknown
- NL NL278039D patent/NL278039A/xx unknown
-
1961
- 1961-05-05 GB GB16355/61A patent/GB958527A/en not_active Expired
-
1962
- 1962-04-20 US US188989A patent/US3159682A/en not_active Expired - Lifetime
- 1962-05-04 DE DEJ21717A patent/DE1174312B/de active Pending
- 1962-05-04 CH CH532962A patent/CH424759A/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL278039A (member.php) | |
| DE1174312B (de) | 1964-07-23 |
| US3159682A (en) | 1964-12-01 |
| GB958527A (en) | 1964-05-21 |
| BE617201A (member.php) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3613944C1 (de) | Verfahren zur Herstellung einer hochkonzentrierten,fliess- und pumpfaehigen Betainloesung | |
| EP0039844A2 (de) | Verfahren zur Herstellung von O-substituierten Derivaten des (+)-Cyanidan-3-ols | |
| CH424759A (de) | Verfahren zur Herstellung von Sulfoniumverbindungen | |
| DE2708751C3 (de) | Verfahren zur Erhöhung der Reaktionsfähigkeit von Perfluorhalogenalkanen | |
| DE2158562C3 (de) | Verfahren zur Herstellung von Glutaminsäure-5-methylester | |
| US2789991A (en) | Substituted disulfones | |
| DE3830351A1 (de) | Verfahren zur herstellung von (alpha)-aminoalkanolen | |
| DE1670214C3 (de) | Verfahren zur Herstellung von Tris-(N-ßhydroxyalkyl-)isocyanursäuren | |
| DE942149C (de) | Verfahren zur Herstellung substituierter Glycinamide | |
| DE2637580C2 (de) | Verfahren zur herstellung von n-substituierten oxazolidinen | |
| DE1695067B1 (de) | Verfahren zur Herstellung von 5-Cyanuracilen | |
| AT229856B (de) | Verfahren zur Herstellung von neuen schwefelhältigen Estern | |
| DE2215169A1 (de) | N-disubstituierte Aminoäthylester der 11-Methoxyraubasinsäure und Verfahren zur Herstellung derselben | |
| DE869066C (de) | Verfahren zur Herstellung von substituierten Alkylthioschwefelsaeuren bzw. deren Salzen | |
| DE1024954B (de) | Verfahren zur Herstellung von N-disubstituierten Dithiocarbaminsaeureestern, die im Alkoholrest Sulfonsaeuregruppen enthalten | |
| DE1259872B (de) | Verfahren zur Herstellung von Sulfonylurethanen bzw. deren Salzen | |
| DE1093790B (de) | Verfahren zur Herstellung von hydroxylgruppenhaltigen Disulfiden | |
| DE2530711C3 (de) | Verfahren zur Herstellung von Methallylsulfonsäure und deren Salze | |
| AT216000B (de) | Verfahren zur Herstellung von 6-Chlor-7-sulfonamido-1,2,4-benzothiadiazin-1,1-dioxyden | |
| AT227696B (de) | Verfahren zur Herstellung von 2-Amino-oxazolen | |
| AT364836B (de) | Verfahren zur herstellung von neuen o-substituierten derivaten des (+)-cyanidan-3-ols und deren salzen | |
| DE19735197A1 (de) | Verfahren zur Herstellung von 2-substituierten 5-Formylthiazolen | |
| CH373047A (de) | Verfahren zur Herstellung von neuen oberflächenaktiven Verbindungen | |
| DE1952735A1 (de) | Verfahren zur Veresterung von 3,5-Dikarboxybenzolsulfonaten alkalischer Metalle zu deren bis (2-Hydroxyaethyl)-estern | |
| DE2060197B2 (de) | Verfahren zur Herstellung von 2-Aminobenzothiazol und dessen N-Alkylsubstitutionsprodukten |