CH422801A - Verfahren zur Herstellung von Sulfensäurederivaten - Google Patents
Verfahren zur Herstellung von SulfensäurederivatenInfo
- Publication number
- CH422801A CH422801A CH960062A CH960062A CH422801A CH 422801 A CH422801 A CH 422801A CH 960062 A CH960062 A CH 960062A CH 960062 A CH960062 A CH 960062A CH 422801 A CH422801 A CH 422801A
- Authority
- CH
- Switzerland
- Prior art keywords
- acid derivatives
- preparation
- sulfenic acid
- group
- bromine
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000003447 sulfenic acid derivatives Chemical class 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- -1 halogenated fluoromethanesulfenic acid halide Chemical class 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 241000607479 Yersinia pestis Species 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 125000005649 substituted arylene group Chemical group 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VXAOKVRKGICQBZ-UHFFFAOYSA-N [dibromo(fluoro)methyl] thiohypobromite Chemical compound BrC(SBr)(F)Br VXAOKVRKGICQBZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 2
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MBVCESWADCIXJN-UHFFFAOYSA-N 5-Bromoisatin Chemical compound BrC1=CC=C2NC(=O)C(=O)C2=C1 MBVCESWADCIXJN-UHFFFAOYSA-N 0.000 description 1
- RNJDTXXKXAXYMK-UHFFFAOYSA-N [chloro(difluoro)methyl] thiohypochlorite Chemical compound FC(F)(Cl)SCl RNJDTXXKXAXYMK-UHFFFAOYSA-N 0.000 description 1
- KDRSHFSCTSFYGH-UHFFFAOYSA-N [dichloro(fluoro)methyl] thiohypochlorite Chemical compound FC(Cl)(Cl)SCl KDRSHFSCTSFYGH-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001768 cations Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- UMNKXPULIDJLSU-UHFFFAOYSA-N dichlorofluoromethane Chemical compound FC(Cl)Cl UMNKXPULIDJLSU-UHFFFAOYSA-N 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- RVEZZJVBDQCTEF-UHFFFAOYSA-N sulfenic acid Chemical compound SO RVEZZJVBDQCTEF-UHFFFAOYSA-N 0.000 description 1
- 150000003449 sulfenic acid halides Chemical class 0.000 description 1
- JRKNUVBODBHDOK-SFHVURJKSA-N tert-butyl (2s)-2-[[4-[(3-chlorophenyl)carbamoyl]-1h-imidazole-5-carbonyl]amino]-3-phenylpropanoate Chemical compound C([C@@H](C(=O)OC(C)(C)C)NC(=O)C1=C(N=CN1)C(=O)NC=1C=C(Cl)C=CC=1)C1=CC=CC=C1 JRKNUVBODBHDOK-SFHVURJKSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/38—Oxygen atoms in positions 2 and 3, e.g. isatin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/26—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/18—Benzotriazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0034792 | 1961-08-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH422801A true CH422801A (de) | 1966-10-31 |
Family
ID=7095714
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH960062A CH422801A (de) | 1961-08-26 | 1962-08-10 | Verfahren zur Herstellung von Sulfensäurederivaten |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3249620A (enExample) |
| BR (1) | BR6242386D0 (enExample) |
| CH (1) | CH422801A (enExample) |
| DE (2) | DE1302649C2 (enExample) |
| DK (1) | DK105676C (enExample) |
| GB (1) | GB973920A (enExample) |
| NL (1) | NL282477A (enExample) |
| SE (1) | SE303632B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1215162B (de) * | 1964-12-16 | 1966-04-28 | Bayer Ag | Verfahren zur Herstellung von N, N'-disubstituierten Imidazolonen |
| US3410864A (en) * | 1965-05-27 | 1968-11-12 | Monsanto Co | Benzimidazolinones |
| US3427319A (en) * | 1968-01-08 | 1969-02-11 | Monsanto Co | Benzimidazolinones |
| DE3118129A1 (de) * | 1981-05-07 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | Ringfoermige sulfenamide, verfahren zu ihrer herstellung, ihre verwendung in arzneimitteln und deren herstellung |
| DE3415532A1 (de) * | 1984-04-26 | 1985-10-31 | Bayer Ag, 5090 Leverkusen | N-(dichlorfluormethylthio)-3,4-dimethylmaleinimid, ein verfahren zu seiner herstellung und seine verwendung |
| CA2461557A1 (en) * | 2001-10-16 | 2003-04-24 | University Of Kansas | Novel prodrugs of n-h bond-containing compounds and methods of making thereof |
| WO2012062749A1 (de) | 2010-11-12 | 2012-05-18 | Bayer Cropscience Ag | Benzimidazolidinone verwendbar als fungizide |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT214708B (de) * | 1948-05-18 | Exxon Research Engineering Co | Verfahren zur Bekämpfung von Schädlingen | |
| US2553775A (en) * | 1949-06-21 | 1951-05-22 | Standard Oil Dev Co | N-thiotrichloromethyl amides and parasiticidal compositions containing them |
| US2657169A (en) * | 1950-10-28 | 1953-10-27 | Ethyl Corp | N-aminophthalic imides and salts thereof as fungicidal compositions |
| NL254931A (enExample) * | 1955-07-20 | |||
| US2863802A (en) * | 1957-04-11 | 1958-12-09 | Diamond Alkali Co | Treating plants with the systemically active fungicide, lower alkyl, 2(3, 3, 3-trihalo-2-hydroxypropyl)-pyridine |
| BE572113A (enExample) * | 1957-10-31 | |||
| US3036088A (en) * | 1959-10-08 | 1962-05-22 | Du Pont | N-(fluoroalkylthio)-imides |
-
0
- NL NL282477D patent/NL282477A/xx unknown
-
1961
- 1961-08-26 DE DE19611302649D patent/DE1302649C2/de not_active Expired
- 1961-08-26 DE DE19611445039 patent/DE1445039A1/de active Pending
-
1962
- 1962-08-10 CH CH960062A patent/CH422801A/de unknown
- 1962-08-22 US US218505A patent/US3249620A/en not_active Expired - Lifetime
- 1962-08-23 BR BR142386/62A patent/BR6242386D0/pt unknown
- 1962-08-24 DK DK373762AA patent/DK105676C/da active
- 1962-08-24 SE SE9212/62A patent/SE303632B/xx unknown
- 1962-08-27 GB GB32884/62A patent/GB973920A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1302649B (de) | 1972-08-24 |
| NL282477A (enExample) | |
| DK105676C (da) | 1966-10-24 |
| SE303632B (enExample) | 1968-09-02 |
| BR6242386D0 (pt) | 1973-09-11 |
| GB973920A (en) | 1964-11-04 |
| DE1302649C2 (de) | 1973-05-03 |
| DE1445039A1 (de) | 1969-04-24 |
| US3249620A (en) | 1966-05-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2638470C2 (enExample) | ||
| CH438280A (de) | Verfahren zur Herstellung von Sulfensäure-Derivaten | |
| CH422801A (de) | Verfahren zur Herstellung von Sulfensäurederivaten | |
| DE2346241A1 (de) | Verfahren zur herstellung von 1-(3di-subst.-phosphonothioureido)-2-(3-subst.ureido- oder -thioureido)-benzolverbindungen | |
| DE1470070B1 (de) | Verfahren zur Herstellung von Benzimidazolderivaten | |
| DE1300117B (de) | 5-Sulfonyl-1, 2-dithiol-3-one | |
| DE2008578A1 (de) | Verfahren zur Herstellung von Nifcrosoharnstof1/erbindungen | |
| AT238192B (de) | Verfahren zur Herstellung von neuen Sulfensäurederivaten | |
| AT227678B (de) | Verfahren zur Herstellung von neuen Sulfensäure-Derivaten | |
| DE1913265A1 (de) | Verfahren zur Herstellung von 2-Alkylpyridazoniumverbindungen | |
| AT222131B (de) | Verfahren zur Herstellung von Isoharnstoff-Derivaten | |
| DE1215709B (de) | Verfahren zur Herstellung von Sulfoxid-Zinnkomplexverbindungen | |
| DE2128466A1 (de) | Phenazindenvate | |
| AT231463B (de) | Verfahren zur Herstellung neuer Organoquecksilberverbindungen | |
| AT235306B (de) | Verfahren zur Herstellung von neuen Carbaminsäurederivaten | |
| CH533107A (de) | Verfahren zur Herstellung substituierter Azabicycloalkane | |
| AT340201B (de) | Pestizides fungizides und bakterizides mittel | |
| DE1670169A1 (de) | Verfahren zur Herstellung von 4-Amino-5-brompyridazonen-(6) | |
| AT256115B (de) | Verfahren zur Herstellung von neuen Benzodiazepin-Derivaten | |
| AT218534B (de) | Verfahren zur Herstellung von neuen substituierten Harnstoffen | |
| AT268230B (de) | Verfahren zur Herstellung von neuen acylierten Trichloracetaldehydaminalen | |
| DE947165C (de) | Verfahren zur Herstellung von in 3-Stellung substituierten 4-Oxycumarinen | |
| CH501006A (de) | Verfahren zur Herstellung von funktionellen Säurederivaten von in 2-Stellung disubstituierten 3-Acyl-5-halogen-thiazolidin-4-carbonsäuren | |
| DE1154107B (de) | Verfahren zur Herstellung von Organoquecksilberverbindungen | |
| DE1101407B (de) | Verfahren zur Herstellung von Sulfonsaeureamid-N-sulfensaeurechloriden |