CA2202058C - Cyclic hexapeptides having antibiotic activity - Google Patents
Cyclic hexapeptides having antibiotic activity Download PDFInfo
- Publication number
- CA2202058C CA2202058C CA002202058A CA2202058A CA2202058C CA 2202058 C CA2202058 C CA 2202058C CA 002202058 A CA002202058 A CA 002202058A CA 2202058 A CA2202058 A CA 2202058A CA 2202058 C CA2202058 C CA 2202058C
- Authority
- CA
- Canada
- Prior art keywords
- alkoxy
- phenyl
- substituted
- alkyl
- nmr
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 230000003115 biocidal effect Effects 0.000 title description 2
- 125000004122 cyclic group Chemical group 0.000 title description 2
- 238000002360 preparation method Methods 0.000 claims abstract description 316
- 150000001875 compounds Chemical class 0.000 claims abstract description 130
- 150000003839 salts Chemical class 0.000 claims abstract description 42
- 229920001184 polypeptide Polymers 0.000 claims abstract description 17
- 102000004196 processed proteins & peptides Human genes 0.000 claims abstract description 17
- 108090000765 processed proteins & peptides Proteins 0.000 claims abstract description 17
- 238000000034 method Methods 0.000 claims abstract description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 4
- 230000000069 prophylactic effect Effects 0.000 claims abstract description 4
- 230000001225 therapeutic effect Effects 0.000 claims abstract description 4
- 241001465754 Metazoa Species 0.000 claims abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 320
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 281
- -1 indolylcarbonyl Chemical group 0.000 claims description 184
- 125000000217 alkyl group Chemical group 0.000 claims description 132
- 125000001424 substituent group Chemical group 0.000 claims description 130
- 125000001589 carboacyl group Chemical group 0.000 claims description 113
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 74
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 51
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 29
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 28
- 125000001624 naphthyl group Chemical group 0.000 claims description 27
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 claims description 23
- 125000004193 piperazinyl group Chemical group 0.000 claims description 18
- 125000004043 oxo group Chemical group O=* 0.000 claims description 17
- 125000005936 piperidyl group Chemical group 0.000 claims description 17
- 125000006529 (C3-C6) alkyl group Chemical group 0.000 claims description 15
- 125000005862 (C1-C6)alkanoyl group Chemical group 0.000 claims description 13
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 12
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 11
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- 125000002971 oxazolyl group Chemical group 0.000 claims description 9
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 9
- 125000001425 triazolyl group Chemical group 0.000 claims description 8
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 7
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 6
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 5
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 claims description 5
- 125000002632 imidazolidinyl group Chemical group 0.000 claims description 5
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 5
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 3
- 125000001422 pyrrolinyl group Chemical group 0.000 claims description 3
- 125000005872 benzooxazolyl group Chemical group 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 2
- 159000000000 sodium salts Chemical class 0.000 claims description 2
- 206010017533 Fungal infection Diseases 0.000 claims 3
- 208000031888 Mycoses Diseases 0.000 claims 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 3
- 239000003814 drug Substances 0.000 claims 2
- 125000001475 halogen functional group Chemical group 0.000 claims 2
- 244000000010 microbial pathogen Species 0.000 claims 1
- 230000000845 anti-microbial effect Effects 0.000 abstract description 6
- 230000000843 anti-fungal effect Effects 0.000 abstract description 4
- 208000035473 Communicable disease Diseases 0.000 abstract description 3
- 206010035660 Pneumocystis Infections Diseases 0.000 abstract description 3
- 206010073756 Pneumocystis jirovecii infection Diseases 0.000 abstract description 3
- 230000002401 inhibitory effect Effects 0.000 abstract description 3
- 229920001503 Glucan Polymers 0.000 abstract 1
- 208000005384 Pneumocystis Pneumonia Diseases 0.000 abstract 1
- 206010073755 Pneumocystis jirovecii pneumonia Diseases 0.000 abstract 1
- 201000000317 pneumocystosis Diseases 0.000 abstract 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 464
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 177
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 174
- 101150041968 CDC13 gene Proteins 0.000 description 172
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 168
- 125000003118 aryl group Chemical group 0.000 description 146
- 239000000203 mixture Substances 0.000 description 101
- 230000002829 reductive effect Effects 0.000 description 90
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 84
- 235000019341 magnesium sulphate Nutrition 0.000 description 84
- 239000011734 sodium Substances 0.000 description 82
- 239000000243 solution Substances 0.000 description 81
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 81
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 77
- 238000000921 elemental analysis Methods 0.000 description 77
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 73
- 125000003435 aroyl group Chemical group 0.000 description 58
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 56
- 125000000623 heterocyclic group Chemical group 0.000 description 55
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 55
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- 229910052757 nitrogen Inorganic materials 0.000 description 47
- 239000011541 reaction mixture Substances 0.000 description 46
- 125000004433 nitrogen atom Chemical group N* 0.000 description 44
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 43
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- 239000012267 brine Substances 0.000 description 42
- 239000012044 organic layer Substances 0.000 description 42
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 41
- 239000012964 benzotriazole Substances 0.000 description 39
- 239000002253 acid Substances 0.000 description 38
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 38
- 229910052739 hydrogen Inorganic materials 0.000 description 35
- 239000000706 filtrate Substances 0.000 description 34
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 33
- 238000001914 filtration Methods 0.000 description 29
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 28
- BJFLSHMHTPAZHO-UHFFFAOYSA-N benzotriazole Chemical compound [CH]1C=CC=C2N=NN=C21 BJFLSHMHTPAZHO-UHFFFAOYSA-N 0.000 description 27
- 239000000725 suspension Substances 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 26
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 26
- 238000004440 column chromatography Methods 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- 125000004430 oxygen atom Chemical group O* 0.000 description 21
- 239000002244 precipitate Substances 0.000 description 21
- 239000002904 solvent Substances 0.000 description 21
- 229910052717 sulfur Inorganic materials 0.000 description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- 229920006395 saturated elastomer Polymers 0.000 description 18
- 125000004434 sulfur atom Chemical group 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- 239000000741 silica gel Substances 0.000 description 17
- 229910002027 silica gel Inorganic materials 0.000 description 17
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 15
- 238000004458 analytical method Methods 0.000 description 13
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 13
- 239000000843 powder Substances 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 239000005711 Benzoic acid Substances 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 125000004104 aryloxy group Chemical group 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 8
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 8
- 239000000499 gel Substances 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 8
- 235000010233 benzoic acid Nutrition 0.000 description 7
- 125000005446 heptyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 7
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 7
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 6
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 description 5
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 5
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 125000002541 furyl group Chemical group 0.000 description 5
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 239000003456 ion exchange resin Substances 0.000 description 5
- 229920003303 ion-exchange polymer Polymers 0.000 description 5
- 150000004702 methyl esters Chemical class 0.000 description 5
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical group C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 4
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 241000206607 Porphyra umbilicalis Species 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 238000001990 intravenous administration Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 150000002923 oximes Chemical class 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 239000011369 resultant mixture Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- PVRFWXFHUOIQLV-UHFFFAOYSA-N 1-amino-3-(4-octylphenyl)urea Chemical compound CCCCCCCCC1=CC=C(NC(=O)NN)C=C1 PVRFWXFHUOIQLV-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 125000001769 aryl amino group Chemical group 0.000 description 3
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 238000000855 fermentation Methods 0.000 description 3
- 230000004151 fermentation Effects 0.000 description 3
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000007918 intramuscular administration Methods 0.000 description 3
- 125000002757 morpholinyl group Chemical group 0.000 description 3
- 239000011664 nicotinic acid Substances 0.000 description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 3
- 125000005425 toluyl group Chemical group 0.000 description 3
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 3
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 2
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 2
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- QHLVAKZJUURIQO-UHFFFAOYSA-N 1-(4-octoxyphenyl)piperazine Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCNCC1 QHLVAKZJUURIQO-UHFFFAOYSA-N 0.000 description 2
- QQQSUVSRXPLWAH-UHFFFAOYSA-N 1-[4-(4-heptylphenyl)phenyl]ethanone Chemical group C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(C)=O)C=C1 QQQSUVSRXPLWAH-UHFFFAOYSA-N 0.000 description 2
- RJQRJLCQHIMUQO-UHFFFAOYSA-N 1-bromo-4-(4-heptylphenyl)benzene Chemical group C1=CC(CCCCCCC)=CC=C1C1=CC=C(Br)C=C1 RJQRJLCQHIMUQO-UHFFFAOYSA-N 0.000 description 2
- VXJTWTJULLKDPY-UHFFFAOYSA-N 1-bromo-4-(4-pentylphenyl)benzene Chemical group C1=CC(CCCCC)=CC=C1C1=CC=C(Br)C=C1 VXJTWTJULLKDPY-UHFFFAOYSA-N 0.000 description 2
- UXQBXLHGTWIYNR-UHFFFAOYSA-N 1-bromo-4-[4-(7-bromoheptoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCBr)=CC=C1C1=CC=C(Br)C=C1 UXQBXLHGTWIYNR-UHFFFAOYSA-N 0.000 description 2
- SNKZHWDUNHXAMY-UHFFFAOYSA-N 1-bromo-4-[4-(8-bromooctoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCCBr)=CC=C1C1=CC=C(Br)C=C1 SNKZHWDUNHXAMY-UHFFFAOYSA-N 0.000 description 2
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- MKSWQHOPSDCVMS-UHFFFAOYSA-N 1-ethynyl-4-pentoxybenzene Chemical group CCCCCOC1=CC=C(C#C)C=C1 MKSWQHOPSDCVMS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- IUNJCFABHJZSKB-UHFFFAOYSA-N 2,4-dihydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C(O)=C1 IUNJCFABHJZSKB-UHFFFAOYSA-N 0.000 description 2
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 2
- DVFWRZHZHULTLX-UHFFFAOYSA-N 3-(4-bromophenyl)-5-(4-pentoxyphenyl)-1,2-oxazole Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC(C=2C=CC(Br)=CC=2)=NO1 DVFWRZHZHULTLX-UHFFFAOYSA-N 0.000 description 2
- PWGPANWHHZDAIP-UHFFFAOYSA-N 3-[4-(4-pentylphenyl)phenyl]propanoic acid Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(CCC(O)=O)C=C1 PWGPANWHHZDAIP-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- ZVTRGFJIJKDEMD-UHFFFAOYSA-N 4-[3-(4-hexoxyphenyl)-1h-pyrazol-5-yl]benzoic acid Chemical compound C1=CC(OCCCCCC)=CC=C1C1=CC(C=2C=CC(=CC=2)C(O)=O)=NN1 ZVTRGFJIJKDEMD-UHFFFAOYSA-N 0.000 description 2
- IEPCABVQANKPNT-UHFFFAOYSA-N 4-[4-(8-bromooctoxy)phenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=C(OCCCCCCCCBr)C=C1 IEPCABVQANKPNT-UHFFFAOYSA-N 0.000 description 2
- PDTXSIGPZDVVIX-UHFFFAOYSA-N 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoic acid Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC(C=2C=CC(=CC=2)C(O)=O)=NO1 PDTXSIGPZDVVIX-UHFFFAOYSA-N 0.000 description 2
- ZKSQOKZGDNEDJQ-UHFFFAOYSA-N 4-hexoxybenzohydrazide Chemical compound CCCCCCOC1=CC=C(C(=O)NN)C=C1 ZKSQOKZGDNEDJQ-UHFFFAOYSA-N 0.000 description 2
- HCXJFMDOHDNDCC-UHFFFAOYSA-N 5-$l^{1}-oxidanyl-3,4-dihydropyrrol-2-one Chemical group O=C1CCC(=O)[N]1 HCXJFMDOHDNDCC-UHFFFAOYSA-N 0.000 description 2
- UWYDUSKEEPMFNU-UHFFFAOYSA-N 6-heptoxynaphthalene-2-carbonyl chloride Chemical compound C1=C(C(Cl)=O)C=CC2=CC(OCCCCCCC)=CC=C21 UWYDUSKEEPMFNU-UHFFFAOYSA-N 0.000 description 2
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 101150008415 CALCA gene Proteins 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- UEXCJVNBTNXOEH-UHFFFAOYSA-N Ethynylbenzene Chemical group C#CC1=CC=CC=C1 UEXCJVNBTNXOEH-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 2
- 101150084411 crn1 gene Proteins 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- RILLRPWNMMZZBV-UHFFFAOYSA-N ethyl 1-(4-hexoxyphenyl)-4-oxopiperidine-3-carboxylate Chemical compound C1=CC(OCCCCCC)=CC=C1N1CC(C(=O)OCC)C(=O)CC1 RILLRPWNMMZZBV-UHFFFAOYSA-N 0.000 description 2
- WQSOFWIIBNJWSS-UHFFFAOYSA-N ethyl 3-amino-4-hydroxybenzoate Chemical compound CCOC(=O)C1=CC=C(O)C(N)=C1 WQSOFWIIBNJWSS-UHFFFAOYSA-N 0.000 description 2
- GHMHKOHJAFFUCP-UHFFFAOYSA-N ethyl 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC(C=2C=CC(=CC=2)C(=O)OCC)=NO1 GHMHKOHJAFFUCP-UHFFFAOYSA-N 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 125000004284 isoxazol-3-yl group Chemical group [H]C1=C([H])C(*)=NO1 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Inorganic materials O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- IOPLHGOSNCJOOO-UHFFFAOYSA-N methyl 3,4-diaminobenzoate Chemical compound COC(=O)C1=CC=C(N)C(N)=C1 IOPLHGOSNCJOOO-UHFFFAOYSA-N 0.000 description 2
- VVHXCSFDEMZQFY-UHFFFAOYSA-N methyl 4-(hydroxyiminomethyl)benzoate Chemical compound COC(=O)C1=CC=C(C=NO)C=C1 VVHXCSFDEMZQFY-UHFFFAOYSA-N 0.000 description 2
- CVXXHXPNTZBZEL-UHFFFAOYSA-N methyl 4-carbonochloridoylbenzoate Chemical compound COC(=O)C1=CC=C(C(Cl)=O)C=C1 CVXXHXPNTZBZEL-UHFFFAOYSA-N 0.000 description 2
- OMKOCPWIXVQHHX-UHFFFAOYSA-N methyl 6-hept-1-ynylnaphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(C#CCCCCC)=CC=C21 OMKOCPWIXVQHHX-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- XICOPJZLUVZIGC-UHFFFAOYSA-N (2-nonyl-1,3-benzoxazol-5-yl)-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound N1=[N+]([O-])C2=CC=CC=C2N1C(=O)C1=CC=C(OC(CCCCCCCCC)=N2)C2=C1 XICOPJZLUVZIGC-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- VFCANFOUSHVCKC-UHFFFAOYSA-N (3,4-dipentoxyphenyl)-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=C(OCCCCC)C(OCCCCC)=CC=C1C(=O)N1C2=CC=CC=C2[N+]([O-])=N1 VFCANFOUSHVCKC-UHFFFAOYSA-N 0.000 description 1
- VZEPZIRFHZJREF-UHFFFAOYSA-N (3-oxidobenzotriazol-3-ium-1-yl)-[4-[4-(4-phenylcyclohexyl)piperazin-1-yl]phenyl]methanone Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)C(C=C1)=CC=C1N(CC1)CCN1C(CC1)CCC1C1=CC=CC=C1 VZEPZIRFHZJREF-UHFFFAOYSA-N 0.000 description 1
- YTDRFIFPDYISQX-UHFFFAOYSA-N (3-oxidobenzotriazol-3-ium-1-yl)-[4-[4-[8-(tetrazol-2-yl)octoxy]phenyl]phenyl]methanone Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1OCCCCCCCCN1N=CN=N1 YTDRFIFPDYISQX-UHFFFAOYSA-N 0.000 description 1
- QCYUORFAXPPMLW-UHFFFAOYSA-N (3-oxidobenzotriazol-3-ium-1-yl)-[4-[5-[4-(4-propoxyphenyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]methanone Chemical compound C1=CC(OCCC)=CC=C1C1=CC=C(C=2OC(=NN=2)C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 QCYUORFAXPPMLW-UHFFFAOYSA-N 0.000 description 1
- ZLNLODKRFLDQDX-IBGZPJMESA-N (3s)-3-hydroxy-1-(3-oxidobenzotriazol-3-ium-1-yl)hexadecan-1-one Chemical compound C1=CC=C2N(C(=O)C[C@@H](O)CCCCCCCCCCCCC)N=[N+]([O-])C2=C1 ZLNLODKRFLDQDX-IBGZPJMESA-N 0.000 description 1
- ZJYIVHWYSNWCSX-LBPRGKRZSA-N (3s)-7-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1h-isoquinoline-3-carboxylic acid Chemical compound OC1=CC=C2C[C@@H](C(O)=O)N(C(=O)OC(C)(C)C)CC2=C1 ZJYIVHWYSNWCSX-LBPRGKRZSA-N 0.000 description 1
- PQCXFUXRTRESBD-UHFFFAOYSA-N (4-methoxycarbonylphenyl)boronic acid Chemical compound COC(=O)C1=CC=C(B(O)O)C=C1 PQCXFUXRTRESBD-UHFFFAOYSA-N 0.000 description 1
- VGRXAHXMIDCTNV-UHFFFAOYSA-N (6-chlorobenzotriazol-1-yl) 4-chlorobenzenesulfonate Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)ON1C2=CC(Cl)=CC=C2N=N1 VGRXAHXMIDCTNV-UHFFFAOYSA-N 0.000 description 1
- FPTLXNXYTSEYKS-OVCLIPMQSA-N (e)-3-[4-(4-hex-5-enoxyphenyl)phenyl]prop-2-enoic acid Chemical compound C1=CC(/C=C/C(=O)O)=CC=C1C1=CC=C(OCCCCC=C)C=C1 FPTLXNXYTSEYKS-OVCLIPMQSA-N 0.000 description 1
- RPPDKOWDJNJJTA-WOJGMQOQSA-N (e)-3-[4-[4-(6-fluorohexoxy)phenyl]phenyl]-1-(3-oxidobenzotriazol-3-ium-1-yl)prop-2-en-1-one Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)\C=C\C(C=C1)=CC=C1C1=CC=C(OCCCCCCF)C=C1 RPPDKOWDJNJJTA-WOJGMQOQSA-N 0.000 description 1
- VNAYIIFSISFFEL-VGOFMYFVSA-N (e)-3-[4-[4-(6-fluorohexoxy)phenyl]phenyl]prop-2-enoic acid Chemical compound C1=CC(/C=C/C(=O)O)=CC=C1C1=CC=C(OCCCCCCF)C=C1 VNAYIIFSISFFEL-VGOFMYFVSA-N 0.000 description 1
- HQFZRJBEYYRMLR-XDHOZWIPSA-N (e)-3-[4-[4-(6-methoxyhexoxy)phenyl]phenyl]-1-(3-oxidobenzotriazol-3-ium-1-yl)prop-2-en-1-one Chemical compound C1=CC(OCCCCCCOC)=CC=C1C(C=C1)=CC=C1\C=C\C(=O)N1C2=CC=CC=C2[N+]([O-])=N1 HQFZRJBEYYRMLR-XDHOZWIPSA-N 0.000 description 1
- CUZVYLKXUNFGOM-XDHOZWIPSA-N (e)-3-[4-[4-(7-fluoroheptoxy)phenyl]phenyl]-1-(3-oxidobenzotriazol-3-ium-1-yl)prop-2-en-1-one Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)\C=C\C(C=C1)=CC=C1C1=CC=C(OCCCCCCCF)C=C1 CUZVYLKXUNFGOM-XDHOZWIPSA-N 0.000 description 1
- BTSSKYNPVOVRDN-ZCXUNETKSA-N (z)-3-[4-(4-heptylphenyl)phenyl]but-2-enoic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(\C)=C/C(O)=O)C=C1 BTSSKYNPVOVRDN-ZCXUNETKSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- AGEIEHTVRJHTIV-UHFFFAOYSA-N 1-(3-oxidobenzotriazol-3-ium-1-yl)-3-[4-(4-pentoxyphenyl)phenyl]prop-2-en-1-one Chemical compound C1=CC(OCCCCC)=CC=C1C(C=C1)=CC=C1C=CC(=O)N1C2=CC=CC=C2[N+]([O-])=N1 AGEIEHTVRJHTIV-UHFFFAOYSA-N 0.000 description 1
- QAVOXXMITVAYCL-UHFFFAOYSA-N 1-(3-oxidobenzotriazol-3-ium-1-yl)-3-[4-(4-pentylphenyl)phenyl]prop-2-en-1-one Chemical compound C1=CC(CCCCC)=CC=C1C(C=C1)=CC=C1C=CC(=O)N1C2=CC=CC=C2[N+]([O-])=N1 QAVOXXMITVAYCL-UHFFFAOYSA-N 0.000 description 1
- CRUVZSXCXPWZAC-UHFFFAOYSA-N 1-(4-cyclohexylphenyl)piperazine Chemical compound C1CCCCC1C1=CC=C(N2CCNCC2)C=C1 CRUVZSXCXPWZAC-UHFFFAOYSA-N 0.000 description 1
- ACFUNONLPCBJDR-UHFFFAOYSA-N 1-(4-hexoxyphenyl)piperidin-4-one Chemical compound C1=CC(OCCCCCC)=CC=C1N1CCC(=O)CC1 ACFUNONLPCBJDR-UHFFFAOYSA-N 0.000 description 1
- PFVJQJDAFGYXEV-UHFFFAOYSA-N 1-(4-hexylphenyl)piperazine;dihydrobromide Chemical compound Br.Br.C1=CC(CCCCCC)=CC=C1N1CCNCC1 PFVJQJDAFGYXEV-UHFFFAOYSA-N 0.000 description 1
- UPLBTVYITAGXGL-UHFFFAOYSA-N 1-bromo-4-(4-butoxyphenyl)benzene Chemical group C1=CC(OCCCC)=CC=C1C1=CC=C(Br)C=C1 UPLBTVYITAGXGL-UHFFFAOYSA-N 0.000 description 1
- BPYRRARMEFLXFA-UHFFFAOYSA-N 1-bromo-4-[4-(5-bromopentoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCBr)=CC=C1C1=CC=C(Br)C=C1 BPYRRARMEFLXFA-UHFFFAOYSA-N 0.000 description 1
- KNNBCWVKTHEAKP-UHFFFAOYSA-N 1-bromo-4-[4-(6-bromohexoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCBr)=CC=C1C1=CC=C(Br)C=C1 KNNBCWVKTHEAKP-UHFFFAOYSA-N 0.000 description 1
- NVVVHPJZHYYYLI-UHFFFAOYSA-N 1-bromo-4-[4-(7-fluoroheptoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCF)=CC=C1C1=CC=C(Br)C=C1 NVVVHPJZHYYYLI-UHFFFAOYSA-N 0.000 description 1
- ITSFDFNBRHKPLN-UHFFFAOYSA-N 1-bromo-4-[4-(7-methoxyheptoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCOC)=CC=C1C1=CC=C(Br)C=C1 ITSFDFNBRHKPLN-UHFFFAOYSA-N 0.000 description 1
- FQWMSISJKKMMAY-UHFFFAOYSA-N 1-bromo-4-[4-(8-methoxyoctoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCCOC)=CC=C1C1=CC=C(Br)C=C1 FQWMSISJKKMMAY-UHFFFAOYSA-N 0.000 description 1
- SVHXPGWTCYKGGU-UHFFFAOYSA-N 1-ethynyl-4-(4-pentylphenyl)benzene Chemical group C1=CC(CCCCC)=CC=C1C1=CC=C(C#C)C=C1 SVHXPGWTCYKGGU-UHFFFAOYSA-N 0.000 description 1
- WQUQANRAAFHDNF-UHFFFAOYSA-N 1-heptyl-4-iodopyrazole Chemical compound CCCCCCCN1C=C(I)C=N1 WQUQANRAAFHDNF-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- NUMXHEUHHRTBQT-AATRIKPKSA-N 2,4-dimethoxy-1-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC=C(\C=C\[N+]([O-])=O)C(OC)=C1 NUMXHEUHHRTBQT-AATRIKPKSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- FEPVDSQKTSBMKK-UHFFFAOYSA-N 2-(4-hexoxyphenyl)-3h-benzimidazole-5-carboxylic acid Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2N1 FEPVDSQKTSBMKK-UHFFFAOYSA-N 0.000 description 1
- CCCNSSCOAQLYDF-UHFFFAOYSA-N 2-(4-octoxyphenoxy)-1-(3-oxidobenzotriazol-3-ium-1-yl)ethanone Chemical compound C1=CC(OCCCCCCCC)=CC=C1OCC(=O)N1C2=CC=CC=C2[N+]([O-])=N1 CCCNSSCOAQLYDF-UHFFFAOYSA-N 0.000 description 1
- ZVNRMMKUQPXARN-UHFFFAOYSA-N 2-(4-octoxyphenoxy)acetic acid Chemical compound CCCCCCCCOC1=CC=C(OCC(O)=O)C=C1 ZVNRMMKUQPXARN-UHFFFAOYSA-N 0.000 description 1
- CLGYXJLTRJDOEL-UHFFFAOYSA-N 2-(6-octoxypyridin-3-yl)-1,3-benzoxazole-5-carboxylic acid Chemical compound C1=NC(OCCCCCCCC)=CC=C1C1=NC2=CC(C(O)=O)=CC=C2O1 CLGYXJLTRJDOEL-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- WKYPGMRZXGMVQA-UHFFFAOYSA-N 2-[4-(4-heptylphenyl)phenyl]-2-oxoacetic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(=O)C(O)=O)C=C1 WKYPGMRZXGMVQA-UHFFFAOYSA-N 0.000 description 1
- RMHAFACFZBGDDL-UHFFFAOYSA-N 2-[4-(4-octylphenyl)-5-oxo-1,2,4-triazol-1-yl]acetic acid Chemical compound C1=CC(CCCCCCCC)=CC=C1N1C(=O)N(CC(O)=O)N=C1 RMHAFACFZBGDDL-UHFFFAOYSA-N 0.000 description 1
- DQLXHSRVVQUSHR-UHFFFAOYSA-N 2-ethynyl-6-heptoxynaphthalene Chemical group C1=C(C#C)C=CC2=CC(OCCCCCCC)=CC=C21 DQLXHSRVVQUSHR-UHFFFAOYSA-N 0.000 description 1
- QIPBUORAZAUNLL-UHFFFAOYSA-N 2-hydroxy-4-octoxybenzaldehyde Chemical compound CCCCCCCCOC1=CC=C(C=O)C(O)=C1 QIPBUORAZAUNLL-UHFFFAOYSA-N 0.000 description 1
- SBTKMQWDHADPNF-UHFFFAOYSA-N 2-methyl-2-(4-octoxyphenoxy)-1-(3-oxidobenzotriazol-3-ium-1-yl)propan-1-one Chemical compound C1=CC(OCCCCCCCC)=CC=C1OC(C)(C)C(=O)N1C2=CC=CC=C2[N+]([O-])=N1 SBTKMQWDHADPNF-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- ILWROKQKEDTIKB-UHFFFAOYSA-N 2-pentan-2-yloxy-1-phenylethanone Chemical compound CCCC(C)OCC(=O)C1=CC=CC=C1 ILWROKQKEDTIKB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- PDMYKAFCDWAAID-UHFFFAOYSA-N 3,4-dipentoxybenzoic acid Chemical compound CCCCCOC1=CC=C(C(O)=O)C=C1OCCCCC PDMYKAFCDWAAID-UHFFFAOYSA-N 0.000 description 1
- NSHAOELVDPKZIC-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonic acid;hydroxide Chemical compound [OH-].O1[N+](CC)=CC=C1C1=CC=CC(S(O)(=O)=O)=C1 NSHAOELVDPKZIC-UHFFFAOYSA-N 0.000 description 1
- ZODPRHWKXOVAAN-UHFFFAOYSA-N 3-(6-heptoxynaphthalen-2-yl)prop-2-enoic acid Chemical compound C1=C(C=CC(O)=O)C=CC2=CC(OCCCCCCC)=CC=C21 ZODPRHWKXOVAAN-UHFFFAOYSA-N 0.000 description 1
- GJFBPEQRLGLNJE-UHFFFAOYSA-N 3-(6-heptoxynaphthalen-2-yl)propanoic acid Chemical compound C1=C(CCC(O)=O)C=CC2=CC(OCCCCCCC)=CC=C21 GJFBPEQRLGLNJE-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- HOKMTWJLJUSSLY-UHFFFAOYSA-N 3-[2-(4-hexylanilino)ethyl]-1,3-oxazolidin-2-one;hydrochloride Chemical compound Cl.C1=CC(CCCCCC)=CC=C1NCCN1C(=O)OCC1 HOKMTWJLJUSSLY-UHFFFAOYSA-N 0.000 description 1
- GMFMOGFXYQJZNZ-UHFFFAOYSA-N 3-[4-(4-butoxyphenyl)phenyl]-1-(3-oxidobenzotriazol-3-ium-1-yl)prop-2-en-1-one Chemical compound C1=CC(OCCCC)=CC=C1C(C=C1)=CC=C1C=CC(=O)N1C2=CC=CC=C2[N+]([O-])=N1 GMFMOGFXYQJZNZ-UHFFFAOYSA-N 0.000 description 1
- OFUJQNIYHRBBFU-UHFFFAOYSA-N 3-[4-(4-heptylphenyl)phenyl]propanoic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(CCC(O)=O)C=C1 OFUJQNIYHRBBFU-UHFFFAOYSA-N 0.000 description 1
- KGRZYPOLYXJKAB-UHFFFAOYSA-N 3-[4-(4-pentoxyphenyl)phenyl]propanoic acid Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC=C(CCC(O)=O)C=C1 KGRZYPOLYXJKAB-UHFFFAOYSA-N 0.000 description 1
- MWIWHZXYIFPWQF-UHFFFAOYSA-N 3-[4-(4-pentylphenyl)phenyl]prop-2-enoic acid Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(C=CC(O)=O)C=C1 MWIWHZXYIFPWQF-UHFFFAOYSA-N 0.000 description 1
- BEUGGHYDMAZKJF-UHFFFAOYSA-N 3-[4-(4-pentylphenyl)phenyl]prop-2-ynoic acid Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(C#CC(O)=O)C=C1 BEUGGHYDMAZKJF-UHFFFAOYSA-N 0.000 description 1
- NGTZFLWMWXTVOY-UHFFFAOYSA-N 3-fluoro-4-[4-(4-hexoxyphenyl)piperazin-1-yl]benzoic acid;dihydrochloride Chemical compound Cl.Cl.C1=CC(OCCCCCC)=CC=C1N1CCN(C=2C(=CC(=CC=2)C(O)=O)F)CC1 NGTZFLWMWXTVOY-UHFFFAOYSA-N 0.000 description 1
- RAFNCAQESSDNCC-UHFFFAOYSA-N 3-fluoro-4-[4-(4-hydroxyphenyl)piperazin-1-yl]benzoic acid;dihydrobromide Chemical compound Br.Br.FC1=CC(C(=O)O)=CC=C1N1CCN(C=2C=CC(O)=CC=2)CC1 RAFNCAQESSDNCC-UHFFFAOYSA-N 0.000 description 1
- UHQJLSAZNHYLFW-UHFFFAOYSA-N 3-fluoro-4-[4-(4-methoxyphenyl)piperazin-1-yl]benzonitrile Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C(=CC(=CC=2)C#N)F)CC1 UHQJLSAZNHYLFW-UHFFFAOYSA-N 0.000 description 1
- VEXCLXOUWMYCPS-UHFFFAOYSA-N 3-methyl-1-(3-oxidobenzotriazol-3-ium-1-yl)tridec-2-en-1-one Chemical compound C1=CC=C2N(C(=O)C=C(C)CCCCCCCCCC)N=[N+]([O-])C2=C1 VEXCLXOUWMYCPS-UHFFFAOYSA-N 0.000 description 1
- ZDRQLAQHRMGIKF-UHFFFAOYSA-N 4-(1-heptylpyrazol-4-yl)benzoic acid Chemical compound C1=NN(CCCCCCC)C=C1C1=CC=C(C(O)=O)C=C1 ZDRQLAQHRMGIKF-UHFFFAOYSA-N 0.000 description 1
- XVROSBHWACAQRL-UHFFFAOYSA-N 4-(4-heptylphenyl)benzoic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(O)=O)C=C1 XVROSBHWACAQRL-UHFFFAOYSA-N 0.000 description 1
- JSFQGNDVWUWKMY-UHFFFAOYSA-N 4-(4-octylphenyl)-1h-1,2,4-triazol-5-one Chemical compound C1=CC(CCCCCCCC)=CC=C1N1C(=O)NN=C1 JSFQGNDVWUWKMY-UHFFFAOYSA-N 0.000 description 1
- YDOAWSTWKLBZHC-UHFFFAOYSA-N 4-(4-octylphenyl)-2-[2-(3-oxidobenzotriazol-3-ium-1-yl)-2-oxoethyl]-1,2,4-triazol-3-one Chemical compound C1=CC(CCCCCCCC)=CC=C1N1C(=O)N(CC(=O)N2C3=CC=CC=C3[N+]([O-])=N2)N=C1 YDOAWSTWKLBZHC-UHFFFAOYSA-N 0.000 description 1
- USLZAESUXAJUQT-UHFFFAOYSA-N 4-(4-propoxyphenyl)benzohydrazide Chemical compound C1=CC(OCCC)=CC=C1C1=CC=C(C(=O)NN)C=C1 USLZAESUXAJUQT-UHFFFAOYSA-N 0.000 description 1
- KMYOGIILYYCAGY-UHFFFAOYSA-N 4-(5-nonyl-1,3,4-oxadiazol-2-yl)benzoic acid Chemical compound O1C(CCCCCCCCC)=NN=C1C1=CC=C(C(O)=O)C=C1 KMYOGIILYYCAGY-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- ZJYYDMKIBGAUCA-UHFFFAOYSA-N 4-(pentyloxy)benzene-1-carbohydrazide Chemical compound CCCCCOC1=CC=C(C(=O)NN)C=C1 ZJYYDMKIBGAUCA-UHFFFAOYSA-N 0.000 description 1
- DJRKHTCUXRGYEU-UHFFFAOYSA-N 4-Hexyloxyaniline Chemical compound CCCCCCOC1=CC=C(N)C=C1 DJRKHTCUXRGYEU-UHFFFAOYSA-N 0.000 description 1
- IGWVTENILPBXJK-UHFFFAOYSA-N 4-[3-(4-hexoxyphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NOC(C=2C=CC(=CC=2)C(O)=O)=N1 IGWVTENILPBXJK-UHFFFAOYSA-N 0.000 description 1
- KRZZFHBQRFLGFB-UHFFFAOYSA-N 4-[4-(4-butoxyphenyl)phenyl]benzoic acid Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(O)=O)C=C1 KRZZFHBQRFLGFB-UHFFFAOYSA-N 0.000 description 1
- JKWOBDIWOIKNMF-UHFFFAOYSA-N 4-[4-(4-hexylphenyl)piperazin-1-yl]benzonitrile Chemical compound C1=CC(CCCCCC)=CC=C1N1CCN(C=2C=CC(=CC=2)C#N)CC1 JKWOBDIWOIKNMF-UHFFFAOYSA-N 0.000 description 1
- GKKDPUXAHZTMDA-UHFFFAOYSA-N 4-[4-(4-hydroxyphenyl)piperazin-1-yl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1N1CCN(C=2C=CC(O)=CC=2)CC1 GKKDPUXAHZTMDA-UHFFFAOYSA-N 0.000 description 1
- OTSBRMIZLFWKLW-UHFFFAOYSA-N 4-[4-(4-octoxyphenyl)piperazin-1-yl]benzoic acid Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C=2C=CC(=CC=2)C(O)=O)CC1 OTSBRMIZLFWKLW-UHFFFAOYSA-N 0.000 description 1
- YAYPIAMVDAPXIL-UHFFFAOYSA-N 4-[4-(4-octoxyphenyl)piperazin-1-yl]benzonitrile Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C=2C=CC(=CC=2)C#N)CC1 YAYPIAMVDAPXIL-UHFFFAOYSA-N 0.000 description 1
- VLQVFMAPZWAKMW-UHFFFAOYSA-N 4-[4-(4-pentoxyphenyl)piperazin-1-yl]benzoic acid;dihydrochloride Chemical compound Cl.Cl.C1=CC(OCCCCC)=CC=C1N1CCN(C=2C=CC(=CC=2)C(O)=O)CC1 VLQVFMAPZWAKMW-UHFFFAOYSA-N 0.000 description 1
- LYVSLZGLJNJAIT-UHFFFAOYSA-N 4-[4-(4-phenylcyclohexyl)piperazin-1-yl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1N1CCN(C2CCC(CC2)C=2C=CC=CC=2)CC1 LYVSLZGLJNJAIT-UHFFFAOYSA-N 0.000 description 1
- BBYPSSOHZOYSLV-UHFFFAOYSA-N 4-[4-(6-phenylpyridazin-3-yl)oxyphenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(C=C1)=CC=C1OC1=CC=C(C=2C=CC=CC=2)N=N1 BBYPSSOHZOYSLV-UHFFFAOYSA-N 0.000 description 1
- JQLDDMPJIABJPT-UHFFFAOYSA-N 4-[4-(6-propoxyhexoxy)phenyl]benzoic acid Chemical compound C1=CC(OCCCCCCOCCC)=CC=C1C1=CC=C(C(O)=O)C=C1 JQLDDMPJIABJPT-UHFFFAOYSA-N 0.000 description 1
- LXEIWYDDRKIJPV-UHFFFAOYSA-N 4-[4-(8-oxo-8-piperidin-1-yloctoxy)phenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(C=C1)=CC=C1OCCCCCCCC(=O)N1CCCCC1 LXEIWYDDRKIJPV-UHFFFAOYSA-N 0.000 description 1
- DAFGUIPDFPZTEG-UHFFFAOYSA-N 4-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(C=C1)=CC=C1OCCCCCCCCN1N=CN=C1 DAFGUIPDFPZTEG-UHFFFAOYSA-N 0.000 description 1
- XFPBZYIDFWFBOA-UHFFFAOYSA-N 4-[5-(4-hexoxyphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(O)=O)O1 XFPBZYIDFWFBOA-UHFFFAOYSA-N 0.000 description 1
- JJYMAZPWFNSWSF-UHFFFAOYSA-N 4-[5-(4-octoxyphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(O)=O)O1 JJYMAZPWFNSWSF-UHFFFAOYSA-N 0.000 description 1
- UGHHSCGTCCBZGA-UHFFFAOYSA-N 4-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(O)=O)S1 UGHHSCGTCCBZGA-UHFFFAOYSA-N 0.000 description 1
- UXBMCTOADKRHBZ-UHFFFAOYSA-N 4-[5-[4-(4-propoxyphenyl)phenyl]-1,3,4-thiadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCC)=CC=C1C1=CC=C(C=2SC(=NN=2)C=2C=CC(=CC=2)C(O)=O)C=C1 UXBMCTOADKRHBZ-UHFFFAOYSA-N 0.000 description 1
- SFMJCBKNKOWTOT-UHFFFAOYSA-N 4-[5-[4-(8-methoxyoctoxy)phenyl]-1,3,4-thiadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCCCCCCCOC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(O)=O)S1 SFMJCBKNKOWTOT-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- GWXUVWKBVROFDM-UHFFFAOYSA-N 4-hexoxybenzaldehyde Chemical compound CCCCCCOC1=CC=C(C=O)C=C1 GWXUVWKBVROFDM-UHFFFAOYSA-N 0.000 description 1
- ZBOKEVFJYLXVJQ-UHFFFAOYSA-N 4-hexoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCCCCOC1=CC=C(C(N)=N)C=C1 ZBOKEVFJYLXVJQ-UHFFFAOYSA-N 0.000 description 1
- HBQUXMZZODHFMJ-UHFFFAOYSA-N 4-hexoxybenzoic acid Chemical compound CCCCCCOC1=CC=C(C(O)=O)C=C1 HBQUXMZZODHFMJ-UHFFFAOYSA-N 0.000 description 1
- DQQOONVCLQZWOY-UHFFFAOYSA-N 4-hexoxybenzoyl chloride Chemical compound CCCCCCOC1=CC=C(C(Cl)=O)C=C1 DQQOONVCLQZWOY-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- HFRUPPHPJRZOCM-UHFFFAOYSA-N 4-octoxyphenol Chemical compound CCCCCCCCOC1=CC=C(O)C=C1 HFRUPPHPJRZOCM-UHFFFAOYSA-N 0.000 description 1
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 description 1
- YAPVGSXODFOBBR-UHFFFAOYSA-N 4-pentoxybenzaldehyde Chemical compound CCCCCOC1=CC=C(C=O)C=C1 YAPVGSXODFOBBR-UHFFFAOYSA-N 0.000 description 1
- NLDYZVXJDDWPJI-UHFFFAOYSA-N 4-piperidin-1-ylbenzohydrazide Chemical compound C1=CC(C(=O)NN)=CC=C1N1CCCCC1 NLDYZVXJDDWPJI-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- PNWUVMQJFCWBOY-UHFFFAOYSA-N 5-[4-(4-butoxyphenyl)phenyl]furan-2-carboxylic acid Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2OC(=CC=2)C(O)=O)C=C1 PNWUVMQJFCWBOY-UHFFFAOYSA-N 0.000 description 1
- FPPLUUPWGRRIIN-UHFFFAOYSA-N 5-hydroxy-1-benzothiophene-2-carboxylic acid Chemical compound OC1=CC=C2SC(C(=O)O)=CC2=C1 FPPLUUPWGRRIIN-UHFFFAOYSA-N 0.000 description 1
- MGNMPIQWBOVLFX-UHFFFAOYSA-N 5-methoxy-1-benzothiophene-2-carboxamide Chemical compound COC1=CC=C2SC(C(N)=O)=CC2=C1 MGNMPIQWBOVLFX-UHFFFAOYSA-N 0.000 description 1
- TZVWFVNRJGQBDZ-UHFFFAOYSA-N 5-octoxy-1-benzothiophene-2-carboxylic acid Chemical compound CCCCCCCCOC1=CC=C2SC(C(O)=O)=CC2=C1 TZVWFVNRJGQBDZ-UHFFFAOYSA-N 0.000 description 1
- YKGKZQHPSPKBRS-UHFFFAOYSA-N 6-(8-methoxyoctoxy)naphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(OCCCCCCCCOC)=CC=C21 YKGKZQHPSPKBRS-UHFFFAOYSA-N 0.000 description 1
- CPNHCZANGMBQLB-UHFFFAOYSA-N 6-[4-(4-butoxyphenyl)phenyl]pyridine-3-carboxylic acid Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2N=CC(=CC=2)C(O)=O)C=C1 CPNHCZANGMBQLB-UHFFFAOYSA-N 0.000 description 1
- UJLHMYSJHQTVGT-UHFFFAOYSA-N 6-[4-(4-heptoxyphenyl)piperazin-1-yl]pyridine-3-carboxylic acid Chemical compound C1=CC(OCCCCCCC)=CC=C1N1CCN(C=2N=CC(=CC=2)C(O)=O)CC1 UJLHMYSJHQTVGT-UHFFFAOYSA-N 0.000 description 1
- OURHICMQMQBYDD-UHFFFAOYSA-N 6-heptylnaphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(CCCCCCC)=CC=C21 OURHICMQMQBYDD-UHFFFAOYSA-N 0.000 description 1
- ZJJWBEVVSDIYCS-UHFFFAOYSA-N 6-hexylnaphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(CCCCCC)=CC=C21 ZJJWBEVVSDIYCS-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 241000186046 Actinomyces Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- JCMQZYHTGVPSGY-OVCLIPMQSA-N C1=CC(/C=C/C(=O)OC)=CC=C1C1=CC=C(OCCCCCCF)C=C1 Chemical compound C1=CC(/C=C/C(=O)OC)=CC=C1C1=CC=C(OCCCCCCF)C=C1 JCMQZYHTGVPSGY-OVCLIPMQSA-N 0.000 description 1
- RPEVDUSDGACMRH-LICLKQGHSA-N C1=CC(OCCCCCCCOC)=CC=C1C1=CC=C(\C=C\C(=O)OC)C=C1 Chemical compound C1=CC(OCCCCCCCOC)=CC=C1C1=CC=C(\C=C\C(=O)OC)C=C1 RPEVDUSDGACMRH-LICLKQGHSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- MBWRHUSKMKZTLJ-XYPYZODXSA-N CCCCC[C@H]1CC[C@H](C(=O)NN)CC1 Chemical compound CCCCC[C@H]1CC[C@H](C(=O)NN)CC1 MBWRHUSKMKZTLJ-XYPYZODXSA-N 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 241001158911 Coleophoma sp. Species 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- 241001337994 Cryptococcus <scale insect> Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 241000228402 Histoplasma Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000555676 Malassezia Species 0.000 description 1
- 101100043756 Metarhizium robertsii (strain ARSEF 23 / ATCC MYA-3075) subE gene Proteins 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241000235395 Mucor Species 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- PHCBEOGBQHYFOQ-UHFFFAOYSA-N ON=CC(C=C1)=CC=C1Br.Cl Chemical compound ON=CC(C=C1)=CC=C1Br.Cl PHCBEOGBQHYFOQ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- NUOITAPZZREUHB-ZZTVPSNHSA-N [(16R)-1-methoxy-18-(3-oxidobenzotriazol-3-ium-1-yl)-18-oxo-16-phenylmethoxyoctadecyl]carbamic acid Chemical compound C(C1=CC=CC=C1)O[C@@H](CC(=O)N1N=[N+](C2=C1C=CC=C2)[O-])CCCCCCCCCCCCCCC(OC)NC(=O)O NUOITAPZZREUHB-ZZTVPSNHSA-N 0.000 description 1
- RCDVMGKQZXRFFS-UHFFFAOYSA-N [2-(4-hexoxyphenyl)-1,3-benzoxazol-5-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC(C(=O)N3C4=CC=CC=C4[N+]([O-])=N3)=CC=C2O1 RCDVMGKQZXRFFS-UHFFFAOYSA-N 0.000 description 1
- MCHBIIHSIALIAR-UHFFFAOYSA-N [2-(4-hexoxyphenyl)-3h-benzimidazol-5-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC=C(C(=O)N3C4=CC=CC=C4[N+]([O-])=N3)C=C2N1 MCHBIIHSIALIAR-UHFFFAOYSA-N 0.000 description 1
- PLYSQUYKMUHJRF-UHFFFAOYSA-N [2-(4-hexylphenyl)phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(CCCCCC)=CC=C1C1=CC=CC=C1C(=O)N1C2=CC=CC=C2[N+]([O-])=N1 PLYSQUYKMUHJRF-UHFFFAOYSA-N 0.000 description 1
- NAGIHWCWUMTCBC-UHFFFAOYSA-N [3-(4-octoxyphenyl)-2,5-dioxopyrrolidin-1-yl] hydrogen carbonate Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1C(=O)N(OC(O)=O)C(=O)C1 NAGIHWCWUMTCBC-UHFFFAOYSA-N 0.000 description 1
- MWEWQDMVKHCOSZ-UHFFFAOYSA-N [4-(4-heptylphenyl)phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 MWEWQDMVKHCOSZ-UHFFFAOYSA-N 0.000 description 1
- WUSJFDCDUOHBPD-UHFFFAOYSA-N [4-(5-nonyl-1,3,4-oxadiazol-2-yl)phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound O1C(CCCCCCCCC)=NN=C1C1=CC=C(C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 WUSJFDCDUOHBPD-UHFFFAOYSA-N 0.000 description 1
- FQYALAYSGVPARL-UHFFFAOYSA-N [4-[2-(4-hexoxyphenyl)pyrimidin-4-yl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC=CC(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)=N1 FQYALAYSGVPARL-UHFFFAOYSA-N 0.000 description 1
- WJSIULJLENASJR-UHFFFAOYSA-N [4-[3-(4-hexoxyphenyl)-1h-pyrazol-5-yl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NNC(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)=C1 WJSIULJLENASJR-UHFFFAOYSA-N 0.000 description 1
- GCSDRULGDNBYMR-UHFFFAOYSA-N [4-[4-(4-butoxyphenyl)phenyl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 GCSDRULGDNBYMR-UHFFFAOYSA-N 0.000 description 1
- XQMRMZWNELKAIZ-UHFFFAOYSA-N [4-[4-(4-cyclohexylphenyl)piperazin-1-yl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)C(C=C1)=CC=C1N(CC1)CCN1C(C=C1)=CC=C1C1CCCCC1 XQMRMZWNELKAIZ-UHFFFAOYSA-N 0.000 description 1
- OCBVZLAURCOAHB-UHFFFAOYSA-N [4-[4-(5-methoxypentoxy)phenyl]phenyl]boronic acid Chemical compound C1=CC(OCCCCCOC)=CC=C1C1=CC=C(B(O)O)C=C1 OCBVZLAURCOAHB-UHFFFAOYSA-N 0.000 description 1
- AGQJYXDYYXKDRV-UHFFFAOYSA-N [4-[4-(6-methoxyhexoxy)phenyl]phenyl]boronic acid Chemical compound C1=CC(OCCCCCCOC)=CC=C1C1=CC=C(B(O)O)C=C1 AGQJYXDYYXKDRV-UHFFFAOYSA-N 0.000 description 1
- WNRGGOKCTNJGMY-UHFFFAOYSA-N [4-[4-[4-(6-methoxyhexoxy)phenyl]phenyl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCOC)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 WNRGGOKCTNJGMY-UHFFFAOYSA-N 0.000 description 1
- WBERCTSVJLCBJJ-UHFFFAOYSA-N [4-[4-[8-(2,6-dimethylmorpholin-4-yl)octoxy]phenyl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1C(C)OC(C)CN1CCCCCCCCOC1=CC=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 WBERCTSVJLCBJJ-UHFFFAOYSA-N 0.000 description 1
- SIGBZCVCKKKRFD-UHFFFAOYSA-N [4-[4-[8-(2-ethoxyethoxy)octoxy]phenyl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCCCOCCOCC)=CC=C1C1=CC=C(C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 SIGBZCVCKKKRFD-UHFFFAOYSA-N 0.000 description 1
- NSDRWIFMUWNFAY-UHFFFAOYSA-N [4-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)S1 NSDRWIFMUWNFAY-UHFFFAOYSA-N 0.000 description 1
- ATZVJULTBLIUPS-UHFFFAOYSA-N [5-[4-(4-hexoxyphenyl)piperazin-1-yl]pyridin-2-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1N1CCN(C=2C=NC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)CC1 ATZVJULTBLIUPS-UHFFFAOYSA-N 0.000 description 1
- ZZDHCAQJASOHBL-UHFFFAOYSA-N [6-(4-heptoxyphenyl)pyridin-3-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCC)=CC=C1C1=CC=C(C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=N1 ZZDHCAQJASOHBL-UHFFFAOYSA-N 0.000 description 1
- XVLAYOKCKRVSOO-UHFFFAOYSA-N [6-(8-methoxyoctoxy)naphthalen-2-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound N1=[N+]([O-])C2=CC=CC=C2N1C(=O)C1=CC2=CC=C(OCCCCCCCCOC)C=C2C=C1 XVLAYOKCKRVSOO-UHFFFAOYSA-N 0.000 description 1
- ZPEFJOYFIWGZQA-UHFFFAOYSA-N [6-[4-(4-octoxyphenyl)piperazin-1-yl]pyridin-3-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C=2N=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)CC1 ZPEFJOYFIWGZQA-UHFFFAOYSA-N 0.000 description 1
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCO)C=N2 MKUXAQIIEYXACX-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- QBYJBZPUGVGKQQ-SJJAEHHWSA-N aldrin Chemical compound C1[C@H]2C=C[C@@H]1[C@H]1[C@@](C3(Cl)Cl)(Cl)C(Cl)=C(Cl)[C@@]3(Cl)[C@H]12 QBYJBZPUGVGKQQ-SJJAEHHWSA-N 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 125000001124 arachidoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000000668 atmospheric pressure chemical ionisation mass spectrometry Methods 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 1
- KLQNJBAFEFFWQZ-UHFFFAOYSA-N benzoic acid;dihydrochloride Chemical compound Cl.Cl.OC(=O)C1=CC=CC=C1 KLQNJBAFEFFWQZ-UHFFFAOYSA-N 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- LQICGOKNCGVNAE-UHFFFAOYSA-N benzotriazol-1-yl-[4-[5-[4-(8-methoxyoctoxy)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]methanone Chemical compound C1=CC(OCCCCCCCCOC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3N=N2)O1 LQICGOKNCGVNAE-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- PFYXSUNOLOJMDX-UHFFFAOYSA-N bis(2,5-dioxopyrrolidin-1-yl) carbonate Chemical compound O=C1CCC(=O)N1OC(=O)ON1C(=O)CCC1=O PFYXSUNOLOJMDX-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- IPIVAXLHTVNRBS-UHFFFAOYSA-N decanoyl chloride Chemical compound CCCCCCCCCC(Cl)=O IPIVAXLHTVNRBS-UHFFFAOYSA-N 0.000 description 1
- 125000003074 decanoyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- OREAFAJWWJHCOT-UHFFFAOYSA-N dimethylmalonic acid Chemical compound OC(=O)C(C)(C)C(O)=O OREAFAJWWJHCOT-UHFFFAOYSA-N 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- ODQSOTBFWCNPKF-UHFFFAOYSA-N ethyl 2-(4-hexoxyphenyl)-1,3-benzoxazole-5-carboxylate Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC(C(=O)OCC)=CC=C2O1 ODQSOTBFWCNPKF-UHFFFAOYSA-N 0.000 description 1
- OSLQGOBYIDZZTD-UHFFFAOYSA-N ethyl 2-(6-octoxypyridin-3-yl)-1,3-benzoxazole-5-carboxylate Chemical compound C1=NC(OCCCCCCCC)=CC=C1C1=NC2=CC(C(=O)OCC)=CC=C2O1 OSLQGOBYIDZZTD-UHFFFAOYSA-N 0.000 description 1
- GGJAUSTVMDKDTM-UHFFFAOYSA-N ethyl 2-[4-(4-octylphenyl)-5-oxo-1,2,4-triazol-1-yl]acetate Chemical compound C1=CC(CCCCCCCC)=CC=C1N1C(=O)N(CC(=O)OCC)N=C1 GGJAUSTVMDKDTM-UHFFFAOYSA-N 0.000 description 1
- RDULEYWUGKOCMR-UHFFFAOYSA-N ethyl 2-chloro-3-oxobutanoate Chemical compound CCOC(=O)C(Cl)C(C)=O RDULEYWUGKOCMR-UHFFFAOYSA-N 0.000 description 1
- NTHCRGDBZGKGNG-UHFFFAOYSA-N ethyl 3-(n-(3-ethoxy-3-oxopropyl)-4-hexoxyanilino)propanoate Chemical compound CCCCCCOC1=CC=C(N(CCC(=O)OCC)CCC(=O)OCC)C=C1 NTHCRGDBZGKGNG-UHFFFAOYSA-N 0.000 description 1
- PWLIDNJVLQJKIS-UHFFFAOYSA-N ethyl 4-[3-(dimethylamino)prop-2-enoyl]benzoate Chemical group CCOC(=O)C1=CC=C(C(=O)C=CN(C)C)C=C1 PWLIDNJVLQJKIS-UHFFFAOYSA-N 0.000 description 1
- GLOAPLPTWAXAIG-UHFFFAOYSA-N ethyl 4-acetylbenzoate Chemical compound CCOC(=O)C1=CC=C(C(C)=O)C=C1 GLOAPLPTWAXAIG-UHFFFAOYSA-N 0.000 description 1
- IXJHHMIKLJPXMW-UHFFFAOYSA-N ethyl 6-[4-(4-hexoxyphenyl)piperazin-1-yl]pyridazine-3-carboxylate Chemical compound C1=CC(OCCCCCC)=CC=C1N1CCN(C=2N=NC(=CC=2)C(=O)OCC)CC1 IXJHHMIKLJPXMW-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- YVXHZKKCZYLQOP-UHFFFAOYSA-N hept-1-yne Chemical compound CCCCCC#C YVXHZKKCZYLQOP-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- DCPMPXBYPZGNDC-UHFFFAOYSA-N hydron;methanediimine;chloride Chemical compound Cl.N=C=N DCPMPXBYPZGNDC-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 125000004499 isoxazol-5-yl group Chemical group O1N=CC=C1* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KNFPLMFTXFVFPA-UHFFFAOYSA-N lithium;bis(2-methylpropyl)azanide Chemical compound CC(C)CN([Li])CC(C)C KNFPLMFTXFVFPA-UHFFFAOYSA-N 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- DHWRKYAZTBDRKA-VGOFMYFVSA-N methyl (E)-3-[4-(4-butoxyphenyl)phenyl]prop-2-enoate Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(\C=C\C(=O)OC)C=C1 DHWRKYAZTBDRKA-VGOFMYFVSA-N 0.000 description 1
- WZBUGBMBPXARJR-UHFFFAOYSA-N methyl 2-(4-hexoxyphenyl)-3h-benzimidazole-5-carboxylate Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC=C(C(=O)OC)C=C2N1 WZBUGBMBPXARJR-UHFFFAOYSA-N 0.000 description 1
- OQNUTBBRDVILAY-UHFFFAOYSA-N methyl 2-nonyl-3h-benzimidazole-5-carboxylate Chemical compound C1=C(C(=O)OC)C=C2NC(CCCCCCCCC)=NC2=C1 OQNUTBBRDVILAY-UHFFFAOYSA-N 0.000 description 1
- VURTXDMCDUXUKM-UHFFFAOYSA-N methyl 3,4-dipentoxybenzoate Chemical compound CCCCCOC1=CC=C(C(=O)OC)C=C1OCCCCC VURTXDMCDUXUKM-UHFFFAOYSA-N 0.000 description 1
- JZUXUPZONYEBIP-UHFFFAOYSA-N methyl 3-(6-heptoxynaphthalen-2-yl)propanoate Chemical compound C1=C(CCC(=O)OC)C=CC2=CC(OCCCCCCC)=CC=C21 JZUXUPZONYEBIP-UHFFFAOYSA-N 0.000 description 1
- CLCNNGUQZLFXBQ-UHFFFAOYSA-N methyl 3-[4-(4-pentoxyphenyl)phenyl]prop-2-enoate Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC=C(C=CC(=O)OC)C=C1 CLCNNGUQZLFXBQ-UHFFFAOYSA-N 0.000 description 1
- PKWJLGJNZNVUBD-UHFFFAOYSA-N methyl 3-[4-(4-pentoxyphenyl)phenyl]propanoate Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC=C(CCC(=O)OC)C=C1 PKWJLGJNZNVUBD-UHFFFAOYSA-N 0.000 description 1
- VRRBSYXFKWJTLW-UHFFFAOYSA-N methyl 3-[4-(4-pentylphenyl)phenyl]prop-2-enoate Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(C=CC(=O)OC)C=C1 VRRBSYXFKWJTLW-UHFFFAOYSA-N 0.000 description 1
- UIEPULRPIPFXGJ-UHFFFAOYSA-N methyl 3-[4-(4-pentylphenyl)phenyl]propanoate Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(CCC(=O)OC)C=C1 UIEPULRPIPFXGJ-UHFFFAOYSA-N 0.000 description 1
- SSKROZKPITVKMK-UHFFFAOYSA-N methyl 4-(1-heptylpyrazol-4-yl)benzoate Chemical compound C1=NN(CCCCCCC)C=C1C1=CC=C(C(=O)OC)C=C1 SSKROZKPITVKMK-UHFFFAOYSA-N 0.000 description 1
- WWHGRCXLJLLWOX-UHFFFAOYSA-N methyl 4-(5-nonyl-1,3,4-oxadiazol-2-yl)benzoate Chemical compound O1C(CCCCCCCCC)=NN=C1C1=CC=C(C(=O)OC)C=C1 WWHGRCXLJLLWOX-UHFFFAOYSA-N 0.000 description 1
- HGVBEQHEDXPHBI-UHFFFAOYSA-N methyl 4-(hydrazinecarbonyl)benzoate Chemical compound COC(=O)C1=CC=C(C(=O)NN)C=C1 HGVBEQHEDXPHBI-UHFFFAOYSA-N 0.000 description 1
- WNYDFMUZTKXZNM-UHFFFAOYSA-N methyl 4-[(decanoylamino)carbamoyl]benzoate Chemical compound CCCCCCCCCC(=O)NNC(=O)C1=CC=C(C(=O)OC)C=C1 WNYDFMUZTKXZNM-UHFFFAOYSA-N 0.000 description 1
- RJZGFGGJJGEFFT-UHFFFAOYSA-N methyl 4-[2-(4-hexoxyphenyl)pyrimidin-4-yl]benzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC=CC(C=2C=CC(=CC=2)C(=O)OC)=N1 RJZGFGGJJGEFFT-UHFFFAOYSA-N 0.000 description 1
- DDWVXFQATJTOFS-UHFFFAOYSA-N methyl 4-[3-(4-hexoxyphenyl)-3-oxopropanoyl]benzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C(=O)CC(=O)C1=CC=C(C(=O)OC)C=C1 DDWVXFQATJTOFS-UHFFFAOYSA-N 0.000 description 1
- MYSHSAIDZYLUKW-UHFFFAOYSA-N methyl 4-[3-oxo-3-(4-pentoxyphenyl)propanoyl]benzoate Chemical compound C1=CC(OCCCCC)=CC=C1C(=O)CC(=O)C1=CC=C(C(=O)OC)C=C1 MYSHSAIDZYLUKW-UHFFFAOYSA-N 0.000 description 1
- XBJCOFOSYJQAFA-UHFFFAOYSA-N methyl 4-[4-(5-bromopentoxy)phenyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C1=CC=C(OCCCCCBr)C=C1 XBJCOFOSYJQAFA-UHFFFAOYSA-N 0.000 description 1
- SSKKHIDDPNRCLR-UHFFFAOYSA-N methyl 4-[4-(5-phenoxypentoxy)phenyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C(C=C1)=CC=C1OCCCCCOC1=CC=CC=C1 SSKKHIDDPNRCLR-UHFFFAOYSA-N 0.000 description 1
- ZOBQOLMFGUPNTI-UHFFFAOYSA-N methyl 4-[4-(8-bromooctoxy)phenyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C1=CC=C(OCCCCCCCCBr)C=C1 ZOBQOLMFGUPNTI-UHFFFAOYSA-N 0.000 description 1
- CIXYXCKHJMKPKG-UHFFFAOYSA-N methyl 4-[4-(8-oxo-8-piperidin-1-yloctoxy)phenyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C(C=C1)=CC=C1OCCCCCCCC(=O)N1CCCCC1 CIXYXCKHJMKPKG-UHFFFAOYSA-N 0.000 description 1
- AIBMXQRTBASMNP-UHFFFAOYSA-N methyl 4-[5-(4-hexoxyphenyl)-1,3,4-oxadiazol-2-yl]benzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(=O)OC)O1 AIBMXQRTBASMNP-UHFFFAOYSA-N 0.000 description 1
- JLCLOAYOQLRDSK-UHFFFAOYSA-N methyl 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC(C=2C=CC(=CC=2)C(=O)OC)=NO1 JLCLOAYOQLRDSK-UHFFFAOYSA-N 0.000 description 1
- RUTXRPSNXSBXSF-UHFFFAOYSA-N methyl 4-[[(4-hexoxybenzoyl)amino]carbamoyl]benzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C(=O)NNC(=O)C1=CC=C(C(=O)OC)C=C1 RUTXRPSNXSBXSF-UHFFFAOYSA-N 0.000 description 1
- FEIOASZZURHTHB-UHFFFAOYSA-N methyl 4-formylbenzoate Chemical compound COC(=O)C1=CC=C(C=O)C=C1 FEIOASZZURHTHB-UHFFFAOYSA-N 0.000 description 1
- IVYQLXCACCEQHM-UHFFFAOYSA-N methyl 4-hexoxybenzoate Chemical compound CCCCCCOC1=CC=C(C(=O)OC)C=C1 IVYQLXCACCEQHM-UHFFFAOYSA-N 0.000 description 1
- PJMMXLPXRYKMLD-UHFFFAOYSA-N methyl 5-[4-(4-butoxyphenyl)phenyl]furan-2-carboxylate Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2OC(=CC=2)C(=O)OC)C=C1 PJMMXLPXRYKMLD-UHFFFAOYSA-N 0.000 description 1
- UIZHVPVXYAJVBS-UHFFFAOYSA-N methyl 6-(4-heptoxyphenyl)pyridine-3-carboxylate Chemical compound C1=CC(OCCCCCCC)=CC=C1C1=CC=C(C(=O)OC)C=N1 UIZHVPVXYAJVBS-UHFFFAOYSA-N 0.000 description 1
- MPUYLLIQJZUWBZ-UHFFFAOYSA-N methyl 6-(8-bromooctoxy)naphthalene-2-carboxylate Chemical compound C1=C(OCCCCCCCCBr)C=CC2=CC(C(=O)OC)=CC=C21 MPUYLLIQJZUWBZ-UHFFFAOYSA-N 0.000 description 1
- WPRSDVPSRCCIEQ-UHFFFAOYSA-N methyl 6-(8-methoxyoctoxy)naphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(OCCCCCCCCOC)=CC=C21 WPRSDVPSRCCIEQ-UHFFFAOYSA-N 0.000 description 1
- BKWOEKNWNWAWLV-UHFFFAOYSA-N methyl 6-[4-(4-hydroxyphenyl)piperazin-1-yl]pyridine-3-carboxylate Chemical compound N1=CC(C(=O)OC)=CC=C1N1CCN(C=2C=CC(O)=CC=2)CC1 BKWOEKNWNWAWLV-UHFFFAOYSA-N 0.000 description 1
- YVKJWGVIRXYAKV-UHFFFAOYSA-N methyl 6-[4-(4-octoxyphenyl)piperazin-1-yl]pyridine-3-carboxylate Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C=2N=CC(=CC=2)C(=O)OC)CC1 YVKJWGVIRXYAKV-UHFFFAOYSA-N 0.000 description 1
- PZDVVVLVCQRQSV-UHFFFAOYSA-N methyl 6-[4-[4-(8-bromooctoxy)phenyl]piperazin-1-yl]pyridine-3-carboxylate Chemical compound N1=CC(C(=O)OC)=CC=C1N1CCN(C=2C=CC(OCCCCCCCCBr)=CC=2)CC1 PZDVVVLVCQRQSV-UHFFFAOYSA-N 0.000 description 1
- MKSIUKCSAHIELM-UHFFFAOYSA-N methyl 6-heptylnaphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(CCCCCCC)=CC=C21 MKSIUKCSAHIELM-UHFFFAOYSA-N 0.000 description 1
- OTGJDXGQXHXPLL-UHFFFAOYSA-N methyl 6-hex-1-ynylnaphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(C#CCCCC)=CC=C21 OTGJDXGQXHXPLL-UHFFFAOYSA-N 0.000 description 1
- HYWOJVCLXAQCPV-UHFFFAOYSA-N methyl 6-hexylnaphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(CCCCCC)=CC=C21 HYWOJVCLXAQCPV-UHFFFAOYSA-N 0.000 description 1
- UKZOPQRTQJERQC-UHFFFAOYSA-N methyl 6-hydroxynaphthalene-2-carboxylate Chemical compound C1=C(O)C=CC2=CC(C(=O)OC)=CC=C21 UKZOPQRTQJERQC-UHFFFAOYSA-N 0.000 description 1
- PXKNNGRTOQEZFY-UHFFFAOYSA-N methyl 7-octoxy-2-oxochromene-3-carboxylate Chemical compound C1=C(C(=O)OC)C(=O)OC2=CC(OCCCCCCCC)=CC=C21 PXKNNGRTOQEZFY-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000001419 myristoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XPIHNCHVIZFNFJ-UHFFFAOYSA-N n'-hydroxy-4-octoxybenzenecarboximidamide Chemical compound CCCCCCCCOC1=CC=C(C(=N)NO)C=C1 XPIHNCHVIZFNFJ-UHFFFAOYSA-N 0.000 description 1
- UHAAFJWANJYDIS-UHFFFAOYSA-N n,n'-diethylmethanediimine Chemical compound CCN=C=NCC UHAAFJWANJYDIS-UHFFFAOYSA-N 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- NJGRNRAXMBFJJY-UHFFFAOYSA-N n-(2-azaniumylethyl)carbamodithioate Chemical compound NCCNC(S)=S NJGRNRAXMBFJJY-UHFFFAOYSA-N 0.000 description 1
- FTNFEHXDETWERN-UHFFFAOYSA-N n-[bis(aziridin-1-yl)phosphoryl]-2,6-dimethyl-5-[(4-propan-2-yloxyphenyl)methyl]pyrimidin-4-amine Chemical compound C1=CC(OC(C)C)=CC=C1CC1=C(C)N=C(C)N=C1NP(=O)(N1CC1)N1CC1 FTNFEHXDETWERN-UHFFFAOYSA-N 0.000 description 1
- 125000005184 naphthylamino group Chemical group C1(=CC=CC2=CC=CC=C12)N* 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000005186 naphthyloxy group Chemical group C1(=CC=CC2=CC=CC=C12)O* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XITQUSLLOSKDTB-UHFFFAOYSA-N nitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1Cl XITQUSLLOSKDTB-UHFFFAOYSA-N 0.000 description 1
- 125000001196 nonadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- SEVSMVUOKAMPDO-UHFFFAOYSA-N para-Acetoxybenzaldehyde Natural products CC(=O)OC1=CC=C(C=O)C=C1 SEVSMVUOKAMPDO-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- WEYVCQFUGFRXOM-UHFFFAOYSA-N perazine Chemical compound C1CN(C)CCN1CCCN1C2=CC=CC=C2SC2=CC=CC=C21 WEYVCQFUGFRXOM-UHFFFAOYSA-N 0.000 description 1
- 229960002195 perazine Drugs 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- CEMSSDOOIJDOBQ-UHFFFAOYSA-N phenyl n-(4-octylphenyl)carbamate Chemical compound C1=CC(CCCCCCCC)=CC=C1NC(=O)OC1=CC=CC=C1 CEMSSDOOIJDOBQ-UHFFFAOYSA-N 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- WRAQQYDMVSCOTE-UHFFFAOYSA-N phenyl prop-2-enoate Chemical compound C=CC(=O)OC1=CC=CC=C1 WRAQQYDMVSCOTE-UHFFFAOYSA-N 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 125000001129 phenylbutoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 102220109092 rs372989037 Human genes 0.000 description 1
- 102220114166 rs754921704 Human genes 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- JSBPGDXOXSDAFB-UHFFFAOYSA-N tert-butyl 4-(4-octoxyphenyl)piperazine-1-carboxylate Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C(=O)OC(C)(C)C)CC1 JSBPGDXOXSDAFB-UHFFFAOYSA-N 0.000 description 1
- OVIPBGIXYIUXDX-UHFFFAOYSA-N tert-butyl 4-(4-phenylcyclohexyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C1CCC(C=2C=CC=CC=2)CC1 OVIPBGIXYIUXDX-UHFFFAOYSA-N 0.000 description 1
- LJKXCXOKTGVAHI-UHFFFAOYSA-N tert-butyl 4-[4-(phenoxycarbonylamino)phenyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C(C=C1)=CC=C1NC(=O)OC1=CC=CC=C1 LJKXCXOKTGVAHI-UHFFFAOYSA-N 0.000 description 1
- FRYGEZWYUGOZES-UHFFFAOYSA-N tert-butyl 4-[4-[1-(4-methylpentyl)-5-oxo-1,2,4-triazol-4-yl]phenyl]piperazine-1-carboxylate Chemical compound O=C1N(CCCC(C)C)N=CN1C1=CC=C(N2CCN(CC2)C(=O)OC(C)(C)C)C=C1 FRYGEZWYUGOZES-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- VVRBLMQPRNPMSX-UHFFFAOYSA-N trimethyl-[2-[4-(4-pentylphenyl)phenyl]ethynyl]silane Chemical group C1=CC(CCCCC)=CC=C1C1=CC=C(C#C[Si](C)(C)C)C=C1 VVRBLMQPRNPMSX-UHFFFAOYSA-N 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000000297 undecanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K7/00—Peptides having 5 to 20 amino acids in a fully defined sequence; Derivatives thereof
- C07K7/50—Cyclic peptides containing at least one abnormal peptide link
- C07K7/54—Cyclic peptides containing at least one abnormal peptide link with at least one abnormal peptide link in the ring
- C07K7/56—Cyclic peptides containing at least one abnormal peptide link with at least one abnormal peptide link in the ring the cyclisation not occurring through 2,4-diamino-butanoic acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
- A61K38/04—Peptides having up to 20 amino acids in a fully defined sequence; Derivatives thereof
- A61K38/12—Cyclic peptides, e.g. bacitracins; Polymyxins; Gramicidins S, C; Tyrocidins A, B or C
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/10—Antimycotics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Pharmacology & Pharmacy (AREA)
- Molecular Biology (AREA)
- Genetics & Genomics (AREA)
- Biophysics (AREA)
- Biochemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Gastroenterology & Hepatology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Epidemiology (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9420425A GB9420425D0 (en) | 1994-10-07 | 1994-10-07 | New compound |
| GB9508745.8 | 1995-04-28 | ||
| GB9420425.2 | 1995-04-28 | ||
| GBGB9508745.8A GB9508745D0 (en) | 1995-04-28 | 1995-04-28 | New compound |
| PCT/JP1995/001983 WO1996011210A1 (en) | 1994-10-07 | 1995-09-29 | Cyclic hexapeptides having antibiotic activity |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2202058A1 CA2202058A1 (en) | 1996-04-18 |
| CA2202058C true CA2202058C (en) | 2007-11-06 |
Family
ID=26305774
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002202058A Expired - Lifetime CA2202058C (en) | 1994-10-07 | 1995-09-29 | Cyclic hexapeptides having antibiotic activity |
Country Status (26)
| Country | Link |
|---|---|
| US (2) | US6107458A (esLanguage) |
| EP (1) | EP0788511B1 (esLanguage) |
| JP (2) | JP2897427B2 (esLanguage) |
| KR (1) | KR100353303B1 (esLanguage) |
| CN (1) | CN1203089C (esLanguage) |
| AR (1) | AR041770A1 (esLanguage) |
| AT (1) | ATE229541T1 (esLanguage) |
| AU (1) | AU696949B2 (esLanguage) |
| BR (2) | BR9504791B1 (esLanguage) |
| CA (1) | CA2202058C (esLanguage) |
| DE (2) | DE122008000025I2 (esLanguage) |
| DK (1) | DK0788511T3 (esLanguage) |
| ES (1) | ES2187575T3 (esLanguage) |
| FI (1) | FI119988B (esLanguage) |
| FR (1) | FR08C0028I2 (esLanguage) |
| HU (1) | HU228151B1 (esLanguage) |
| IL (1) | IL115484A (esLanguage) |
| LU (1) | LU91452I2 (esLanguage) |
| MX (1) | MX9702531A (esLanguage) |
| NL (1) | NL300352I2 (esLanguage) |
| NO (2) | NO328483B1 (esLanguage) |
| OA (1) | OA10475A (esLanguage) |
| PT (1) | PT788511E (esLanguage) |
| RU (1) | RU2165423C2 (esLanguage) |
| TR (1) | TR199501229A2 (esLanguage) |
| WO (1) | WO1996011210A1 (esLanguage) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5696084A (en) * | 1996-08-16 | 1997-12-09 | Abbott Laboratories | Amino-lipopetide antifungal agents |
| AUPO371596A0 (en) * | 1996-11-19 | 1996-12-12 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| AUPO381496A0 (en) * | 1996-11-25 | 1996-12-19 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| WO1998057923A1 (en) * | 1997-06-18 | 1998-12-23 | Fujisawa Pharmaceutical Co., Ltd. | New production process |
| BR9907967A (pt) * | 1998-02-09 | 2000-10-17 | Fujisawa Pharmaceutical Co | Composto de polipeptideo, processo para sua preparação, composição farmacêutica compreendendo dito composto, e seu uso. |
| AU756792B2 (en) * | 1998-02-09 | 2003-01-23 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| ATE311373T1 (de) * | 1999-02-11 | 2005-12-15 | Emisphere Tech Inc | Oxadiazolverbindungen und -zusammensetzungen zur abgabe von wirkstoffen |
| US7084279B1 (en) * | 1999-02-11 | 2006-08-01 | Emisphere Technologies Inc. | Oxadiazole compounds and compositions for delivering active agents |
| AUPP999799A0 (en) | 1999-04-27 | 1999-05-20 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| AUPQ066399A0 (en) * | 1999-05-31 | 1999-06-24 | Fujisawa Pharmaceutical Co., Ltd. | Antifungal combination use |
| TWI233805B (en) | 1999-07-01 | 2005-06-11 | Fujisawa Pharmaceutical Co | Stabilized pharmaceutical composition in lyophilized form as antifungal agent |
| US7166572B1 (en) | 1999-07-27 | 2007-01-23 | Aventis Pharma Deutschland Gmbh | Cyclohexapeptide compounds, processes for their production and their use as a pharmaceutical |
| AUPQ462399A0 (en) * | 1999-12-13 | 2000-01-13 | Fujisawa Pharmaceutical Co., Ltd. | New use |
| TWI250992B (en) * | 2000-02-21 | 2006-03-11 | Astellas Pharma Inc | Polypeptide compounds for the prophylactic and/or therapeutic treatment of infectious diseases caused by pathogenic microorganisms |
| ES2191516B1 (es) * | 2000-07-28 | 2005-01-01 | Consejo Superior De Investigaciones Cientificas | Antibioticos antifungicos de naturaleza peptidica inhibidores de la germinacion y el crecimiento de hongos fitopatogenos. |
| AUPQ938700A0 (en) * | 2000-08-14 | 2000-09-07 | Fujisawa Pharmaceutical Co., Ltd. | Antifungal combination use |
| DE60234812D1 (de) | 2001-01-29 | 2010-02-04 | Shionogi & Co | Arzneipräparat, das als wirkstoff 5-methyl-1-phenyl-2-(1h)-pyridon enthält |
| JP2005053782A (ja) * | 2001-08-31 | 2005-03-03 | Fujisawa Pharmaceut Co Ltd | 環状リポペプチド化合物の新規結晶 |
| EP2316469A1 (en) | 2002-02-22 | 2011-05-04 | Shire LLC | Delivery system and methods for protecting and administering dextroamphetamine |
| US7199248B2 (en) | 2002-08-08 | 2007-04-03 | Astellas Pharma Inc. | Process |
| AU2003903205A0 (en) * | 2003-06-23 | 2003-07-10 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| JP4664912B2 (ja) * | 2003-07-22 | 2011-04-06 | セラヴァンス, インコーポレーテッド | グリコペプチド抗菌剤と組み合わせたエキノカンジン抗真菌剤の使用 |
| WO2005026323A2 (en) * | 2003-09-05 | 2005-03-24 | Merck & Co., Inc. | Stationary phases and a purification process using the stationary phases |
| AU2004274309B2 (en) * | 2003-09-22 | 2010-04-08 | Msd K.K. | Novel piperidine derivative |
| US7476673B2 (en) * | 2003-12-30 | 2009-01-13 | Allergan, Inc. | Disubstituted chalcone oximes as selective agonists of RARγ retinoid receptors |
| CN101198598A (zh) * | 2004-05-20 | 2008-06-11 | 弗尔德里克斯制药股份有限公司 | 2-((杂)芳基)-苯并噁唑化合物及其衍生物、组合物以及用于稳定和抑制甲状腺素转运蛋白错重叠的方法 |
| AU2005286728A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as mediators of stearoyl-CoA desaturase |
| AU2005286793A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives for the treatment of diseases mediated by stearoyl-CoA desaturase enzymes |
| EP1814551A2 (en) | 2004-09-20 | 2007-08-08 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives for inhibiting human stearoyl-coa-desaturase |
| CA2580857A1 (en) | 2004-09-20 | 2006-09-28 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-coa desaturase inhibitors |
| US8071603B2 (en) | 2004-09-20 | 2011-12-06 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-CoA desaturase inhibitors |
| CA2580762A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as therapeutic agents |
| US7767677B2 (en) | 2004-09-20 | 2010-08-03 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-CoA desaturase inhibitors |
| EP2301536B1 (en) * | 2004-10-13 | 2014-04-09 | PTC Therapeutics, Inc. | Compounds and their use for treating nonsense-related diseases |
| MX2007015216A (es) | 2005-06-03 | 2008-02-22 | Xenon Pharmaceuticals Inc | Derivados de aminotiazol y sus usos como agentes terapeuticos. |
| JPWO2007043401A1 (ja) * | 2005-10-07 | 2009-04-16 | キッセイ薬品工業株式会社 | 含窒素複素環化合物およびそれを含有する医薬組成物 |
| CN101516387B (zh) * | 2006-07-26 | 2014-06-04 | 桑多斯股份公司 | 卡泊芬净制剂 |
| US8853392B2 (en) | 2007-06-03 | 2014-10-07 | Vanderbilt University | Benzamide mGluR5 positive allosteric modulators and methods of making and using same |
| WO2009023721A1 (en) | 2007-08-13 | 2009-02-19 | Divergence, Inc. | Compositions and methods for controlling nematodes |
| RU2470939C2 (ru) * | 2007-10-29 | 2012-12-27 | Астеллас Фарма Инк. | Полипептидное соединение |
| US8034806B2 (en) | 2007-11-02 | 2011-10-11 | Vanderbilt University | Bicyclic mGluR5 positive allosteric modulators and methods of making and using same |
| BRPI0914629A2 (pt) * | 2008-06-24 | 2019-09-24 | Irm Llc | compostos e métodos para a modulação de receptores acoplados à proteína g |
| US9394340B2 (en) | 2009-03-24 | 2016-07-19 | Cadila Healthcare Limited | Purification process for lipopeptides |
| BR112013023531A2 (pt) * | 2011-04-04 | 2016-12-06 | Xellia Pharmaceuticals Aps | processo de um único vaso para a fabricação de micafungina ou de um sal desta |
| DK2699327T3 (en) | 2011-04-20 | 2015-10-05 | Xellia Pharmaceuticals Aps | Method of cleaning micafungin |
| CN102775476B (zh) * | 2011-05-12 | 2015-01-07 | 上海天伟生物制药有限公司 | 一种米卡芬净钠盐的制备方法 |
| JP6130827B2 (ja) | 2011-05-17 | 2017-05-17 | 塩野義製薬株式会社 | ヘテロ環化合物 |
| ES2586408T3 (es) * | 2011-09-09 | 2016-10-14 | Sandoz Ag | Preparación de intermedios de micafungina |
| CN102659930B (zh) * | 2012-03-30 | 2014-04-23 | 上海天伟生物制药有限公司 | 一种高纯度环肽类物质的晶体及其制备方法和用途 |
| CN102627689B (zh) * | 2012-03-30 | 2014-08-06 | 上海天伟生物制药有限公司 | 一种环肽类化合物的水合物及其制备方法和用途 |
| CN102627688B (zh) | 2012-03-30 | 2014-12-31 | 上海天伟生物制药有限公司 | 一种高纯度环肽化合物及其制备方法和用途 |
| WO2015180682A1 (zh) * | 2014-05-29 | 2015-12-03 | 上海天伟生物制药有限公司 | 一种环肽类化合物的溶剂合物及其制备方法和用途 |
| US20170190742A1 (en) * | 2014-05-29 | 2017-07-06 | Shanghai Techwell Biopharmaceutical Co., Ltd. | Composition of cyclic peptide compound, preparation method for same, and uses thereof |
| WO2016056023A2 (en) * | 2014-10-07 | 2016-04-14 | Alaparthi Lakshmi Prasad | Intermediates and processes to prepare micafungin |
| CA2937365C (en) | 2016-03-29 | 2018-09-18 | F. Hoffmann-La Roche Ag | Granulate formulation of 5-methyl-1-phenyl-2-(1h)-pyridone and method of making the same |
| AU2017376960B2 (en) | 2016-12-16 | 2023-12-14 | Baxter Healthcare Sa | Micafungin compositions |
| EP3485873A1 (en) | 2017-11-17 | 2019-05-22 | Cadila Healthcare Limited | Stable pharmaceutical injectable compositions of micafungin |
| CN108752430B (zh) * | 2018-05-31 | 2022-02-18 | 杭州中美华东制药有限公司 | 米卡芬净钠新晶型及其制备方法 |
| WO2020013116A1 (ja) * | 2018-07-10 | 2020-01-16 | 京都薬品工業株式会社 | Ptp-1b阻害剤およびその用途 |
| CN110734408A (zh) * | 2019-10-22 | 2020-01-31 | 重庆康乐制药有限公司 | 一种米卡芬净类衍生物侧链中间体的制备方法 |
| CN115785226A (zh) * | 2021-09-09 | 2023-03-14 | 上海天伟生物制药有限公司 | 一种棘白菌素药物杂质及其制备、纯化方法和应用 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU1574603A1 (ru) * | 1988-08-11 | 1990-06-30 | Ивановский Химико-Технологический Институт | Способ получени мезо-тетраарилоктаметилпорфиринов |
| IL98506A (en) * | 1990-06-18 | 1996-09-12 | Fujisawa Pharmaceutical Co | Cyclic peptide antibiotics processes for the preparation thereof and pharmaceutical compositions containing them |
| MY136593A (en) * | 1992-03-19 | 2008-10-31 | Lilly Co Eli | Cyclic peptide antifungal agents and process for preparation thereof |
-
1995
- 1995-09-29 DK DK95932935T patent/DK0788511T3/da active
- 1995-09-29 AT AT95932935T patent/ATE229541T1/de active
- 1995-09-29 US US08/809,723 patent/US6107458A/en not_active Expired - Lifetime
- 1995-09-29 AU AU35780/95A patent/AU696949B2/en not_active Expired
- 1995-09-29 DE DE122008000025C patent/DE122008000025I2/de active Active
- 1995-09-29 ES ES95932935T patent/ES2187575T3/es not_active Expired - Lifetime
- 1995-09-29 DE DE69529172T patent/DE69529172T2/de not_active Expired - Lifetime
- 1995-09-29 JP JP8512472A patent/JP2897427B2/ja not_active Expired - Lifetime
- 1995-09-29 WO PCT/JP1995/001983 patent/WO1996011210A1/en not_active Ceased
- 1995-09-29 HU HU9800338A patent/HU228151B1/hu active Protection Beyond IP Right Term
- 1995-09-29 RU RU97107338/04A patent/RU2165423C2/ru active Protection Beyond IP Right Term
- 1995-09-29 CN CNB95196643XA patent/CN1203089C/zh not_active Expired - Lifetime
- 1995-09-29 CA CA002202058A patent/CA2202058C/en not_active Expired - Lifetime
- 1995-09-29 KR KR1019970702213A patent/KR100353303B1/ko not_active Expired - Lifetime
- 1995-09-29 PT PT95932935T patent/PT788511E/pt unknown
- 1995-09-29 EP EP95932935A patent/EP0788511B1/en not_active Expired - Lifetime
- 1995-09-29 MX MX9702531A patent/MX9702531A/es unknown
- 1995-10-02 IL IL11548495A patent/IL115484A/xx not_active IP Right Cessation
- 1995-10-06 AR ARP9501333763A patent/AR041770A1/es unknown
- 1995-10-06 BR BRPI9504791-3A patent/BR9504791B1/pt active IP Right Grant
- 1995-10-06 TR TR95/01229A patent/TR199501229A2/xx unknown
- 1995-10-06 BR BRPI9504791A patent/BRPI9504791B8/pt not_active IP Right Cessation
-
1997
- 1997-04-04 FI FI971397A patent/FI119988B/fi not_active IP Right Cessation
- 1997-04-04 NO NO19971544A patent/NO328483B1/no not_active IP Right Cessation
- 1997-04-17 OA OA60989A patent/OA10475A/en unknown
-
1998
- 1998-05-19 JP JP13675698A patent/JP3518665B2/ja not_active Expired - Lifetime
-
1999
- 1999-02-11 US US09/248,267 patent/US6265536B1/en not_active Expired - Lifetime
-
2008
- 2008-06-03 NL NL300352C patent/NL300352I2/nl unknown
- 2008-06-04 LU LU91452C patent/LU91452I2/fr unknown
- 2008-06-27 FR FR08C0028C patent/FR08C0028I2/fr active Active
-
2010
- 2010-08-09 NO NO2010016C patent/NO2010016I2/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2202058C (en) | Cyclic hexapeptides having antibiotic activity | |
| CA2044746C (en) | Polypeptide compound and a process for preparation thereof | |
| JP3551469B2 (ja) | 新規ポリペプチド化合物及びその塩 | |
| US6232290B1 (en) | Cyclic hexapeptides with antimicrobial activity | |
| KR100250921B1 (ko) | 타키키닌 길항활성을 갖는 펩타이드 | |
| US5741775A (en) | Cyclohexapeptidyl aminoalkyl ethers | |
| JP2004526728A (ja) | 抗菌活性を有する環状ヘキサペプチド化合物 | |
| US6743776B2 (en) | Cyclohexapeptides having antimicrobial activity | |
| JPH0570495A (ja) | 環式ヘキサペプチド化合物 | |
| CZ20022844A3 (cs) | Cyklický hexapeptidový derivát a farmaceutický prostředek | |
| WO1995000536A1 (en) | Peptide compounds | |
| US5952299A (en) | Cyclic peptide nuclei and derivatives thereof | |
| US5654400A (en) | Process for making peptide compounds having tachykinin antagonistic activity | |
| JP2005524640A (ja) | 新規化合物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKEX | Expiry |
Effective date: 20150929 |