CA2147263C - 4-alkoxy-2,6-di-t-butylphenol derivatives - Google Patents
4-alkoxy-2,6-di-t-butylphenol derivatives Download PDFInfo
- Publication number
- CA2147263C CA2147263C CA002147263A CA2147263A CA2147263C CA 2147263 C CA2147263 C CA 2147263C CA 002147263 A CA002147263 A CA 002147263A CA 2147263 A CA2147263 A CA 2147263A CA 2147263 C CA2147263 C CA 2147263C
- Authority
- CA
- Canada
- Prior art keywords
- tert
- butyl
- tbu
- compound
- acetoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 199
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 12
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical group C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 claims abstract description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 9
- 125000003118 aryl group Chemical group 0.000 claims abstract description 6
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 5
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims abstract description 5
- 125000002252 acyl group Chemical group 0.000 claims abstract description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical class N* 0.000 claims abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000006239 protecting group Chemical group 0.000 claims description 8
- 125000004429 atom Chemical group 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 abstract description 71
- 238000003786 synthesis reaction Methods 0.000 abstract description 69
- 230000003078 antioxidant effect Effects 0.000 abstract description 8
- 208000023589 ischemic disease Diseases 0.000 abstract description 7
- 208000010125 myocardial infarction Diseases 0.000 abstract description 6
- 206010003210 Arteriosclerosis Diseases 0.000 abstract description 5
- 208000011775 arteriosclerosis disease Diseases 0.000 abstract description 5
- 239000003814 drug Substances 0.000 abstract description 5
- 239000000543 intermediate Substances 0.000 abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 abstract description 4
- 125000000547 substituted alkyl group Chemical group 0.000 abstract description 3
- 229910052717 sulfur Inorganic materials 0.000 abstract description 3
- 125000004434 sulfur atom Chemical group 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 236
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 114
- 239000000203 mixture Substances 0.000 description 112
- 239000000243 solution Substances 0.000 description 89
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 88
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 82
- 238000005160 1H NMR spectroscopy Methods 0.000 description 80
- 101150041968 CDC13 gene Proteins 0.000 description 80
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 80
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 71
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 65
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 62
- 239000012141 concentrate Substances 0.000 description 61
- 238000010898 silica gel chromatography Methods 0.000 description 57
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 54
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 52
- 239000007864 aqueous solution Substances 0.000 description 48
- 238000000605 extraction Methods 0.000 description 48
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 45
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 42
- 238000006243 chemical reaction Methods 0.000 description 40
- 238000001816 cooling Methods 0.000 description 39
- 229920006395 saturated elastomer Polymers 0.000 description 38
- 239000012044 organic layer Substances 0.000 description 37
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 36
- 238000003756 stirring Methods 0.000 description 32
- 239000002904 solvent Substances 0.000 description 30
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 29
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 28
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 27
- 239000012230 colorless oil Substances 0.000 description 26
- -1 methoxyethoxymethyl Chemical group 0.000 description 26
- 239000012299 nitrogen atmosphere Substances 0.000 description 26
- 239000011541 reaction mixture Substances 0.000 description 26
- 238000000034 method Methods 0.000 description 24
- 108010007622 LDL Lipoproteins Proteins 0.000 description 21
- 102000007330 LDL Lipoproteins Human genes 0.000 description 21
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 21
- 235000017557 sodium bicarbonate Nutrition 0.000 description 21
- 229960001701 chloroform Drugs 0.000 description 18
- 230000003859 lipid peroxidation Effects 0.000 description 17
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- 239000010410 layer Substances 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 13
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 13
- 235000019270 ammonium chloride Nutrition 0.000 description 13
- 238000010438 heat treatment Methods 0.000 description 13
- 239000012280 lithium aluminium hydride Substances 0.000 description 12
- 230000002829 reductive effect Effects 0.000 description 11
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000000524 Thiobarbituric Acid Reactive Substance Substances 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- 239000013078 crystal Substances 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 239000005457 ice water Substances 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 10
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- OYHQOLUKZRVURQ-HZJYTTRNSA-N Linoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O OYHQOLUKZRVURQ-HZJYTTRNSA-N 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- 239000003963 antioxidant agent Substances 0.000 description 8
- 235000006708 antioxidants Nutrition 0.000 description 8
- 230000000052 comparative effect Effects 0.000 description 8
- OYHQOLUKZRVURQ-IXWMQOLASA-N linoleic acid Natural products CCCCC\C=C/C\C=C\CCCCCCCC(O)=O OYHQOLUKZRVURQ-IXWMQOLASA-N 0.000 description 8
- 235000020778 linoleic acid Nutrition 0.000 description 8
- 230000004048 modification Effects 0.000 description 8
- 238000012986 modification Methods 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 8
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 108010093894 Xanthine oxidase Proteins 0.000 description 7
- 102100033220 Xanthine oxidase Human genes 0.000 description 7
- 239000012298 atmosphere Substances 0.000 description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 229940098779 methanesulfonic acid Drugs 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 108010023244 Lactoperoxidase Proteins 0.000 description 6
- 102000045576 Lactoperoxidases Human genes 0.000 description 6
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- MXZACTZQSGYANA-UHFFFAOYSA-N chembl545463 Chemical compound Cl.C1=CC(OC)=CC=C1C(N=C1)=CN2C1=NC(C)=C2O MXZACTZQSGYANA-UHFFFAOYSA-N 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 230000002401 inhibitory effect Effects 0.000 description 6
- 229940057428 lactoperoxidase Drugs 0.000 description 6
- HWYHZTIRURJOHG-UHFFFAOYSA-N luminol Chemical compound O=C1NNC(=O)C2=C1C(N)=CC=C2 HWYHZTIRURJOHG-UHFFFAOYSA-N 0.000 description 6
- CYAJEMFRSQGFIG-ISWIILBPSA-N microcystin-LA Natural products CO[C@@H](Cc1ccccc1)[C@@H](C)C=C(C)C=C[C@H](NC(=O)CNC(=O)[C@@H](C)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](C)NC(=O)C(=C)N(C)C(=O)CC[C@@H](C)C(=O)O)C(=O)O)[C@H](C)C(=O)N CYAJEMFRSQGFIG-ISWIILBPSA-N 0.000 description 6
- 230000001590 oxidative effect Effects 0.000 description 6
- OKLPSIJWGLWCOR-UHFFFAOYSA-N (2,6-ditert-butyl-4-hydroxy-3-methylphenyl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C(O)C(C)=C1C(C)(C)C OKLPSIJWGLWCOR-UHFFFAOYSA-N 0.000 description 5
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical group C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 5
- AKXFJUUGOGZHQF-UHFFFAOYSA-N 4,6-ditert-butyl-1-benzofuran-5-ol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC2=C1C=CO2 AKXFJUUGOGZHQF-UHFFFAOYSA-N 0.000 description 5
- LXEKPEMOWBOYRF-QDBORUFSSA-N AAPH Chemical compound Cl.Cl.NC(=N)C(C)(C)\N=N\C(C)(C)C(N)=N LXEKPEMOWBOYRF-QDBORUFSSA-N 0.000 description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
- OUUQCZGPVNCOIJ-UHFFFAOYSA-M Superoxide Chemical class [O-][O] OUUQCZGPVNCOIJ-UHFFFAOYSA-M 0.000 description 5
- 238000006701 autoxidation reaction Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 239000011259 mixed solution Substances 0.000 description 5
- 230000009257 reactivity Effects 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 241000894007 species Species 0.000 description 5
- XCRRGMKOURUQBY-UHFFFAOYSA-N (2,6-ditert-butyl-4-hydroxy-3-prop-2-enylphenyl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C(O)C(CC=C)=C1C(C)(C)C XCRRGMKOURUQBY-UHFFFAOYSA-N 0.000 description 4
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 4
- YLOHHUKVCVOPID-UHFFFAOYSA-N 4,6-ditert-butyl-2-methyl-1-benzofuran-5-ol Chemical compound OC1=C(C(C)(C)C)C=C2OC(C)=CC2=C1C(C)(C)C YLOHHUKVCVOPID-UHFFFAOYSA-N 0.000 description 4
- 229910015900 BF3 Inorganic materials 0.000 description 4
- 206010008190 Cerebrovascular accident Diseases 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000007818 Grignard reagent Substances 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- 241000283973 Oryctolagus cuniculus Species 0.000 description 4
- 208000006011 Stroke Diseases 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 230000002490 cerebral effect Effects 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 4
- 150000004795 grignard reagents Chemical class 0.000 description 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 4
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- ZXLSPBINTBCOEN-UHFFFAOYSA-N (2,6-ditert-butyl-3-formyl-4-hydroxyphenyl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C(O)C(C=O)=C1C(C)(C)C ZXLSPBINTBCOEN-UHFFFAOYSA-N 0.000 description 3
- SKKZEOWXZNQGGG-UHFFFAOYSA-N (2,6-ditert-butyl-4-hydroxyphenyl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C(O)C=C1C(C)(C)C SKKZEOWXZNQGGG-UHFFFAOYSA-N 0.000 description 3
- ATFPLQAPABRYMU-UHFFFAOYSA-N (4,6-ditert-butyl-1-benzofuran-5-yl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C2OC=CC2=C1C(C)(C)C ATFPLQAPABRYMU-UHFFFAOYSA-N 0.000 description 3
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 3
- FIKMFHGBTJCWFJ-UHFFFAOYSA-N 4-tert-butyl-2-octyl-1-benzofuran-5-ol Chemical compound OC1=CC=C2OC(CCCCCCCC)=CC2=C1C(C)(C)C FIKMFHGBTJCWFJ-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 102000006991 Apolipoprotein B-100 Human genes 0.000 description 3
- 108010008150 Apolipoprotein B-100 Proteins 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- KMKKIKWBZRABCJ-UHFFFAOYSA-N [2,6-ditert-butyl-4-(2-methylprop-2-enoxy)phenyl] acetate Chemical compound CC(=C)COC1=CC(C(C)(C)C)=C(OC(C)=O)C(C(C)(C)C)=C1 KMKKIKWBZRABCJ-UHFFFAOYSA-N 0.000 description 3
- ZRWVAPXFCCFREB-UHFFFAOYSA-N [2,6-ditert-butyl-4-methoxy-3-(2-oxopropyl)phenyl] acetate Chemical compound COC1=CC(C(C)(C)C)=C(OC(C)=O)C(C(C)(C)C)=C1CC(C)=O ZRWVAPXFCCFREB-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 229940125904 compound 1 Drugs 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 3
- 235000019345 sodium thiosulphate Nutrition 0.000 description 3
- HJYCVQWBZKFFSM-UHFFFAOYSA-N (2,6-ditert-butyl-3-methyl-4-propoxyphenyl) acetate Chemical compound CCCOC1=CC(C(C)(C)C)=C(OC(C)=O)C(C(C)(C)C)=C1C HJYCVQWBZKFFSM-UHFFFAOYSA-N 0.000 description 2
- BPEMFEJKXADBPJ-UHFFFAOYSA-N (2,6-ditert-butyl-4-methoxy-3-prop-2-enylphenyl) acetate Chemical compound COC1=CC(C(C)(C)C)=C(OC(C)=O)C(C(C)(C)C)=C1CC=C BPEMFEJKXADBPJ-UHFFFAOYSA-N 0.000 description 2
- MVMJPOWBEAVKQJ-UHFFFAOYSA-N (2,6-ditert-butyl-4-prop-2-enoxyphenyl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C(OCC=C)C=C1C(C)(C)C MVMJPOWBEAVKQJ-UHFFFAOYSA-N 0.000 description 2
- YAOFBLSAKCMWJT-UHFFFAOYSA-N (4,6-ditert-butyl-2,2-diethyl-3h-1-benzofuran-5-yl) acetate Chemical compound C1=C(C(C)(C)C)C(OC(C)=O)=C(C(C)(C)C)C2=C1OC(CC)(CC)C2 YAOFBLSAKCMWJT-UHFFFAOYSA-N 0.000 description 2
- OPAGKTCPAHGILI-UHFFFAOYSA-N (4,6-ditert-butyl-2,2-dimethyl-3h-1-benzofuran-5-yl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C2OC(C)(C)CC2=C1C(C)(C)C OPAGKTCPAHGILI-UHFFFAOYSA-N 0.000 description 2
- GUEBXUDJJMYEBZ-UHFFFAOYSA-N (4,6-ditert-butyl-2,2-dimethyl-7-propyl-3h-1-benzofuran-5-yl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C(CCC)=C2OC(C)(C)CC2=C1C(C)(C)C GUEBXUDJJMYEBZ-UHFFFAOYSA-N 0.000 description 2
- QREOPMZWVRIIQZ-UHFFFAOYSA-N (4,6-ditert-butyl-2-formyl-1-benzofuran-5-yl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C2OC(C=O)=CC2=C1C(C)(C)C QREOPMZWVRIIQZ-UHFFFAOYSA-N 0.000 description 2
- DNCKAEJHMZTTGQ-UHFFFAOYSA-N (4,6-ditert-butyl-2-oct-1-enyl-1-benzofuran-5-yl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C2OC(C=CCCCCCC)=CC2=C1C(C)(C)C DNCKAEJHMZTTGQ-UHFFFAOYSA-N 0.000 description 2
- XBUGQUJQAAXZAU-UHFFFAOYSA-N (4,6-ditert-butyl-2-octyl-1-benzofuran-5-yl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C2OC(CCCCCCCC)=CC2=C1C(C)(C)C XBUGQUJQAAXZAU-UHFFFAOYSA-N 0.000 description 2
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 2
- LHXBIWSIWVQZCO-UHFFFAOYSA-N 2,4,6-tritert-butyl-1-benzofuran-5-ol Chemical compound OC1=C(C(C)(C)C)C=C2OC(C(C)(C)C)=CC2=C1C(C)(C)C LHXBIWSIWVQZCO-UHFFFAOYSA-N 0.000 description 2
- ULYYWSSGHJGKKC-UHFFFAOYSA-N 2,6-ditert-butyl-3-methyl-4-(oxan-2-yloxy)phenol Chemical compound C1=C(C(C)(C)C)C(O)=C(C(C)(C)C)C(C)=C1OC1OCCCC1 ULYYWSSGHJGKKC-UHFFFAOYSA-N 0.000 description 2
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 2
- TXNSZCSYBXHETP-UHFFFAOYSA-N 2-chloro-n-(hydroxymethyl)acetamide Chemical compound OCNC(=O)CCl TXNSZCSYBXHETP-UHFFFAOYSA-N 0.000 description 2
- ZJQROHZHGAYXEJ-UHFFFAOYSA-N 4,6-ditert-butyl-2,3-dihydro-1-benzofuran-5-ol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC2=C1CCO2 ZJQROHZHGAYXEJ-UHFFFAOYSA-N 0.000 description 2
- FFSVNBNGENDDQD-XNTDXEJSSA-N 4,6-ditert-butyl-2-[(e)-5-hydroxy-4-methylpent-3-enyl]-2-methyl-3h-1-benzofuran-5-ol Chemical compound C1=C(C(C)(C)C)C(O)=C(C(C)(C)C)C2=C1OC(CC\C=C(CO)/C)(C)C2 FFSVNBNGENDDQD-XNTDXEJSSA-N 0.000 description 2
- BFHOUCVIUPGOEW-UHFFFAOYSA-N 4,6-ditert-butyl-2-octyl-2,3-dihydro-1-benzofuran-5-ol Chemical compound C1=C(C(C)(C)C)C(O)=C(C(C)(C)C)C2=C1OC(CCCCCCCC)C2 BFHOUCVIUPGOEW-UHFFFAOYSA-N 0.000 description 2
- HLNICQLGFOCYDX-UHFFFAOYSA-N 4-tert-butyl-2-methyl-1-benzofuran-5-ol Chemical compound OC1=CC=C2OC(C)=CC2=C1C(C)(C)C HLNICQLGFOCYDX-UHFFFAOYSA-N 0.000 description 2
- MUXZKJREFZKMTB-UHFFFAOYSA-N 4-tert-butyl-5-phenylmethoxy-1-benzofuran Chemical compound C1=CC=2OC=CC=2C(C(C)(C)C)=C1OCC1=CC=CC=C1 MUXZKJREFZKMTB-UHFFFAOYSA-N 0.000 description 2
- ZYUVGYBAPZYKSA-UHFFFAOYSA-N 5-(3-hydroxybutan-2-yl)-4-methylbenzene-1,3-diol Chemical compound CC(O)C(C)C1=CC(O)=CC(O)=C1C ZYUVGYBAPZYKSA-UHFFFAOYSA-N 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- CLDKWFPTLVCUTJ-UHFFFAOYSA-N C(C)(=O)OC1=C(C(=C(C=C1C(C)(C)C)O)CC(CCCC(CCCC(CCCC(C)C)C)CO)C)C(C)(C)C Chemical compound C(C)(=O)OC1=C(C(=C(C=C1C(C)(C)C)O)CC(CCCC(CCCC(CCCC(C)C)C)CO)C)C(C)(C)C CLDKWFPTLVCUTJ-UHFFFAOYSA-N 0.000 description 2
- 102000020897 Formins Human genes 0.000 description 2
- 108091022623 Formins Proteins 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- UGQMRVRMYYASKQ-UHFFFAOYSA-N Hypoxanthine nucleoside Natural products OC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 UGQMRVRMYYASKQ-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 229940123973 Oxygen scavenger Drugs 0.000 description 2
- 208000026062 Tissue disease Diseases 0.000 description 2
- 229930003427 Vitamin E Natural products 0.000 description 2
- MMVLYORDXVTGJX-UHFFFAOYSA-N [2,6-ditert-butyl-3-(2-ethylbut-1-enyl)-4-hydroxyphenyl] acetate Chemical compound CCC(CC)=CC1=C(O)C=C(C(C)(C)C)C(OC(C)=O)=C1C(C)(C)C MMVLYORDXVTGJX-UHFFFAOYSA-N 0.000 description 2
- BTZHJQFJUSACQB-UHFFFAOYSA-N [2,6-ditert-butyl-3-[4-(1,3-dioxolan-2-yl)-2-hydroxy-2-methylbutyl]-4-methoxyphenyl] acetate Chemical compound COC1=CC(C(C)(C)C)=C(OC(C)=O)C(C(C)(C)C)=C1CC(C)(O)CCC1OCCO1 BTZHJQFJUSACQB-UHFFFAOYSA-N 0.000 description 2
- XZKXKIKWDQMOFZ-UHFFFAOYSA-N [2,6-ditert-butyl-3-[[(2-chloroacetyl)amino]methyl]-4-hydroxyphenyl] acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C(O)C(CNC(=O)CCl)=C1C(C)(C)C XZKXKIKWDQMOFZ-UHFFFAOYSA-N 0.000 description 2
- QNTNJQDFVWVCJS-UHFFFAOYSA-N [2,6-ditert-butyl-3-methyl-4-(oxan-2-yloxy)phenyl] acetate Chemical compound CC1=C(C(C)(C)C)C(OC(=O)C)=C(C(C)(C)C)C=C1OC1OCCCC1 QNTNJQDFVWVCJS-UHFFFAOYSA-N 0.000 description 2
- CVVMNGIMTBKDGK-UHFFFAOYSA-N [2,6-ditert-butyl-4-hydroxy-3-[1-hydroxy-5-methyl-2-(3-methylbutyl)hexyl]phenyl] acetate Chemical compound CC(C)CCC(CCC(C)C)C(O)C1=C(O)C=C(C(C)(C)C)C(OC(C)=O)=C1C(C)(C)C CVVMNGIMTBKDGK-UHFFFAOYSA-N 0.000 description 2
- CTTWYJVOGXJMFH-UHFFFAOYSA-N [2,6-ditert-butyl-4-methoxy-3-(2-oxoethyl)phenyl] acetate Chemical compound COC1=CC(C(C)(C)C)=C(OC(C)=O)C(C(C)(C)C)=C1CC=O CTTWYJVOGXJMFH-UHFFFAOYSA-N 0.000 description 2
- NSHFJEMHQGGBOH-UHFFFAOYSA-N [4,6-ditert-butyl-2,2-bis(3-methylbutyl)-3h-1-benzofuran-5-yl] acetate Chemical compound C1=C(C(C)(C)C)C(OC(C)=O)=C(C(C)(C)C)C2=C1OC(CCC(C)C)(CCC(C)C)C2 NSHFJEMHQGGBOH-UHFFFAOYSA-N 0.000 description 2
- KVJWDIYGXLZESZ-LFIBNONCSA-N [4,6-ditert-butyl-2-[(e)-5-chloro-4-methylpent-3-enyl]-2-methyl-3h-1-benzofuran-5-yl] acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C2OC(C)(CC\C=C(/C)CCl)CC2=C1C(C)(C)C KVJWDIYGXLZESZ-LFIBNONCSA-N 0.000 description 2
- NETVTKTYVRJDLE-LFIBNONCSA-N [4,6-ditert-butyl-2-[(e)-5-hydroxy-4-methylpent-3-enyl]-2-methyl-3h-1-benzofuran-5-yl] acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C2OC(C)(CC\C=C(/C)CO)CC2=C1C(C)(C)C NETVTKTYVRJDLE-LFIBNONCSA-N 0.000 description 2
- WINNFOMNCBKDDD-UHFFFAOYSA-N [4,6-ditert-butyl-2-methyl-2-(3-oxopropyl)-3h-1-benzofuran-5-yl] acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C2OC(C)(CCC=O)CC2=C1C(C)(C)C WINNFOMNCBKDDD-UHFFFAOYSA-N 0.000 description 2
- AOAOSQXWCCKTQY-UHFFFAOYSA-N [4-[3-(4-acetyloxy-3,5-ditert-butyl-2-methylphenoxy)propoxy]-2,6-ditert-butyl-3-methylphenyl] acetate Chemical compound CC1=C(C(C)(C)C)C(OC(=O)C)=C(C(C)(C)C)C=C1OCCCOC1=CC(C(C)(C)C)=C(OC(C)=O)C(C(C)(C)C)=C1C AOAOSQXWCCKTQY-UHFFFAOYSA-N 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 2
- 239000008351 acetate buffer Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- QHIMEFKYTNKHCI-UHFFFAOYSA-N chembl1193972 Chemical compound C1=CC(OC)=CC=C1C(N=C1)=CN2C1=NC(C)=C2O QHIMEFKYTNKHCI-UHFFFAOYSA-N 0.000 description 2
- 235000012000 cholesterol Nutrition 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- NHADDZMCASKINP-HTRCEHHLSA-N decarboxydihydrocitrinin Natural products C1=C(O)C(C)=C2[C@H](C)[C@@H](C)OCC2=C1O NHADDZMCASKINP-HTRCEHHLSA-N 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000006911 enzymatic reaction Methods 0.000 description 2
- DCUNCZYCNWEUTO-GHRIWEEISA-N ethyl (e)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3h-1-benzofuran-2-yl)-2-methylpent-2-enoate Chemical compound C1=C(C(C)(C)C)C(OC(C)=O)=C(C(C)(C)C)C2=C1OC(CC/C=C(\C)C(=O)OCC)(C)C2 DCUNCZYCNWEUTO-GHRIWEEISA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 210000000497 foam cell Anatomy 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 2
- 238000005227 gel permeation chromatography Methods 0.000 description 2
- WCZSOHSGMBVYFW-UHFFFAOYSA-M heptyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCCCCC)C1=CC=CC=C1 WCZSOHSGMBVYFW-UHFFFAOYSA-M 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 210000002540 macrophage Anatomy 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 150000002829 nitrogen Chemical class 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 229940097156 peroxyl Drugs 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 235000019165 vitamin E Nutrition 0.000 description 2
- 229940046009 vitamin E Drugs 0.000 description 2
- 239000011709 vitamin E Substances 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- AGKKHPKPDRLQEM-UHFFFAOYSA-N (2,6-ditert-butyl-4-hydroxyphenyl) acetate (2,6-ditert-butyl-4-methoxyphenyl) acetate Chemical compound C(C)(=O)OC1=C(C=C(C=C1C(C)(C)C)OC)C(C)(C)C.C(C)(=O)OC1=C(C=C(C=C1C(C)(C)C)O)C(C)(C)C AGKKHPKPDRLQEM-UHFFFAOYSA-N 0.000 description 1
- GTKGUPGJCXOVIH-UHFFFAOYSA-N (2,6-ditert-butyl-4-methoxyphenyl) acetate Chemical compound COC1=CC(C(C)(C)C)=C(OC(C)=O)C(C(C)(C)C)=C1 GTKGUPGJCXOVIH-UHFFFAOYSA-N 0.000 description 1
- GDDAJHJRAKOILH-QFXXITGJSA-N (2e,5e)-octa-2,5-diene Chemical compound CC\C=C\C\C=C\C GDDAJHJRAKOILH-QFXXITGJSA-N 0.000 description 1
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 1
- RCPRJFSNFCAYII-UHFFFAOYSA-N 2,4,6-tritert-butyl-2,3-dihydro-1-benzofuran-5-ol Chemical compound C1=C(C(C)(C)C)C(O)=C(C(C)(C)C)C2=C1OC(C(C)(C)C)C2 RCPRJFSNFCAYII-UHFFFAOYSA-N 0.000 description 1
- XNKORVDIYOQTHA-UHFFFAOYSA-N 2,6-ditert-butyl-3-methyl-4-propoxyphenol Chemical compound CCCOC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1C XNKORVDIYOQTHA-UHFFFAOYSA-N 0.000 description 1
- NQYUFJSXPVRWHL-UHFFFAOYSA-N 2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxy-2-methylphenoxy)propoxy]-3-methylphenol Chemical compound C1=C(C(C)(C)C)C(O)=C(C(C)(C)C)C(C)=C1OCCCOC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1C NQYUFJSXPVRWHL-UHFFFAOYSA-N 0.000 description 1
- WMDHQEHPOVOEOG-UHFFFAOYSA-N 2-(2-bromoethyl)-1,3-dioxane Chemical compound BrCCC1OCCCO1 WMDHQEHPOVOEOG-UHFFFAOYSA-N 0.000 description 1
- DOFSDLCHFNDQRF-UHFFFAOYSA-N 2-bromo-6,10,14-trimethylpentadecane Chemical compound CC(C)CCCC(C)CCCC(C)CCCC(C)Br DOFSDLCHFNDQRF-UHFFFAOYSA-N 0.000 description 1
- ZTVIKZXZYLEVOL-DGKWVBSXSA-N 2-hydroxy-2-phenylacetic acid [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ester Chemical group C([C@H]1CC[C@@H](C2)N1C)C2OC(=O)C(O)C1=CC=CC=C1 ZTVIKZXZYLEVOL-DGKWVBSXSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- PWHHPOIUNAHINY-UHFFFAOYSA-N 3,5-ditert-butyl-2-methylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=C(C(C)(C)C)C(=O)C(C(C)(C)C)=CC1=O PWHHPOIUNAHINY-UHFFFAOYSA-N 0.000 description 1
- VTOQFOCYBTVOJZ-UHFFFAOYSA-N 3-bromopentane Chemical compound CCC(Br)CC VTOQFOCYBTVOJZ-UHFFFAOYSA-N 0.000 description 1
- FJIQORDEXCYALP-UHFFFAOYSA-N 4,6-ditert-butyl-2,2-bis(3-methylbutyl)-3h-1-benzofuran-5-ol Chemical compound C1=C(C(C)(C)C)C(O)=C(C(C)(C)C)C2=C1OC(CCC(C)C)(CCC(C)C)C2 FJIQORDEXCYALP-UHFFFAOYSA-N 0.000 description 1
- XRWOVTOOBYSHTG-UHFFFAOYSA-N 4,6-ditert-butyl-2,2-diethyl-3h-1-benzofuran-5-ol Chemical compound C1=C(C(C)(C)C)C(O)=C(C(C)(C)C)C2=C1OC(CC)(CC)C2 XRWOVTOOBYSHTG-UHFFFAOYSA-N 0.000 description 1
- GIUGSQPFGPYKAZ-UHFFFAOYSA-N 4,6-ditert-butyl-2,2-dimethyl-7-propyl-3h-1-benzofuran-5-ol Chemical compound OC1=C(C(C)(C)C)C(CCC)=C2OC(C)(C)CC2=C1C(C)(C)C GIUGSQPFGPYKAZ-UHFFFAOYSA-N 0.000 description 1
- HMPGJSDRRGJLDA-UHFFFAOYSA-N 4,6-ditert-butyl-2-methyl-2,3-dihydro-1-benzofuran-5-ol Chemical compound C1=C(C(C)(C)C)C(O)=C(C(C)(C)C)C2=C1OC(C)C2 HMPGJSDRRGJLDA-UHFFFAOYSA-N 0.000 description 1
- HIAAPFANDCASRO-UHFFFAOYSA-N 4,6-ditert-butyl-2-octyl-1-benzofuran-5-ol Chemical compound OC1=C(C(C)(C)C)C=C2OC(CCCCCCCC)=CC2=C1C(C)(C)C HIAAPFANDCASRO-UHFFFAOYSA-N 0.000 description 1
- JSWOAWAKGVVBJS-UHFFFAOYSA-N 4,6-ditert-butylspiro[3h-1-benzofuran-2,1'-cycloheptane]-5-ol Chemical compound C1C=2C(C(C)(C)C)=C(O)C(C(C)(C)C)=CC=2OC21CCCCCC2 JSWOAWAKGVVBJS-UHFFFAOYSA-N 0.000 description 1
- GIAVFPKZFUTDJT-UHFFFAOYSA-N 4-tert-butyl-1-benzofuran-5-ol Chemical compound CC(C)(C)C1=C(O)C=CC2=C1C=CO2 GIAVFPKZFUTDJT-UHFFFAOYSA-N 0.000 description 1
- DJRSGLVTWSQESU-UHFFFAOYSA-N 4-tert-butyl-2,3-dihydro-1-benzofuran-5-ol Chemical compound C1=C(O)C(C(C)(C)C)=C2CCOC2=C1 DJRSGLVTWSQESU-UHFFFAOYSA-N 0.000 description 1
- FGFICAYYSVAMGP-UHFFFAOYSA-N 4-tert-butyl-2-(chloromethyl)-2,3-dihydro-1-benzofuran-5-ol Chemical compound C1=C(O)C(C(C)(C)C)=C2CC(CCl)OC2=C1 FGFICAYYSVAMGP-UHFFFAOYSA-N 0.000 description 1
- BLZDMWJMFUYOLV-UHFFFAOYSA-N 4-tert-butyl-2-(hydroxymethyl)-2,3-dihydro-1-benzofuran-5-ol Chemical compound C1=C(O)C(C(C)(C)C)=C2CC(CO)OC2=C1 BLZDMWJMFUYOLV-UHFFFAOYSA-N 0.000 description 1
- SJJASOVRZAMDOP-UHFFFAOYSA-N 4-tert-butyl-2-oct-1-enyl-5-phenylmethoxy-1-benzofuran Chemical compound C=1C=C2OC(C=CCCCCCC)=CC2=C(C(C)(C)C)C=1OCC1=CC=CC=C1 SJJASOVRZAMDOP-UHFFFAOYSA-N 0.000 description 1
- AYRNAWGENWEONR-UHFFFAOYSA-N 4-tert-butyl-2-octyl-2,3-dihydro-1-benzofuran-5-ol Chemical compound C1=CC(O)=C(C(C)(C)C)C2=C1OC(CCCCCCCC)C2 AYRNAWGENWEONR-UHFFFAOYSA-N 0.000 description 1
- VYGALKFTVWDPBT-UHFFFAOYSA-N 4h-1,2-benzoxazine Chemical compound C1=CC=C2CC=NOC2=C1 VYGALKFTVWDPBT-UHFFFAOYSA-N 0.000 description 1
- FBHGRNXZRJOREO-UHFFFAOYSA-N 5-bromo-2,8-dimethylnonane Chemical compound CC(C)CCC(Br)CCC(C)C FBHGRNXZRJOREO-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- ZWPWSXGBDMGKKS-ZDUSSCGKSA-N Cypridina luciferin Chemical class C1=CC=C2C(C=3NC(CCCNC(N)=N)=C4N=C(C(N4C=3)=O)[C@@H](C)CC)=CNC2=C1 ZWPWSXGBDMGKKS-ZDUSSCGKSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102000000853 LDL receptors Human genes 0.000 description 1
- 108010001831 LDL receptors Proteins 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- NEFMTJVKRIGJLH-UHFFFAOYSA-N OC1=C(C=C(C=C1C(C)(C)C)OC)C(C)(C)C.C(C)(=O)OC1=C(C=C(C=C1C(C)(C)C)OC)C(C)(C)C Chemical compound OC1=C(C=C(C=C1C(C)(C)C)OC)C(C)(C)C.C(C)(=O)OC1=C(C=C(C=C1C(C)(C)C)OC)C(C)(C)C NEFMTJVKRIGJLH-UHFFFAOYSA-N 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- ZHFRLSJBQWEZQB-UHFFFAOYSA-N [2,6-ditert-butyl-4-(2-methylprop-2-enoxy)-3-propylphenyl] acetate Chemical compound CCCC1=C(OCC(C)=C)C=C(C(C)(C)C)C(OC(C)=O)=C1C(C)(C)C ZHFRLSJBQWEZQB-UHFFFAOYSA-N 0.000 description 1
- DJFANDMJDMYQFC-UHFFFAOYSA-N [3-(aminomethyl)-2,6-ditert-butyl-4-hydroxyphenyl] acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C(O)C(CN)=C1C(C)(C)C DJFANDMJDMYQFC-UHFFFAOYSA-N 0.000 description 1
- PNFYFRIMNGCDKC-UHFFFAOYSA-N [4,6-ditert-butyl-2-[2-(1,3-dioxolan-2-yl)ethyl]-2-methyl-3h-1-benzofuran-5-yl] acetate Chemical compound C1C2=C(C(C)(C)C)C(OC(=O)C)=C(C(C)(C)C)C=C2OC1(C)CCC1OCCO1 PNFYFRIMNGCDKC-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 230000000923 atherogenic effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 150000001840 cholesterol esters Chemical class 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000004914 cyclooctane Substances 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- KZENFXVDPUMQOE-UHFFFAOYSA-N ethyl 2-(triphenyl-$l^{5}-phosphanylidene)propanoate Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=C(C)C(=O)OCC)C1=CC=CC=C1 KZENFXVDPUMQOE-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 125000004030 farnesyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])C([H])([H])C([H])=C(C([H])([H])[H])C([H])([H])C([H])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000005558 fluorometry Methods 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 238000013467 fragmentation Methods 0.000 description 1
- 238000006062 fragmentation reaction Methods 0.000 description 1
- 125000002350 geranyl group Chemical group [H]C([*])([H])/C([H])=C(C([H])([H])[H])/C([H])([H])C([H])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 230000007654 ischemic lesion Effects 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- QYZFTMMPKCOTAN-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]-2-[[1-[2-(2-hydroxyethylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCCNCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCNCCO QYZFTMMPKCOTAN-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002900 organolithium compounds Chemical class 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 108010071584 oxidized low density lipoprotein Proteins 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- WTJKGGKOPKCXLL-RRHRGVEJSA-N phosphatidylcholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC WTJKGGKOPKCXLL-RRHRGVEJSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000010410 reperfusion Effects 0.000 description 1
- 102000014452 scavenger receptors Human genes 0.000 description 1
- 108010078070 scavenger receptors Proteins 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/20—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms
- C07C47/277—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/017—Esters of hydroxy compounds having the esterified hydroxy group bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/94—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom spiro-condensed with carbocyclic rings or ring systems, e.g. griseofulvins
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP32110192 | 1992-10-16 | ||
| JP321101/1992 | 1992-10-16 | ||
| PCT/JP1993/001489 WO1994008930A1 (fr) | 1992-10-16 | 1993-10-18 | DERIVE DE 4-ALCOXY-2,6-DI-t-BUTHYLPHENOL |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2147263A1 CA2147263A1 (en) | 1994-04-28 |
| CA2147263C true CA2147263C (en) | 2004-12-21 |
Family
ID=18128834
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002147263A Expired - Fee Related CA2147263C (en) | 1992-10-16 | 1993-10-18 | 4-alkoxy-2,6-di-t-butylphenol derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (3) | US5574178A (enExample) |
| EP (1) | EP0665208B1 (enExample) |
| KR (1) | KR100247213B1 (enExample) |
| CN (1) | CN1054128C (enExample) |
| AT (1) | ATE175658T1 (enExample) |
| AU (1) | AU6241894A (enExample) |
| CA (1) | CA2147263C (enExample) |
| DE (1) | DE69323090T2 (enExample) |
| DK (1) | DK0665208T3 (enExample) |
| ES (1) | ES2128440T3 (enExample) |
| GR (1) | GR3029810T3 (enExample) |
| SG (1) | SG49937A1 (enExample) |
| TW (1) | TW393475B (enExample) |
| WO (1) | WO1994008930A1 (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1995029906A1 (en) * | 1994-04-28 | 1995-11-09 | Meiji Milk Products Co., Ltd. | Benzofuran derivative and use thereof |
| US5674876A (en) * | 1995-01-20 | 1997-10-07 | Research Development Foundation | ρ-heteroatom-substituted phenols and uses thereof |
| EP0749972A1 (en) * | 1995-06-21 | 1996-12-27 | Merrell Pharmaceuticals Inc. | A process for preparing 1-(3-trialkylsilylphenyl)-2,2,2-trifluoromethyl ethanone derivatives |
| TW565558B (en) * | 1995-11-09 | 2003-12-11 | Chugai Pharmaceutical Co Ltd | Intimal thickening inhibitory agent |
| KR100383835B1 (ko) * | 1996-06-26 | 2003-08-27 | 쥬가이 세이야쿠 가부시키가이샤 | 신장질환치료제및장기보존제 |
| EP0942896B1 (en) * | 1996-11-20 | 2003-04-16 | Aventis Pharmaceuticals Inc. | Substituted phenols and thiophenols useful as antioxidant agents |
| US6114572A (en) * | 1996-11-20 | 2000-09-05 | Hoechst Marion Roussel, Inc. | Substituted phenols and thiophenols useful as antioxidant agents |
| US5679820A (en) * | 1996-12-16 | 1997-10-21 | General Electric Company | Silylated ultraviolet light absorbers having resistance to humidity |
| EP0982029A4 (en) * | 1997-05-08 | 2002-07-03 | Chugai Pharmaceutical Co Ltd | PREVENTIVE / MEDICINE FOR ARTERIOSCLEROSIS |
| TW472051B (en) * | 1997-05-23 | 2002-01-11 | Chugai Pharmaceutical Co Ltd | 2,3-dihydrobenzofuran derivatives |
| WO2000050029A1 (en) * | 1999-02-23 | 2000-08-31 | Chugai Seiyaku Kabushiki Kaisha | Seam soft capsule preparations containing dihydrobenzofuran derivative |
| DE19941595A1 (de) * | 1999-09-01 | 2001-03-08 | Basf Ag | Verwendung von anellierten Benzolderivaten als Antioxidans oder Radikalfänger in kosmetischen Zubereitungen |
| EP1304328A4 (en) * | 2000-07-19 | 2004-06-16 | Chugai Pharmaceutical Co Ltd | METHOD FOR PRODUCING A BENZOFURANE DERIVATIVE |
| US20040242678A1 (en) * | 2001-08-31 | 2004-12-02 | Shinji Yokoyama | Apolipo protein e secretion promoters |
| EP1490048A4 (en) * | 2002-03-29 | 2005-06-01 | Chugai Pharmaceutical Co Ltd | PHARMACEUTICAL COMPOSITION FOR THE PREVENTION OR TREATMENT OF RESPIRATORY DISEASES |
| US6882245B2 (en) * | 2002-06-05 | 2005-04-19 | Rf Stream Corporation | Frequency discrete LC filter bank |
| US20070066681A1 (en) * | 2003-09-26 | 2007-03-22 | Chugai Seiyaku Kaushiki Kaisha | Pharmaceutical composition for treating fatty liver or hepatic disease |
| CN110940747B (zh) * | 2019-12-03 | 2022-06-28 | 酒泉市食品检验检测中心 | 一种马铃薯及其制品中α-茄碱和α-卡茄碱的测定方法 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH085871B2 (ja) * | 1986-12-27 | 1996-01-24 | 武田薬品工業株式会社 | クマラン誘導体およびその製造法 |
| DE3777366D1 (de) * | 1986-12-27 | 1992-04-16 | Takeda Chemical Industries Ltd | 2,3-dihydro-cumaron-derivate, ihre herstellung und verwendung. |
| JP2855341B2 (ja) * | 1988-06-10 | 1999-02-10 | 武田薬品工業株式会社 | 新規2―置換クマラン誘導体 |
| JP2855340B2 (ja) * | 1988-06-10 | 1999-02-10 | 武田薬品工業株式会社 | 2―置換クマラン誘導体 |
| IT1229482B (it) * | 1988-08-01 | 1991-09-03 | Foscama Biomed Chim Farma | Acidi (rs) 2 (2,3 diidro 5 idrossi 4,6,7 trimetilbenzofuranil) acetico e 2 (2,3 diidro 5 acilossi 4,6,7 trimetilbenzofuranil) acetici e loro esteri, utili come farmaci mucoregolatori ed antiischemici. |
| US4966907A (en) * | 1988-08-12 | 1990-10-30 | Merck & Co., Inc. | 6-substituted 5-hydroxy-2,3-dihydrobenzofurans as inhibitors of leukotriene biosynthesis |
| JPH02121975A (ja) * | 1988-10-28 | 1990-05-09 | Eisai Co Ltd | 2,3−ジヒドロベンゾフラン誘導体 |
| US5091533A (en) * | 1990-03-12 | 1992-02-25 | Merck Frosst Canada, Inc. | 5-hydroxy-2,3-dihydrobenzofuran analogs as leukotriene biosynthesis inhibitors |
| DE4109627A1 (de) * | 1991-03-23 | 1992-09-24 | Boehringer Mannheim Gmbh | Neue phenolether, verfahren zu ihrer herstellung und arzneimittel, die diese verbindungen enthalten |
| JPH04300878A (ja) * | 1991-03-28 | 1992-10-23 | Fujirebio Inc | ベンゼンジオール誘導体 |
| CA2124086A1 (en) * | 1991-11-22 | 1993-05-27 | Ronald H. Lane | Tocotrienols and tocotrienol-like compounds and methods for their use |
| JP3150740B2 (ja) * | 1991-12-26 | 2001-03-26 | エーザイ株式会社 | ジヒドロベンゾフラン誘導体 |
| FI944655A0 (fi) * | 1992-04-06 | 1994-10-05 | Merrell Dow Pharma | Uudet 2,3-dihydro-2,2,4,6,7-penta-alkyyli-5-bentsofuranolit |
-
1993
- 1993-10-15 TW TW082108556A patent/TW393475B/zh not_active IP Right Cessation
- 1993-10-16 CN CN93120400A patent/CN1054128C/zh not_active Expired - Fee Related
- 1993-10-16 SG SG1996009546A patent/SG49937A1/en unknown
- 1993-10-18 AT AT93922643T patent/ATE175658T1/de not_active IP Right Cessation
- 1993-10-18 AU AU62418/94A patent/AU6241894A/en not_active Abandoned
- 1993-10-18 ES ES93922643T patent/ES2128440T3/es not_active Expired - Lifetime
- 1993-10-18 WO PCT/JP1993/001489 patent/WO1994008930A1/ja not_active Ceased
- 1993-10-18 CA CA002147263A patent/CA2147263C/en not_active Expired - Fee Related
- 1993-10-18 DK DK93922643T patent/DK0665208T3/da active
- 1993-10-18 US US08/416,862 patent/US5574178A/en not_active Expired - Fee Related
- 1993-10-18 EP EP93922643A patent/EP0665208B1/en not_active Expired - Lifetime
- 1993-10-18 DE DE69323090T patent/DE69323090T2/de not_active Expired - Fee Related
- 1993-10-18 KR KR1019950701454A patent/KR100247213B1/ko not_active Expired - Fee Related
-
1995
- 1995-05-18 US US08/444,055 patent/US5606089A/en not_active Expired - Fee Related
-
1996
- 1996-08-21 US US08/700,834 patent/US5663373A/en not_active Expired - Fee Related
-
1999
- 1999-03-29 GR GR990400900T patent/GR3029810T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US5606089A (en) | 1997-02-25 |
| CN1112115A (zh) | 1995-11-22 |
| DE69323090D1 (de) | 1999-02-25 |
| EP0665208B1 (en) | 1999-01-13 |
| KR100247213B1 (ko) | 2000-03-15 |
| ES2128440T3 (es) | 1999-05-16 |
| US5574178A (en) | 1996-11-12 |
| DE69323090T2 (de) | 2000-01-27 |
| SG49937A1 (en) | 1998-06-15 |
| CA2147263A1 (en) | 1994-04-28 |
| DK0665208T3 (da) | 1999-08-30 |
| CN1054128C (zh) | 2000-07-05 |
| TW393475B (en) | 2000-06-11 |
| KR950703503A (ko) | 1995-09-20 |
| EP0665208A4 (enExample) | 1995-08-23 |
| EP0665208A1 (en) | 1995-08-02 |
| WO1994008930A1 (fr) | 1994-04-28 |
| GR3029810T3 (en) | 1999-06-30 |
| ATE175658T1 (de) | 1999-01-15 |
| US5663373A (en) | 1997-09-02 |
| AU6241894A (en) | 1994-05-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2147263C (en) | 4-alkoxy-2,6-di-t-butylphenol derivatives | |
| EP2861554B1 (en) | Improved process for the preparation of treprostinil and derivatives thereof | |
| WO2020031179A1 (en) | Methods for synthesis of cannabinoid compounds | |
| EP2595977A1 (fr) | Procede de preparation de derives de benzofurane substitues en position 5 | |
| KR0124802B1 (ko) | 벤조피란 및 관련 ltb₄ 길항물질 | |
| JP3050733B2 (ja) | 4−アルコキシ−2,6−ジ−t−ブチルフェノール誘導体 | |
| US5789436A (en) | 4,6 Di-t-butyl-5-hydroxy-2,3-dihydrobenzothiophene | |
| Bajwa et al. | Regiospecific O-alkylation of δ-tetronic acids under mitsunobu-reaction conditions | |
| TWI710550B (zh) | 魯比前列酮(lubiprostone)之製備方法及其中間物 | |
| US4395561A (en) | Synthesis of 3-hydroxyoxetane | |
| CA2187315C (en) | 4,6-di-t-butyl-2,3-dihydrobenzothiophene derivatives | |
| JP3848387B2 (ja) | 4,6−ジ−t−ブチル−2,3−ジヒドロベンゾチオフェン誘導体 | |
| US4021425A (en) | Process for producing enone intermediates | |
| EP1072582B1 (en) | Intermediate for synthesis of a ring part of vitamin d derivatives having a substituent at 2-position | |
| Hendrickson et al. | Methylation of polysubstituted electron-rich aromatics and their Birch reduction | |
| JPS6388173A (ja) | 2,3−ジヒドロベンゾフラン誘導体 | |
| JP2587705B2 (ja) | 4―デソキシ―4―エピポドフィロトキシン誘導体 | |
| KR870002016B1 (ko) | 치환된 스티렌 유도체의 제조방법 | |
| JP2675569B2 (ja) | 2,3−ジヒドロベンゾフラン誘導体の製造方法 | |
| Goering et al. | Preparation and determination of absolute configurations and rotations of 1, 2-dimethyl-5-norbornen-2-yl derivatives | |
| JPH037673B2 (enExample) | ||
| EP0152003B1 (en) | Process for the preparation of alpha-hydroxyaryl-alkanoic acids | |
| Rodriguez et al. | Intermolecular silyl migration reactions | |
| JPH08127579A (ja) | 5,7−ジ−t−ブチル−2H−3,4−ジヒドロベンゾ[b]ピラン誘導体 | |
| JPH0326188B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |