CA1174682A - Active compounds - Google Patents
Active compoundsInfo
- Publication number
- CA1174682A CA1174682A CA000412049A CA412049A CA1174682A CA 1174682 A CA1174682 A CA 1174682A CA 000412049 A CA000412049 A CA 000412049A CA 412049 A CA412049 A CA 412049A CA 1174682 A CA1174682 A CA 1174682A
- Authority
- CA
- Canada
- Prior art keywords
- dihydro
- dimethyl
- benzo
- pyran
- trans
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 104
- 239000001257 hydrogen Substances 0.000 claims abstract description 60
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 60
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 59
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 56
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 52
- -1 alkylhydroxymethyl Chemical group 0.000 claims abstract description 19
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 16
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 13
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims abstract description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 10
- 125000002252 acyl group Chemical group 0.000 claims abstract description 7
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims abstract description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 6
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 5
- 150000003951 lactams Chemical group 0.000 claims abstract description 4
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims abstract description 3
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims abstract description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 3
- 125000005469 ethylenyl group Chemical group 0.000 claims abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims abstract 2
- 238000000034 method Methods 0.000 claims description 54
- 150000003839 salts Chemical class 0.000 claims description 53
- 230000008569 process Effects 0.000 claims description 52
- 125000004429 atom Chemical group 0.000 claims description 44
- 238000002360 preparation method Methods 0.000 claims description 27
- 125000001424 substituent group Chemical group 0.000 claims description 23
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 239000007787 solid Substances 0.000 claims description 14
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 claims description 11
- 239000002168 alkylating agent Substances 0.000 claims description 10
- 229940100198 alkylating agent Drugs 0.000 claims description 10
- 230000002152 alkylating effect Effects 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 claims description 6
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 claims description 6
- CXVQSUBJMYZELD-UHFFFAOYSA-N ethyl 4-aminobutanoate;hydrochloride Chemical compound [Cl-].CCOC(=O)CCC[NH3+] CXVQSUBJMYZELD-UHFFFAOYSA-N 0.000 claims description 5
- 150000001450 anions Chemical class 0.000 claims description 3
- 229960003692 gamma aminobutyric acid Drugs 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims 13
- TVZCRIROJQEVOT-CABCVRRESA-N Cromakalim Chemical compound N1([C@@H]2C3=CC(=CC=C3OC([C@H]2O)(C)C)C#N)CCCC1=O TVZCRIROJQEVOT-CABCVRRESA-N 0.000 claims 9
- HCYIWPLDKSWKGY-UHFFFAOYSA-N 2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-carbonitrile Chemical compound CC1(C)OC2=CC=C(C#N)C=C2C2C1O2 HCYIWPLDKSWKGY-UHFFFAOYSA-N 0.000 claims 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims 3
- AISUZMDUJWZBSW-DMJDIKPUSA-N (3s,4r)-3-hydroxy-4-(2-hydroxypyrrolidin-1-yl)-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile Chemical compound N1([C@@H]2C3=CC(=CC=C3OC([C@H]2O)(C)C)C#N)CCCC1O AISUZMDUJWZBSW-DMJDIKPUSA-N 0.000 claims 2
- HHPHMEFAEUXBAX-UHFFFAOYSA-N 1-(2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromen-6-yl)ethanone Chemical compound O1C(C)(C)C2OC2C2=CC(C(=O)C)=CC=C21 HHPHMEFAEUXBAX-UHFFFAOYSA-N 0.000 claims 2
- KLUMRFDKRSYNGF-SJORKVTESA-N 1-[(3s,4r)-6-acetyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperidin-2-one Chemical compound N1([C@H]2[C@H](O)C(C)(C)OC3=CC=C(C=C32)C(=O)C)CCCCC1=O KLUMRFDKRSYNGF-SJORKVTESA-N 0.000 claims 2
- CWNDIXOXRUSATL-CVEARBPZSA-N 1-[(3s,4r)-6-acetyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one Chemical compound N1([C@H]2[C@H](O)C(C)(C)OC3=CC=C(C=C32)C(=O)C)CCCC1=O CWNDIXOXRUSATL-CVEARBPZSA-N 0.000 claims 2
- DKBATQOPZPZAEX-KGLIPLIRSA-N 1-[(3s,4r)-6-chloro-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyrrolidin-2-one Chemical compound N1([C@@H]2C3=CC(Cl)=CC=C3OC([C@H]2O)(C)C)CCCC1=O DKBATQOPZPZAEX-KGLIPLIRSA-N 0.000 claims 2
- WDEPLOPOUPCKDZ-CABCVRRESA-N 4-chloro-n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]butanamide Chemical compound C1=C(C#N)C=C2[C@@H](NC(=O)CCCCl)[C@H](O)C(C)(C)OC2=C1 WDEPLOPOUPCKDZ-CABCVRRESA-N 0.000 claims 2
- MUCIVWGGWJZCBJ-SJORKVTESA-N [(3s,4r)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] acetate Chemical compound N1([C@H]2[C@@H](C(OC3=CC=C(C=C32)C#N)(C)C)OC(=O)C)CCCC1=O MUCIVWGGWJZCBJ-SJORKVTESA-N 0.000 claims 2
- NIOZJBQWSPFQDN-CABCVRRESA-N methyl (3s,4r)-3-hydroxy-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromene-6-carboxylate Chemical compound N1([C@H]2[C@H](O)C(C)(C)OC3=CC=C(C=C32)C(=O)OC)CCCC1=O NIOZJBQWSPFQDN-CABCVRRESA-N 0.000 claims 2
- IEKDJVUNXSQUHG-CVEARBPZSA-N (3s,4r)-3-hydroxy-2,2-dimethyl-4-(2-oxopiperidin-1-yl)-3,4-dihydrochromene-6-carbonitrile Chemical compound N1([C@@H]2C3=CC(=CC=C3OC([C@H]2O)(C)C)C#N)CCCCC1=O IEKDJVUNXSQUHG-CVEARBPZSA-N 0.000 claims 1
- VGRHXYRYQCVELV-KGLIPLIRSA-N 1-[(3s,4r)-3-hydroxy-2,2-dimethyl-7-nitro-3,4-dihydrochromen-4-yl]pyrrolidin-2-one Chemical compound N1([C@@H]2C3=CC=C(C=C3OC([C@H]2O)(C)C)[N+]([O-])=O)CCCC1=O VGRHXYRYQCVELV-KGLIPLIRSA-N 0.000 claims 1
- NDIVLDNITQYABM-UHFFFAOYSA-N 6-chloro-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene Chemical compound CC1(C)OC2=CC=C(Cl)C=C2C2C1O2 NDIVLDNITQYABM-UHFFFAOYSA-N 0.000 claims 1
- REQONFNGOLSTKR-CVEARBPZSA-N ethyl 4-[[(3s,4r)-3-hydroxy-2,2-dimethyl-7-nitro-3,4-dihydrochromen-4-yl]amino]butanoate Chemical compound [O-][N+](=O)C1=CC=C2[C@@H](NCCCC(=O)OCC)[C@H](O)C(C)(C)OC2=C1 REQONFNGOLSTKR-CVEARBPZSA-N 0.000 claims 1
- VZWFLKDQNQFXCO-CVEARBPZSA-N methyl (3s,4r)-3-hydroxy-2,2-dimethyl-4-(2-oxopiperidin-1-yl)-3,4-dihydrochromene-6-carboxylate Chemical compound N1([C@H]2[C@H](O)C(C)(C)OC3=CC=C(C=C32)C(=O)OC)CCCCC1=O VZWFLKDQNQFXCO-CVEARBPZSA-N 0.000 claims 1
- APMKKPHGMDRZAF-UHFFFAOYSA-N methyl 2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-carboxylate Chemical compound O1C(C)(C)C2OC2C2=CC(C(=O)OC)=CC=C21 APMKKPHGMDRZAF-UHFFFAOYSA-N 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- 206010020772 Hypertension Diseases 0.000 abstract description 6
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 5
- 125000004644 alkyl sulfinyl group Chemical group 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 54
- 238000006243 chemical reaction Methods 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- 239000002904 solvent Substances 0.000 description 20
- 239000000203 mixture Substances 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- 238000001704 evaporation Methods 0.000 description 14
- 230000008020 evaporation Effects 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 101150041968 CDC13 gene Proteins 0.000 description 10
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 8
- 238000001035 drying Methods 0.000 description 8
- 230000036772 blood pressure Effects 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 238000000605 extraction Methods 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 150000002924 oxiranes Chemical class 0.000 description 6
- 239000008188 pellet Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- KDKYADYSIPSCCQ-UHFFFAOYSA-N but-1-yne Chemical compound CCC#C KDKYADYSIPSCCQ-UHFFFAOYSA-N 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 239000012038 nucleophile Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 230000009102 absorption Effects 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- QVDYYQXUNAQSNI-UHFFFAOYSA-N ethyl acetate;pentane Chemical compound CCCCC.CCOC(C)=O QVDYYQXUNAQSNI-UHFFFAOYSA-N 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000003223 protective agent Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- CNXYPUUAPXKSBM-UHFFFAOYSA-N 8ah-chromen-3-ol Chemical compound C1=CC=CC2=CC(O)=COC21 CNXYPUUAPXKSBM-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 150000001562 benzopyrans Chemical class 0.000 description 2
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000006575 electron-withdrawing group Chemical group 0.000 description 2
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 230000001631 hypertensive effect Effects 0.000 description 2
- 230000001788 irregular Effects 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- YRRGBHWYSKWFDX-UHFFFAOYSA-N n,n-diethylethanamine;ethyl acetate;heptane Chemical compound CCOC(C)=O.CCCCCCC.CCN(CC)CC YRRGBHWYSKWFDX-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- ASGMFNBUXDJWJJ-JLCFBVMHSA-N (1R,3R)-3-[[3-bromo-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-yl]amino]-N,1-dimethylcyclopentane-1-carboxamide Chemical compound BrC1=NN(C2=NC(=NC=C21)N[C@H]1C[C@@](CC1)(C(=O)NC)C)C1=CC=C(C=C1)C=1SC(=NN=1)C ASGMFNBUXDJWJJ-JLCFBVMHSA-N 0.000 description 1
- MLIWQXBKMZNZNF-KUHOPJCQSA-N (2e)-2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one Chemical compound O=C1\C(=C\C=2C=CC(=CC=2)N=[N+]=[N-])CC(C)CC1=CC1=CC=C(N=[N+]=[N-])C=C1 MLIWQXBKMZNZNF-KUHOPJCQSA-N 0.000 description 1
- 125000004755 (C2-C7) acylamino group Chemical group 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- HJKLEAOXCZIMPI-UHFFFAOYSA-N 2,2-diethoxyethanamine Chemical compound CCOC(CN)OCC HJKLEAOXCZIMPI-UHFFFAOYSA-N 0.000 description 1
- XPKQHJJKXONCHR-UHFFFAOYSA-N 2-amino-3,4-dihydrochromen-2-ol Chemical compound C1=CC=C2OC(N)(O)CCC2=C1 XPKQHJJKXONCHR-UHFFFAOYSA-N 0.000 description 1
- YHAIJGCMZJJHMH-UHFFFAOYSA-N 2-methyl-2,7b-dihydro-1ah-oxireno[2,3-c]chromene Chemical compound CC1OC2=CC=CC=C2C2C1O2 YHAIJGCMZJJHMH-UHFFFAOYSA-N 0.000 description 1
- BLZYZFVJHYTMKP-UHFFFAOYSA-N 2-methyl-6-nitro-2h-chromene Chemical compound C1=C([N+]([O-])=O)C=C2C=CC(C)OC2=C1 BLZYZFVJHYTMKP-UHFFFAOYSA-N 0.000 description 1
- WXCFKIXCYRQSOT-UHFFFAOYSA-N 2h-chromene-6-carbonitrile Chemical class O1CC=CC2=CC(C#N)=CC=C21 WXCFKIXCYRQSOT-UHFFFAOYSA-N 0.000 description 1
- PYJVGTWBTIEAMV-UHFFFAOYSA-N 3-bromobut-1-yne Chemical compound CC(Br)C#C PYJVGTWBTIEAMV-UHFFFAOYSA-N 0.000 description 1
- QSILYWCNPOLKPN-UHFFFAOYSA-N 3-chloro-3-methylbut-1-yne Chemical compound CC(C)(Cl)C#C QSILYWCNPOLKPN-UHFFFAOYSA-N 0.000 description 1
- DZQLQEYLEYWJIB-UHFFFAOYSA-N 4-aminobutanal Chemical compound NCCCC=O DZQLQEYLEYWJIB-UHFFFAOYSA-N 0.000 description 1
- CDIIZULDSLKBKV-UHFFFAOYSA-N 4-chlorobutanoyl chloride Chemical compound ClCCCC(Cl)=O CDIIZULDSLKBKV-UHFFFAOYSA-N 0.000 description 1
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- ZOEGTCHMBZBJPL-UHFFFAOYSA-N 8ah-chromene Chemical compound C1=CC=CC2OC=CC=C21 ZOEGTCHMBZBJPL-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical compound C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 description 1
- GHIGJPPVXZCAAT-UHFFFAOYSA-N C(C)N(CC)CC.CCCCCCC.C(C)(=O)O Chemical compound C(C)N(CC)CC.CCCCCCC.C(C)(=O)O GHIGJPPVXZCAAT-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229940127007 Compound 39 Drugs 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 244000137850 Marrubium vulgare Species 0.000 description 1
- 229910003827 NRaRb Inorganic materials 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- FHNINJWBTRXEBC-UHFFFAOYSA-N Sudan III Chemical compound OC1=CC=C2C=CC=CC2=C1N=NC(C=C1)=CC=C1N=NC1=CC=CC=C1 FHNINJWBTRXEBC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 229910052736 halogen Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000716 hydrazinylidene group Chemical group [*]=NN([H])[H] 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical class [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000452 restraining effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
- C07D311/68—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4 with nitrogen atoms directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
- C07D311/70—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4 with two hydrocarbon radicals attached in position 2 and elements other than carbon and hydrogen in position 6
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Heart & Thoracic Surgery (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrane Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Compounds Of Unknown Constitution (AREA)
- Medicinal Preparation (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Saccharide Compounds (AREA)
- Glass Compositions (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8129064 | 1981-09-25 | ||
| GB8129064 | 1981-09-25 | ||
| GB8206400 | 1982-03-04 | ||
| GB8206400 | 1982-03-04 | ||
| GB8210490 | 1982-04-08 | ||
| GB8210490 | 1982-04-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1174682A true CA1174682A (en) | 1984-09-18 |
Family
ID=27261315
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000412049A Expired CA1174682A (en) | 1981-09-25 | 1982-09-23 | Active compounds |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4446113A (enFirst) |
| EP (1) | EP0076075B1 (enFirst) |
| JP (4) | JPH0314573A (enFirst) |
| KR (1) | KR880001943B1 (enFirst) |
| AT (1) | ATE23718T1 (enFirst) |
| AU (1) | AU561536B2 (enFirst) |
| CA (1) | CA1174682A (enFirst) |
| DE (1) | DE3274350D1 (enFirst) |
| DK (1) | DK170165B1 (enFirst) |
| ES (4) | ES515921A0 (enFirst) |
| FI (1) | FI73675C (enFirst) |
| GB (1) | GB2107706A (enFirst) |
| GR (1) | GR76732B (enFirst) |
| HK (1) | HK17588A (enFirst) |
| IE (1) | IE53875B1 (enFirst) |
| MX (3) | MX174532B (enFirst) |
| MY (1) | MY102061A (enFirst) |
| NO (4) | NO159597C (enFirst) |
| NZ (1) | NZ201984A (enFirst) |
| PH (1) | PH18691A (enFirst) |
| PL (4) | PL141135B1 (enFirst) |
| PT (1) | PT75598B (enFirst) |
| SG (1) | SG98587G (enFirst) |
| YU (4) | YU43279B (enFirst) |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ183551A (en) * | 1976-04-02 | 1978-09-20 | Beecham Group Ltd | Aminochromanols and pharmaceutical compositions containingthem |
| EP0091748B1 (en) * | 1982-04-08 | 1986-06-18 | Beecham Group Plc | Antihypertensive benzopyranols |
| DE3368629D1 (en) * | 1982-04-28 | 1987-02-05 | Beecham Group Plc | Novel chromenes and chromans |
| EP0093534A1 (en) * | 1982-04-28 | 1983-11-09 | Beecham Group Plc | Novel chromanols |
| EP0095316B1 (en) * | 1982-05-21 | 1986-12-03 | Beecham Group Plc | Pharmaceutically active aminobenzopyrans |
| DE3364734D1 (en) * | 1982-10-19 | 1986-08-28 | Beecham Group Plc | Novel chromans and chromenes |
| GB8308064D0 (en) * | 1983-03-24 | 1983-05-05 | Beecham Group Plc | Active compounds |
| GB8308063D0 (en) * | 1983-03-24 | 1983-05-05 | Beecham Group Plc | Active compounds |
| GB8308062D0 (en) * | 1983-03-24 | 1983-05-05 | Beecham Group Plc | Active compounds |
| DE3486354T2 (de) * | 1983-05-18 | 1995-03-30 | Beecham Group Plc | Chroman- und Chromenderivate. |
| EP0126311B1 (en) * | 1983-05-18 | 1989-09-13 | Beecham Group Plc | Benzopyran derivatives. |
| GB8313679D0 (en) * | 1983-05-18 | 1983-06-22 | Beecham Group Plc | Active compounds |
| EP0150202B1 (en) * | 1983-07-27 | 1988-07-06 | Beecham Group Plc | Di/tetra-hydroquinolines |
| DE3475786D1 (de) * | 1983-09-01 | 1989-02-02 | Beecham Group Plc | Chromanol derivatives |
| EP0138134B1 (en) * | 1983-10-13 | 1989-04-19 | Beecham Group Plc | Chroman derivatives |
| GB8409745D0 (en) * | 1984-04-14 | 1984-05-23 | Beecham Group Plc | Active compounds |
| GB8413191D0 (en) * | 1984-05-23 | 1984-06-27 | Beecham Group Plc | Pharmaceutical composition |
| EP0172352B1 (en) * | 1984-06-22 | 1990-08-29 | Beecham Group Plc | Active benzopyran compounds |
| GB8419515D0 (en) * | 1984-07-31 | 1984-09-05 | Beecham Group Plc | Treatment |
| GB8419516D0 (en) * | 1984-07-31 | 1984-09-05 | Beecham Group Plc | Treatment |
| GB8513369D0 (en) * | 1985-05-28 | 1985-07-03 | Beecham Group Plc | Treatment |
| DE3682331D1 (de) | 1985-06-08 | 1991-12-12 | Beecham Group Plc | Pyrano(3,2-c)pyridinderivate, verfahren und zwischenprodukte zu ihrer herstellung und diese enthaltende pharmazeutische zubereitungen. |
| EP0218373B1 (en) * | 1985-09-11 | 1990-03-07 | Beecham Group Plc | Chroman derivatives and analogues having antihypertensive activity |
| PT84806B (pt) * | 1986-05-03 | 1989-12-29 | Beecham Group Plc | Processo para a preparacao de benzopiranos |
| DE3777656D1 (de) * | 1986-08-08 | 1992-04-23 | Upjohn Co | Mittel zur behandlung von alopezien. |
| US4801605A (en) * | 1986-08-29 | 1989-01-31 | Ciba-Geigy Corporation | 3-amino-dihydro-[1]-benzopyrans and benzothiopyrans |
| GB8625185D0 (en) * | 1986-10-21 | 1986-11-26 | Beecham Group Plc | Active compounds |
| DE3726261A1 (de) * | 1986-12-23 | 1988-07-07 | Merck Patent Gmbh | Chromanderivate |
| EP0277611B1 (de) * | 1987-02-04 | 1993-06-16 | Hoechst Aktiengesellschaft | Alkylsubstituierte N-Benzopyranyllactame, Verfahren zu ihrer Herstellung, ihre Verwendung sowie pharmazeutische Präparate auf Basis dieser Verbindungen |
| DE3703227A1 (de) * | 1987-02-04 | 1988-08-18 | Hoechst Ag | Substituierte 3,4-dihydro-2h-benzopyrane, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen |
| FR2628424B1 (fr) * | 1988-03-09 | 1990-12-28 | Sanofi Sa | Derives du dimethyl-2,2 chromannol-3 procede d'obtention et compositions pharmaceutiques en contenant |
| FR2625744B1 (fr) * | 1988-01-12 | 1990-07-06 | Sanofi Sa | Derives du dimethyl-2,2 chromannol-3 procede d'obtention et compositions pharmaceutiques en contenant |
| US5284838A (en) * | 1987-06-23 | 1994-02-08 | Elf Sanofi | Use of 2,2-dimethylchroman-3-ol derivatives in the treatment of asthma |
| FR2617165B1 (fr) * | 1987-06-23 | 1989-12-15 | Sanofi Sa | Derives du dimethyl-2, 2 chromannol-3 |
| FI90343C (fi) * | 1987-06-23 | 1994-01-25 | Merck Patent Gmbh | Menetelmä korkeaa verenpainetta alentavien ja rytmihäiriöitä vastustavien trans-2,2-dimetyylikroman-3-olijohdannaisten valmistamiseksi |
| US4971982A (en) * | 1987-07-06 | 1990-11-20 | Hoffmann-La Roche Inc. | Benzopyran derivatives |
| FR2621587B1 (fr) * | 1987-10-12 | 1990-02-09 | Sanofi Sa | Derives du dimethyl-2,2 chromene, procede pour leur preparation et composition pharmaceutiques les contenant |
| IL88035A0 (en) * | 1987-10-27 | 1989-06-30 | American Home Prod | Benzopyran derivatives,their preparation and pharmaceutical compositions containing them |
| GB8800199D0 (en) * | 1988-01-06 | 1988-02-10 | Beecham Group Plc | Pharmaceutical preparation |
| DE3811017A1 (de) * | 1988-03-31 | 1989-10-19 | Hoechst Ag | Ungesaettigte n-benzopyranyllactame |
| US5021432A (en) * | 1988-04-26 | 1991-06-04 | Yoshitomi Pharmaceutical Industries, Ltd. | Benzopyran compound and its pharmaceutical use |
| AU628331B2 (en) * | 1988-05-06 | 1992-09-17 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Chroman derivatives |
| WO1989010757A1 (en) * | 1988-05-10 | 1989-11-16 | Leo Pharmaceutical Products Ltd. A/S (Løvens Kemis | New ophthalmic preparation for treating glaucoma |
| DE3818245A1 (de) * | 1988-05-28 | 1989-12-07 | Hoechst Ag | Kombination von angiotensin-converting-enzyme-hemmern mit kaliumkanal-modulatoren sowie deren verwendung in arzneimitteln |
| US4988723A (en) * | 1988-06-02 | 1991-01-29 | Fujisawa Pharmaceutical Co., Ltd. | Benzopyran derivatives and their use as anti-hypertensives |
| EP0346724A1 (de) * | 1988-06-16 | 1989-12-20 | MERCK PATENT GmbH | Chromanderivate |
| DE3823533A1 (de) * | 1988-07-12 | 1990-02-08 | Beiersdorf Ag | Substituierte 4-heterocyclyl-2h-benzo(b)pyrane, verfahren und 4-hydroxy-3-brom-, 3,4-oxiranyl-3,4-dehydro-2h-benzo(b)pyrane als zwischenprodukte zu ihrer herstellung, sowie sie enthaltende pharmazeutsche praeparate |
| DE3827532A1 (de) * | 1988-08-13 | 1990-03-01 | Hoechst Ag | 6-aroyl-substituierte 3,4-dihydro-2h-benzopyrane, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen |
| US5194442A (en) * | 1988-09-17 | 1993-03-16 | Hoechst Aktiengesellschaft | 2,3,4,5-tetrahydro-1-benzoxepins, the use thereof and pharmaceutical products based on these compounds |
| US4992465A (en) * | 1988-09-27 | 1991-02-12 | Ciba-Geigy Corporation | 3-amino-dihydro-(1)-benzopyrans |
| DE3837809A1 (de) * | 1988-11-08 | 1990-05-10 | Merck Patent Gmbh | Tetralinderivate |
| FR2639227A1 (fr) * | 1988-11-23 | 1990-05-25 | Sanofi Sa | Utilisation de derives du chromane pour le traitement des etats depressifs |
| ES2071668T3 (es) * | 1988-12-13 | 1995-07-01 | Beecham Group Plc | Benzopirano y compuestos relacionados. |
| DE3901720A1 (de) * | 1989-01-21 | 1990-07-26 | Hoechst Ag | Substituierte benzo(b)pyrane, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen |
| GB8902118D0 (en) * | 1989-02-01 | 1989-03-22 | Beecham Group Plc | Chemical process |
| US5239090A (en) * | 1989-02-01 | 1993-08-24 | Beecham Group P.L.C. | Certain optically active 3,4-dihydrobenzopyran-4-ols which are intermediates |
| US5162553A (en) * | 1989-03-03 | 1992-11-10 | Yoshitomi Pharmaceutical Industries, Ltd. | Processes for preparing optically active 3,4-dihydro-3,4-epoxy-2H-1-benzopyran compounds and intermediates therefor |
| US5066816A (en) * | 1989-03-03 | 1991-11-19 | Yoshitomi Pharmaceutical Industries, Ltd. | Processes for preparing optically active 3,4-dihydro-3,4-epoxy-2h-1-benzopyran compounds and intermediates therefor |
| DE3918041A1 (de) * | 1989-06-02 | 1990-12-06 | Merck Patent Gmbh | Chromanderivate |
| IE63935B1 (en) | 1989-06-27 | 1995-06-28 | Chem Pharm Forsch Gmbh | Novel thienopyran derivatives a process for their preparation and their use |
| DE3922392A1 (de) | 1989-07-07 | 1991-01-17 | Merck Patent Gmbh | Chromanderivate |
| DE3923839A1 (de) * | 1989-07-19 | 1991-01-31 | Beiersdorf Ag | Benzopyran-derivate, verfahren zu ihrer herstellung und ihre verwendung sowie die verbindungen enthaltende zubereitungen |
| US5223629A (en) * | 1989-07-21 | 1993-06-29 | Alkaloida Vegyeszeti Gyar | Process for the preparation of anti-hypertensive benzopyran |
| HU207861B (en) * | 1989-07-21 | 1993-06-28 | Alkaloida Vegyeszeti Gyar | Process for producing benzopirane derivative of blood pressure lowering activity |
| DE3926001A1 (de) * | 1989-08-05 | 1991-02-07 | Merck Patent Gmbh | Chromanderivate |
| US5254555A (en) * | 1989-10-30 | 1993-10-19 | Beecham Group P.L.C. | Amino pyrimidin-7-yl substituted benzopyrans for treatment of hypertension |
| GB8924373D0 (en) * | 1989-10-30 | 1989-12-20 | Beecham Group Plc | Novel compounds |
| TW224941B (enFirst) * | 1989-11-08 | 1994-06-11 | Yamanouchi Pharma Co Ltd | |
| EP0430621A3 (en) * | 1989-11-29 | 1992-03-04 | Beecham Group P.L.C. | Process for the preparation of chiral 3,4-epoxy benzopyrans |
| MX24433A (es) * | 1990-02-06 | 1993-05-01 | Pfizer | Derivados de 3-piperidino-1-cromanol y sus analogos y procedimiento para su preparacion |
| US5273998A (en) * | 1990-05-11 | 1993-12-28 | Yoshitomi Pharmaceutical Industries, Ltd. | Process for making an optically active 3,4-dihydro-3,4-epoxy-2H-1-benzopyran compound |
| US5276168A (en) * | 1990-06-18 | 1994-01-04 | E. R. Squibb & Sons, Inc. | Benzopyran derivatives and heterocyclic analogs thereof as antiischemic agents |
| CN1060467A (zh) * | 1990-09-25 | 1992-04-22 | 武田药品工业株式会社 | 1,3-苯并嗪衍生物、其生产方法和用途 |
| CA2061179A1 (en) * | 1991-02-18 | 1992-08-19 | Ryuji Tsuzuki | Oxzazinobenzazole compounds |
| WO1993010757A1 (en) * | 1991-12-05 | 1993-06-10 | Smithkline Beecham Plc | Pharmaceutical composition |
| FR2698873B1 (fr) | 1992-12-07 | 1995-02-24 | Lipha | Benzocycloheptènes, benzoxépines et benzothiépines activateurs des canaux potassiques, procédé de préparation, composition pharmaceutique les contenant. |
| US5436255A (en) * | 1992-07-23 | 1995-07-25 | Pfizer Inc. | Method of treating diseases susceptable to treatment by blocking NMDA-receptors |
| HUT72741A (en) * | 1992-12-19 | 1996-05-28 | Alkaloida Vegyeszeti Gyar | Method for producing benzopyrane derivatives and pharmaceutical compositions containing them |
| US5416097A (en) * | 1993-05-19 | 1995-05-16 | Berlex Laboratories, Inc. | Potassium channel activators/openers |
| DK0741724T3 (da) * | 1994-01-31 | 1999-12-20 | Pfizer | Neurobeskyttende chromanforbindelser |
| US5869478A (en) * | 1995-06-07 | 1999-02-09 | Bristol-Myers Squibb Company | Sulfonamido substituted benzopyran derivatives |
| US5629429A (en) * | 1995-06-07 | 1997-05-13 | Bristol-Myers Squibb Company | Process for preparing 4-arylamino-benzopyran and related compounds |
| US5612323A (en) * | 1995-06-07 | 1997-03-18 | Bristol-Myers Squibb Company | Phosphinic ester substituted benzopyran derivatives |
| US5612370A (en) * | 1995-06-07 | 1997-03-18 | Bristol-Myers Squibb Company | Phenylglycine and phenylalaninen amido benzopyran derivatives |
| WO2000067754A1 (en) | 1999-05-12 | 2000-11-16 | Nitromed, Inc. | Nitrosated and nitrosylated potassium channel activators, compositions and methods of use |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1495526A (en) * | 1974-05-31 | 1977-12-21 | Beecham Group Ltd | Chroman derivatives |
| GB1548221A (en) * | 1976-01-27 | 1979-07-04 | Beecham Group Ltd | Trans-4-heterocycyl-3,4-dihydro-2h-benzo pyran-3-ol esters |
| NZ183551A (en) * | 1976-04-02 | 1978-09-20 | Beecham Group Ltd | Aminochromanols and pharmaceutical compositions containingthem |
| GB1511187A (en) * | 1976-04-02 | 1978-05-17 | Beecham Group Ltd | Chromans |
| GB1548222A (en) * | 1976-12-17 | 1979-07-04 | Beecham Group Ltd | Trans-4-heterocyclyl-3,4-dihydro-2h-benzo pyarn-3-ol derivatives |
| EP0009912B1 (en) * | 1978-10-04 | 1983-06-22 | Beecham Group Plc | Chromanol derivatives, a process for their preparation and pharmaceutical compositions comprising them |
| DE3064285D1 (en) * | 1979-09-28 | 1983-08-25 | Beecham Group Plc | Chromanol derivatives, a process for their preparation and a pharmaceutical composition comprising them |
| ZM7682A1 (en) * | 1981-09-25 | 1983-05-23 | Beecham Group Plc | Active compounds |
| EP0093534A1 (en) * | 1982-04-28 | 1983-11-09 | Beecham Group Plc | Novel chromanols |
-
1982
- 1982-09-21 AT AT82304946T patent/ATE23718T1/de not_active IP Right Cessation
- 1982-09-21 DE DE8282304946T patent/DE3274350D1/de not_active Expired
- 1982-09-21 GB GB08226914A patent/GB2107706A/en not_active Withdrawn
- 1982-09-21 EP EP82304946A patent/EP0076075B1/en not_active Expired
- 1982-09-22 YU YU2101/82A patent/YU43279B/xx unknown
- 1982-09-23 MX MX009343A patent/MX174532B/es unknown
- 1982-09-23 NZ NZ201984A patent/NZ201984A/en unknown
- 1982-09-23 MX MX009342A patent/MX174531B/es unknown
- 1982-09-23 DK DK424582A patent/DK170165B1/da not_active IP Right Cessation
- 1982-09-23 IE IE2313/82A patent/IE53875B1/en not_active IP Right Cessation
- 1982-09-23 ES ES515921A patent/ES515921A0/es active Granted
- 1982-09-23 MX MX009344A patent/MX174533B/es unknown
- 1982-09-23 PT PT75598A patent/PT75598B/pt unknown
- 1982-09-23 FI FI823272A patent/FI73675C/fi not_active IP Right Cessation
- 1982-09-23 GR GR69350A patent/GR76732B/el unknown
- 1982-09-23 CA CA000412049A patent/CA1174682A/en not_active Expired
- 1982-09-23 PH PH27902A patent/PH18691A/en unknown
- 1982-09-24 PL PL1982247748A patent/PL141135B1/pl unknown
- 1982-09-24 PL PL1982247747A patent/PL141134B1/pl unknown
- 1982-09-24 US US06/423,450 patent/US4446113A/en not_active Expired - Lifetime
- 1982-09-24 KR KR8204317A patent/KR880001943B1/ko not_active Expired
- 1982-09-24 NO NO823247A patent/NO159597C/no unknown
- 1982-09-24 PL PL1982247746A patent/PL141133B1/pl unknown
- 1982-09-24 PL PL1982238342A patent/PL141099B1/pl unknown
- 1982-09-24 AU AU88675/82A patent/AU561536B2/en not_active Expired
-
1983
- 1983-06-01 ES ES522937A patent/ES8407490A1/es not_active Expired
- 1983-06-01 ES ES522938A patent/ES8407491A1/es not_active Expired
- 1983-06-01 ES ES522939A patent/ES522939A0/es active Granted
- 1983-11-11 NO NO834135A patent/NO834135L/no unknown
- 1983-11-11 NO NO834134A patent/NO834134L/no unknown
- 1983-11-11 NO NO834133A patent/NO834133L/no unknown
-
1984
- 1984-08-24 YU YU1453/84A patent/YU44767B/xx unknown
- 1984-08-24 YU YU1454/84A patent/YU44768B/xx unknown
- 1984-08-24 YU YU1452/84A patent/YU44766B/xx unknown
-
1987
- 1987-09-28 MY MYPI87002011A patent/MY102061A/en unknown
- 1987-11-04 SG SG985/87A patent/SG98587G/en unknown
-
1988
- 1988-03-03 HK HK175/88A patent/HK17588A/en not_active IP Right Cessation
-
1990
- 1990-05-28 JP JP2138152A patent/JPH0314573A/ja active Granted
-
1992
- 1992-03-26 JP JP4100440A patent/JPH0780875B2/ja not_active Expired - Lifetime
- 1992-06-03 JP JP4185633A patent/JP2504708B2/ja not_active Expired - Lifetime
- 1992-06-03 JP JP4185632A patent/JP2504707B2/ja not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1174682A (en) | Active compounds | |
| US4647670A (en) | Trans-3,4-dihydro-2,2-dimethyl-6-nitro-4-(2-oxo-pyrrolidinyl)2H-1-benzopyran-3-ol | |
| EP0120427B1 (en) | 3,4-Dihydro-thiaoxo-1-pyrrolidinyl-or piperidinyl-ZH-benzo[b]pyrons | |
| EP0107423B1 (en) | Novel chromans and chromenes | |
| EP0139992B1 (en) | Chromanol derivatives | |
| EP0095316B1 (en) | Pharmaceutically active aminobenzopyrans | |
| EP0028449B1 (en) | Chromanol derivatives, a process for their preparation and a pharmaceutical composition comprising them | |
| HU193480B (en) | Process for producing benzopyrane derivatives | |
| US4629734A (en) | Benzopyrans | |
| NZ213468A (en) | Benzopyran compounds as intermediates |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |