CA1096872A - 1,2,3,-thiadiazole-5-carboxylic acid derivatives having a herbicidal and growth regulating action and their manufacture and use - Google Patents
1,2,3,-thiadiazole-5-carboxylic acid derivatives having a herbicidal and growth regulating action and their manufacture and useInfo
- Publication number
- CA1096872A CA1096872A CA305,253A CA305253A CA1096872A CA 1096872 A CA1096872 A CA 1096872A CA 305253 A CA305253 A CA 305253A CA 1096872 A CA1096872 A CA 1096872A
- Authority
- CA
- Canada
- Prior art keywords
- thiadiazole
- methyl
- carboxylic acid
- living plant
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000001105 regulatory effect Effects 0.000 title claims description 20
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 230000002363 herbicidal effect Effects 0.000 title abstract description 7
- -1 phenoxy- Chemical class 0.000 claims abstract description 34
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 8
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000011575 calcium Substances 0.000 claims abstract description 7
- 229910052791 calcium Inorganic materials 0.000 claims abstract description 7
- 125000005843 halogen group Chemical group 0.000 claims abstract description 7
- BXCZJWHJYRELHY-UHFFFAOYSA-N thiadiazole-5-carboxylic acid Chemical class OC(=O)C1=CN=NS1 BXCZJWHJYRELHY-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims abstract description 6
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 6
- 239000011777 magnesium Substances 0.000 claims abstract description 6
- 229910052749 magnesium Inorganic materials 0.000 claims abstract description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 5
- 150000001340 alkali metals Chemical group 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000000068 chlorophenyl group Chemical group 0.000 claims abstract description 5
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims abstract description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 5
- 125000006501 nitrophenyl group Chemical group 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 125000003944 tolyl group Chemical group 0.000 claims abstract description 5
- 239000011701 zinc Substances 0.000 claims abstract description 5
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 5
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims abstract description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052788 barium Inorganic materials 0.000 claims abstract description 4
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims abstract description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052794 bromium Chemical group 0.000 claims abstract description 4
- 239000000460 chlorine Substances 0.000 claims abstract description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 4
- 125000004209 (C1-C8) alkyl group Chemical class 0.000 claims abstract 3
- 125000001246 bromo group Chemical group Br* 0.000 claims abstract 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract 3
- 241000196324 Embryophyta Species 0.000 claims description 86
- 150000001875 compounds Chemical class 0.000 claims description 62
- 239000002253 acid Substances 0.000 claims description 52
- 238000000034 method Methods 0.000 claims description 30
- NHHQOYLPBUYHQU-UHFFFAOYSA-N 4-methylthiadiazole-5-carboxylic acid Chemical compound CC=1N=NSC=1C(O)=O NHHQOYLPBUYHQU-UHFFFAOYSA-N 0.000 claims description 27
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 10
- 229920000742 Cotton Polymers 0.000 claims description 7
- 241000219146 Gossypium Species 0.000 claims description 7
- 240000008042 Zea mays Species 0.000 claims description 7
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 claims description 7
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 7
- 235000009973 maize Nutrition 0.000 claims description 7
- 235000013339 cereals Nutrition 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 5
- 244000068988 Glycine max Species 0.000 claims description 4
- 235000010469 Glycine max Nutrition 0.000 claims description 4
- 240000007594 Oryza sativa Species 0.000 claims description 3
- 235000007164 Oryza sativa Nutrition 0.000 claims description 3
- 235000021307 Triticum Nutrition 0.000 claims description 3
- 235000009566 rice Nutrition 0.000 claims description 3
- IYKDYRRWHMXJLW-UHFFFAOYSA-N 4-methyl-n-phenylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=CC=CC=2)=C1C IYKDYRRWHMXJLW-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- ZAIAQGGOMNVCNF-UHFFFAOYSA-N n-(2,6-dichlorophenyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C(=CC=CC=2Cl)Cl)=C1C ZAIAQGGOMNVCNF-UHFFFAOYSA-N 0.000 claims description 2
- CPPCRKJNHYHEQT-UHFFFAOYSA-N n-(cyclohexylmethyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NCC2CCCCC2)=C1C CPPCRKJNHYHEQT-UHFFFAOYSA-N 0.000 claims description 2
- UUWZPJRTVUSALT-UHFFFAOYSA-N 4-methyl-n,n-di(propan-2-yl)thiadiazole-5-carboxamide Chemical compound CC(C)N(C(C)C)C(=O)C=1SN=NC=1C UUWZPJRTVUSALT-UHFFFAOYSA-N 0.000 claims 1
- ORVUSKNUQNPKJQ-UHFFFAOYSA-N 4-methyl-n,n-diphenylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)N(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1C ORVUSKNUQNPKJQ-UHFFFAOYSA-N 0.000 claims 1
- NTMXOGPLFDVHPG-UHFFFAOYSA-N 4-methyl-n-(2-methylphenyl)thiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C(=CC=CC=2)C)=C1C NTMXOGPLFDVHPG-UHFFFAOYSA-N 0.000 claims 1
- WVVIQPHJYLUECE-UHFFFAOYSA-N 4-methyl-n-(2-methylpropyl)thiadiazole-5-carboxamide Chemical compound CC(C)CNC(=O)C=1SN=NC=1C WVVIQPHJYLUECE-UHFFFAOYSA-N 0.000 claims 1
- BAQVIZKEXWRJPY-UHFFFAOYSA-N 4-methyl-n-(3-methylphenyl)thiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=C(C)C=CC=2)=C1C BAQVIZKEXWRJPY-UHFFFAOYSA-N 0.000 claims 1
- SLKPWVISRATEOW-UHFFFAOYSA-N 4-methyl-n-(4-methylphenyl)thiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=CC(C)=CC=2)=C1C SLKPWVISRATEOW-UHFFFAOYSA-N 0.000 claims 1
- VAYPLYVYCXTDQA-UHFFFAOYSA-N 4-methyl-n-(4-nitrophenyl)thiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=CC(=CC=2)[N+]([O-])=O)=C1C VAYPLYVYCXTDQA-UHFFFAOYSA-N 0.000 claims 1
- LPLCBLSSHJUMRT-UHFFFAOYSA-N 4-methyl-n-prop-2-enylthiadiazole-5-carboxamide Chemical compound CC=1N=NSC=1C(=O)NCC=C LPLCBLSSHJUMRT-UHFFFAOYSA-N 0.000 claims 1
- LLQVJPBDRQAKTD-UHFFFAOYSA-N N-(2-chloro-6-methylphenyl)-4-methylthiadiazole-5-carboxamide Chemical compound ClC1=C(NC(=O)C2=C(N=NS2)C)C(=CC=C1)C LLQVJPBDRQAKTD-UHFFFAOYSA-N 0.000 claims 1
- DJJNOCUVPKDBBT-UHFFFAOYSA-N N-(3-ethylpent-1-yn-3-yl)-4-methylthiadiazole-5-carboxamide Chemical compound C(C)C(C#C)(CC)NC(=O)C1=C(N=NS1)C DJJNOCUVPKDBBT-UHFFFAOYSA-N 0.000 claims 1
- YGYHIOLIEDYRLZ-UHFFFAOYSA-N N-(4-chloro-2-methylphenyl)-4-methylthiadiazole-5-carboxamide Chemical compound ClC1=CC(=C(NC(=O)C2=C(N=NS2)C)C=C1)C YGYHIOLIEDYRLZ-UHFFFAOYSA-N 0.000 claims 1
- 241000209140 Triticum Species 0.000 claims 1
- 239000011230 binding agent Substances 0.000 claims 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 claims 1
- CKOGASHLHVWJBL-UHFFFAOYSA-N n,4-dimethyl-n-phenylthiadiazole-5-carboxamide Chemical compound C=1C=CC=CC=1N(C)C(=O)C=1SN=NC=1C CKOGASHLHVWJBL-UHFFFAOYSA-N 0.000 claims 1
- ZNADJCXSRLQLRF-UHFFFAOYSA-N n,n,4-trimethylthiadiazole-5-carboxamide Chemical compound CN(C)C(=O)C=1SN=NC=1C ZNADJCXSRLQLRF-UHFFFAOYSA-N 0.000 claims 1
- PUIFLNXSYCDFEX-UHFFFAOYSA-N n,n-diethyl-4-methylthiadiazole-5-carboxamide Chemical compound CCN(CC)C(=O)C=1SN=NC=1C PUIFLNXSYCDFEX-UHFFFAOYSA-N 0.000 claims 1
- NUKBBXLMLUPXDB-UHFFFAOYSA-N n-(2,2-diethoxyethyl)-4-methylthiadiazole-5-carboxamide Chemical compound CCOC(OCC)CNC(=O)C=1SN=NC=1C NUKBBXLMLUPXDB-UHFFFAOYSA-N 0.000 claims 1
- FMMCUTKKLQMDNJ-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C(=CC=CC=2C)C)=C1C FMMCUTKKLQMDNJ-UHFFFAOYSA-N 0.000 claims 1
- OGTWYDOQEGXEOJ-UHFFFAOYSA-N n-(2-chlorophenyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C(=CC=CC=2)Cl)=C1C OGTWYDOQEGXEOJ-UHFFFAOYSA-N 0.000 claims 1
- RAHFDQJLBRFBMX-UHFFFAOYSA-N n-(2-ethoxyethyl)-4-methylthiadiazole-5-carboxamide Chemical compound CCOCCNC(=O)C=1SN=NC=1C RAHFDQJLBRFBMX-UHFFFAOYSA-N 0.000 claims 1
- WCYMCGFMRGJWBX-UHFFFAOYSA-N n-(3,4-dichlorophenyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=C(Cl)C(Cl)=CC=2)=C1C WCYMCGFMRGJWBX-UHFFFAOYSA-N 0.000 claims 1
- YCNAXKIDJHFMTC-UHFFFAOYSA-N n-(3,5-dichlorophenyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=C(Cl)C=C(Cl)C=2)=C1C YCNAXKIDJHFMTC-UHFFFAOYSA-N 0.000 claims 1
- PEIMOXABIXMPAH-UHFFFAOYSA-N n-(3-chlorophenyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=C(Cl)C=CC=2)=C1C PEIMOXABIXMPAH-UHFFFAOYSA-N 0.000 claims 1
- MTALIUQMLMIPSX-UHFFFAOYSA-N n-(4-chlorophenyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=CC(Cl)=CC=2)=C1C MTALIUQMLMIPSX-UHFFFAOYSA-N 0.000 claims 1
- AMTYWERSNMFHRG-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]-4-methylthiadiazole-5-carboxamide Chemical compound CN(C)CCCNC(=O)C=1SN=NC=1C AMTYWERSNMFHRG-UHFFFAOYSA-N 0.000 claims 1
- WWDBTNPQCDGBBO-UHFFFAOYSA-N n-cycloheptyl-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC2CCCCCC2)=C1C WWDBTNPQCDGBBO-UHFFFAOYSA-N 0.000 claims 1
- ICNCWFGLFARJBP-UHFFFAOYSA-N n-cyclohexyl-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC2CCCCC2)=C1C ICNCWFGLFARJBP-UHFFFAOYSA-N 0.000 claims 1
- KIAXEYKHZWSFNN-UHFFFAOYSA-N n-cyclooctyl-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC2CCCCCCC2)=C1C KIAXEYKHZWSFNN-UHFFFAOYSA-N 0.000 claims 1
- CZUUAZZWYZFXJZ-UHFFFAOYSA-N n-tert-butyl-4-methylthiadiazole-5-carboxamide Chemical compound CC=1N=NSC=1C(=O)NC(C)(C)C CZUUAZZWYZFXJZ-UHFFFAOYSA-N 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 9
- 230000009471 action Effects 0.000 abstract description 8
- 239000000969 carrier Substances 0.000 abstract description 3
- 150000003839 salts Chemical class 0.000 description 23
- 150000002148 esters Chemical class 0.000 description 22
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 18
- 150000001408 amides Chemical class 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- 150000007513 acids Chemical class 0.000 description 13
- 239000013543 active substance Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 229920006063 Lamide® Polymers 0.000 description 7
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- OFFFOVCCGHKJES-UHFFFAOYSA-N 4-methylthiadiazole Chemical compound CC1=CSN=N1 OFFFOVCCGHKJES-UHFFFAOYSA-N 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical compound C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- 235000002634 Solanum Nutrition 0.000 description 4
- 241000207763 Solanum Species 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- IIFVWLUQBAIPMJ-UHFFFAOYSA-N (4-fluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1 IIFVWLUQBAIPMJ-UHFFFAOYSA-N 0.000 description 3
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 3
- OIEJOFLPFAPTEP-UHFFFAOYSA-N 4-propylthiadiazole-5-carboxylic acid Chemical compound CCCC=1N=NSC=1C(O)=O OIEJOFLPFAPTEP-UHFFFAOYSA-N 0.000 description 3
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 3
- 241000132570 Centaurea Species 0.000 description 3
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 3
- 244000192528 Chrysanthemum parthenium Species 0.000 description 3
- 241000208296 Datura Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241001101998 Galium Species 0.000 description 3
- 235000021506 Ipomoea Nutrition 0.000 description 3
- 241000207783 Ipomoea Species 0.000 description 3
- 235000017945 Matricaria Nutrition 0.000 description 3
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 241000205407 Polygonum Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- JPYQFYIEOUVJDU-UHFFFAOYSA-N beclamide Chemical compound ClCCC(=O)NCC1=CC=CC=C1 JPYQFYIEOUVJDU-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- MSZJEPVVQWJCIF-UHFFFAOYSA-N butylazanide Chemical compound CCCC[NH-] MSZJEPVVQWJCIF-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- JLIDBLDQVAYHNE-YKALOCIXSA-N (+)-Abscisic acid Chemical compound OC(=O)/C=C(/C)\C=C\[C@@]1(O)C(C)=CC(=O)CC1(C)C JLIDBLDQVAYHNE-YKALOCIXSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DRTQHJPVMGBUCF-UCVXFZOQSA-N 1-[(2s,3s,4s,5s)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@H]1[C@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UCVXFZOQSA-N 0.000 description 2
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical class C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- 241000234282 Allium Species 0.000 description 2
- 241000743985 Alopecurus Species 0.000 description 2
- 241000219318 Amaranthus Species 0.000 description 2
- 235000005781 Avena Nutrition 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 235000011331 Brassica Nutrition 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- WNHIYKKCTUQANF-UHFFFAOYSA-N CC1=C[S+](C([O-])=O)N=N1 Chemical compound CC1=C[S+](C([O-])=O)N=N1 WNHIYKKCTUQANF-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 235000007516 Chrysanthemum Nutrition 0.000 description 2
- 240000005250 Chrysanthemum indicum Species 0.000 description 2
- 241000234653 Cyperus Species 0.000 description 2
- 241000208175 Daucus Species 0.000 description 2
- 241000192043 Echinochloa Species 0.000 description 2
- 241000919496 Erysimum Species 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 241000110847 Kochia Species 0.000 description 2
- 241000520028 Lamium Species 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 241000219295 Portulaca Species 0.000 description 2
- 240000003801 Sigesbeckia orientalis Species 0.000 description 2
- 235000003407 Sigesbeckia orientalis Nutrition 0.000 description 2
- 240000006394 Sorghum bicolor Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229950005499 carbon tetrachloride Drugs 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- AVKNGPAMCBSNSO-UHFFFAOYSA-N cyclohexylmethanamine Chemical compound NCC1CCCCC1 AVKNGPAMCBSNSO-UHFFFAOYSA-N 0.000 description 2
- OGGXGZAMXPVRFZ-UHFFFAOYSA-N dimethylarsinic acid Chemical compound C[As](C)(O)=O OGGXGZAMXPVRFZ-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- ZWRUINPWMLAQRD-UHFFFAOYSA-N nonan-1-ol Chemical compound CCCCCCCCCO ZWRUINPWMLAQRD-UHFFFAOYSA-N 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- DZBHNPJZCQWUCG-UHFFFAOYSA-N (3,5-dimethylphenyl)methanamine Chemical compound CC1=CC(C)=CC(CN)=C1 DZBHNPJZCQWUCG-UHFFFAOYSA-N 0.000 description 1
- RGXUCUWVGKLACF-UHFFFAOYSA-N (3-methylphenyl)methanamine Chemical compound CC1=CC=CC(CN)=C1 RGXUCUWVGKLACF-UHFFFAOYSA-N 0.000 description 1
- ZHWCNOCTAKKMDJ-UHFFFAOYSA-N (4-chlorophenyl) 4-methylthiadiazole-5-carboxylate Chemical compound N1=NSC(C(=O)OC=2C=CC(Cl)=CC=2)=C1C ZHWCNOCTAKKMDJ-UHFFFAOYSA-N 0.000 description 1
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 description 1
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical class C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- IDPURXSQCKYKIJ-UHFFFAOYSA-N 1-(4-methoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1 IDPURXSQCKYKIJ-UHFFFAOYSA-N 0.000 description 1
- VJXKPMICAFCWKC-UHFFFAOYSA-N 1-pyridin-2-yl-3-(thiadiazol-5-yl)urea Chemical compound C=1C=CC=NC=1NC(=O)NC1=CN=NS1 VJXKPMICAFCWKC-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- ZYIFXLMEIVHSNY-UHFFFAOYSA-N 2-aminoethenone Chemical compound NC=C=O ZYIFXLMEIVHSNY-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- FEUISMYEFPANSS-UHFFFAOYSA-N 2-methylcyclohexan-1-amine Chemical compound CC1CCCCC1N FEUISMYEFPANSS-UHFFFAOYSA-N 0.000 description 1
- REEXLQXWNOSJKO-UHFFFAOYSA-N 2h-1$l^{4},2,3-benzothiadiazine 1-oxide Chemical class C1=CC=C2S(=O)NN=CC2=C1 REEXLQXWNOSJKO-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- TXPPFLCUNAAVAM-UHFFFAOYSA-N 4-methyl-n-propan-2-ylthiadiazole-5-carboxamide Chemical compound CC(C)NC(=O)C=1SN=NC=1C TXPPFLCUNAAVAM-UHFFFAOYSA-N 0.000 description 1
- SDNDOCTUXWLDIX-UHFFFAOYSA-N 4-methylthiadiazole-5-carbonyl chloride Chemical compound CC=1N=NSC=1C(Cl)=O SDNDOCTUXWLDIX-UHFFFAOYSA-N 0.000 description 1
- UPZREXDCVZYFHI-UHFFFAOYSA-N 4-methylthiadiazole-5-carboxylic acid;piperidine-2-carboxamide Chemical compound CC=1N=NSC=1C(O)=O.NC(=O)C1CCCCN1 UPZREXDCVZYFHI-UHFFFAOYSA-N 0.000 description 1
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical class C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 1
- 241000743339 Agrostis Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000440284 Andamia Species 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-N Arsenic acid Chemical compound O[As](O)(O)=O DJHGAFSJWGLOIV-UHFFFAOYSA-N 0.000 description 1
- 229930192334 Auxin Natural products 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- LIMLKPGGTOGZAD-UHFFFAOYSA-N C1(CCCCC1)N(C(=O)C1=C(N=NS1)CCC)C Chemical compound C1(CCCCC1)N(C(=O)C1=C(N=NS1)CCC)C LIMLKPGGTOGZAD-UHFFFAOYSA-N 0.000 description 1
- 241000723343 Cichorium Species 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 244000024469 Cucumis prophetarum Species 0.000 description 1
- 235000010071 Cucumis prophetarum Nutrition 0.000 description 1
- 241000209210 Dactylis Species 0.000 description 1
- 240000001879 Digitalis lutea Species 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 244000089409 Erythrina poeppigiana Species 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000221079 Euphorbia <genus> Species 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 241000982822 Ficus obtusifolia Species 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000208822 Lactuca Species 0.000 description 1
- 241000208204 Linum Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 1
- 241000219823 Medicago Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- OGISPZUIRIJOQX-UHFFFAOYSA-N N-(3-hydroxyphenyl)-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=C(O)C=CC=2)=C1C OGISPZUIRIJOQX-UHFFFAOYSA-N 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 241001325197 Phacelia Species 0.000 description 1
- 241000745991 Phalaris Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- 241000219843 Pisum Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 229940000488 arsenic acid Drugs 0.000 description 1
- BUSBFZWLPXDYIC-UHFFFAOYSA-N arsonic acid Chemical class O[AsH](O)=O BUSBFZWLPXDYIC-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002363 auxin Substances 0.000 description 1
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical class C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 1
- 150000005130 benzoxazines Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 230000003851 biochemical process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229950004243 cacodylic acid Drugs 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006622 cycloheptylmethyl group Chemical group 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000006623 cyclooctylmethyl group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- FCRACOPGPMPSHN-UHFFFAOYSA-N desoxyabscisic acid Natural products OC(=O)C=C(C)C=CC1C(C)=CC(=O)CC1(C)C FCRACOPGPMPSHN-UHFFFAOYSA-N 0.000 description 1
- PBGGNZZGJIKBMJ-UHFFFAOYSA-N di(propan-2-yl)azanide Chemical compound CC(C)[N-]C(C)C PBGGNZZGJIKBMJ-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- QQSGDKKFXBGYON-UHFFFAOYSA-N ethoxy-methylperoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-$l^{5}-phosphane Chemical class CCOP(=S)(OOC)OC1=CC(C)=NC(C(C)C)=N1 QQSGDKKFXBGYON-UHFFFAOYSA-N 0.000 description 1
- JXRGWJZDGRJZRR-UHFFFAOYSA-N ethyl 4-ethylthiadiazole-5-carboxylate Chemical compound CCOC(=O)C=1SN=NC=1CC JXRGWJZDGRJZRR-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- TVFIYRKPCACCNL-UHFFFAOYSA-N furan-2-carboxamide Chemical compound NC(=O)C1=CC=CO1 TVFIYRKPCACCNL-UHFFFAOYSA-N 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- ALBYIUDWACNRRB-UHFFFAOYSA-N hexanamide Chemical compound CCCCCC(N)=O ALBYIUDWACNRRB-UHFFFAOYSA-N 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 1
- JTEDVYBZBROSJT-UHFFFAOYSA-N indole-3-butyric acid Chemical compound C1=CC=C2C(CCCC(=O)O)=CNC2=C1 JTEDVYBZBROSJT-UHFFFAOYSA-N 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 230000004660 morphological change Effects 0.000 description 1
- BUNBYZALFNVREQ-UHFFFAOYSA-N n,4-dimethyl-n-naphthalen-2-ylthiadiazole-5-carboxamide Chemical compound C=1C=C2C=CC=CC2=CC=1N(C)C(=O)C=1SN=NC=1C BUNBYZALFNVREQ-UHFFFAOYSA-N 0.000 description 1
- ZXOYKQGLOZWYHR-UHFFFAOYSA-N n-(3-methylcyclohexyl)-4-propylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC2CC(C)CCC2)=C1CCC ZXOYKQGLOZWYHR-UHFFFAOYSA-N 0.000 description 1
- UVVXXHWSXMLHIY-UHFFFAOYSA-N n-[(2,4-dichlorophenyl)methyl]-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NCC=2C(=CC(Cl)=CC=2)Cl)=C1C UVVXXHWSXMLHIY-UHFFFAOYSA-N 0.000 description 1
- QQSAJDWXVVAZOD-UHFFFAOYSA-N n-[(2-fluorophenyl)methyl]-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NCC=2C(=CC=CC=2)F)=C1C QQSAJDWXVVAZOD-UHFFFAOYSA-N 0.000 description 1
- NKPFFNLPNQIICZ-UHFFFAOYSA-N n-[(2-methoxyphenyl)methyl]-4-methylthiadiazole-5-carboxamide Chemical compound COC1=CC=CC=C1CNC(=O)C1=C(C)N=NS1 NKPFFNLPNQIICZ-UHFFFAOYSA-N 0.000 description 1
- PSSHRCVVFPHSNG-UHFFFAOYSA-N n-[(3,4-dichlorophenyl)methyl]-4-propylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NCC=2C=C(Cl)C(Cl)=CC=2)=C1CCC PSSHRCVVFPHSNG-UHFFFAOYSA-N 0.000 description 1
- KLGWPRAEGFQNAV-UHFFFAOYSA-N n-[(3,5-dimethylphenyl)methyl]-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NCC=2C=C(C)C=C(C)C=2)=C1C KLGWPRAEGFQNAV-UHFFFAOYSA-N 0.000 description 1
- LPJVAISPBSZFNB-UHFFFAOYSA-N n-[(3-chlorophenyl)methyl]-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NCC=2C=C(Cl)C=CC=2)=C1C LPJVAISPBSZFNB-UHFFFAOYSA-N 0.000 description 1
- RCOYHYDLJIPWAT-UHFFFAOYSA-N n-benzyl-4-methyl-n-phenylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)N(CC=2C=CC=CC=2)C=2C=CC=CC=2)=C1C RCOYHYDLJIPWAT-UHFFFAOYSA-N 0.000 description 1
- HIPXPABRMMYVQD-UHFFFAOYSA-N n-benzylbutan-1-amine Chemical compound CCCCNCC1=CC=CC=C1 HIPXPABRMMYVQD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MMNRAPZVHWIEPN-UHFFFAOYSA-N n-cyclohexyl-4-propylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC2CCCCC2)=C1CCC MMNRAPZVHWIEPN-UHFFFAOYSA-N 0.000 description 1
- ONODEVMCIDCRPW-UHFFFAOYSA-N n-cyclopentyl-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC2CCCC2)=C1C ONODEVMCIDCRPW-UHFFFAOYSA-N 0.000 description 1
- NSNSYCMYOIFVJW-UHFFFAOYSA-N n-cyclopropyl-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC2CC2)=C1C NSNSYCMYOIFVJW-UHFFFAOYSA-N 0.000 description 1
- LRXSDHDEISIWQB-UHFFFAOYSA-N n-methylcycloheptanamine Chemical compound CNC1CCCCCC1 LRXSDHDEISIWQB-UHFFFAOYSA-N 0.000 description 1
- XJINZNWPEQMMBV-UHFFFAOYSA-N n-methylhexan-1-amine Chemical compound CCCCCCNC XJINZNWPEQMMBV-UHFFFAOYSA-N 0.000 description 1
- SVEUVITYHIHZQE-UHFFFAOYSA-N n-methylpyridin-2-amine Chemical compound CNC1=CC=CC=N1 SVEUVITYHIHZQE-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- SDRLFDJOSQLRPB-UHFFFAOYSA-N oxadiazine-4,5-dione Chemical class O=C1CON=NC1=O SDRLFDJOSQLRPB-UHFFFAOYSA-N 0.000 description 1
- 150000004866 oxadiazoles Chemical class 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- RJUVFGTVVVYSFK-UHFFFAOYSA-N phenyl n-propan-2-ylcarbamate Chemical compound CC(C)NC(=O)OC1=CC=CC=C1 RJUVFGTVVVYSFK-UHFFFAOYSA-N 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical compound NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 1
- OVPLZYJGTGDFNB-UHFFFAOYSA-N propan-2-yl carbamate Chemical compound CC(C)OC(N)=O OVPLZYJGTGDFNB-UHFFFAOYSA-N 0.000 description 1
- XUWVIABDWDTJRZ-UHFFFAOYSA-N propan-2-ylazanide Chemical compound CC(C)[NH-] XUWVIABDWDTJRZ-UHFFFAOYSA-N 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- 150000004892 pyridazines Chemical class 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003235 pyrrolidines Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000021749 root development Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 125000003011 styrenyl group Chemical class [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/82—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with three ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/06—1,2,3-Thiadiazoles; Hydrogenated 1,2,3-thiadiazoles
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Lubricants (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2728523A DE2728523C2 (de) | 1977-06-23 | 1977-06-23 | 4-Methyl-1,2,3-thiadiazol-5-carbonsäure-(cyclohexylmethyl)-amid, Mittel mit herbizider und wachstumsregulatorischer Wirkung enthaltend diese Verbindung sowie Verfahren zu seiner Herstellung |
| DEP2728523.0 | 1977-06-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1096872A true CA1096872A (en) | 1981-03-03 |
Family
ID=6012283
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA305,253A Expired CA1096872A (en) | 1977-06-23 | 1978-06-12 | 1,2,3,-thiadiazole-5-carboxylic acid derivatives having a herbicidal and growth regulating action and their manufacture and use |
Country Status (38)
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2909991A1 (de) * | 1979-03-12 | 1980-10-02 | Schering Ag | 1,2,3-thiadiazol-5-carbonsaeurederivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit herbizider und wuchsregulatorischer sowie fungizider wirkung |
| DE2913977A1 (de) * | 1979-04-05 | 1980-10-23 | Schering Ag | 1,2,3-thiadiazol-5-carbonsaeureamid- derivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit herbizider, wuchsregulatorischer und entblaetternder sowie fungizider wirkung |
| US4253864A (en) * | 1979-07-23 | 1981-03-03 | Monsanto Company | Substituted-1,2,3-thiadiazole-safening agents |
| DE3029375A1 (de) * | 1980-07-31 | 1982-03-04 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Verfahren zur herstellung von 3-acylazopropionsaeureestern |
| DE3030736A1 (de) * | 1980-08-14 | 1982-03-25 | Basf Ag, 6700 Ludwigshafen | N-disubstituierte anilinderivate, ihre herstellung, ihre verwendung als mikrobizide und mittel dafuer |
| DE3042195A1 (de) * | 1980-11-08 | 1982-06-24 | Basf Ag, 6700 Ludwigshafen | 2-(n-aryl-,n-1,2,3-thiadiazolylcarbonyl)-aminobutyrolactone, verfahren zu ihrer herstellung, diese enthaltende fungizide mittel und ihre anwendung als fungizide |
| US5098918A (en) * | 1985-05-17 | 1992-03-24 | The Upjohn Company | 1,2,3-thiadiazole compounds, compositions and method of anti-thrombotic treatment |
| US4990652A (en) * | 1985-10-03 | 1991-02-05 | Atochem North America, Inc. | Intermediates for preparing multifunctional thiadiazole lubricant additives |
| DE223916T1 (de) * | 1985-10-03 | 1987-10-15 | Pennwalt Corp., Philadelphia, Pa. | Mehrfach wirksame thiadiazol-additive fuer schmiermittel. |
| US4914097A (en) * | 1987-02-25 | 1990-04-03 | Mitsubishi Kasei Corporation | N-indanyl carboxamide derivative and agricultural/horticultural fungicide containing the derivative as active ingredient |
| DE19775050I2 (de) * | 1987-08-21 | 2010-12-16 | Syngenta Participations Ag | Benzothiadiazole und ihre Verwendung in Verfahren und Mitteln gegen Pflanzenkrankheiten. |
| DE3814117A1 (de) * | 1988-04-22 | 1989-11-02 | Schering Ag | Substituierte 2-thiadiazolylcarbonyl-cyclohexan-1,3-dione und deren iminoderivate, verfahren zur herstellung dieser verbindungen und ihre verwendung als mittel mit herbizider und pflanzenwachstumsregulierender wirkung |
| EP0347377A3 (de) * | 1988-06-13 | 1990-04-04 | Ciba-Geigy Ag | 1,2,3-Benzthiadiazol-4-carbonsäure-Derivate als Pflanzenwuchsregulatoren |
| US5264448A (en) * | 1989-04-19 | 1993-11-23 | Sumitomo Chemical Company, Limited | Amide compound and its production and use |
| AU626402B2 (en) * | 1989-04-19 | 1992-07-30 | Sumitomo Chemical Company, Limited | An amide compound and its production and use |
| US6166054A (en) * | 1995-03-31 | 2000-12-26 | Nihon Nohyaku Co., Ltd. | Agricultural and horticultural disease controller and a method for controlling the diseases |
| MY113237A (en) * | 1995-03-31 | 2001-12-31 | Nihon Nohyaku Co Ltd | An agricultural and horticultural disease controller and a method for controlling the diseases |
| DE69722019T2 (de) | 1996-09-30 | 2003-11-27 | Nihon Nohyaku Co., Ltd. | 1,2,3-thiadiazol-derivate und ihre salze, mittel zur kontrolle von krankheiten in landwirtschaft und gartenbau und eine methode zu ihrer anwendung |
| DE69735429T2 (de) | 1996-09-30 | 2006-08-10 | Nihon Nohyaku Co., Ltd. | Bisthiadiazolderivate und ihre salze, mittel zur bekaempfung von pflanzenkrankheiten in landwirtschaft und gartenbau und methode zur anwendung dieser mittel |
| AU730694B2 (en) * | 1997-10-31 | 2001-03-15 | Nihon Nohyaku Co., Ltd. | Thiadiazole carboxamide derivative, plant disease controlling agent, and method of using the same |
| ATE238661T1 (de) * | 1998-07-30 | 2003-05-15 | Nihon Nohyaku Co Ltd | Fungizide zusammensetzung enthaltend ein 1,2,3- thiadiazolderivat sowie deren verwendung |
| WO2000065914A1 (fr) * | 1999-04-30 | 2000-11-09 | Nihon Nohyaku Co., Ltd. | Procede d'utilisation de composition bactericide |
| DE10027151A1 (de) * | 2000-05-31 | 2001-12-06 | Bayer Ag | Herbizide Mittel auf Basis von substituierten Carbonsäureamiden |
| AU2004315596B2 (en) * | 2003-08-29 | 2011-11-24 | President And Fellows Of Harvard College | Inhibitors of cellular necrosis |
| AR056882A1 (es) * | 2006-02-01 | 2007-10-31 | Bayer Cropscience Sa | Derivados del fungicida n- cicloalquil- bencil- amida |
| WO2009023272A1 (en) | 2007-08-15 | 2009-02-19 | President And Fellows Of Harvard College | Heterocyclic inhibitors of necroptosis |
| US20120122889A1 (en) | 2008-12-23 | 2012-05-17 | President And Fellows Of Harvard College | Small molecule inhibitors of necroptosis |
| CN101875645B (zh) * | 2009-04-29 | 2011-12-28 | 南开大学 | 一类1,2,3-噻二唑甲酰胺衍生物的制备和用途 |
| CN101875644B (zh) * | 2009-04-29 | 2012-04-25 | 南开大学 | 噻二唑类杂环化合物及其合成方法和用途 |
| CN101921244B (zh) * | 2010-09-02 | 2012-06-27 | 南开大学 | 含4-(1,1,2,2-四氟乙氧基)-3,5-二氯苯胺基的4-甲基-1,2,3-噻二唑的衍生物及其合成方法和用途 |
| JP2014088322A (ja) * | 2011-01-12 | 2014-05-15 | Nippon Nohyaku Co Ltd | 植物成長調節剤及びその使用方法 |
| CN102617510A (zh) * | 2012-02-23 | 2012-08-01 | 浙江工业大学 | 一种噻二唑类化合物及其制备与应用 |
| CN102838566A (zh) * | 2012-07-10 | 2012-12-26 | 南开大学 | 4-甲基-1,2,3-噻二唑-5-甲酸酯类衍生物的制备及植物激活抗病活性 |
| WO2014145022A1 (en) | 2013-03-15 | 2014-09-18 | President And Fellows Of Harvard College | Hybrid necroptosis inhibitors |
| MX2017007607A (es) | 2014-12-11 | 2018-05-28 | Harvard College | Inhibidores de necrosis celular y metodos relacionados. |
| CN112194642B (zh) * | 2020-10-20 | 2022-08-19 | 浙江工业大学 | 一种1,2,3-噻二唑类化合物及其制备方法和应用 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795811A (fr) * | 1972-02-25 | 1973-08-22 | Bristol Myers Co | Agents antibacteriens et procede pour les preparer |
| DD103124A5 (enExample) * | 1972-03-23 | 1974-01-12 | ||
| US3787434A (en) * | 1972-03-27 | 1974-01-22 | Fmc Corp | Herbicidal 1,2,3-thiadiazol-5-yl ureas |
| US3874873A (en) * | 1972-03-27 | 1975-04-01 | Fmc Corp | Herbicidal compositions based on 1,2,3-thiadiazol-5-yl ureas |
| US3776907A (en) * | 1972-06-12 | 1973-12-04 | Bristol Myers Co | 7-(d-(alpha-amino-alpha-phenyl-,2-thienyl-and 3-thienyl-acetamido))-3-(1,2,3-thiadiazol-4-or 5-yl)-carbonylthiomethyl-3-cephem-4-carboxylic acids |
| DE2324732C2 (de) * | 1973-05-14 | 1983-06-01 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | N-Phenyl-N'-1,2,3-thiadiazol-5-yl-thioharnstoff, wuchsregulatorisches Mittel enthaltend diese Verbindung sowie Verfahren zu ihrer Herstellung |
| US3940407A (en) * | 1974-09-16 | 1976-02-24 | Syntex (U.S.A.) Inc. | β-Adrenergic blocking agents in the 1,2,3-thiadiazole series |
| US4101548A (en) * | 1977-02-22 | 1978-07-18 | Bristol-Myers Company | 1,2,3-Thiadiazole amides |
-
1977
- 1977-06-23 DE DE2728523A patent/DE2728523C2/de not_active Expired
-
1978
- 1978-05-18 SE SE7805723A patent/SE429861B/sv unknown
- 1978-05-19 NL NL7805470A patent/NL7805470A/xx not_active Application Discontinuation
- 1978-05-29 IN IN402/DEL/78A patent/IN148754B/en unknown
- 1978-05-29 YU YU1274/78A patent/YU40335B/xx unknown
- 1978-06-07 TR TR20600A patent/TR20600A/xx unknown
- 1978-06-09 AR AR272521A patent/AR217850A1/es active
- 1978-06-09 NZ NZ187506A patent/NZ187506A/xx unknown
- 1978-06-12 CA CA305,253A patent/CA1096872A/en not_active Expired
- 1978-06-14 JP JP7203178A patent/JPS549272A/ja active Pending
- 1978-06-14 DD DD78205998A patent/DD137317A5/xx unknown
- 1978-06-16 MX MX787158U patent/MX5582E/es unknown
- 1978-06-16 SU SU782627104A patent/SU733503A3/ru active
- 1978-06-16 SU SU782625900A patent/SU816401A3/ru active
- 1978-06-16 IL IL54930A patent/IL54930A/xx unknown
- 1978-06-16 FI FI781926A patent/FI64361C/fi not_active IP Right Cessation
- 1978-06-19 AT AT445578A patent/AT358323B/de not_active IP Right Cessation
- 1978-06-19 CS CS784024A patent/CS200159B2/cs unknown
- 1978-06-20 GB GB787827354A patent/GB2001623B/en not_active Expired
- 1978-06-20 RO RO7894408A patent/RO75256A/ro unknown
- 1978-06-20 CH CH669278A patent/CH636092A5/de not_active IP Right Cessation
- 1978-06-21 BG BG040157A patent/BG29864A3/xx unknown
- 1978-06-21 PH PH21290A patent/PH14496A/en unknown
- 1978-06-21 BR BR7803932A patent/BR7803932A/pt unknown
- 1978-06-21 LU LU79854A patent/LU79854A1/de unknown
- 1978-06-21 EG EG384/78A patent/EG13412A/xx active
- 1978-06-21 IE IE1241/78A patent/IE47000B1/en unknown
- 1978-06-21 PL PL1978207788A patent/PL110342B1/pl unknown
- 1978-06-22 HU HU78SCHE649A patent/HU180986B/hu unknown
- 1978-06-22 IT IT24835/78A patent/IT1096813B/it active
- 1978-06-22 NO NO782175A patent/NO147987C/no unknown
- 1978-06-22 PT PT68208A patent/PT68208A/pt unknown
- 1978-06-22 AU AU37374/78A patent/AU523321B2/en not_active Expired
- 1978-06-23 FR FR7818797A patent/FR2395263A1/fr active Granted
- 1978-06-23 ZA ZA00783615A patent/ZA783615B/xx unknown
- 1978-06-23 US US05/918,462 patent/US4177054A/en not_active Expired - Lifetime
- 1978-06-23 DK DK284078A patent/DK284078A/da not_active Application Discontinuation
- 1978-06-23 BE BE188816A patent/BE868417A/xx not_active IP Right Cessation
- 1978-06-23 ES ES471078A patent/ES471078A1/es not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1096872A (en) | 1,2,3,-thiadiazole-5-carboxylic acid derivatives having a herbicidal and growth regulating action and their manufacture and use | |
| CA1088552A (en) | 4,5-dichloro-imidazole-1-carboxylic acid aryl esters and their use as plant protection agents | |
| HU197829B (en) | Herbicide and growth-regulating composition containing substituted tetrazolinon derivatives as active components and process for producing substituted tetrazolinon derivatives | |
| US4337081A (en) | 5-Amido-3-trihalomethyl-1,2,4-thiadiazoles and their use as herbicides | |
| IL44710A (en) | 1-phenyl-2-azolyl-formamidines their preparation and their use as herbicides | |
| US4343945A (en) | 5-Benzamido-3-trichloromethyl-1,2,4-thiadiazoles and their use as herbicides, fungicides and insecticides | |
| CA1154775A (en) | 1,2,3-thiadiazole-5-carboxylic acid derivatives having a herbicidal, growth-regulating and fungicidal action, and their manufacture and use | |
| US4221584A (en) | Herbicidal and plant-growth-regulating N-(heterocyclyl)-methylacetanilides | |
| US4559079A (en) | Substituted phenylsulfonyl guanidine herbicides and intermeditates therefor | |
| IE47234B1 (en) | Herbicidally active diurethanes and their manufacture and use | |
| JPS62294665A (ja) | ピリミジン誘導体 | |
| EP0010396A1 (en) | Fungicidal and herbicidal compositions, certain cyanomethane and cyanoethene derivatives being active agents thereof, the preparation of these derivatives and methods for combating fungi and weeds | |
| US4627871A (en) | Herbicidal 2-[4-substituted carboxyamino-phenoxy (or phenyl mercapto)]-substituted pyrimidines | |
| US4059590A (en) | Certain 4-halo-5-aryl-1,2,3-dithiazole compounds and their preparation | |
| DD145364A5 (de) | Biozide mittel | |
| IE45848B1 (en) | N,n'-disubstituted 2,1,3-benzothiadiazin-(4)-one derivatives and their use as herbicides | |
| KR920005411B1 (ko) | 치환된 테트라졸의 제법 | |
| US4259506A (en) | New 3-ureido-(thio)-chromone derivatives | |
| JPH03133969A (ja) | チアゾールカルボキシアミド誘導体 | |
| EP0280367B1 (en) | Glycine compounds | |
| US4336059A (en) | Herbicidal and plant-growth-regulating N-(heterocyclyl)-methylacetanilide | |
| JPS5835182B2 (ja) | 硫黄含有化合物の製法 | |
| US3981714A (en) | Cyclic N-thiadiazolyl-(2)-carboxylic acid compounds and herbicidal compositions | |
| US3758481A (en) | Ridine m-(2,4-dichloro - 5-(haloalkoxy)-phenylcarbomoyl)-pyrrolidine or pipe | |
| US4876044A (en) | Thiadiazole compounds and methods of use |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |