BG61813B1 - Пестицидни 1-(2-пиридил)пиразоли,методи за тяхното получаване, пестицидни средства и методи за използването им срещу вредители по културни растения - Google Patents
Пестицидни 1-(2-пиридил)пиразоли,методи за тяхното получаване, пестицидни средства и методи за използването им срещу вредители по културни растения Download PDFInfo
- Publication number
- BG61813B1 BG61813B1 BG95776A BG9577692A BG61813B1 BG 61813 B1 BG61813 B1 BG 61813B1 BG 95776 A BG95776 A BG 95776A BG 9577692 A BG9577692 A BG 9577692A BG 61813 B1 BG61813 B1 BG 61813B1
- Authority
- BG
- Bulgaria
- Prior art keywords
- compound
- formula
- amino
- halogen
- cyano
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 162
- 241000607479 Yersinia pestis Species 0.000 title claims abstract description 56
- 238000002360 preparation method Methods 0.000 title claims abstract description 43
- 239000000575 pesticide Substances 0.000 title abstract description 5
- 150000003217 pyrazoles Chemical class 0.000 title description 12
- 239000003090 pesticide formulation Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 377
- 239000000203 mixture Substances 0.000 claims abstract description 104
- -1 alkylsulphenyl Chemical group 0.000 claims abstract description 74
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 71
- 150000002367 halogens Chemical class 0.000 claims abstract description 71
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 66
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 47
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 43
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 39
- 239000001257 hydrogen Substances 0.000 claims abstract description 38
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 36
- 241000244206 Nematoda Species 0.000 claims abstract description 29
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 28
- 125000005843 halogen group Chemical group 0.000 claims abstract description 25
- 150000002431 hydrogen Chemical group 0.000 claims abstract description 25
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 25
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 23
- 244000000013 helminth Species 0.000 claims abstract description 22
- 238000006467 substitution reaction Methods 0.000 claims abstract description 16
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims abstract description 11
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 11
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims abstract description 10
- 125000005208 trialkylammonium group Chemical group 0.000 claims abstract description 10
- 125000005221 halo alkyl carbonyl amino group Chemical group 0.000 claims abstract description 9
- 125000004438 haloalkoxy group Chemical group 0.000 claims abstract description 9
- 125000004949 alkyl amino carbonyl amino group Chemical group 0.000 claims abstract description 8
- 241000196324 Embryophyta Species 0.000 claims description 63
- 238000006243 chemical reaction Methods 0.000 claims description 46
- 239000004480 active ingredient Substances 0.000 claims description 41
- 241000238421 Arthropoda Species 0.000 claims description 40
- 239000002689 soil Substances 0.000 claims description 37
- 125000004647 alkyl sulfenyl group Chemical group 0.000 claims description 34
- 125000004076 pyridyl group Chemical group 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 33
- 239000000460 chlorine Substances 0.000 claims description 33
- 241001465754 Metazoa Species 0.000 claims description 28
- 239000003960 organic solvent Substances 0.000 claims description 28
- 239000007787 solid Substances 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 26
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 24
- 241000238631 Hexapoda Species 0.000 claims description 20
- 239000007788 liquid Substances 0.000 claims description 20
- 230000008569 process Effects 0.000 claims description 20
- 150000001412 amines Chemical class 0.000 claims description 19
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 18
- 150000002148 esters Chemical class 0.000 claims description 17
- 239000003795 chemical substances by application Substances 0.000 claims description 15
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 claims description 13
- 229910052794 bromium Inorganic materials 0.000 claims description 12
- 241001124076 Aphididae Species 0.000 claims description 11
- 125000003277 amino group Chemical group 0.000 claims description 11
- 125000004440 haloalkylsulfinyl group Chemical group 0.000 claims description 10
- 238000007254 oxidation reaction Methods 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 9
- 239000000654 additive Substances 0.000 claims description 9
- 229910021529 ammonia Inorganic materials 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 230000003647 oxidation Effects 0.000 claims description 9
- 239000004094 surface-active agent Substances 0.000 claims description 9
- 241000254173 Coleoptera Species 0.000 claims description 8
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims description 8
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 8
- 239000002168 alkylating agent Substances 0.000 claims description 8
- 229940100198 alkylating agent Drugs 0.000 claims description 8
- 239000003638 chemical reducing agent Substances 0.000 claims description 8
- 239000004009 herbicide Substances 0.000 claims description 8
- 230000000361 pesticidal effect Effects 0.000 claims description 8
- 125000005233 alkylalcohol group Chemical group 0.000 claims description 7
- 150000003857 carboxamides Chemical class 0.000 claims description 7
- 230000018044 dehydration Effects 0.000 claims description 7
- 238000006297 dehydration reaction Methods 0.000 claims description 7
- 241000894007 species Species 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 241000251539 Vertebrata <Metazoa> Species 0.000 claims description 6
- 230000009435 amidation Effects 0.000 claims description 6
- 238000007112 amidation reaction Methods 0.000 claims description 6
- 239000012442 inert solvent Substances 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 6
- 241000238876 Acari Species 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 239000000969 carrier Substances 0.000 claims description 5
- 239000012954 diazonium Substances 0.000 claims description 5
- 150000001989 diazonium salts Chemical class 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 241000258937 Hemiptera Species 0.000 claims description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 4
- 150000003973 alkyl amines Chemical class 0.000 claims description 4
- 150000001350 alkyl halides Chemical class 0.000 claims description 4
- 230000009615 deamination Effects 0.000 claims description 4
- 238000006481 deamination reaction Methods 0.000 claims description 4
- 239000012024 dehydrating agents Substances 0.000 claims description 4
- 125000005265 dialkylamine group Chemical group 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 4
- 239000012948 isocyanate Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- 238000006485 reductive methylation reaction Methods 0.000 claims description 4
- 238000005991 sulfenylation reaction Methods 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 3
- 241001414989 Thysanoptera Species 0.000 claims description 3
- URCLXLVQHAJFSJ-UHFFFAOYSA-N chlorosulfonyl hypochlorite Chemical compound ClOS(Cl)(=O)=O URCLXLVQHAJFSJ-UHFFFAOYSA-N 0.000 claims description 3
- 229940126208 compound 22 Drugs 0.000 claims description 3
- 235000019253 formic acid Nutrition 0.000 claims description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 3
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 3
- 125000005031 thiocyano group Chemical group S(C#N)* 0.000 claims description 3
- 230000002152 alkylating effect Effects 0.000 claims description 2
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 claims description 2
- 229940126086 compound 21 Drugs 0.000 claims description 2
- 125000004774 dichlorofluoromethyl group Chemical group FC(Cl)(Cl)* 0.000 claims description 2
- YYJNOYZRYGDPNH-MFKUBSTISA-N fenpyroximate Chemical compound C=1C=C(C(=O)OC(C)(C)C)C=CC=1CO/N=C/C=1C(C)=NN(C)C=1OC1=CC=CC=C1 YYJNOYZRYGDPNH-MFKUBSTISA-N 0.000 claims description 2
- 125000001979 organolithium group Chemical group 0.000 claims description 2
- 125000002734 organomagnesium group Chemical group 0.000 claims description 2
- 125000002524 organometallic group Chemical group 0.000 claims description 2
- 244000045947 parasite Species 0.000 claims description 2
- 238000010791 quenching Methods 0.000 claims description 2
- 230000000171 quenching effect Effects 0.000 claims description 2
- VRACBAOXIWUCEI-UHFFFAOYSA-N 4-chloro-5-(difluoromethylsulfonyl)-1H-pyrazole Chemical compound ClC=1C(=NNC=1)S(=O)(=O)C(F)F VRACBAOXIWUCEI-UHFFFAOYSA-N 0.000 claims 2
- MDLAHYBEAWGVRV-UHFFFAOYSA-N 5-(trifluoromethylsulfanyl)-1h-pyrazole Chemical compound FC(F)(F)SC=1C=CNN=1 MDLAHYBEAWGVRV-UHFFFAOYSA-N 0.000 claims 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 claims 1
- 241000255777 Lepidoptera Species 0.000 claims 1
- 230000000996 additive effect Effects 0.000 claims 1
- QBYJBZPUGVGKQQ-SJJAEHHWSA-N aldrin Chemical compound C1[C@H]2C=C[C@@H]1[C@H]1[C@@](C3(Cl)Cl)(Cl)C(Cl)=C(Cl)[C@@]3(Cl)[C@H]12 QBYJBZPUGVGKQQ-SJJAEHHWSA-N 0.000 claims 1
- 125000005037 alkyl phenyl group Chemical group 0.000 claims 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims 1
- LUJAVIAOCJHNFU-UHFFFAOYSA-N n-[bis(dimethylamino)phosphoryl]-n-methylmethanamine;pyridine Chemical compound C1=CC=NC=C1.CN(C)P(=O)(N(C)C)N(C)C LUJAVIAOCJHNFU-UHFFFAOYSA-N 0.000 claims 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- XXTPHXNBKRVYJI-UHFFFAOYSA-N 2-pyrazol-1-ylpyridine Chemical class C1=CC=NN1C1=CC=CC=N1 XXTPHXNBKRVYJI-UHFFFAOYSA-N 0.000 abstract description 4
- 229910052799 carbon Inorganic materials 0.000 abstract description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract description 2
- 239000000543 intermediate Substances 0.000 description 82
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- 239000000243 solution Substances 0.000 description 40
- 238000012360 testing method Methods 0.000 description 39
- 239000000843 powder Substances 0.000 description 26
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- 239000000047 product Substances 0.000 description 20
- 239000002904 solvent Substances 0.000 description 20
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- 241000255925 Diptera Species 0.000 description 17
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 17
- 239000007921 spray Substances 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 239000008187 granular material Substances 0.000 description 15
- 125000001424 substituent group Chemical group 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 235000013305 food Nutrition 0.000 description 13
- 239000000126 substance Substances 0.000 description 13
- 239000000725 suspension Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000005481 NMR spectroscopy Methods 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical group CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 239000004615 ingredient Substances 0.000 description 11
- 230000009897 systematic effect Effects 0.000 description 11
- 240000003768 Solanum lycopersicum Species 0.000 description 10
- 239000002585 base Substances 0.000 description 10
- 125000003226 pyrazolyl group Chemical group 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 235000013601 eggs Nutrition 0.000 description 9
- 239000000839 emulsion Substances 0.000 description 9
- 230000000749 insecticidal effect Effects 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- QFMDFTQOJHFVNR-UHFFFAOYSA-N 1-[2,2-dichloro-1-(4-ethylphenyl)ethyl]-4-ethylbenzene Chemical compound C1=CC(CC)=CC=C1C(C(Cl)Cl)C1=CC=C(CC)C=C1 QFMDFTQOJHFVNR-UHFFFAOYSA-N 0.000 description 7
- 229920000742 Cotton Polymers 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 240000003829 Sorghum propinquum Species 0.000 description 7
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 7
- 235000013339 cereals Nutrition 0.000 description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 241000219146 Gossypium Species 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 241000257303 Hymenoptera Species 0.000 description 6
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000000853 adhesive Substances 0.000 description 6
- 230000001070 adhesive effect Effects 0.000 description 6
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 239000004495 emulsifiable concentrate Substances 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 5
- 241001142392 Bibio Species 0.000 description 5
- 239000005946 Cypermethrin Substances 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 241000256602 Isoptera Species 0.000 description 5
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 5
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000003086 colorant Substances 0.000 description 5
- 229960005424 cypermethrin Drugs 0.000 description 5
- KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- 230000001069 nematicidal effect Effects 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- 238000005507 spraying Methods 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 241000254023 Locusta Species 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000000895 acaricidal effect Effects 0.000 description 4
- 239000000642 acaricide Substances 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000013543 active substance Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000003337 fertilizer Substances 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- 239000003630 growth substance Substances 0.000 description 4
- 208000015181 infectious disease Diseases 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 239000002917 insecticide Substances 0.000 description 4
- 235000021374 legumes Nutrition 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000005645 nematicide Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 239000000123 paper Substances 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- 238000003359 percent control normalization Methods 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 150000003457 sulfones Chemical class 0.000 description 4
- 150000003462 sulfoxides Chemical class 0.000 description 4
- JXHJNEJVUNHLKO-UHFFFAOYSA-N sulprofos Chemical compound CCCSP(=S)(OCC)OC1=CC=C(SC)C=C1 JXHJNEJVUNHLKO-UHFFFAOYSA-N 0.000 description 4
- 238000001308 synthesis method Methods 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- 235000013311 vegetables Nutrition 0.000 description 4
- 239000001993 wax Substances 0.000 description 4
- 238000009736 wetting Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 241000256111 Aedes <genus> Species 0.000 description 3
- 229910002012 Aerosil® Inorganic materials 0.000 description 3
- 241001136265 Agriotes Species 0.000 description 3
- 241000256186 Anopheles <genus> Species 0.000 description 3
- 241000271566 Aves Species 0.000 description 3
- 241000283690 Bos taurus Species 0.000 description 3
- 241001660203 Gasterophilus Species 0.000 description 3
- 241000257176 Hypoderma <fly> Species 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 241000257229 Musca <genus> Species 0.000 description 3
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 3
- 244000061176 Nicotiana tabacum Species 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 241000238661 Periplaneta Species 0.000 description 3
- 235000005805 Prunus cerasus Nutrition 0.000 description 3
- 241000254026 Schistocerca Species 0.000 description 3
- 241000256108 Simulium <genus> Species 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001335 aliphatic alkanes Chemical class 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 150000001351 alkyl iodides Chemical class 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 239000003899 bactericide agent Substances 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229950005228 bromoform Drugs 0.000 description 3
- 238000004364 calculation method Methods 0.000 description 3
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 3
- 229940125961 compound 24 Drugs 0.000 description 3
- 150000008050 dialkyl sulfates Chemical class 0.000 description 3
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 3
- 235000020188 drinking water Nutrition 0.000 description 3
- 239000003651 drinking water Substances 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- 235000019439 ethyl acetate Nutrition 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000000417 fungicide Substances 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 230000002262 irrigation Effects 0.000 description 3
- 238000003973 irrigation Methods 0.000 description 3
- 244000144972 livestock Species 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 230000003129 miticidal effect Effects 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 238000005580 one pot reaction Methods 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000008247 solid mixture Substances 0.000 description 3
- 239000004550 soluble concentrate Substances 0.000 description 3
- 230000007480 spreading Effects 0.000 description 3
- 238000003892 spreading Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000011550 stock solution Substances 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- 238000011200 topical administration Methods 0.000 description 3
- 239000004562 water dispersible granule Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 2
- XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 2
- 241000238818 Acheta domesticus Species 0.000 description 2
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 2
- 241001600407 Aphis <genus> Species 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 241001503479 Athalia Species 0.000 description 2
- 241000726103 Atta Species 0.000 description 2
- 241001674044 Blattodea Species 0.000 description 2
- 240000002791 Brassica napus Species 0.000 description 2
- 241000488564 Bryobia Species 0.000 description 2
- 241000257160 Calliphora Species 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000717851 Cephus Species 0.000 description 2
- 241000255580 Ceratitis <genus> Species 0.000 description 2
- 241000255579 Ceratitis capitata Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000088885 Chlorops Species 0.000 description 2
- 239000005944 Chlorpyrifos Substances 0.000 description 2
- 208000003495 Coccidiosis Diseases 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 240000007154 Coffea arabica Species 0.000 description 2
- 241001427559 Collembola Species 0.000 description 2
- 241001509964 Coptotermes Species 0.000 description 2
- 241001212536 Cosmopolites Species 0.000 description 2
- 241000256054 Culex <genus> Species 0.000 description 2
- 241000692095 Cuterebra Species 0.000 description 2
- 241001635274 Cydia pomonella Species 0.000 description 2
- 241000268912 Damalinia Species 0.000 description 2
- 241001414890 Delia Species 0.000 description 2
- 241000511318 Diprion Species 0.000 description 2
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 2
- 241000283086 Equidae Species 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 241000189565 Frankliniella Species 0.000 description 2
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 2
- 240000002024 Gossypium herbaceum Species 0.000 description 2
- 241000256257 Heliothis Species 0.000 description 2
- 241000256244 Heliothis virescens Species 0.000 description 2
- 241001659688 Hercinothrips femoralis Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical class [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 206010023076 Isosporiasis Diseases 0.000 description 2
- 241000256686 Lasius <genus> Species 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 241000243786 Meloidogyne incognita Species 0.000 description 2
- 241000555285 Monomorium Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000963706 Onychiurus Species 0.000 description 2
- 241000238814 Orthoptera Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 241000488585 Panonychus Species 0.000 description 2
- 241001494479 Pecora Species 0.000 description 2
- 241000238675 Periplaneta americana Species 0.000 description 2
- 241001253325 Perkinsiella Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 241001401861 Phorodon humuli Species 0.000 description 2
- 241000913072 Phytomyza Species 0.000 description 2
- 241000500437 Plutella xylostella Species 0.000 description 2
- 241001481703 Rhipicephalus <genus> Species 0.000 description 2
- 241001510236 Rhyparobia maderae Species 0.000 description 2
- 241000282849 Ruminantia Species 0.000 description 2
- 241000258242 Siphonaptera Species 0.000 description 2
- 241000254181 Sitophilus Species 0.000 description 2
- 241001562126 Sminthurus Species 0.000 description 2
- 241001521235 Spodoptera eridania Species 0.000 description 2
- 241000282887 Suidae Species 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 241001454294 Tetranychus Species 0.000 description 2
- 244000299461 Theobroma cacao Species 0.000 description 2
- 235000009470 Theobroma cacao Nutrition 0.000 description 2
- 241001414833 Triatoma Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 229940127219 anticoagulant drug Drugs 0.000 description 2
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 229950005499 carbon tetrachloride Drugs 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- SBPBAQFWLVIOKP-UHFFFAOYSA-N chlorpyrifos Chemical compound CCOP(=S)(OCC)OC1=NC(Cl)=C(Cl)C=C1Cl SBPBAQFWLVIOKP-UHFFFAOYSA-N 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 235000016213 coffee Nutrition 0.000 description 2
- 235000013353 coffee beverage Nutrition 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000001212 derivatisation Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 2
- UOAMTSKGCBMZTC-UHFFFAOYSA-N dicofol Chemical compound C=1C=C(Cl)C=CC=1C(C(Cl)(Cl)Cl)(O)C1=CC=C(Cl)C=C1 UOAMTSKGCBMZTC-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 235000015872 dietary supplement Nutrition 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- 229940075933 dithionate Drugs 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000001804 emulsifying effect Effects 0.000 description 2
- 230000012173 estrus Effects 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 230000009969 flowable effect Effects 0.000 description 2
- 239000003517 fume Substances 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- SBGKURINHGJRFN-UHFFFAOYSA-N hydroxymethanesulfinic acid Chemical compound OCS(O)=O SBGKURINHGJRFN-UHFFFAOYSA-N 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 230000001418 larval effect Effects 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 150000002641 lithium Chemical class 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000007069 methylation reaction Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000003595 mist Substances 0.000 description 2
- 229910052901 montmorillonite Inorganic materials 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 230000000802 nitrating effect Effects 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 235000014571 nuts Nutrition 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000002420 orchard Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- 230000000149 penetrating effect Effects 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 2
- BULVZWIRKLYCBC-UHFFFAOYSA-N phorate Chemical compound CCOP(=S)(OCC)SCSCC BULVZWIRKLYCBC-UHFFFAOYSA-N 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000002453 shampoo Substances 0.000 description 2
- 238000007873 sieving Methods 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 238000000527 sonication Methods 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 235000013599 spices Nutrition 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000010189 synthetic method Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- XLNZEKHULJKQBA-UHFFFAOYSA-N terbufos Chemical compound CCOP(=S)(OCC)SCSC(C)(C)C XLNZEKHULJKQBA-UHFFFAOYSA-N 0.000 description 2
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 239000013008 thixotropic agent Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 2
- 239000010455 vermiculite Substances 0.000 description 2
- 229910052902 vermiculite Inorganic materials 0.000 description 2
- 235000019354 vermiculite Nutrition 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- VDWYKAMPKIFOIO-UHFFFAOYSA-N 1-methyl-3-[(3-methylphenyl)disulfanyl]benzene Chemical compound CC1=CC=CC(SSC=2C=C(C)C=CC=2)=C1 VDWYKAMPKIFOIO-UHFFFAOYSA-N 0.000 description 1
- TVFWYUWNQVRQRG-UHFFFAOYSA-N 2,3,4-tris(2-phenylethenyl)phenol Chemical compound C=1C=CC=CC=1C=CC1=C(C=CC=2C=CC=CC=2)C(O)=CC=C1C=CC1=CC=CC=C1 TVFWYUWNQVRQRG-UHFFFAOYSA-N 0.000 description 1
- HKEWOTUTAYJWQJ-UHFFFAOYSA-N 2-(1h-pyrazol-5-yl)pyridine Chemical compound N1N=CC=C1C1=CC=CC=N1 HKEWOTUTAYJWQJ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000238819 Acheta Species 0.000 description 1
- 241000254032 Acrididae Species 0.000 description 1
- 235000009436 Actinidia deliciosa Nutrition 0.000 description 1
- 244000298697 Actinidia deliciosa Species 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 241000902874 Agelastica alni Species 0.000 description 1
- 241001368048 Agrochola Species 0.000 description 1
- 241000218473 Agrotis Species 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 241000238679 Amblyomma Species 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 240000002339 Anredera cordifolia Species 0.000 description 1
- 241000254177 Anthonomus Species 0.000 description 1
- 241001640910 Anthrenus Species 0.000 description 1
- 241001414827 Aonidiella Species 0.000 description 1
- 241000294569 Aphelenchoides Species 0.000 description 1
- 241000134843 Aphelenchoides besseyi Species 0.000 description 1
- 241000680417 Aphelenchoides ritzemabosi Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 241001600408 Aphis gossypii Species 0.000 description 1
- 241001095118 Aphis pomi Species 0.000 description 1
- 241001002469 Archips Species 0.000 description 1
- 241001162025 Archips podana Species 0.000 description 1
- 241000722823 Armadillidium Species 0.000 description 1
- 241000387321 Aspidiotus nerii Species 0.000 description 1
- 241001174347 Atomaria Species 0.000 description 1
- 241001490249 Bactrocera oleae Species 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 241001573714 Blaniulus Species 0.000 description 1
- 241000238658 Blattella Species 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical class [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 235000006008 Brassica napus var napus Nutrition 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241000982105 Brevicoryne brassicae Species 0.000 description 1
- 235000004936 Bromus mango Nutrition 0.000 description 1
- 241001517925 Bucculatrix Species 0.000 description 1
- 241001491790 Bupalus piniaria Species 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- AEXUGIJDVCTHGV-UHFFFAOYSA-N C(CCCCCCCCC)C1=C(C=CC=C1)CCCCCCCCCC.[Ca] Chemical compound C(CCCCCCCCC)C1=C(C=CC=C1)CCCCCCCCCC.[Ca] AEXUGIJDVCTHGV-UHFFFAOYSA-N 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 235000002566 Capsicum Nutrition 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000426499 Chilo Species 0.000 description 1
- 241000258920 Chilopoda Species 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 241000255945 Choristoneura Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical class [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000500845 Costelytra zealandica Species 0.000 description 1
- 241001267662 Criconemoides Species 0.000 description 1
- 241001094916 Cryptomyzus ribis Species 0.000 description 1
- 241000256113 Culicidae Species 0.000 description 1
- 241000157278 Dacus <genus> Species 0.000 description 1
- 239000005892 Deltamethrin Substances 0.000 description 1
- 241001124144 Dermaptera Species 0.000 description 1
- 241001641895 Dermestes Species 0.000 description 1
- 241000214908 Dermolepida Species 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- 241000489975 Diabrotica Species 0.000 description 1
- 241000122105 Diatraea Species 0.000 description 1
- 241000709823 Dictyoptera <beetle genus> Species 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000399934 Ditylenchus Species 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- 241000241133 Earias Species 0.000 description 1
- 241000353522 Earias insulana Species 0.000 description 1
- 241000223924 Eimeria Species 0.000 description 1
- 241000499566 Eimeria brunetti Species 0.000 description 1
- 241000223934 Eimeria maxima Species 0.000 description 1
- 241000499563 Eimeria necatrix Species 0.000 description 1
- 235000001950 Elaeis guineensis Nutrition 0.000 description 1
- 244000127993 Elaeis melanococca Species 0.000 description 1
- 241000995023 Empoasca Species 0.000 description 1
- 241000224431 Entamoeba Species 0.000 description 1
- 241000630736 Ephestia Species 0.000 description 1
- 241000462639 Epilachna varivestis Species 0.000 description 1
- 241000303278 Epitrix Species 0.000 description 1
- 241001558857 Eriophyes Species 0.000 description 1
- 241000917109 Eriosoma Species 0.000 description 1
- 241000483001 Euproctis chrysorrhoea Species 0.000 description 1
- 241000371383 Fannia Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 241000233488 Feltia Species 0.000 description 1
- 239000005958 Fenamiphos (aka phenamiphos) Substances 0.000 description 1
- 241000255896 Galleria mellonella Species 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 241000248126 Geophilus Species 0.000 description 1
- 241001043186 Gibbium Species 0.000 description 1
- 241001442497 Globodera rostochiensis Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 241000890029 Gonocephalum Species 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241001480796 Haemaphysalis Species 0.000 description 1
- 241001148481 Helicotylenchus Species 0.000 description 1
- 241001445511 Helicotylenchus multicinctus Species 0.000 description 1
- 241000255967 Helicoverpa zea Species 0.000 description 1
- 241001227244 Heteronychus Species 0.000 description 1
- 241001466007 Heteroptera Species 0.000 description 1
- 241000282414 Homo sapiens Species 0.000 description 1
- 241001540513 Hoplolaimus Species 0.000 description 1
- 241001540500 Hoplolaimus galeatus Species 0.000 description 1
- 241001480803 Hyalomma Species 0.000 description 1
- 241001251909 Hyalopterus pruni Species 0.000 description 1
- 241001253669 Hylesinus Species 0.000 description 1
- 241000404582 Hymenolepis <angiosperm> Species 0.000 description 1
- 241001508558 Hypera Species 0.000 description 1
- 241000577496 Hypothenemus hampei Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005867 Iprodione Substances 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241001495069 Ischnocera Species 0.000 description 1
- 241001149911 Isopoda Species 0.000 description 1
- 241000238681 Ixodes Species 0.000 description 1
- 241001397173 Kali <angiosperm> Species 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 241001470017 Laodelphax striatella Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000966204 Lissorhoptrus oryzophilus Species 0.000 description 1
- 241000257162 Lucilia <blowfly> Species 0.000 description 1
- 241001177134 Lyctus Species 0.000 description 1
- 241000721696 Lymantria Species 0.000 description 1
- 241000255685 Malacosoma neustria Species 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- 241000732113 Mamestra configurata Species 0.000 description 1
- 235000014826 Mangifera indica Nutrition 0.000 description 1
- 240000007228 Mangifera indica Species 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- 241000252067 Megalops atlanticus Species 0.000 description 1
- 241001415013 Melanoplus Species 0.000 description 1
- 241001415015 Melanoplus differentialis Species 0.000 description 1
- 241001143352 Meloidogyne Species 0.000 description 1
- 241000254099 Melolontha melolontha Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical class [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 241000952627 Monomorium pharaonis Species 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 241000204031 Mycoplasma Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- IWJCIQBQHIBUQW-UHFFFAOYSA-N NC=1NN=C(SC(F)F)C=1Cl Chemical compound NC=1NN=C(SC(F)F)C=1Cl IWJCIQBQHIBUQW-UHFFFAOYSA-N 0.000 description 1
- 241000359016 Nephotettix Species 0.000 description 1
- 241000358422 Nephotettix cincticeps Species 0.000 description 1
- 241001671714 Nezara Species 0.000 description 1
- 241001556089 Nilaparvata lugens Species 0.000 description 1
- 241001385053 Niptus Species 0.000 description 1
- 241000819999 Nymphes Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- HFEFMUSTGZNOPY-UHFFFAOYSA-N OOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOO HFEFMUSTGZNOPY-UHFFFAOYSA-N 0.000 description 1
- ZQTQPYJGMWHXMO-UHFFFAOYSA-N OOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOO ZQTQPYJGMWHXMO-UHFFFAOYSA-N 0.000 description 1
- ZMAKCCXIFPCMEE-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOOO ZMAKCCXIFPCMEE-UHFFFAOYSA-N 0.000 description 1
- 241000866537 Odontotermes Species 0.000 description 1
- 241000207836 Olea <angiosperm> Species 0.000 description 1
- 241001491877 Operophtera brumata Species 0.000 description 1
- 241000238887 Ornithodoros Species 0.000 description 1
- 241000273340 Ornithonyssus Species 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000131101 Oryzaephilus surinamensis Species 0.000 description 1
- 241001147398 Ostrinia nubilalis Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000486437 Panolis Species 0.000 description 1
- 241000721452 Pectinophora Species 0.000 description 1
- 239000006002 Pepper Substances 0.000 description 1
- 235000008673 Persea americana Nutrition 0.000 description 1
- 244000025272 Persea americana Species 0.000 description 1
- 241001608567 Phaedon cochleariae Species 0.000 description 1
- 241000257149 Phormia Species 0.000 description 1
- 241001674048 Phthiraptera Species 0.000 description 1
- 241000593806 Phyllis Species 0.000 description 1
- 241001525654 Phyllocnistis citrella Species 0.000 description 1
- 241001517955 Phyllonorycter blancardella Species 0.000 description 1
- 241001516577 Phylloxera Species 0.000 description 1
- 241000690748 Piesma Species 0.000 description 1
- 235000016761 Piper aduncum Nutrition 0.000 description 1
- 240000003889 Piper guineense Species 0.000 description 1
- 235000017804 Piper guineense Nutrition 0.000 description 1
- 235000008184 Piper nigrum Nutrition 0.000 description 1
- 239000005923 Pirimicarb Substances 0.000 description 1
- 241000224016 Plasmodium Species 0.000 description 1
- 241000256835 Polistes Species 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000908127 Porcellio scaber Species 0.000 description 1
- 208000027954 Poultry disease Diseases 0.000 description 1
- 241000193943 Pratylenchus Species 0.000 description 1
- 241001148486 Pratylenchus pratensis Species 0.000 description 1
- 241001649229 Psoroptes Species 0.000 description 1
- 241001180370 Psylliodes chrysocephalus Species 0.000 description 1
- 241000382353 Pupa Species 0.000 description 1
- 241000932787 Pyrilla Species 0.000 description 1
- 241000219492 Quercus Species 0.000 description 1
- 241000201375 Radopholus similis Species 0.000 description 1
- 241001481704 Rhipicephalus appendiculatus Species 0.000 description 1
- 241000238680 Rhipicephalus microplus Species 0.000 description 1
- 241000722249 Rhodnius prolixus Species 0.000 description 1
- 241001249484 Rhodnius robustus Species 0.000 description 1
- 241000125167 Rhopalosiphum padi Species 0.000 description 1
- 241000344244 Rhynchophorus Species 0.000 description 1
- 241000314691 Rhysamphichloris similis Species 0.000 description 1
- 241001540480 Rotylenchulus Species 0.000 description 1
- 241000702971 Rotylenchulus reniformis Species 0.000 description 1
- 229920002531 Rubberwood Polymers 0.000 description 1
- NCLBXHJGKYIJFN-UHFFFAOYSA-N SOSOS Chemical compound SOSOS NCLBXHJGKYIJFN-UHFFFAOYSA-N 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000509416 Sarcoptes Species 0.000 description 1
- 241000509427 Sarcoptes scabiei Species 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- 241000722027 Schizaphis graminum Species 0.000 description 1
- 241001157779 Scutigera Species 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- 241000256103 Simuliidae Species 0.000 description 1
- 241000180219 Sitobion avenae Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 241001492664 Solenopsis <angiosperm> Species 0.000 description 1
- 241000209072 Sorghum Species 0.000 description 1
- 241000277984 Sparganothis pilleriana Species 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- 241000931755 Spodoptera exempta Species 0.000 description 1
- 241000985245 Spodoptera litura Species 0.000 description 1
- 235000009184 Spondias indica Nutrition 0.000 description 1
- 240000003949 Sporobolus virginicus Species 0.000 description 1
- 241000599723 Stewartia laotica Species 0.000 description 1
- 241001494139 Stomoxys Species 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- IDCBOTIENDVCBQ-UHFFFAOYSA-N TEPP Chemical compound CCOP(=O)(OCC)OP(=O)(OCC)OCC IDCBOTIENDVCBQ-UHFFFAOYSA-N 0.000 description 1
- 241000255628 Tabanidae Species 0.000 description 1
- 239000005938 Teflubenzuron Substances 0.000 description 1
- 241000254109 Tenebrio molitor Species 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- 241000223777 Theileria Species 0.000 description 1
- 241000130764 Tinea Species 0.000 description 1
- 208000002474 Tinea Diseases 0.000 description 1
- 241000333690 Tineola bisselliella Species 0.000 description 1
- 241000511627 Tipula paludosa Species 0.000 description 1
- 241000223996 Toxoplasma Species 0.000 description 1
- 241000018135 Trialeurodes Species 0.000 description 1
- 241000254086 Tribolium <beetle> Species 0.000 description 1
- 241001220305 Trichodorus primitivus Species 0.000 description 1
- 241001061558 Trichomonadidae Species 0.000 description 1
- 241000595935 Triops Species 0.000 description 1
- 241001267621 Tylenchulus semipenetrans Species 0.000 description 1
- 241000256856 Vespidae Species 0.000 description 1
- 241001274788 Viteus vitifoliae Species 0.000 description 1
- 241001530234 Wiseana Species 0.000 description 1
- 241000353223 Xenopsylla cheopis Species 0.000 description 1
- 241000201423 Xiphinema Species 0.000 description 1
- 241001423921 Xiphinema diversicaudatum Species 0.000 description 1
- 241001466337 Yponomeuta Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 241001414985 Zygentoma Species 0.000 description 1
- WSYCJUQXWOAKTL-UHFFFAOYSA-N [3-chloro-6-(trifluoromethyl)pyridin-2-yl]hydrazine Chemical compound NNC1=NC(C(F)(F)F)=CC=C1Cl WSYCJUQXWOAKTL-UHFFFAOYSA-N 0.000 description 1
- RNJDTXXKXAXYMK-UHFFFAOYSA-N [chloro(difluoro)methyl] thiohypochlorite Chemical compound FC(F)(Cl)SCl RNJDTXXKXAXYMK-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- YASYVMFAVPKPKE-UHFFFAOYSA-N acephate Chemical compound COP(=O)(SC)NC(C)=O YASYVMFAVPKPKE-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000009418 agronomic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 125000005360 alkyl sulfoxide group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- VXAUWWUXCIMFIM-UHFFFAOYSA-M aluminum;oxygen(2-);hydroxide Chemical compound [OH-].[O-2].[Al+3] VXAUWWUXCIMFIM-UHFFFAOYSA-M 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 210000003056 antler Anatomy 0.000 description 1
- 230000002824 aphicidal effect Effects 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- XEGGRYVFLWGFHI-UHFFFAOYSA-N bendiocarb Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)O2 XEGGRYVFLWGFHI-UHFFFAOYSA-N 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 1
- VBQDSLGFSUGBBE-UHFFFAOYSA-N benzyl(triethyl)azanium Chemical compound CC[N+](CC)(CC)CC1=CC=CC=C1 VBQDSLGFSUGBBE-UHFFFAOYSA-N 0.000 description 1
- 235000013361 beverage Nutrition 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- JLQUFIHWVLZVTJ-UHFFFAOYSA-N carbosulfan Chemical compound CCCCN(CCCC)SN(C)C(=O)OC1=CC=CC2=C1OC(C)(C)C2 JLQUFIHWVLZVTJ-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000010941 cobalt Chemical class 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical class [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Chemical class 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229960001591 cyfluthrin Drugs 0.000 description 1
- QQODLKZGRKWIFG-QSFXBCCZSA-N cyfluthrin Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)O[C@@H](C#N)C1=CC=C(F)C(OC=2C=CC=CC=2)=C1 QQODLKZGRKWIFG-QSFXBCCZSA-N 0.000 description 1
- 229960002483 decamethrin Drugs 0.000 description 1
- OWZREIFADZCYQD-NSHGMRRFSA-N deltamethrin Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OWZREIFADZCYQD-NSHGMRRFSA-N 0.000 description 1
- WEBQKRLKWNIYKK-UHFFFAOYSA-N demeton-S-methyl Chemical compound CCSCCSP(=O)(OC)OC WEBQKRLKWNIYKK-UHFFFAOYSA-N 0.000 description 1
- 239000002781 deodorant agent Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 1
- 229950001327 dichlorvos Drugs 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- FAXIJTUDSBIMHY-UHFFFAOYSA-N diethoxy-(2-ethylsulfanylethoxy)-sulfanylidene-$l^{5}-phosphane;1-diethoxyphosphorylsulfanyl-2-ethylsulfanylethane Chemical compound CCOP(=O)(OCC)SCCSCC.CCOP(=S)(OCC)OCCSCC FAXIJTUDSBIMHY-UHFFFAOYSA-N 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- 230000001079 digestive effect Effects 0.000 description 1
- OMBRFUXPXNIUCZ-UHFFFAOYSA-N dioxidonitrogen(1+) Chemical class O=[N+]=O OMBRFUXPXNIUCZ-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 239000004491 dispersible concentrate Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000002228 disulfide group Chemical group 0.000 description 1
- TXKMVPPZCYKFAC-UHFFFAOYSA-N disulfur monoxide Inorganic materials O=S=S TXKMVPPZCYKFAC-UHFFFAOYSA-N 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- RDYMFSUJUZBWLH-SVWSLYAFSA-N endosulfan Chemical compound C([C@@H]12)OS(=O)OC[C@@H]1[C@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl RDYMFSUJUZBWLH-SVWSLYAFSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- VJYFKVYYMZPMAB-UHFFFAOYSA-N ethoprophos Chemical compound CCCSP(=O)(OCC)SCCC VJYFKVYYMZPMAB-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- IDNUEBSJWINEMI-UHFFFAOYSA-N ethyl nitrate Chemical compound CCO[N+]([O-])=O IDNUEBSJWINEMI-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 150000002194 fatty esters Chemical class 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- ZCJPOPBZHLUFHF-UHFFFAOYSA-N fenamiphos Chemical compound CCOP(=O)(NC(C)C)OC1=CC=C(SC)C(C)=C1 ZCJPOPBZHLUFHF-UHFFFAOYSA-N 0.000 description 1
- ZNOLGFHPUIJIMJ-UHFFFAOYSA-N fenitrothion Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C(C)=C1 ZNOLGFHPUIJIMJ-UHFFFAOYSA-N 0.000 description 1
- XQUXKZZNEFRCAW-UHFFFAOYSA-N fenpropathrin Chemical compound CC1(C)C(C)(C)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 XQUXKZZNEFRCAW-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013332 fish product Nutrition 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- KVGLBTYUCJYMND-UHFFFAOYSA-N fonofos Chemical compound CCOP(=S)(CC)SC1=CC=CC=C1 KVGLBTYUCJYMND-UHFFFAOYSA-N 0.000 description 1
- 235000013373 food additive Nutrition 0.000 description 1
- 239000002778 food additive Substances 0.000 description 1
- 239000004459 forage Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- JLYXXMFPNIAWKQ-GNIYUCBRSA-N gamma-hexachlorocyclohexane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl JLYXXMFPNIAWKQ-GNIYUCBRSA-N 0.000 description 1
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N gamma-hexachlorocyclohexane Natural products ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 235000011868 grain product Nutrition 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 239000010903 husk Substances 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000009545 invasion Effects 0.000 description 1
- ONUFESLQCSAYKA-UHFFFAOYSA-N iprodione Chemical compound O=C1N(C(=O)NC(C)C)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 ONUFESLQCSAYKA-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 235000013980 iron oxide Nutrition 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- 230000000622 irritating effect Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000002655 kraft paper Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229960002809 lindane Drugs 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 230000003137 locomotive effect Effects 0.000 description 1
- 150000002680 magnesium Chemical class 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 235000013622 meat product Nutrition 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 150000001457 metallic cations Chemical group 0.000 description 1
- LRMHVVPPGGOAJQ-UHFFFAOYSA-N methyl nitrate Chemical compound CO[N+]([O-])=O LRMHVVPPGGOAJQ-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 229960001952 metrifonate Drugs 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000011785 micronutrient Substances 0.000 description 1
- 235000013369 micronutrients Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 239000012046 mixed solvent Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000013379 molasses Nutrition 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Chemical class 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229940042880 natural phospholipid Drugs 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- JCZMXVGQBBATMY-UHFFFAOYSA-N nitro acetate Chemical compound CC(=O)O[N+]([O-])=O JCZMXVGQBBATMY-UHFFFAOYSA-N 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 235000019645 odor Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 235000013348 organic food Nutrition 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000012430 organic reaction media Substances 0.000 description 1
- 231100000194 ovacidal Toxicity 0.000 description 1
- 230000003151 ovacidal effect Effects 0.000 description 1
- KZAUOCCYDRDERY-UHFFFAOYSA-N oxamyl Chemical compound CNC(=O)ON=C(SC)C(=O)N(C)C KZAUOCCYDRDERY-UHFFFAOYSA-N 0.000 description 1
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical class [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- LCCNCVORNKJIRZ-UHFFFAOYSA-N parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 description 1
- 238000009304 pastoral farming Methods 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 229960000490 permethrin Drugs 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- IOUNQDKNJZEDEP-UHFFFAOYSA-N phosalone Chemical compound C1=C(Cl)C=C2OC(=O)N(CSP(=S)(OCC)OCC)C2=C1 IOUNQDKNJZEDEP-UHFFFAOYSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- YFGYUFNIOHWBOB-UHFFFAOYSA-N pirimicarb Chemical compound CN(C)C(=O)OC1=NC(N(C)C)=NC(C)=C1C YFGYUFNIOHWBOB-UHFFFAOYSA-N 0.000 description 1
- QHOQHJPRIBSPCY-UHFFFAOYSA-N pirimiphos-methyl Chemical group CCN(CC)C1=NC(C)=CC(OP(=S)(OC)OC)=N1 QHOQHJPRIBSPCY-UHFFFAOYSA-N 0.000 description 1
- 238000009372 pisciculture Methods 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 244000000040 protozoan parasite Species 0.000 description 1
- 229960003351 prussian blue Drugs 0.000 description 1
- 239000013225 prussian blue Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- NWELCUKYUCBVKK-UHFFFAOYSA-N pyridin-2-ylhydrazine Chemical class NNC1=CC=CC=N1 NWELCUKYUCBVKK-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 230000002786 root growth Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- OEBIHOVSAMBXIB-SJKOYZFVSA-N selitrectinib Chemical compound C[C@@H]1CCC2=NC=C(F)C=C2[C@H]2CCCN2C2=NC3=C(C=NN3C=C2)C(=O)N1 OEBIHOVSAMBXIB-SJKOYZFVSA-N 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- CJDWRQLODFKPEL-UHFFFAOYSA-N teflubenzuron Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC1=CC(Cl)=C(F)C(Cl)=C1F CJDWRQLODFKPEL-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- AMFGTOFWMRQMEM-UHFFFAOYSA-N triazophos Chemical compound N1=C(OP(=S)(OCC)OCC)N=CN1C1=CC=CC=C1 AMFGTOFWMRQMEM-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- NFACJZMKEDPNKN-UHFFFAOYSA-N trichlorfon Chemical compound COP(=O)(OC)C(O)C(Cl)(Cl)Cl NFACJZMKEDPNKN-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000000230 xanthan gum Substances 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- 235000010493 xanthan gum Nutrition 0.000 description 1
- 229940082509 xanthan gum Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64353091A | 1991-01-18 | 1991-01-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| BG95776A BG95776A (en) | 1994-03-24 |
| BG61813B1 true BG61813B1 (bg) | 1998-06-30 |
Family
ID=24581208
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG95776A BG61813B1 (bg) | 1991-01-18 | 1992-01-17 | Пестицидни 1-(2-пиридил)пиразоли,методи за тяхното получаване, пестицидни средства и методи за използването им срещу вредители по културни растения |
Country Status (32)
| Country | Link |
|---|---|
| US (1) | US5306694A (cs) |
| EP (1) | EP0500209B1 (cs) |
| JP (1) | JP3140829B2 (cs) |
| KR (1) | KR100225658B1 (cs) |
| CN (2) | CN1041269C (cs) |
| AT (1) | ATE158290T1 (cs) |
| AU (1) | AU644259B2 (cs) |
| BG (1) | BG61813B1 (cs) |
| BR (1) | BR9200219A (cs) |
| CA (1) | CA2059088C (cs) |
| CZ (1) | CZ281976B6 (cs) |
| DE (1) | DE69222202T2 (cs) |
| DK (1) | DK0500209T3 (cs) |
| EG (1) | EG19658A (cs) |
| ES (1) | ES2106821T3 (cs) |
| FI (1) | FI105028B (cs) |
| GR (1) | GR3025572T3 (cs) |
| HU (1) | HU208534B (cs) |
| IE (1) | IE920146A1 (cs) |
| IL (1) | IL100678A (cs) |
| MA (1) | MA22390A1 (cs) |
| MX (1) | MX9200182A (cs) |
| MY (1) | MY108659A (cs) |
| NO (1) | NO179282C (cs) |
| NZ (1) | NZ241314A (cs) |
| OA (1) | OA09756A (cs) |
| PL (1) | PL168730B1 (cs) |
| RO (1) | RO109940B1 (cs) |
| RU (1) | RU2088580C1 (cs) |
| TR (1) | TR25675A (cs) |
| UY (1) | UY23358A1 (cs) |
| ZW (1) | ZW1192A1 (cs) |
Families Citing this family (99)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6426333B1 (en) | 1996-09-19 | 2002-07-30 | Merial | Spot-on formulations for combating parasites |
| FR2753377B1 (fr) * | 1996-09-19 | 1999-09-24 | Rhone Merieux | Nouvelle association parasiticide a base de 1-n-phenylpyra- zoles et de lactones macrocycliques endectocides |
| DE4414333A1 (de) * | 1994-04-25 | 1995-10-26 | Bayer Ag | Substituierte Pyridylpyrazole |
| FR2731875B1 (fr) * | 1995-03-24 | 1997-04-30 | Rhone Poulenc Agrochimie | Procede de lutte contre les acridiens |
| US6001859A (en) * | 1995-03-24 | 1999-12-14 | Rhone-Poulenc Agrochimie | Method for controlling acridians |
| GB9507073D0 (en) * | 1995-04-05 | 1995-05-31 | Rhone Poulenc Agriculture | New method of combating insects |
| US5629335A (en) * | 1995-04-07 | 1997-05-13 | Rhone-Poulenc Inc. | Pesticidal 1-arylpyrazole-3-carboximidothioic acid esters |
| US5614182A (en) * | 1995-04-10 | 1997-03-25 | Rhone-Poulenc Inc. | Methods of attracting and combatting insects |
| FR2733120B1 (fr) * | 1995-04-19 | 2002-09-13 | Rhone Poulenc Agrochimie | Protection des cultures contre les oiseaux a l'aide d'un compose de type phenylpyrazole |
| US5707934A (en) * | 1995-04-28 | 1998-01-13 | Rhone-Poulenc Inc. | Plant growth regulation using 3-cyano-1-phenylpyrazoles such as fipronil |
| US5696144A (en) * | 1995-05-01 | 1997-12-09 | Rhone-Poulenc Inc. | Protection of corn |
| AUPN328395A0 (en) * | 1995-05-31 | 1995-06-22 | Rhone-Poulenc Rural Australia Pty Ltd | Insecticide |
| AU708045B2 (en) * | 1995-05-31 | 1999-07-29 | Rhone-Poulenc Agrochimie | A method for controlling flies infesting mushrooms by using a N-arylpyrazole or a N-heteroarylpyrazole compound |
| US6060502A (en) * | 1995-06-05 | 2000-05-09 | Rhone-Poulenc Agrochimie | Pesticidal sulfur compounds |
| US6136983A (en) * | 1995-06-05 | 2000-10-24 | Rhone-Poulenc Agrochimie | Pesticidal sulfur compounds |
| US6060495A (en) * | 1995-06-05 | 2000-05-09 | Rhone-Poulenc Agrochimie | Pesticidal sulfur compounds |
| FR2735950B1 (fr) * | 1995-06-29 | 1997-08-01 | Rhone Poulenc Agrochimie | Compositions insecticides a base d'un derive de phenylpyrazole pour lutter notamment contre les fourmis |
| FR2735952B1 (fr) * | 1995-06-29 | 1997-08-01 | Rhone Poulenc Agrochimie | Procede de controle d'une population d'insectes sociaux |
| DE19530606A1 (de) * | 1995-08-21 | 1997-02-27 | Basf Ag | 1-(Pyridyl)-pyrazole |
| JPH0987111A (ja) * | 1995-09-27 | 1997-03-31 | Sumitomo Chem Co Ltd | 害虫駆除用毒餌剤 |
| FR2739255B1 (fr) * | 1995-09-29 | 1998-09-04 | Rhone Merieux | Composition antiparasitaire pour le traitement et la protection des animaux de compagnie |
| US5817688A (en) * | 1995-12-19 | 1998-10-06 | Rhone-Poulenc Inc. | Pesticidal 1-arylpyrazole derivatives |
| ES2191076T3 (es) * | 1995-12-19 | 2003-09-01 | Bayer Cropscience Sa | Nuevos derivados de 1-aril-pirazol y su empleo como plaguicidas. |
| US5922885A (en) * | 1995-12-19 | 1999-07-13 | Rhone-Poulenc Inc. | Pesticidal 1-arylpyrazole derivatives |
| AU1555797A (en) | 1996-01-30 | 1997-08-22 | Takeda Chemical Industries Ltd. | Arylpyrazole insecticides |
| FR2745467A1 (fr) * | 1996-03-04 | 1997-09-05 | Rhone Poulenc Agrochimie | Pyrazoles contre les virus des plantes |
| FR2745466B1 (fr) * | 1996-03-04 | 1998-04-10 | Rhone Poulenc Agrochimie | Pyrazoles fongicides |
| FR2745469B1 (fr) * | 1996-03-04 | 1998-09-18 | Rhone Poulenc Agrochimie | Pyrazoles fongicides |
| FR2745468B1 (fr) * | 1996-03-04 | 1998-04-10 | Rhone Poulenc Agrochimie | Pyrazoles aphicides |
| FR2745470B1 (fr) * | 1996-03-04 | 1998-04-10 | Rhone Poulenc Agrochimie | Pyrazoles aphicides |
| FR2746593B1 (fr) * | 1996-03-26 | 1998-06-05 | Rhone Poulenc Agrochimie | Procede de lutte contre le charancon rouge des palmiers |
| IE80657B1 (en) * | 1996-03-29 | 1998-11-04 | Merial Sas | Insecticidal combination to control mammal fleas in particular fleas on cats and dogs |
| IE970215A1 (en) * | 1996-03-29 | 1997-10-08 | Rhone Merieux | Direct pour-on skin solution for antiparasitic use in cattle¹and sheep |
| AU769273B2 (en) * | 1996-03-29 | 2004-01-22 | Merial | External anti-parasitic device containing N-phenylpyrazole, particularly an earring for use on cattle |
| FR2746584B1 (fr) * | 1996-03-29 | 1998-08-28 | Rhone Merieux | Dispositif externe anti-parasitaire pour bovins a base de n-phenylpyrazole, en particulier boucles auriculaires |
| US6010710A (en) * | 1996-03-29 | 2000-01-04 | Merial | Direct pour-on skin solution for antiparasitic use in cattle and sheep |
| AU769668C (en) * | 1996-03-29 | 2007-03-15 | Merial | Flea and tick control collar containing N-phenylpyrazole for use on cats and dogs |
| AU2003257646B2 (en) * | 1996-03-29 | 2006-03-30 | Merial | Direct pour-on skin solution for anitparasitic use in cattle and sheep |
| GR1002899B (el) * | 1996-03-29 | 1998-05-11 | Rhone Merieux | Περιλαιμιο κατα ψυλλων και κροτωνων για σκυλους και γατες, με βαση ν-φαινυλπυραζολη |
| FR2746594B1 (fr) * | 1996-03-29 | 1998-08-28 | Rhone Merieux | Association insecticide contre les puces des mammiferes, notamment des chiens et chats |
| FR2746585B1 (fr) * | 1996-03-29 | 1998-07-03 | Rhone Merieux | Collier anti-puces et anti-tiques pour chien et chat, a base de n-phenylpyrazole |
| FR2746595B1 (fr) * | 1996-03-29 | 1998-07-03 | Rhone Merieux | Solution cutanee pour depot direct a usage anti-parasitaire chez les bovins et ovins |
| GR970100096A (el) * | 1996-03-29 | 1997-11-28 | Merial | Εξωτερικη διαταξη κατα των παρασιτων για βοοειδη με βαση τη ν-φαινυλπυραζολη, ειδικα σκουλαρικια. |
| FR2747067B1 (fr) * | 1996-04-09 | 1998-04-30 | Rhone Poulenc Agrochimie | Materiaux a base de bois contreplaque traites a l'aide d'un insecticide pyrazole |
| US20030049293A1 (en) * | 1996-04-09 | 2003-03-13 | Sylvestre Jobic | Wood glue incorporating an insecticide |
| FR2748503B1 (fr) * | 1996-05-10 | 2001-03-02 | Rhone Poulenc Agrochimie | Utilisation de 1-phenyl pyrazole pour la protection de materiau composite contre les termites |
| FR2750860B1 (fr) * | 1996-07-11 | 1998-12-04 | Rhone Merieux | Procedes d'elimination des parasites, et notamment des ectoparasites de vertebres, notamment de mammiferes et compositions pour la mise en oeuvre de ce procede |
| AU773119B2 (en) * | 1996-07-11 | 2004-05-20 | Merial | Methods for eliminating parasites and in particular ectoparasites of vertebrates, particularly of mammals and compositions for implementing these methods |
| FR2750861B1 (fr) * | 1996-07-11 | 1998-12-24 | Rhone Merieux | Procedes d'elimination des parasites, et notamment des ectoparasites de vertebres, notamment de mammiferes et compositions pour la mise en oeuvre de ce procede |
| NZ333808A (en) * | 1996-07-23 | 2000-06-23 | Merial Sas | Process and composition for the antiparasitic treatment of the surroundings of animals by treating their litter with 1-arylpyrazole insecticides |
| US20050192319A1 (en) * | 1996-09-19 | 2005-09-01 | Albert Boeckh | Spot-on formulations for combating parasites |
| US6998131B2 (en) | 1996-09-19 | 2006-02-14 | Merial Limited | Spot-on formulations for combating parasites |
| ATE224878T1 (de) * | 1996-11-04 | 2002-10-15 | Aventis Cropscience Sa | 1-polyarylpyrazole als pestizide |
| KR20000062318A (ko) * | 1996-12-24 | 2000-10-25 | 제닌 페트릭 | 살충성 1-아릴 및 피리딜피라졸 유도체 |
| CO5060426A1 (es) * | 1997-03-10 | 2001-07-30 | Rhone Poulenc Agrochimie | 1-aril-3-imidiopirazoles plaguicidas |
| ZA981776B (en) | 1997-03-10 | 1998-09-03 | Rhone Poulenc Agrochimie | Pesticidal 1-arylpyrazoles |
| EP1084117A2 (en) * | 1998-04-08 | 2001-03-21 | Novartis AG | Novel herbicides |
| BR9909487A (pt) * | 1998-04-08 | 2000-12-12 | Novartis Ag | Herbicidas de n-piridonila |
| CA2328832C (en) * | 1998-04-20 | 2009-10-20 | Aventis Agriculture Ltd. | Processes for preparing pesticidal intermediates |
| AU746667B2 (en) | 1998-04-28 | 2002-05-02 | Novartis Ag | Novel herbicides |
| ES2280087T3 (es) * | 1998-05-07 | 2007-09-01 | Basf Agro B.V., Arnhem (Nl), Wadenswil-Branch | Metodo plaguicida. |
| EP0968651A1 (en) * | 1998-07-01 | 2000-01-05 | Rhone-Poulenc Agriculture Ltd. | Pesticidal method and composition |
| DE69923585T2 (de) | 1998-11-05 | 2006-03-23 | Fukuju Kogyo K.K., Hashima | Element von metallriemen |
| DE19853560A1 (de) * | 1998-11-20 | 2000-05-25 | Bayer Ag | Verfahren zur Herstellung von 5-Amino-3-(thio)carbamoylpyrazolen |
| AR021608A1 (es) * | 1998-12-11 | 2002-07-31 | Merial Ltd | Represion de artropodos en animales |
| US6506784B1 (en) | 1999-07-01 | 2003-01-14 | 3-Dimensional Pharmaceuticals, Inc. | Use of 1,3-substituted pyrazol-5-yl sulfonates as pesticides |
| US6409988B1 (en) | 1999-07-01 | 2002-06-25 | 3-Dimensional Pharmaceuticals, Inc. | Radiolabeled 1-aryl pyrazoles, the synthesis thereof and the use thereof as pest GABA receptor ligands |
| WO2001007413A1 (en) | 1999-07-22 | 2001-02-01 | 3-Dimensional Pharmaceuticals, Inc. | 1-aryl-3-thioalkyl pyrazoles, the synthesis thereof and the use thereof as insecticides |
| AU7865000A (en) | 1999-10-06 | 2001-05-10 | 3-Dimensional Pharmaceuticals, Inc. | Fused 1-(2,6-dichloro-4-trifluoromethylphenyl)-pyrazoles, the synthesis thereof and the use thereof as pesticides |
| JP4954425B2 (ja) | 2000-06-09 | 2012-06-13 | メリアル・リミテツド | 農薬化合物の調製方法 |
| JP4868103B2 (ja) * | 2000-07-31 | 2012-02-01 | 日本農薬株式会社 | ピラゾール誘導体及びこれを有効成分とする有害生物防除剤並びにその製造方法 |
| RU2197086C2 (ru) * | 2001-04-13 | 2003-01-27 | Парфенова Татьяна Аркадьевна | Средство для уничтожения клещей бытовой пыли |
| RU2426730C2 (ru) * | 2001-04-18 | 2011-08-20 | Эро-Селтик, С.А. | Аналоги ноцицептина |
| RU2283840C2 (ru) * | 2001-08-13 | 2006-09-20 | Е.И.Дюпон Де Немур Энд Компани | Антраниламидное соединение, композиция для борьбы с насекомыми, композиция для борьбы с беспозвоночными вредителями, способы борьбы с насекомыми, промежуточные соединения |
| TWI312274B (en) * | 2001-08-13 | 2009-07-21 | Du Pont | Method for controlling particular insect pests by applying anthranilamide compounds |
| TWI283164B (en) * | 2001-09-21 | 2007-07-01 | Du Pont | Anthranilamide arthropodicide treatment |
| BR0213646A (pt) * | 2001-10-15 | 2004-08-24 | Du Pont | Método, compostos e composição para controle de pragas invertebradas |
| BRPI0316996B8 (pt) * | 2002-12-03 | 2022-08-23 | Bayer Cropscience Sa | Derivados de 1-aril-3-amidoxima-pirazol pesticida |
| ME00495B (me) * | 2003-01-28 | 2011-10-10 | Du Pont | Cijano antranilamidni insekticidi |
| ZA200601794B (en) | 2003-09-04 | 2007-04-25 | Bayer Cropscience Sa | Pesticidal 5-substituted-oxyalkylamino-1-arylpyrazole derivatives |
| US7531186B2 (en) | 2003-12-17 | 2009-05-12 | Merial Limited | Topical formulations comprising 1-N-arylpyrazole derivatives and amitraz |
| AR048669A1 (es) * | 2004-03-03 | 2006-05-17 | Syngenta Ltd | Derivados biciclicos de bisamida |
| GB0422556D0 (en) * | 2004-10-11 | 2004-11-10 | Syngenta Participations Ag | Novel insecticides |
| TW200820902A (en) * | 2006-11-08 | 2008-05-16 | Dow Agrosciences Llc | Use of N-substituted sulfoximines for control of invertebrate pests |
| EP2189455A4 (en) * | 2007-08-14 | 2011-10-19 | Sumitomo Chemical Co | METHOD FOR PRODUCING A HYDRAZINE COMPOUND, INTERMEDIATE PRODUCT FOR PRODUCING THE HYDRAZIN COMPOUND AND METHOD FOR PRODUCING THE INTERMEDIATE PRODUCT |
| US8198461B2 (en) * | 2008-05-08 | 2012-06-12 | Ampac Fine Chemicals Llc. | Process for the preparation of 3-cyano-1,2,4-triazoles |
| US9173728B2 (en) | 2008-11-19 | 2015-11-03 | Merial Inc. | Multi-cavity container having offset indentures for dispensing fluids |
| RU2011124948A (ru) | 2008-11-19 | 2012-12-27 | Мериал Лимитед | Композиции, включающие 1-арилпиразол сам по себе или в комбинации с формамидином, для лечения паразитарных инфекций |
| AU2010224685A1 (en) | 2009-03-18 | 2011-11-03 | Fidopharm, Inc. | Parasiticidal formulation |
| EP2243777A1 (de) * | 2009-04-03 | 2010-10-27 | Bayer CropScience AG | Verfahren zum Herstellen von Pyridyl-substituierten Pyrazolen |
| UA108641C2 (uk) | 2010-04-02 | 2015-05-25 | Паразитицидна композиція, яка містить чотири активних агенти, та спосіб її застосування | |
| DK178513B1 (da) * | 2011-01-07 | 2016-04-25 | Merial Sas | Præparat indeholdende insekticid kombination til anvendelse mod blodmider hos pattedyr, især katte og hunde |
| CN103347873A (zh) * | 2011-02-09 | 2013-10-09 | 日产化学工业株式会社 | 吡唑衍生物和有害生物防除剂 |
| EP2780008B1 (en) | 2011-11-17 | 2017-07-05 | Merial, Inc. | Compositions comprising an aryl pyrazole and a substituted imidazole, methods and uses thereof |
| TWI579274B (zh) | 2012-04-20 | 2017-04-21 | 龍馬躍公司 | 製備1-芳基-5-烷基吡唑化合物的改良方法 |
| US20140275565A1 (en) * | 2013-03-13 | 2014-09-18 | Dow Agrosciences Llc | Process for the preparation of certain triaryl rhamnose carbamates |
| US20140275502A1 (en) * | 2013-03-13 | 2014-09-18 | Dow Agrosciences Llc | Process for the preparation of certain triaryl rhamnose carbamates |
| WO2016069983A1 (en) | 2014-10-31 | 2016-05-06 | Merial, Inc. | Parasiticidal composition comprising fipronil |
| KR101856444B1 (ko) * | 2017-04-20 | 2018-05-10 | 압타바이오 주식회사 | 3-페닐-4-프로필-1-(피리딘-2-일)-1h-피라졸-5-올 염산염의 신규 결정형 고체 화합물 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4622330A (en) * | 1982-12-20 | 1986-11-11 | Merck & Co., Inc. | Antiprotozoal 3-amino or substituted amino pyrazoles |
| GB2136427B (en) * | 1983-03-09 | 1986-07-09 | May & Baker Ltd | Herbicidal n-pyridylpyrazole derivatives |
| DE3602728A1 (de) * | 1985-05-17 | 1986-11-20 | Bayer Ag, 51373 Leverkusen | Schaedlingsbekaempfungsmittel auf basis von pyrazolderivaten |
| DE3520330A1 (de) * | 1985-06-07 | 1986-12-11 | Bayer Ag, 5090 Leverkusen | 5-amino-1-pyridyl-pyrazole |
| GB8531485D0 (en) * | 1985-12-20 | 1986-02-05 | May & Baker Ltd | Compositions of matter |
| GB8713768D0 (en) * | 1987-06-12 | 1987-07-15 | May & Baker Ltd | Compositions of matter |
| DE3617554A1 (de) * | 1986-05-24 | 1987-11-26 | Bayer Ag | 5-oxy(thio)-pyrazol-derivate |
| DE3625686A1 (de) * | 1986-07-30 | 1988-02-04 | Bayer Ag | 4-cyano(nitro)-5-oxy(thio)-pyrazol-derivate |
| JPH07106964B2 (ja) * | 1987-01-14 | 1995-11-15 | 株式会社トクヤマ | 摘果剤 |
| JPS63233977A (ja) * | 1987-03-23 | 1988-09-29 | Otsuka Chem Co Ltd | ピラゾ−ル誘導体、その製造方法及び該誘導体を有効成分とする除草剤 |
| JPS63313773A (ja) * | 1987-06-16 | 1988-12-21 | Tokuyama Soda Co Ltd | ピラゾ−ル化合物 |
| DE3724920A1 (de) * | 1987-07-28 | 1989-02-09 | Bayer Ag | Substituierte 1-aryl-5-(het)arylmethylamino-pyrazole |
| DE68926016T2 (de) * | 1988-10-27 | 1996-09-19 | Nissan Chemical Ind Ltd | Halogeno-4-Methylpyrazole und Verfahren zu ihrer Herstellung |
| JPH02142785A (ja) * | 1988-11-22 | 1990-05-31 | Mitsubishi Petrochem Co Ltd | 5−アミノ−4−クロロ−1−ピリジルピラゾール誘導体 |
| US4918085A (en) * | 1989-03-02 | 1990-04-17 | Rhone-Poulenc Ag Company | Pesticidal 3-cyano-5-alkoxy-1-arylpyrazoles, compositions and use |
| PH27357A (en) * | 1989-09-22 | 1993-06-21 | Fujisawa Pharmaceutical Co | Pyrazole derivatives and pharmaceutical compositions comprising the same |
-
1992
- 1992-01-08 NO NO920097A patent/NO179282C/no not_active IP Right Cessation
- 1992-01-09 CA CA002059088A patent/CA2059088C/en not_active Expired - Lifetime
- 1992-01-15 MA MA22675A patent/MA22390A1/fr unknown
- 1992-01-15 AU AU10251/92A patent/AU644259B2/en not_active Expired
- 1992-01-15 NZ NZ241314A patent/NZ241314A/en not_active IP Right Cessation
- 1992-01-16 MY MYPI92000074A patent/MY108659A/en unknown
- 1992-01-16 CZ CS92130A patent/CZ281976B6/cs not_active IP Right Cessation
- 1992-01-16 MX MX9200182A patent/MX9200182A/es unknown
- 1992-01-16 IL IL10067892A patent/IL100678A/en not_active IP Right Cessation
- 1992-01-16 BR BR929200219A patent/BR9200219A/pt not_active IP Right Cessation
- 1992-01-16 EG EG3092A patent/EG19658A/xx active
- 1992-01-16 ZW ZW11/92A patent/ZW1192A1/xx unknown
- 1992-01-17 OA OA60130A patent/OA09756A/fr unknown
- 1992-01-17 TR TR92/0075A patent/TR25675A/xx unknown
- 1992-01-17 BG BG95776A patent/BG61813B1/bg unknown
- 1992-01-17 PL PL92293228A patent/PL168730B1/pl unknown
- 1992-01-17 RU SU925010813A patent/RU2088580C1/ru active
- 1992-01-17 HU HU9200170A patent/HU208534B/hu unknown
- 1992-01-17 RO RO149204A patent/RO109940B1/ro unknown
- 1992-01-17 IE IE014692A patent/IE920146A1/en unknown
- 1992-01-17 JP JP04044353A patent/JP3140829B2/ja not_active Expired - Lifetime
- 1992-01-17 FI FI920221A patent/FI105028B/fi active
- 1992-01-18 KR KR1019920000700A patent/KR100225658B1/ko not_active Expired - Lifetime
- 1992-01-18 CN CN92100330A patent/CN1041269C/zh not_active Expired - Lifetime
- 1992-01-20 DK DK92300467.5T patent/DK0500209T3/da active
- 1992-01-20 AT AT92300467T patent/ATE158290T1/de not_active IP Right Cessation
- 1992-01-20 ES ES92300467T patent/ES2106821T3/es not_active Expired - Lifetime
- 1992-01-20 UY UY23358A patent/UY23358A1/es unknown
- 1992-01-20 DE DE69222202T patent/DE69222202T2/de not_active Expired - Lifetime
- 1992-01-20 EP EP92300467A patent/EP0500209B1/en not_active Expired - Lifetime
-
1993
- 1993-06-17 US US08/079,221 patent/US5306694A/en not_active Expired - Lifetime
-
1997
- 1997-12-02 GR GR970403222T patent/GR3025572T3/el unknown
-
1998
- 1998-04-08 CN CN98106376A patent/CN1103771C/zh not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3140829B2 (ja) | 殺虫性1−(2−ピリジル)ピラゾール | |
| JP2963484B2 (ja) | 3‐シアノ‐5‐アルコキシ‐1‐アリールピラゾール殺虫剤 | |
| RU2088576C1 (ru) | Производные 1-арил-5-(замещенного метилиденимино)пиразола, способ борьбы с вредными насекомыми и инсектицидная композиция | |
| AU653722B2 (en) | Pesticidal 1-arylpyrroles | |
| DE69132687T2 (de) | Pestizide 1-Arylimidazole | |
| DE69627281T2 (de) | Neue 1-Aryl Pyrazol Derivate und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| JP3078556B2 (ja) | ピロール殺虫剤 | |
| JP2943993B2 (ja) | 農薬としての1―アリールイミダゾール | |
| NO303631B1 (no) | Nye pyrazolforbindelser, deres anvendelse samt en pesticid blanding | |
| BG60842B1 (bg) | Производни на пирола, методи за получаване и приложение |