AT310750B - Verfahren zur Herstellung von neuen Thiolactamverbindungen und deren Salzen - Google Patents
Verfahren zur Herstellung von neuen Thiolactamverbindungen und deren SalzenInfo
- Publication number
- AT310750B AT310750B AT654871A AT654871A AT310750B AT 310750 B AT310750 B AT 310750B AT 654871 A AT654871 A AT 654871A AT 654871 A AT654871 A AT 654871A AT 310750 B AT310750 B AT 310750B
- Authority
- AT
- Austria
- Prior art keywords
- sep
- carbon atoms
- new
- salts
- preparation
- Prior art date
Links
- -1 thiolactam compounds Chemical class 0.000 title description 5
- 150000003839 salts Chemical class 0.000 title description 4
- 238000000034 method Methods 0.000 title description 2
- 238000002360 preparation method Methods 0.000 title description 2
- 229910052945 inorganic sulfide Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 125000003710 aryl alkyl group Chemical group 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical group 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 208000025865 Ulcer Diseases 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000002496 gastric effect Effects 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003449 preventive effect Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 231100000397 ulcer Toxicity 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- XEQXBUHZDFKDDT-UHFFFAOYSA-N 3-phenylpiperidin-2-one Chemical compound O=C1NCCCC1C1=CC=CC=C1 XEQXBUHZDFKDDT-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- AAPJPRURJAVYBR-UHFFFAOYSA-N 3-pyridin-2-ylpiperidine-2-thione Chemical compound N1=C(C=CC=C1)C1C(NCCC1)=S AAPJPRURJAVYBR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 230000001078 anti-cholinergic effect Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 150000003571 thiolactams Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6704970A JPS503314B1 (https=) | 1970-07-30 | 1970-07-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT310750B true AT310750B (de) | 1973-10-10 |
Family
ID=13333583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT654871A AT310750B (de) | 1970-07-30 | 1971-07-27 | Verfahren zur Herstellung von neuen Thiolactamverbindungen und deren Salzen |
Country Status (2)
| Country | Link |
|---|---|
| JP (1) | JPS503314B1 (https=) |
| AT (1) | AT310750B (https=) |
-
1970
- 1970-07-30 JP JP6704970A patent/JPS503314B1/ja active Pending
-
1971
- 1971-07-27 AT AT654871A patent/AT310750B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS503314B1 (https=) | 1975-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT310750B (de) | Verfahren zur Herstellung von neuen Thiolactamverbindungen und deren Salzen | |
| DE2127734A1 (de) | Neue Nitrofuranderivate und Verfahren zu ihrer Herstellung | |
| DE1251330B (de) | Verfahren zur Herstellung von Nickel Amm Komplexen von 2 2 -Thiobis (p alkylphenolen) | |
| DE2128941A1 (de) | Neue Derivate des 2 Amino 5 Chlor Thiazols | |
| DE2114884A1 (de) | Basisch substituierte Derivate des 1(2H)-Phthalazinons | |
| DE1158082B (de) | Verfahren zur Herstellung von Alkylendiaminderivaten und deren Salzen | |
| AT203501B (de) | Verfahren zur Herstellung neuer Derivate des Piperazins | |
| AT238168B (de) | Verfahren zur Herstellung von N-(2,3-Dimethylphenyl)-anthranilsäure und deren Salzen | |
| AT355023B (de) | Verfahren zur herstellung von benzo(a) chinolizidin-derivaten und deren salzen | |
| AT323154B (de) | Verfahren zur herstellung von neuen 5-methoxy-2-methylindol-3-essigsäurederivaten sowie von deren salzen | |
| AT360514B (de) | Verfahren zur herstellung von neuen 4-hydroxy- indol-derivaten und ihren salzen | |
| AT236952B (de) | Verfahren zur Herstellung von neuen Estern von quaternären Ammoniumverbindungen | |
| AT387572B (de) | Verfahren zur herstellung von neuen 4-(4,4-bis-(p-fluorphenyl)-butyl)-1-carbophenox -piperazinen und von 1-piperazincarboxamiden | |
| CH533619A (de) | Verfahren zur Herstellung von Pyrrolderivaten | |
| AT317196B (de) | Verfahren zur Herstellung neuer 1-Benzoyloxy-2-niedrig-alkylaminobenzocycloalkanderivate | |
| AT223619B (de) | Verfahren zur Herstellung von 3,4-Dihydro-1,2,4-benzothiadiazin-1,1-dioxyden | |
| AT266137B (de) | Verfahren zur Herstellung neuer Pyridyl-dihydroisochinoline sowie von deren Salzen | |
| AT211823B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| AT270673B (de) | Verfahren zur Herstellung von neuen substituierten Aminen oder deren Salzen | |
| AT281822B (de) | Verfahren zur Herstellung neuer Zimtsäureamide | |
| AT229321B (de) | Verfahren zur Herstellung von neuen Phenthiazinderivaten und deren Salzen | |
| AT356670B (de) | Verfahren zur herstellung von neuen trisguanyl- hydrazoniumsalzen | |
| AT319483B (de) | Verfahren zur Herstellung von neuen Morphinanderivaten | |
| AT280269B (de) | Verfahren zur Herstellung von Succinimid-Derivaten und ihren Salzen | |
| AT284850B (de) | Verfahren zur Herstellung von neuen N-(Cycloalkyloxy-alkyl)-piperazinderivaten, ihren Salzen und quartären Derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |