US3856513A - Novel amorphous metals and amorphous metal articles - Google Patents
Novel amorphous metals and amorphous metal articles Download PDFInfo
- Publication number
- US3856513A US3856513A US00318146A US31814672A US3856513A US 3856513 A US3856513 A US 3856513A US 00318146 A US00318146 A US 00318146A US 31814672 A US31814672 A US 31814672A US 3856513 A US3856513 A US 3856513A
- Authority
- US
- United States
- Prior art keywords
- amorphous
- metal
- alloys
- compositions
- alloy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 229910052751 metal Inorganic materials 0.000 title claims abstract description 47
- 239000002184 metal Substances 0.000 title claims abstract description 47
- 150000002739 metals Chemical class 0.000 title claims abstract description 15
- 239000005300 metallic glass Substances 0.000 title claims description 25
- 229910045601 alloy Inorganic materials 0.000 claims abstract description 71
- 239000000956 alloy Substances 0.000 claims abstract description 71
- 239000000203 mixture Substances 0.000 claims abstract description 67
- 238000004519 manufacturing process Methods 0.000 claims abstract description 13
- 229910000808 amorphous metal alloy Inorganic materials 0.000 claims abstract description 10
- 229910001092 metal group alloy Inorganic materials 0.000 claims abstract description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 27
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 16
- 229910052742 iron Inorganic materials 0.000 claims description 14
- 229910052782 aluminium Inorganic materials 0.000 claims description 13
- 229910052799 carbon Inorganic materials 0.000 claims description 13
- 229910052710 silicon Inorganic materials 0.000 claims description 13
- 229910052698 phosphorus Inorganic materials 0.000 claims description 12
- 229910052787 antimony Inorganic materials 0.000 claims description 10
- 229910052718 tin Inorganic materials 0.000 claims description 10
- 229910052723 transition metal Inorganic materials 0.000 claims description 10
- 150000003624 transition metals Chemical group 0.000 claims description 10
- 239000011651 chromium Substances 0.000 claims description 9
- 229910052759 nickel Inorganic materials 0.000 claims description 9
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 8
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 8
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 8
- 229910052790 beryllium Inorganic materials 0.000 claims description 8
- 229910052804 chromium Inorganic materials 0.000 claims description 8
- 229910052732 germanium Inorganic materials 0.000 claims description 8
- 229910052738 indium Inorganic materials 0.000 claims description 8
- 239000010703 silicon Substances 0.000 claims description 8
- 239000011135 tin Substances 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 7
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 claims description 7
- 229910052796 boron Inorganic materials 0.000 claims description 7
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 7
- 239000011574 phosphorus Substances 0.000 claims description 7
- 239000000843 powder Substances 0.000 claims description 7
- 229910052720 vanadium Inorganic materials 0.000 claims description 7
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 6
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 6
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 5
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- 229910052752 metalloid Inorganic materials 0.000 claims description 4
- 150000002738 metalloids Chemical class 0.000 claims description 4
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 4
- 230000000704 physical effect Effects 0.000 abstract description 5
- 238000000034 method Methods 0.000 description 35
- 238000010791 quenching Methods 0.000 description 20
- 238000001816 cooling Methods 0.000 description 16
- 230000000171 quenching effect Effects 0.000 description 12
- 239000007788 liquid Substances 0.000 description 10
- 238000002441 X-ray diffraction Methods 0.000 description 9
- 239000000155 melt Substances 0.000 description 9
- 239000012267 brine Substances 0.000 description 7
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 229910052802 copper Inorganic materials 0.000 description 6
- 239000010949 copper Substances 0.000 description 6
- 230000007797 corrosion Effects 0.000 description 6
- 238000005260 corrosion Methods 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 238000000151 deposition Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- 238000005452 bending Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 230000008021 deposition Effects 0.000 description 3
- 239000005350 fused silica glass Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 230000009477 glass transition Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 230000002787 reinforcement Effects 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 238000007496 glass forming Methods 0.000 description 2
- 229910052735 hafnium Inorganic materials 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 238000003892 spreading Methods 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- 229910001339 C alloy Inorganic materials 0.000 description 1
- 229910020630 Co Ni Inorganic materials 0.000 description 1
- 101100234002 Drosophila melanogaster Shal gene Proteins 0.000 description 1
- 229910000640 Fe alloy Inorganic materials 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910000990 Ni alloy Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 235000015076 Shorea robusta Nutrition 0.000 description 1
- 244000166071 Shorea robusta Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 229910052767 actinium Inorganic materials 0.000 description 1
- QQINRWTZWGJFDB-UHFFFAOYSA-N actinium atom Chemical compound [Ac] QQINRWTZWGJFDB-UHFFFAOYSA-N 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000012993 chemical processing Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000004070 electrodeposition Methods 0.000 description 1
- 238000002003 electron diffraction Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- -1 germa' nium Chemical compound 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- 238000000386 microscopy Methods 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 229910052713 technetium Inorganic materials 0.000 description 1
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 1
- 238000002076 thermal analysis method Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K9/00—Screening of apparatus or components against electric or magnetic fields
- H05K9/0073—Shielding materials
- H05K9/0081—Electromagnetic shielding materials, e.g. EMI, RFI shielding
- H05K9/009—Electromagnetic shielding materials, e.g. EMI, RFI shielding comprising electro-conductive fibres, e.g. metal fibres, carbon fibres, metallised textile fibres, electro-conductive mesh, woven, non-woven mat, fleece, cross-linked
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D11/00—Continuous casting of metals, i.e. casting in indefinite lengths
- B22D11/005—Continuous casting of metals, i.e. casting in indefinite lengths of wire
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C19/00—Alloys based on nickel or cobalt
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C27/00—Alloys based on rhenium or a refractory metal not mentioned in groups C22C14/00 or C22C16/00
- C22C27/02—Alloys based on vanadium, niobium, or tantalum
- C22C27/025—Alloys based on vanadium, niobium, or tantalum alloys based on vanadium
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C27/00—Alloys based on rhenium or a refractory metal not mentioned in groups C22C14/00 or C22C16/00
- C22C27/06—Alloys based on chromium
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C45/00—Amorphous alloys
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C45/00—Amorphous alloys
- C22C45/02—Amorphous alloys with iron as the major constituent
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C3/00—Non-adjustable metal resistors made of wire or ribbon, e.g. coiled, woven or formed as grids
- H01C3/005—Metallic glasses therefor
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F1/00—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties
- H01F1/01—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials
- H01F1/03—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity
- H01F1/12—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of soft-magnetic materials
- H01F1/14—Magnets or magnetic bodies characterised by the magnetic materials therefor; Selection of materials for their magnetic properties of inorganic materials characterised by their coercivity of soft-magnetic materials metals or alloys
- H01F1/147—Alloys characterised by their composition
- H01F1/153—Amorphous metallic alloys, e.g. glassy metals
- H01F1/15391—Elongated structures, e.g. wires
Definitions
- amorphous, i.e., noncrystalline or glassy, metal alloys have been prepared.
- a molten alloy of a suitable composition must be quenched rapidly, or alternatively, a deposition technique must be used: suitably employed vapor deposition, sputtering, electrodeposition, or chemical (electro-less) deposition can be used to produce the amorphous metal.
- amorphous metal by these known techniques, i.e., either through a rapid quench of the melt or by deposition, severely limits the form in which the amorphous metal can be obtained.
- the rapid quench has generally been achieved by spreading the molten alloy in a thin layer against a metal substrate such as Cu or Al held at or below room temperature.
- the molten metal is typically spread to a thickness of about 0.002 inch which, as discussed in detail by R. Predecki, A. W. Mullendore and N. J. Grant .in Trans. AIME 233, I581 (1965) and R. C. Ruhl in Mat. Sci. & Eng. 1,313 (1967), leads to a cooling rate of about l C/sec.
- the amorphous metals be formed in a shape which does not preclude adequate quenching, i.e., they must have at least one dimension small enough to permit the sufficiently rapid removal of the heat from the sample.
- Metal alloys which are most easily obtained in the amorphous state by rapid quenching or by deposition techniques are mixtures of transition metals with metalloids, i.e. semimetals. In each case, the alloy is approximately 80 atomic percent transition metal and atomic percent metalloid. Examples of alloys of this type reportedly made previously in the amorphous State are Pd34SI15, Pd79Sl2 pdn cugsl C080P20,
- the cooling rate necessary to achieve the amorphous state, i.e., to avoid crystallization, and the stability of the amorphous state once it is obtained depends upon the composition of the alloy. Some of these alloys are better glass formers than others; these better" alloys can be obtainedin the amorphous state with a lower cooling rate, which in practice may be more readily obtainable, or can be obtained with a greater thickness when quenched from the melt with a given technique.
- the amorphous and the crystalline state are distinguished by the respective absence or presence of long range periodicity. Further, the compositional ordering in alloys maybe different for the two states. These differences are reflected in the differences in their x-ray diffraction behavior, and accordingly, x-ray diffraction measurements are most often used to distinguish a crystalline from an amorphous substance. Diffractometer traces of an amorphous substance reveal a slowly varying diffracted intensity, in many respects similar to a liquid, while crystalline materials produce a much more rapidly varying diffracted intensity. Also, the physical properties, which depend upon the atomic arrangement, are uniquely different for the crystalline and the amorphous state.
- the mechanical properties differ substantially for the two states; for example, a 0.002 inch thick strip of amorphous Pd si is relatively more ductile and stronger and will deform plasticallyupon sufficiently severe bending while a similar crystalline strip of the same composition is brittle and weak and will fracture upon identical bending. Further, the magnetic and electrical properties of the two states are different. In each case, the metastable amorphous state will convert to a crystalline form upon heating to a sufficiently high temperature with the evolution of a heat of crystallization.
- cooling a molten metal to a glass is distinctly different from cooling such a molten metal to the crystalline state.
- the liquid solidifies continuously over a range of temperature without a discontinuous evolution of a heat of fusion.
- crystallization is a thermodynamic first order transition and thus is associated with a heat of fusion and a specific temperature.
- An object of the invention is to provide a novel amorphous metal compositions which are readily quenched to the amorphous state, have increased stability, and possess desirable physical properties.
- a further object of the invention resides in the provision of articles of manufacture of these novel amorphous metals in a variety of forms, e.g., ribbons, sheets, wire, powder, etc.
- Another object of the invention is to provide an arti ole of these and other amorphous metal compositions in the form of wire, i.e., a filament with a cross-section which is approximately circular, i.e., a rod-like filament, as contrasted with strands which are ribbon like.
- novel compositions of interest in this invention are composed primarily of Fe, Ni, Cr, Co, and V.
- certain compositions i.e. Fe P C Fe P C Fe P B Co P B Fe B C and Ni P B have been previously described as being quenched from the melt to the amorphous state
- certain novel, distinct and useful compositions may be obtained by the addition of small amounts, i.e., from 0.1 to 15 atomic percent but preferably from 0.5 to 6 atomic percent, of certain elements such as Al, Si, Sn, Sb, Ge, In, or Be, to such alloys.
- these alloys become much better glass formers, i.e., the amorphous state is more readily obtained and moreover, is more thermally stable.
- Z a group hereafter sometimes referred to by the symbol Z, and consisting of Al, Si, Sn, Ge, ln, Sb or Be, in amounts of from about 0.1 to about 15 atomic percent, to alloys of the type wherein M is a metal selected from one or more of the group consisting of Fe, Ni, Co, V and Cr; and Y represents elements from the group'consisting of P, B, and C; (k) and (p) are in atomic percent and are about 70 to 85 and about 30 to 15, respectively, provides superior glass forming alloys.
- Illustrative alloys for example, are Fe P, C Si,Al Fe Ni P, B Al Ni P B Ab, and Cr, .-,Co Ni P, B Al and may have the general formula:
- M, Y, and Z are as defined above and a, b, and c are in atomic percent and range from about 60 to 90, about 10 to 30 and about 0.1 to 15, respectively, and a plus b plus c equals 100.
- alloy Fe Ni P B and those alloysof similar compositions are SU- perior glass forming alloys.
- Selected alloys of the kinds disclosed above may be relatively more consistently and more readily quenched to the amorphous state than previously thought possible with known Fe-Ni-Cobased alloys. Moreover, these alloys are more stable; upon heating, they show the thermal manifestation of the glass transition (a sudden increase in the specific heat) while previously known Fe-Ni-Cobased alloys do not. Typically, amorphous alloys which show this thermal manifestation of the glass transition are more readily obtained in the amorphous state than amorphous alloys which do not.
- compositions within the contemplation of the present invention can be obtained in the form of ribbons or strips using the apparatus described in the above-mentioned references, Pondand Maddin, or that of Chen and Miller, or other techniques which are similar in principle. Further, wider strips or sheets can be obtained with similar quench tenchiques when the molten metal is squirted as a sheet, for example, rather than with an approximately round cross section. Additionally, powders of-such amorphous metlas where theparticle size ranges from about 0.0004 to 0.010 inch can be made by atomizing the molten alloy to droplets of this size and then quenching these droplets in a liquid such as water, refrigerated brine, or liquid nitrogen.
- alloys discussed above in each case are made from the high purity elements. however, in the utilization of these alloys, it is anticipated that the alloys would be made from the less expensive commercially available material which would have small amounts of other elements in solution.
- the alloys contemplated by the'invention may contain fractional amounts of other elements which are commonly found in commercially available Fe or Ni alloys, for example, either as a result of the source of the primary metal or through a later addition. Examples of such elements are Mo, Ti, Mn, W, Zr, Hf and Cu.
- the invention contemplates a novel article of manufacture in the form of amorphous metal wires of these alloys and others of the transition metalmetalloid type.
- a stream of molten metal is formed by squirting the molten metal from a nozzle or otherwise forming a jet from a suitable die and appropriately quenching the alloy.
- compositions from which such wires are made may be represented by the general formula wherein T is a transition metal or mixture of said transition metals and X is an element selected from the group consisting of phosphorus, boron, carbon, aluminum, silicon, tin, germanium, indium, beryllium and antimony and mixtures thereof and wherein i and j are atomic percent and range from about to 87 and from about 13 to 30, respectively. It will be understood that not every alloy encompassed within the formula T X will necessarily yield an amorphous product.
- a given composition may form a crystalline wire with a particular quenching technique and diameter, while an amorphous wire may be formed with a different quenching technique which provides a higher cooling rate and/or with a smaller diameter.
- some specific ratios within the general formula T X,- cannot be quenched from the melt to a wire of diameter large enough to be useful.
- the quenching of the molten jet to form an amorphous metal wire has been achieved by squirting the molten jet into stationary water or refrigerated brine. however, any process may be used to quench the molten jet to the amorphous state as long as the cooling rate is great enough to avoid crystallization and disruption of the molten jet from the wire form does not take place during cooling.
- the cooling rate experienced by the molten metal stream or jet during quenching is dependent upon both the technique used to cool the molten jet and the diameter of the jet; the cooling technique determines the rate at which heat is removed from the surface of the jet while the diameter determines the surface-to-volume ratio and hence the quantity of heat which must be removed per unit area to reduce the temperature a given amount.
- the amorphous metal wire contemplated by the invention may be derived from a range of compositions of the transition metalmetalloid type alloys including the novel compositions described above, previously inown amorphous compositions, from which wire form articles have not previously been prepared, as well as from other alloy compositions of the type T,-X,.
- amorphous metal wires yields a number of advantages because of their unique properties which are not possessed by crystalline metal wires produced by ordinary techniques. For example, glassy metal wires are less sensitive than crystalline wire to radiation damage and have a small or even negative temperature coefficient of resistivity.
- important processing economies are also available; the amorphous wire form of certain compositions may be less expensive for the sizes and strengths which can be obtained than the commonly used drawn wire.
- the amorphous metal strands, wires, sheets, etc., contemplated by the invention find a variety of uses such as reinforcement use, e.g. as tire cord or as reinforcement in molded thermoplastic or thermosetting plastics; as filter media; biomedical reinforcement, e.g. sutures; as relay magnets; corrosion resistant chemical processing equipment; and the like.
- wires of about 0.005 inch diameter are formed, although the invention is not restricted to such diameter.
- these alloys are ideally suited for the melt spinning of wire since they are generally of a near-eutectic composition and hence have a relatively low liquidus temperature, i.e. the lowest temperature at which the alloy is totally liquid in equilibrium. This simplifies the processing of the alloy and expands the list of materials which can be used to contain the molten alloy and as nozzles or dies to form the molten stream. For example,
- Fe P QAh which is 86.7 weight percent Fe, has a liquidus temperature of about 1020C while pure Fe melts at ,1535C..
- the stream of the molten jet may be squirted into stationery water or refrigerated brine and appropriately collected therefrom after it is quenched.
- Typical of other specific processes which may be adapted to produce amorphous metal wire in accordance with the invention include that process described by S. Kavesh in a copending U.S. Pat. application, Ser. No. 306,472, filed Nov. 14, 1972; those by R. D. Schile in U.S. Pat. Nos. 3,461,943 and 3,543,831; and that described by S. A. Dunn, et al. in U.S. Pat. No. 3,658,979. While these same methods may be employed to yield either crystalline or amorphous metal, one skilled in the art would experience no difficulty in accordance with the teaching presented herein regarding the use of appropriate cooling rates, wire diameters and compositions so as to obtain an amorphous metal wire.
- amorphous alloys and wire form articles have very desirable physical properties. For example, high tensile strengths and a high elastic limit in the asquenched state can be achieved as well as good corrosion resistance and unique magnetic properties in various selected compositions. Also, a number of compositions are found to be remarkably ductile in the amorphous state. Some specimens, for example, can be bent over radii of curvature less than their thickness and can be cut with scissors. Also, with these ductile samples, tensile strengths of up to 350,000 psi have been obtained in the as-quenched condition. Thus, the heat treatments often given crystalline materials to obtain high strength are obviated with the amorphous metal alloys. Alloys such as Fe P, .-,C,B,Si,Al can be quenched directly from the melt to form inexpensive, high strength wire which can be employed directly as a commercial product.
- Alloys such as Fe P, .-,C,B,Si,Al can be quenched
- the amorphous alloys provide strong, corrosionresistant material; selected compositions of these amorphous alloys are relatively unreactive with concentrated surfuric, hydrochloric, or nitric acid.
- amorphous Feg Ni P B Al is found to be several orders of magnitude less reactive than stainless steels with concentrated hydrochloric acid.
- various of the metal alloys of the same general formula T,X,- considered above also have the desirable properties of high strength and hardness, ductility and corrosion resis tance even when they are partially crystalline.
- the fraction of the sample that is crystalline can be estimated by suitably employed x-ray or electron diffraction, electron transmission microscopy, and thermal analysis.
- the invention thus also contemplates a metal wire which is partially crystalline but which is at least 50 percent amorphous.
- such wires may be rendered partially crystalline because the quenching rate is lower than that required to obtain the totally amorphous state for the specific composition being quenched.
- the preferred novel amorphous compositions of the invention are those characterized by the formula M Y Z wherein M is a metal selected from the group consisting of iron, nickel, cobalt, chromium and vanadium and mixtures thereof; Y is an element selected from the group consisting of phosphorus, boron and carbon, and mixtures thereof; and Z is an element selected from the group consisting of aluminum, antimony, beryllium, germanium, indium, tin and silicon and mixtures thereof and wherein the relative proportions in atomic percentages range from about to 80, b from about 19 to 22, and c from 1 to 3.
- amorphous alloys in which M is totally or primarily iron, e.g. Fe P C Si Al are of particular interest because of their low cost and relatively high strength.
- Amorphous alloys such as Ni Fe P B Al are of significance, for example, because of their special ease of formation in combination with high strength and corrosion resistance.
- Alloys which have a high chromium content, e.g. Cr P B Si are exceptional in their hardness and corrosion resistance.
- the wire form amorphous metal alloy products of the invention include the amorphous alloys defined by the formula (I) hereinabove and contemplates also wire form products of other amorphous metals as well and may be defined as those alloys having the formula wherein T is a transition metal or mixture thereof and X is an element selected from the group consisting of aluminum, antimony, beryllium, boron, germanium, carbon, indium, phosphorus, silicon and tin and mixtures thereof and wherein the proportion in atomic percentages as represented by i andj are respectively from about 70 to about 87 and from about 13 to about 30 with the proviso that i plusj equals 100.
- the transition metals T are those of group 18, 111B, IVB, VB, VIB, V118 and VIII of the Periodic Chart of the Elements and include the following: scandium, yttrium, lanthanum, actinium, titanium, zirconium, hafnium, vanadium, niobium, tantalum, chromium, molybdenum, tungsten, manganese, technetium, rhenium, iron, ruthenium,osmium, cobalt, rhodium, iridium, nickel, palladium, platinum, copper, silver, and gold; preferably Fe, Ni, Co, V, Cr, Pd, Pt and Ti.
- the amorphous metal wires of composition T,-X are typically from 0.001 to 0.020 inch in diameter, with diameters of 0.004 to 0.008 inch being preferred.
- Any suitable technique which cools the molten jet sufficiently fast to avoid crystallization or jet breakup can be used to quench the jet.
- the simplest such method is to squirt the molten metal stream into a'suitably chosen liquid such as water or iced brine.
- An advantageous technique is that described in the copending application of S. Kavesh, Ser. No. 306,472, filed Nov. 14, 1972, in which the molten jet is quenched in. a concurrently flowing stream of liquid.
- novel compositions and article of the invention are not limited by this process, however, since various other processes which provide appropriate quenching conditions may be utilized, such as the processes described by R. D. Schile in US. Pat. Nos. 3,461,943 and 3,543,831, in which the cooling of the molten jet through corona discharge, gas jets, and/or the deposition on the stream of a colder substance are used.
- EXAMPLE 1 Elemental Fe, P, C, Si and A1 are weighed so that the product mixture yields the following alloy: Fe P, C Al Si,.
- the Fe, P and C were sintered for 1 day in an evacuated sealed fused silica tube at 450C, then melted in vacuum at 1050C. This alloy is remelted in vacuum at 1100C with the Si and Al to give the final alloy.
- This alloy was placed in a fused silica tube with a 0.012 inch diameter hole in the bottomand melted at 1,100C.
- a gas pressure of8 psi is applied to the tube to force the molten metal through the hole, and the stream of molten alloy is directed into the nip of the rotating double rolls, held at room temperature, described by Chen and Miller in Rev. Sci. lnstrum. 41, 1237 (1970).
- the rolls are two inches in diameter and were rotating at 1500 rpm.
- the quenched metal was entirely amorphous as determined by x-ray diffraction measurements, was ductile to bending and exhibited tensile strengths to 350,000 psi. Alloys containing only Fe-P-C, such as Fe P C Fe P, C and Fe P C similarly quenched, are brittle and partially crystalline, as determined by x-ray diffraction. Further, the amorphous Fe P C Al Si, alloy exhibits the thermal manifestation of the glass transition, i.e. rapid increase in the specific heat, while amorphous Fe-P-C alloys do not.
- EXAMPLE 2 An alloy of composition Ni Fe P B Al is melted at 1,020C and quenched to an amorphous metal in the manner of and following the procedure of Example 1. An alloy with improved thermal stability and high bending ductility, strength, and corrosion resistance is obtained. X-ray diffraction measurements are used to confirm its amorphous structure.
- EXAMPLE 3 The molten alloy of Example 2 is quenched to the amorphous state using the Pond and Maddin teaching wherein the molten stream is directed through a 0.020 inch hole onto the surface of a copper hollow cylinder which is open at one end, has an inner diameter of six inches, is at room temperature and is rotating at 2500 rpm. An amorphous metal ribbon having the properties of that obtained in Example 2 was obtained,
- the alloy of composition Ni P B Si was obtained in the amorphous state by flash evaporation as follows: A fine powder, ,u. particles, of crystalline Ni P B- Si was slowly sprinkled onto a hot tungsten filament (-1,600C) in a vacuum of about 10 mm Hg. The vaporized alloy was condensed onto a nearby copper substrate kept at room temperature so that the amorphous state of the same composition was achieved.
- a continuous, smooth amorphous wire of round cross-section with a diameter of about 0.008 inch was obtained.
- the glassy (amorphous) nature of the wire product was confirmed by x-ray diffraction.
- the wire has an elastic limit of about 160,000 psi and a tensile strength of about 230,000 psi which is about one-fiftieth of the Youngs modulus for this glass, a value which approaches the theoretical strength of this material.
- EXAMPLE 26 Pd-, Cu Si was melt spun to a wire of uniform cross section using the process and apparatus described by Kavesh in the above-noted US. application, Ser. No. 306,472, with an orifice diameter of 0.005 inch and C water as the quench medium to yield an amorphous product.
- EXAMPLE 27 Following the procedure of Example 25, a Ni Feg P B ShAl alloy was melted at l000C and ejected from a 0.005 inch hole into brine held at C to produce a glassy wire whose amorphous character is confirmed by xray diffraction.
- EXAMPLE 29 Following the procedure of Example 26, a Ni40Pd4oP2n alloy was melted at 700C and melt spun through a 0.005 inch orifice into iced brine at 20C to give a glassy wire. the amorphous characterization is confirmed by x-ray diffraction.
- a metal alloy of the formula M,,Y,,Z which is at least 50 percent amorphous and wherein M is a metal selected from the group consisting essentially of iron, nickel, chromium, cobalt, or vanadium or a mixture thereof, Y is a metalloid selected from the-group consisting of phosphorus, carbon and boron or a mixture thereof, and Z isan element selected from the group consisting of aluminum, silicon, tin, antimony, germa' nium, indium, and beryllium and mixtures thereof, 19" and 0" are atomic percentages ranging from about 60 to 90, 10 to 30 and 0.1 to 15 respectively with the proviso that a plus b plus c equals. 100.
- amorphous metal alloy of claim 1 wherein a, b" and 0 range from 69 to 84.5, 15 to 25, and 0.5 to 6, respectively.
- a metal wire comprising an alloy which is at least 50 percent amorphous and having a composition of the formula T X, wherein T is a transition metal or mixture of said transition met als and X is an element selected from the group consisting of aluminum, antimony, beryllium, boron, germanium, carbon, indium, phosphorus, silicon, tin, and mixtures thereof and wherein i andj are in atomic percentages and range from about 70 to about 87 and from about 13 to about 30 respectively.
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electromagnetism (AREA)
- Physics & Mathematics (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Textile Engineering (AREA)
- Dispersion Chemistry (AREA)
- Power Engineering (AREA)
- Soft Magnetic Materials (AREA)
- Continuous Casting (AREA)
- Powder Metallurgy (AREA)
- Heating, Cooling, Or Curing Plastics Or The Like In General (AREA)
- Manufacture Of Metal Powder And Suspensions Thereof (AREA)
- Materials For Medical Uses (AREA)
- Surgical Instruments (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00318146A US3856513A (en) | 1972-12-26 | 1972-12-26 | Novel amorphous metals and amorphous metal articles |
| JP12411373A JPS5519976B2 (enExample) | 1972-12-26 | 1973-11-06 | |
| GB1446975A GB1447268A (en) | 1972-12-26 | 1973-11-21 | Amorphous metal alloy wires |
| GB5408573A GB1447267A (en) | 1972-12-26 | 1973-11-21 | Amorphous metal alloy |
| IT70517/73A IT999851B (it) | 1972-12-26 | 1973-11-30 | Metalli amorfi e manufatti metallici amorfi |
| CA187,101A CA1012382A (en) | 1972-12-26 | 1973-11-30 | Amorphous metals and amorphous metal articles |
| DE2366327A DE2366327C2 (de) | 1972-12-26 | 1973-12-21 | Verfahren zur Herstellung eines Drahtes aus einer überwiegend amorphen Legierung |
| DE2364131A DE2364131C2 (de) | 1972-12-26 | 1973-12-21 | Metallegierungen, Verfahren zu deren Herstellung und deren Verwendung |
| DE2366326A DE2366326C2 (de) | 1972-12-26 | 1973-12-21 | Amorphe Nickel-Eisen-Basislegierung und deren Verwendung |
| FR7346350A FR2211536B1 (enExample) | 1972-12-26 | 1973-12-26 | |
| CA251,049A CA1012383A (en) | 1972-12-26 | 1976-04-26 | Amorphous metals and amorphous metal articles |
| CA269,393A CA1012384A (en) | 1972-12-26 | 1977-01-10 | Amorphous metals and amorphous metal articles |
| JP53148972A JPS5935417B2 (ja) | 1972-12-26 | 1978-12-01 | 非晶質金属針金の製造方法 |
| JP54163656A JPS5842256B2 (ja) | 1972-12-26 | 1979-12-18 | 非晶質合金 |
| US06/922,290 USRE32925E (en) | 1972-12-26 | 1986-10-23 | Novel amorphous metals and amorphous metal articles |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00318146A US3856513A (en) | 1972-12-26 | 1972-12-26 | Novel amorphous metals and amorphous metal articles |
Related Child Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US50529674A Division | 1974-09-12 | 1974-09-12 | |
| US06/922,290 Reissue USRE32925E (en) | 1972-12-26 | 1986-10-23 | Novel amorphous metals and amorphous metal articles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3856513A true US3856513A (en) | 1974-12-24 |
Family
ID=23236859
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US00318146A Ceased US3856513A (en) | 1972-12-26 | 1972-12-26 | Novel amorphous metals and amorphous metal articles |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3856513A (enExample) |
| JP (3) | JPS5519976B2 (enExample) |
| CA (1) | CA1012382A (enExample) |
| DE (3) | DE2364131C2 (enExample) |
| FR (1) | FR2211536B1 (enExample) |
| GB (2) | GB1447267A (enExample) |
| IT (1) | IT999851B (enExample) |
Cited By (276)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3940293A (en) * | 1972-12-20 | 1976-02-24 | Allied Chemical Corporation | Method of producing amorphous cutting blades |
| US3986901A (en) * | 1975-04-30 | 1976-10-19 | International Business Machines Corporation | Controlled catalyst for manufacturing magnetic alloy particles having selective coercivity |
| US3986867A (en) * | 1974-01-12 | 1976-10-19 | The Research Institute For Iron, Steel And Other Metals Of The Tohoku University | Iron-chromium series amorphous alloys |
| US3989517A (en) * | 1974-10-30 | 1976-11-02 | Allied Chemical Corporation | Titanium-beryllium base amorphous alloys |
| US4007072A (en) * | 1973-11-16 | 1977-02-08 | Fuji Photo Film Co., Ltd. | Ferromagnetic metal powder comprising lead and method for making the same |
| USRE29239E (en) * | 1974-01-07 | 1977-05-31 | Whyco Chromium Company Inc. | Ternary alloys |
| US4030892A (en) * | 1976-03-02 | 1977-06-21 | Allied Chemical Corporation | Flexible electromagnetic shield comprising interlaced glassy alloy filaments |
| US4033795A (en) * | 1971-12-30 | 1977-07-05 | International Business Machines Corporation | Method for inducing uniaxial magnetic anisotropy in an amorphous ferromagnetic alloy |
| US4036638A (en) * | 1975-11-13 | 1977-07-19 | Allied Chemical Corporation | Binary amorphous alloys of iron or cobalt and boron |
| US4038073A (en) * | 1976-03-01 | 1977-07-26 | Allied Chemical Corporation | Near-zero magnetostrictive glassy metal alloys with high saturation induction |
| US4050931A (en) * | 1975-08-13 | 1977-09-27 | Allied Chemical Corporation | Amorphous metal alloys in the beryllium-titanium-zirconium system |
| US4052201A (en) * | 1975-06-26 | 1977-10-04 | Allied Chemical Corporation | Amorphous alloys with improved resistance to embrittlement upon heat treatment |
| US4053333A (en) * | 1974-09-20 | 1977-10-11 | University Of Pennsylvania | Enhancing magnetic properties of amorphous alloys by annealing under stress |
| US4053331A (en) * | 1974-09-20 | 1977-10-11 | University Of Pennsylvania | Method of making amorphous metallic alloys having enhanced magnetic properties by using tensile stress |
| US4053332A (en) * | 1974-09-20 | 1977-10-11 | University Of Pennsylvania | Enhancing magnetic properties of amorphous alloys by rolling |
| US4056411A (en) * | 1976-05-14 | 1977-11-01 | Ho Sou Chen | Method of making magnetic devices including amorphous alloys |
| US4059441A (en) * | 1974-08-07 | 1977-11-22 | Allied Chemical Corporation | Metallic glasses with high crystallization temperatures and high hardness values |
| US4067732A (en) * | 1975-06-26 | 1978-01-10 | Allied Chemical Corporation | Amorphous alloys which include iron group elements and boron |
| US4081298A (en) * | 1976-09-07 | 1978-03-28 | Allied Chemical Corporation | Heat treatment of iron-nickel-phosphorus-boron glassy metal alloys |
| US4085396A (en) * | 1976-09-27 | 1978-04-18 | Bell Telephone Laboratories, Incorporated | Electric fuse |
| US4113478A (en) * | 1977-08-09 | 1978-09-12 | Allied Chemical Corporation | Zirconium alloys containing transition metal elements |
| US4115682A (en) * | 1976-11-24 | 1978-09-19 | Allied Chemical Corporation | Welding of glassy metallic materials |
| US4116682A (en) * | 1976-12-27 | 1978-09-26 | Polk Donald E | Amorphous metal alloys and products thereof |
| US4116728A (en) * | 1976-09-02 | 1978-09-26 | General Electric Company | Treatment of amorphous magnetic alloys to produce a wide range of magnetic properties |
| US4116687A (en) * | 1976-12-13 | 1978-09-26 | Allied Chemical Corporation | Glassy superconducting metal alloys in the beryllium-niobium-zirconium system |
| US4118222A (en) * | 1977-06-02 | 1978-10-03 | Allied Chemical Corporation | Glassy hafnium-beryllium alloys |
| US4122240A (en) * | 1976-02-17 | 1978-10-24 | United Technologies Corporation | Skin melting |
| US4126494A (en) * | 1975-10-20 | 1978-11-21 | Kokusai Denshin Denwa Kabushiki Kaisha | Magnetic transfer record film |
| US4126449A (en) * | 1977-08-09 | 1978-11-21 | Allied Chemical Corporation | Zirconium-titanium alloys containing transition metal elements |
| FR2394101A1 (fr) * | 1977-06-06 | 1979-01-05 | Corning Glass Works | Guide d'onde optique a revetement protecteur |
| US4133681A (en) * | 1978-01-03 | 1979-01-09 | Allied Chemical Corporation | Nickel-refractory metal-boron glassy alloys |
| US4133679A (en) * | 1978-01-03 | 1979-01-09 | Allied Chemical Corporation | Iron-refractory metal-boron glassy alloys |
| US4133682A (en) * | 1978-01-03 | 1979-01-09 | Allied Chemical Corporation | Cobalt-refractory metal-boron glassy alloys |
| US4135924A (en) * | 1977-08-09 | 1979-01-23 | Allied Chemical Corporation | Filaments of zirconium-copper glassy alloys containing transition metal elements |
| US4137075A (en) * | 1977-01-17 | 1979-01-30 | Allied Chemical Corporation | Metallic glasses with a combination of high crystallization temperatures and high hardness values |
| US4140525A (en) * | 1978-01-03 | 1979-02-20 | Allied Chemical Corporation | Ultra-high strength glassy alloys |
| DE2839626A1 (de) * | 1977-09-12 | 1979-03-22 | Sony Corp | Amorphe magnetische legierung |
| US4148973A (en) * | 1976-12-15 | 1979-04-10 | Allied Chemical Corporation | Homogeneous, ductile brazing foils |
| US4150981A (en) * | 1977-08-15 | 1979-04-24 | Allied Chemical Corporation | Glassy alloys containing cobalt, nickel and iron having near-zero magnetostriction and high saturation induction |
| US4152147A (en) * | 1978-04-10 | 1979-05-01 | Allied Chemical Corporation | Beryllium-containing iron-boron glassy magnetic alloys |
| US4152486A (en) * | 1976-03-11 | 1979-05-01 | Kokusai Denshin Denwa Kabushiki Kaisha | Magneto-optical memory medium |
| US4152144A (en) * | 1976-12-29 | 1979-05-01 | Allied Chemical Corporation | Metallic glasses having a combination of high permeability, low magnetostriction, low ac core loss and high thermal stability |
| US4152146A (en) * | 1976-12-29 | 1979-05-01 | Allied Chemical Corporation | Glass-forming alloys with improved filament strength |
| USRE29989E (en) * | 1972-12-20 | 1979-05-08 | Allied Chemical Corporation | Cutting blades made of or coated with an amorphous metal |
| USRE30080E (en) * | 1975-04-28 | 1979-08-21 | Allied Chemical Corporation | Titanium-beryllium base amorphous alloys |
| WO1979000674A1 (fr) * | 1978-02-03 | 1979-09-20 | Shin Gijutsu Kaihatsu Jigyodan | Alliages de carbone amorphe et articles fabriques avec ces alliages |
| US4169744A (en) * | 1978-06-28 | 1979-10-02 | Western Gold And Platinum Company | Nickel-chromium-silicon alloy brazing foil |
| USRE30106E (en) * | 1972-12-20 | 1979-10-02 | Allied Chemical Corporation | Method of producing amorphous cutting blades |
| US4171992A (en) * | 1977-08-09 | 1979-10-23 | Allied Chemical Corporation | Preparation of zirconium alloys containing transition metal elements |
| US4172718A (en) * | 1977-05-04 | 1979-10-30 | Siemens Aktiengesellschaft | Ta-containing amorphous alloy layers and process for producing the same |
| US4174419A (en) * | 1978-11-08 | 1979-11-13 | Allied Chemical Corporation | Stabilized magnetic shields |
| EP0007062A1 (en) * | 1978-07-17 | 1980-01-23 | Allied Corporation | Preparation of phosphorus-containing metallic glass-forming alloy melts |
| US4186245A (en) * | 1978-09-28 | 1980-01-29 | Allied Chemical Corporation | Energy storage flywheel |
| US4188211A (en) * | 1977-02-18 | 1980-02-12 | Tdk Electronics Company, Limited | Thermally stable amorphous magnetic alloy |
| US4189618A (en) * | 1978-07-31 | 1980-02-19 | Allied Chemical Corporation | Electromagnetic shielding envelopes from wound glassy metal filaments |
| US4197146A (en) * | 1978-10-24 | 1980-04-08 | General Electric Company | Molded amorphous metal electrical magnetic components |
| US4201837A (en) * | 1978-11-16 | 1980-05-06 | General Electric Company | Bonded amorphous metal electromagnetic components |
| US4202022A (en) * | 1975-10-20 | 1980-05-06 | Kokusai Denshin Denwa Kabushiki Kaisha | Magnetic transfer record film and apparatus for magneto-optically reading magnetic record patterns using the same |
| US4201601A (en) * | 1978-07-19 | 1980-05-06 | Gte Sylvania Incorporated | Copper brazing alloy foils containing germanium |
| US4202089A (en) * | 1978-06-02 | 1980-05-13 | The Singer Company | Splat-cooled instrument flexure and method to fabricate same |
| EP0010866A1 (en) * | 1978-10-02 | 1980-05-14 | Allied Corporation | Homogeneous brazing foils of copper based metallic glasses |
| US4210443A (en) * | 1978-02-27 | 1980-07-01 | Allied Chemical Corporation | Iron group transition metal-refractory metal-boron glassy alloys |
| JPS55104450A (en) * | 1979-01-30 | 1980-08-09 | Tohoku Metal Ind Ltd | Amorphous magnetic alloy with superior corrosion resistance and stress corrosion cracking resistance |
| US4217135A (en) * | 1979-05-04 | 1980-08-12 | General Electric Company | Iron-boron-silicon ternary amorphous alloys |
| EP0014335A1 (en) * | 1979-02-01 | 1980-08-20 | Allied Corporation | Homogeneous ductile brazing foils |
| US4219355A (en) * | 1979-05-25 | 1980-08-26 | Allied Chemical Corporation | Iron-metalloid amorphous alloys for electromagnetic devices |
| US4221587A (en) * | 1979-03-23 | 1980-09-09 | Allied Chemical Corporation | Method for making metallic glass powder |
| US4221592A (en) * | 1977-09-02 | 1980-09-09 | Allied Chemical Corporation | Glassy alloys which include iron group elements and boron |
| DE3010506A1 (de) * | 1979-03-23 | 1980-09-25 | Allied Chem | Metallglaspulver und verfahren zu dessen herstellung |
| US4225339A (en) * | 1977-12-28 | 1980-09-30 | Tokyo Shibaura Denki Kabushiki Kaisha | Amorphous alloy of high magnetic permeability |
| DE3011152A1 (de) * | 1979-03-23 | 1980-10-02 | Allied Chem | Borhaltige legierungen, verfahren zu deren herstellung und deren verwendung |
| US4226619A (en) * | 1979-05-04 | 1980-10-07 | Electric Power Research Institute, Inc. | Amorphous alloy with high magnetic induction at room temperature |
| EP0016916A1 (en) * | 1979-03-30 | 1980-10-15 | Allied Corporation | Homogeneous ductile brazing foils |
| WO1980002123A1 (en) * | 1979-04-09 | 1980-10-16 | United Technologies Corp | Wire with rapidly quenched structure |
| US4229389A (en) * | 1979-03-16 | 1980-10-21 | Thompson Marine Corporation | Gas diffuser, aerator, or sparger apparatus |
| EP0017723A1 (en) * | 1979-03-23 | 1980-10-29 | Allied Corporation | Method and apparatus for making metallic glass powder |
| US4231816A (en) * | 1977-12-30 | 1980-11-04 | International Business Machines Corporation | Amorphous metallic and nitrogen containing alloy films |
| EP0018507A1 (en) * | 1979-05-03 | 1980-11-12 | Allied Corporation | Beryllium-containing iron-boron glassy magnetic alloys and devices utilizing same |
| JPS55161048A (en) * | 1979-06-01 | 1980-12-15 | Nippon Steel Corp | Amorphous alloy for transformer |
| US4247398A (en) * | 1977-04-05 | 1981-01-27 | Tdk Electronics Co., Ltd. | High gradient magnetic separation apparatus |
| US4248707A (en) * | 1979-03-16 | 1981-02-03 | Thompson Marine Corporation | Gas diffuser, aerator, or sparger method |
| US4249969A (en) * | 1979-12-10 | 1981-02-10 | Allied Chemical Corporation | Method of enhancing the magnetic properties of an Fea Bb Sic d amorphous alloy |
| US4256039A (en) * | 1979-01-02 | 1981-03-17 | Allied Chemical Corporation | Armor-piercing projectile |
| US4258756A (en) * | 1979-08-27 | 1981-03-31 | Allied Chemical Corporation | Composite shell |
| US4260007A (en) * | 1979-03-14 | 1981-04-07 | Allied Chemical Corporation | Method and apparatus for casting amorphous filament using a crucible with a boric oxide seal |
| US4260416A (en) * | 1979-09-04 | 1981-04-07 | Allied Chemical Corporation | Amorphous metal alloy for structural reinforcement |
| EP0026863A1 (en) * | 1979-10-09 | 1981-04-15 | Allied Corporation | Corrosion resistant glassy metal alloys |
| US4265665A (en) * | 1979-10-01 | 1981-05-05 | Allied Chemical Corporation | Foundry molds containing glassy metal alloy filaments |
| US4268325A (en) * | 1979-01-22 | 1981-05-19 | Allied Chemical Corporation | Magnetic glassy metal alloy sheets with improved soft magnetic properties |
| US4283225A (en) * | 1978-06-05 | 1981-08-11 | Allied Chemical Corporation | Process for fabricating homogeneous, ductile brazing foils and products produced thereby |
| EP0035644A1 (en) * | 1980-03-06 | 1981-09-16 | Allied Corporation | Magnetic amorphous metal alloys |
| EP0038584A1 (de) * | 1980-04-21 | 1981-10-28 | BBC Aktiengesellschaft Brown, Boveri & Cie. | Mehrschichtiges Lot und Verfahren zu dessen Herstellung |
| US4298862A (en) * | 1979-04-23 | 1981-11-03 | Allied Chemical Corporation | Amorphous antipilferage marker |
| US4298409A (en) * | 1979-12-10 | 1981-11-03 | Allied Chemical Corporation | Method for making iron-metalloid amorphous alloys for electromagnetic devices |
| US4300950A (en) * | 1978-04-20 | 1981-11-17 | General Electric Company | Amorphous metal alloys and ribbons thereof |
| EP0039169A3 (en) * | 1980-04-17 | 1981-12-09 | Tsuyoshi Masumoto | Amorphous metal filaments and process for producing the same |
| US4309214A (en) * | 1978-09-18 | 1982-01-05 | L'air Liquide, Societe Anonyme Pour L'etude Et L'exploitation Des Procedes Georges Claude | Manufacture of metal powder |
| US4314661A (en) * | 1979-08-20 | 1982-02-09 | Allied Corporation | Homogeneous, ductile brazing foils |
| US4316572A (en) * | 1978-11-13 | 1982-02-23 | Allied Corporation | Homogeneous, ductile brazing foils |
| EP0050479A1 (en) * | 1980-10-16 | 1982-04-28 | Unitika Ltd. | Amorphous co-based metal filaments and process for the production of the same |
| US4331497A (en) * | 1979-08-27 | 1982-05-25 | Allied Corporation | Composite shell |
| US4338131A (en) * | 1980-02-19 | 1982-07-06 | Allied Corporation | Nickel-boron binary amorphous alloys |
| EP0055327A1 (en) * | 1980-12-29 | 1982-07-07 | Allied Corporation | Amorphous metal alloys having enhanced AC magnetic properties |
| EP0055403A1 (en) * | 1980-12-31 | 1982-07-07 | Allied Corporation | Amorphous alloys of nickel, aluminum and boron |
| EP0055371A1 (en) * | 1980-12-27 | 1982-07-07 | Kabushiki Kaisha Toshiba | Neutron absorber, neutron absorber assembly utilizing the same, and other uses thereof |
| US4339270A (en) * | 1979-05-16 | 1982-07-13 | Toyo Soda Manufacturing Co. Ltd. | Corrosion resistant amorphous noble metal-base alloys |
| EP0056141A1 (en) * | 1981-01-14 | 1982-07-21 | Allied Corporation | Homogeneous ductile nickel-palladium based brazing foils |
| US4341845A (en) * | 1978-12-22 | 1982-07-27 | General Electric Company | Helical metallic ribbon for continuous edge winding applications |
| DE3106607A1 (de) * | 1981-02-23 | 1982-09-09 | Fr. Kammerer GmbH, 7530 Pforzheim | Plattierverfahren |
| US4353737A (en) * | 1979-03-23 | 1982-10-12 | Allied Corporation | Method of making metallic glass powders from glassy alloys |
| US4359352A (en) * | 1979-11-19 | 1982-11-16 | Marko Materials, Inc. | Nickel base superalloys which contain boron and have been processed by a rapid solidification process |
| US4379720A (en) * | 1982-03-15 | 1983-04-12 | Marko Materials, Inc. | Nickel-aluminum-boron powders prepared by a rapid solidification process |
| EP0076918A1 (en) * | 1981-10-08 | 1983-04-20 | Allied Corporation | Amorphous magnetic core and process for manufacturing to improve efficiency |
| US4381943A (en) * | 1981-07-20 | 1983-05-03 | Allied Corporation | Chemically homogeneous microcrystalline metal powder for coating substrates |
| US4385932A (en) * | 1980-06-24 | 1983-05-31 | Tokyo Shibaura Denki Kabushiki Kaisha | Amorphous magnetic alloy |
| US4385944A (en) * | 1980-05-29 | 1983-05-31 | Allied Corporation | Magnetic implements from glassy alloys |
| US4392072A (en) * | 1978-09-13 | 1983-07-05 | General Electric Company | Dynamoelectric machine stator having articulated amorphous metal components |
| US4406700A (en) * | 1979-11-14 | 1983-09-27 | Allied Corporation | Powder produced by embrittling of metallic glassy alloy by hydrogen charging |
| US4409041A (en) * | 1980-09-26 | 1983-10-11 | Allied Corporation | Amorphous alloys for electromagnetic devices |
| US4409296A (en) * | 1979-05-09 | 1983-10-11 | Allegheny Ludlum Steel Corporation | Rapidly cast alloy strip having dissimilar portions |
| EP0092091A2 (en) | 1982-04-15 | 1983-10-26 | Allied Corporation | Apparatus for the production of magnetic powder |
| EP0100919A1 (en) * | 1982-08-11 | 1984-02-22 | Allied Corporation | Low temperature, high strength nickel based brazing alloys |
| US4437907A (en) | 1981-03-06 | 1984-03-20 | Nippon Steel Corporation | Amorphous alloy for use as a core |
| US4439236A (en) * | 1979-03-23 | 1984-03-27 | Allied Corporation | Complex boride particle containing alloys |
| US4439253A (en) * | 1982-03-04 | 1984-03-27 | Allied Corporation | Cobalt rich manganese containing near-zero magnetostrictive metallic glasses having high saturation induction |
| EP0103770A1 (en) * | 1982-09-20 | 1984-03-28 | Allied Corporation | Homogeneous low melting point copper based alloys |
| EP0103805A1 (en) * | 1982-09-20 | 1984-03-28 | Allied Corporation | Homogeneous low melting point copper based alloys |
| US4448618A (en) * | 1983-02-28 | 1984-05-15 | Allied Corporation | Nickel based brazing filler metals |
| US4450206A (en) * | 1982-05-27 | 1984-05-22 | Allegheny Ludlum Steel Corporation | Amorphous metals and articles made thereof |
| US4464208A (en) * | 1982-01-08 | 1984-08-07 | Tokyo Shibaura Denki Kabushiki Kaisha | Amorphous alloy for magnetic head |
| US4469536A (en) * | 1982-11-10 | 1984-09-04 | The United States Of America As Represented By The Secretary Of The Navy | Alloys and method of making |
| US4470553A (en) * | 1979-08-16 | 1984-09-11 | Allied Corporation | Inline winder |
| US4473417A (en) * | 1981-08-18 | 1984-09-25 | Tokyo Shibaura Denki Kabushiki Kaisha | Amorphous alloy for magnetic core material |
| US4473413A (en) * | 1983-03-16 | 1984-09-25 | Allied Corporation | Amorphous alloys for electromagnetic devices |
| EP0121649A1 (en) * | 1983-02-04 | 1984-10-17 | Allied Corporation | Amorphous antipilferage marker |
| EP0086973A3 (en) * | 1982-02-18 | 1984-10-24 | Allied Corporation | Tuned vibration detector |
| US4484184A (en) * | 1979-04-23 | 1984-11-20 | Allied Corporation | Amorphous antipilferage marker |
| DE3422281A1 (de) * | 1983-06-20 | 1984-12-20 | Allied Corp., Morristown, N.J. | Verfahren zur herstellung von formlingen aus magnetischen metallegierungen und so hergestellte formlinge |
| US4495487A (en) * | 1981-11-02 | 1985-01-22 | Allied Corporation | Amorphous antipilferage marker |
| US4495691A (en) * | 1981-03-31 | 1985-01-29 | Tsuyoshi Masumoto | Process for the production of fine amorphous metallic wires |
| US4503085A (en) * | 1981-07-22 | 1985-03-05 | Allied Corporation | Amorphous metal powder for coating substrates |
| US4508257A (en) * | 1983-02-28 | 1985-04-02 | Allied Corporation | Method of brazing with nickel based alloy |
| US4510490A (en) * | 1982-04-29 | 1985-04-09 | Allied Corporation | Coded surveillance system having magnetomechanical marker |
| US4517017A (en) * | 1981-02-10 | 1985-05-14 | Tokyo Shibaura Denki Kabushiki Kaisha | Temperature sensitive amorphous magnetic alloy |
| US4520335A (en) * | 1983-04-06 | 1985-05-28 | Westinghouse Electric Corp. | Transformer with ferromagnetic circuits of unequal saturation inductions |
| US4523950A (en) * | 1980-12-29 | 1985-06-18 | Allied Corporation | Boron containing rapid solidification alloy and method of making the same |
| US4525314A (en) * | 1981-03-18 | 1985-06-25 | Torobin Leonard B | Producing metal and metal glass microfilaments |
| US4525223A (en) * | 1978-09-19 | 1985-06-25 | Noboru Tsuya | Method of manufacturing a thin ribbon wafer of semiconductor material |
| US4533389A (en) * | 1980-12-29 | 1985-08-06 | Allied Corporation | Boron containing rapid solidification alloy and method of making the same |
| EP0078401B1 (en) * | 1981-11-02 | 1985-08-07 | Allied Corporation | Amorphous antipilferage marker |
| US4536361A (en) * | 1978-08-28 | 1985-08-20 | Torobin Leonard B | Method for producing plastic microfilaments |
| US4543135A (en) * | 1982-11-15 | 1985-09-24 | Allied Corporation | Nickel high-chromium base brazing filler metal for high temperature applications |
| US4557769A (en) * | 1983-07-16 | 1985-12-10 | Alps Electric Co., Ltd. | Soft magnetic material |
| US4560454A (en) * | 1984-05-01 | 1985-12-24 | The Standard Oil Company (Ohio) | Electrolysis of halide-containing solutions with platinum based amorphous metal alloy anodes |
| EP0166864A1 (en) * | 1984-05-10 | 1986-01-08 | Allied Corporation | Floating gang rotary slitting device |
| US4566323A (en) * | 1983-07-29 | 1986-01-28 | Aisin Seiki Kabushiki Kaisha | Liquid helium level indicating gauge |
| EP0170909A1 (de) * | 1984-07-10 | 1986-02-12 | Atlas Fahrzeugtechnik GmbH | Piezokeramische Ventilplatte für ein Niederdruckeinspritzventil und Verfahren zu deren Herstellung |
| US4573630A (en) * | 1983-04-26 | 1986-03-04 | Allied Corporation | Homogeneous low melting point copper based alloys |
| US4576653A (en) * | 1979-03-23 | 1986-03-18 | Allied Corporation | Method of making complex boride particle containing alloys |
| EP0096182A3 (en) * | 1982-06-03 | 1986-03-26 | Allied Corporation | Coded surveillance system having magnetomechanical marker |
| EP0093281A3 (en) * | 1982-04-29 | 1986-03-26 | Allied Corporation | Surveillance system having magnetomechanical marker |
| US4588452A (en) * | 1983-03-16 | 1986-05-13 | Allied Corporation | Amorphous alloys for electromagnetic devices |
| US4606977A (en) * | 1983-02-07 | 1986-08-19 | Allied Corporation | Amorphous metal hardfacing coatings |
| US4609442A (en) * | 1985-06-24 | 1986-09-02 | The Standard Oil Company | Electrolysis of halide-containing solutions with amorphous metal alloys |
| US4612161A (en) * | 1983-10-20 | 1986-09-16 | The United States Of America As Represented By The United States Department Of Energy | Fabrication of metallic glass structures |
| US4614221A (en) * | 1981-09-29 | 1986-09-30 | Unitika Ltd. | Method of manufacturing thin metal wire |
| JPS61223103A (ja) * | 1986-02-21 | 1986-10-03 | Toshiba Corp | 非晶質構造体の製造方法 |
| US4617983A (en) * | 1984-05-21 | 1986-10-21 | Unitika Ltd. | Method and apparatus for continuously manufacturing metal filaments |
| US4634462A (en) * | 1985-01-09 | 1987-01-06 | Allied Corporation | Methods of and apparatus for monitoring precipitates in metallic materials |
| US4650130A (en) * | 1982-01-04 | 1987-03-17 | Allied Corporation | Rapidly solidified powder production system |
| US4655079A (en) * | 1983-11-22 | 1987-04-07 | Aisin Seiki Kabushiki Kaisha | Level gauge for liquid helium |
| US4655857A (en) * | 1982-03-08 | 1987-04-07 | Tsuyoshi Masumoto | Ni-Cr type alloy material |
| USRE32428E (en) * | 1979-04-23 | 1987-05-26 | Allied Corporation | Amorphous antipilferage marker |
| USRE32427E (en) * | 1979-04-23 | 1987-05-26 | Amorphous antipilferage marker | |
| DE3704499A1 (de) * | 1986-02-18 | 1987-08-20 | Gen Electric | Transformatorkern |
| US4696731A (en) * | 1986-12-16 | 1987-09-29 | The Standard Oil Company | Amorphous metal-based composite oxygen anodes |
| US4702813A (en) * | 1986-12-16 | 1987-10-27 | The Standard Oil Company | Multi-layered amorphous metal-based oxygen anodes |
| US4702302A (en) * | 1983-02-23 | 1987-10-27 | Sumitomo Electric Industries Ltd. | Method of making thin alloy wire |
| US4705610A (en) * | 1985-06-24 | 1987-11-10 | The Standard Oil Company | Anodes containing iridium based amorphous metal alloys and use thereof as halogen electrodes |
| US4727202A (en) * | 1984-07-27 | 1988-02-23 | Lonza Ltd. | Process for the production of catalytically-active metallic glasses |
| US4743313A (en) * | 1984-11-12 | 1988-05-10 | Alps Electric Co., Ltd. | Amorphous alloy for use in magnetic heads |
| US4745037A (en) * | 1976-12-15 | 1988-05-17 | Allied Corporation | Homogeneous, ductile brazing foils |
| US4745806A (en) * | 1985-01-29 | 1988-05-24 | Aisin Seiki Kabushiki Kaisha | Level gauge for liquid helium |
| US4746584A (en) * | 1985-06-24 | 1988-05-24 | The Standard Oil Company | Novel amorphous metal alloys as electrodes for hydrogen formation and oxidation |
| US4750951A (en) * | 1986-05-19 | 1988-06-14 | Alps Electric Co., Ltd. | Amorphous alloy for magnetic heads |
| US4760333A (en) * | 1984-12-13 | 1988-07-26 | Kanto Seiki Co., Ltd. | Crossed coil meter having concentrically wound magnetic shield |
| EP0191107A4 (en) * | 1984-07-27 | 1988-10-06 | Japan Res Dev Corp | AMORPHOUS MAGNETIC ACTION MATERIAL. |
| US4781803A (en) * | 1985-02-26 | 1988-11-01 | The Standard Oil Company | Electrolytic processes employing platinum based amorphous metal alloy oxygen anodes |
| US4823113A (en) * | 1986-02-27 | 1989-04-18 | Allied-Signal Inc. | Glassy alloy identification marker |
| AU584436B2 (en) * | 1985-07-15 | 1989-05-25 | Standard Oil Company, The | Corrosion resistant amorphous chromium alloy compositions |
| US4834814A (en) * | 1987-01-12 | 1989-05-30 | Allied-Signal Inc. | Metallic glasses having a combination of high permeability, low coercivity, low AC core loss, low exciting power and high thermal stability |
| US4834816A (en) * | 1981-08-21 | 1989-05-30 | Allied-Signal Inc. | Metallic glasses having a combination of high permeability, low coercivity, low ac core loss, low exciting power and high thermal stability |
| US4839487A (en) * | 1983-07-06 | 1989-06-13 | Mitsubishi Denki Kabushiki Kaisha | Wire electrode for wire-cut electrical discharge machining |
| DE3841748A1 (de) * | 1988-01-14 | 1989-07-27 | Alps Electric Co Ltd | Legierung mit hochgesaettigter magnetischer flussdichte |
| US4889568A (en) * | 1980-09-26 | 1989-12-26 | Allied-Signal Inc. | Amorphous alloys for electromagnetic devices cross reference to related applications |
| US4916109A (en) * | 1987-07-14 | 1990-04-10 | Lonza Ltd. | Catalyst for the oxidation of carbon compounds |
| US4956743A (en) * | 1989-03-13 | 1990-09-11 | Allied-Signal Inc. | Ground fault interrupters for glassy metal alloys |
| US4968363A (en) * | 1985-08-06 | 1990-11-06 | Mitsui Engineering & Shipbuilding Co., Ltd. | Method of preventing corrosion of a material against hydrochloric acid |
| US4989989A (en) * | 1989-08-31 | 1991-02-05 | Westinghouse Electric Corp. | Hydraulic sensor for quench detection and location in superconductors |
| US5011553A (en) * | 1989-07-14 | 1991-04-30 | Allied-Signal, Inc. | Iron-rich metallic glasses having high saturation induction and superior soft ferromagnetic properties |
| US5035755A (en) * | 1984-05-23 | 1991-07-30 | Allied-Signal Inc. | Amorphous metal alloys having enhanced AC magnetic properties at elevated temperatures |
| US5041175A (en) * | 1987-04-28 | 1991-08-20 | Yoshida Kogyo K.K. | Amorphous aluminum alloys |
| US5055144A (en) * | 1989-10-02 | 1991-10-08 | Allied-Signal Inc. | Methods of monitoring precipitates in metallic materials |
| US5076865A (en) * | 1988-10-15 | 1991-12-31 | Yoshida Kogyo K. K. | Amorphous aluminum alloys |
| US5110378A (en) * | 1988-08-17 | 1992-05-05 | Allied-Signal Inc. | Metallic glasses having a combination of high permeability, low coercivity, low ac core loss, low exciting power and high thermal stability |
| US5158229A (en) * | 1985-08-13 | 1992-10-27 | Allied-Signal Inc. | Low temperature, high strength, nickel, base brazing alloys |
| US5200002A (en) * | 1979-06-15 | 1993-04-06 | Vacuumschmelze Gmbh | Amorphous low-retentivity alloy |
| US5240066A (en) * | 1991-09-26 | 1993-08-31 | Technalum Research, Inc. | Method of casting amorphous and microcrystalline microwires |
| US5278377A (en) * | 1991-11-27 | 1994-01-11 | Minnesota Mining And Manufacturing Company | Electromagnetic radiation susceptor material employing ferromagnetic amorphous alloy particles |
| US5277977A (en) * | 1988-12-29 | 1994-01-11 | Tdk Corporation | Ferromagnetic stabilized ultrafine spherical hexagonal crystalline Fe2 |
| US5279349A (en) * | 1989-12-29 | 1994-01-18 | Honda Giken Kogyo Kabushiki Kaisha | Process for casting amorphous alloy member |
| DE3690625C2 (de) * | 1985-12-04 | 1994-01-20 | Gen Electric | Verfahren zum Herstellen einer Baueinheit aus einem magnetischen Kern aus amorphem Metall und einer Spulenstruktur für einen elektrischen Transformator und elektrischer Transformator |
| US5370749A (en) * | 1981-02-17 | 1994-12-06 | Allegheny Ludlum Corporation | Amorphous metal alloy strip |
| US5443664A (en) * | 1988-11-16 | 1995-08-22 | Hitachi Metals, Ltd. | Surge current-suppressing circuit and magnetic device therein |
| USRE35042E (en) * | 1983-02-04 | 1995-09-26 | Allied Corporation | Amorphous antipilferage marker |
| US5456770A (en) * | 1991-07-30 | 1995-10-10 | Nippon Steel Corporation | Amorphous magnetic alloy with high magnetic flux density |
| DE3645282C2 (de) * | 1985-12-04 | 1996-02-08 | Gen Electric | Verfahren zum Herstellen eines Transformatorkerns und danach erhaltener gewickelter Transformatorkern |
| US5518518A (en) * | 1994-10-14 | 1996-05-21 | Fmc Corporation | Amorphous metal alloy and method of producing same |
| EP0745698A1 (en) * | 1995-05-31 | 1996-12-04 | Samsung Heavy Industries Co., Ltd. | Corrosion and wear resistant iron alloy and method for preparing corrosion and wear resistant members using the same |
| US5583734A (en) * | 1994-11-10 | 1996-12-10 | Raychem Corporation | Surge arrester with overvoltage sensitive grounding switch |
| US5683822A (en) * | 1994-04-06 | 1997-11-04 | Nippon Steel Corporation | Liquid-phase diffusion bonding alloy foils for joining heat-resistant metals in oxidizing atmospheres |
| US5759300A (en) * | 1994-03-29 | 1998-06-02 | Nippon Steel Corporation | Liquid-phase diffusion bonding alloy foils for joining heat-resistant metals in oxidizing atmospheres |
| WO1998027788A1 (en) * | 1996-12-19 | 1998-06-25 | Advanced Metal Technologies Ltd. | Amorphous metallic alloy electrical heater system |
| EP0899353A3 (en) * | 1997-08-28 | 1999-05-19 | Alps Electric Co., Ltd. | Sinter and casting comprising Fe-based high-hardness glassy alloy |
| US5961746A (en) * | 1996-04-22 | 1999-10-05 | Read-Rite Corporation | Corrosion resistant amorphous magnetic alloys |
| CN1047632C (zh) * | 1994-10-14 | 1999-12-22 | Fmc有限公司 | 非晶态金属合金的生产方法 |
| ES2138906A1 (es) * | 1997-07-04 | 2000-01-16 | Aplicaciones Magneticas S A | Metodo de fabricacion y procesado de microhilos metalicos amorfos revestidos de cubierta aislante con elevadas propiedades magneticas. |
| US6053989A (en) * | 1997-02-27 | 2000-04-25 | Fmc Corporation | Amorphous and amorphous/microcrystalline metal alloys and methods for their production |
| US6103396A (en) * | 1996-08-20 | 2000-08-15 | Alliedsignal Inc. | Thick amorphous metal strip having improved ductility and magnetic properties |
| US6432226B2 (en) | 1999-04-12 | 2002-08-13 | Alliedsignal Inc. | Magnetic glassy alloys for high frequency applications |
| US6475303B1 (en) | 1999-04-12 | 2002-11-05 | Honeywell International Inc. | Magnetic glassy alloys for electronic article surveillance |
| US6481088B1 (en) * | 1997-07-09 | 2002-11-19 | Akihisa Inoue | Golf club manufacturing method |
| WO2003044754A1 (en) | 2001-11-15 | 2003-05-30 | Metglas, Inc. | Electronic article surveillance markers for recorded media |
| US6585033B2 (en) * | 2001-02-19 | 2003-07-01 | Fukuda Metal Foil & Powder Co., Ltd. | Process for producing vanadium alloy foil |
| US20030151483A1 (en) * | 2002-02-08 | 2003-08-14 | Martis Ronald J. | Current transformer having an amorphous fe-based core |
| US6749695B2 (en) | 2002-02-08 | 2004-06-15 | Ronald J. Martis | Fe-based amorphous metal alloy having a linear BH loop |
| US20040140017A1 (en) * | 2000-11-09 | 2004-07-22 | Branagan Daniel J. | Hard metallic materials |
| WO2004112862A1 (de) * | 2003-06-26 | 2004-12-29 | Eidgenössische Technische Hochschule Zürich | Prothese und verfahren zu deren herstellung |
| US20050034792A1 (en) * | 2003-08-12 | 2005-02-17 | Lu Zhaoping | Bulk amorphous steels based on Fe alloys |
| US6869566B1 (en) | 2003-03-05 | 2005-03-22 | The United States Of America As Represented By The Secretary Of The Air Force | Method of fabricating metallic glasses in bulk forms |
| US20070175545A1 (en) * | 2006-02-02 | 2007-08-02 | Nec Tokin Corporation | Amorphous soft magnetic alloy and inductance component using the same |
| US20070243335A1 (en) * | 2004-09-16 | 2007-10-18 | Belashchenko Vladimir E | Deposition System, Method And Materials For Composite Coatings |
| US20070253856A1 (en) * | 2004-09-27 | 2007-11-01 | Vecchio Kenneth S | Low Cost Amorphous Steel |
| US20080041213A1 (en) * | 2006-08-21 | 2008-02-21 | Jacob Richter | Musical instrument string |
| US20080125848A1 (en) * | 2006-06-30 | 2008-05-29 | Kusleika Richard S | Medical devices with amorphous metals, and methods therefor |
| US20080160266A1 (en) * | 2004-01-27 | 2008-07-03 | Branagan Daniel J | Metallic coatings on silicon substrates |
| US20100006185A1 (en) * | 2007-04-12 | 2010-01-14 | General Electric Company | Amorphous metal alloy having high tensile strength and electrical resistivity |
| US20120076946A1 (en) * | 2005-11-14 | 2012-03-29 | Lawrence Livermore National Security, Llc | Amorphous Metal Formulations and Structured Coatings for Corrosion and Wear Resistance |
| DE102011001784A1 (de) * | 2011-04-04 | 2012-10-04 | Vacuumschmelze Gmbh & Co. Kg | Verfahren zur Herstellung einer Feder für ein mechanisches Uhrwerk und Feder für ein mechanisches Uhrwerk |
| DE102011001783A1 (de) * | 2011-04-04 | 2012-10-04 | Vacuumschmelze Gmbh & Co. Kg | Feder für ein mechanisches Uhrwerk, mechanisches Uhrwerk, Uhr mit einem mechanischen Uhrwerk und Verfahren zur Herstellung einer Feder |
| CN102758183A (zh) * | 2011-04-27 | 2012-10-31 | 鸿富锦精密工业(深圳)有限公司 | 镀膜件及其制备方法 |
| CN102877009A (zh) * | 2012-10-23 | 2013-01-16 | 河北工业大学 | 一种制备多孔镍基非晶态合金材料的方法 |
| US20130146185A1 (en) * | 2010-08-20 | 2013-06-13 | Posco | High-Carbon Iron-Based Amorphous Alloy Using Molten Pig Iron and Method of Manufacturing the Same |
| US20130150230A1 (en) * | 2010-06-08 | 2013-06-13 | Yale University | Bulk metallic glass nanowires for use in energy conversion and storage devices |
| US20140130942A1 (en) * | 2012-11-12 | 2014-05-15 | Glassimetal Technology, Inc. | Bulk iron-nickel glasses bearing phosphorus-boron and germanium |
| US8986469B2 (en) | 2007-11-09 | 2015-03-24 | The Regents Of The University Of California | Amorphous alloy materials |
| CN104878324A (zh) * | 2015-06-01 | 2015-09-02 | 大连理工大学 | 一种软磁性FeCoNiMB高熵块体非晶合金及其制备方法 |
| US9534283B2 (en) | 2013-01-07 | 2017-01-03 | Glassimental Technology, Inc. | Bulk nickel—silicon—boron glasses bearing iron |
| US9556504B2 (en) | 2012-11-15 | 2017-01-31 | Glassimetal Technology, Inc. | Bulk nickel-phosphorus-boron glasses bearing chromium and tantalum |
| US9816166B2 (en) | 2013-02-26 | 2017-11-14 | Glassimetal Technology, Inc. | Bulk nickel-phosphorus-boron glasses bearing manganese |
| US9863025B2 (en) | 2013-08-16 | 2018-01-09 | Glassimetal Technology, Inc. | Bulk nickel-phosphorus-boron glasses bearing manganese, niobium and tantalum |
| US9863024B2 (en) | 2012-10-30 | 2018-01-09 | Glassimetal Technology, Inc. | Bulk nickel-based chromium and phosphorus bearing metallic glasses with high toughness |
| US9920400B2 (en) | 2013-12-09 | 2018-03-20 | Glassimetal Technology, Inc. | Bulk nickel-based glasses bearing chromium, niobium, phosphorus and silicon |
| US9920410B2 (en) | 2011-08-22 | 2018-03-20 | California Institute Of Technology | Bulk nickel-based chromium and phosphorous bearing metallic glasses |
| US9957596B2 (en) | 2013-12-23 | 2018-05-01 | Glassimetal Technology, Inc. | Bulk nickel-iron-based, nickel-cobalt-based and nickel-copper based glasses bearing chromium, niobium, phosphorus and boron |
| US10000834B2 (en) | 2014-02-25 | 2018-06-19 | Glassimetal Technology, Inc. | Bulk nickel-chromium-phosphorus glasses bearing niobium and boron exhibiting high strength and/or high thermal stability of the supercooled liquid |
| US10086246B2 (en) | 2013-01-29 | 2018-10-02 | Glassimetal Technology, Inc. | Golf club fabricated from bulk metallic glasses with high toughness and high stiffness |
| US10287663B2 (en) | 2014-08-12 | 2019-05-14 | Glassimetal Technology, Inc. | Bulk nickel-phosphorus-silicon glasses bearing manganese |
| US10458008B2 (en) | 2017-04-27 | 2019-10-29 | Glassimetal Technology, Inc. | Zirconium-cobalt-nickel-aluminum glasses with high glass forming ability and high reflectivity |
| DE102019112795A1 (de) * | 2019-05-15 | 2020-11-19 | Trafag Ag | Belastungsmessanordnung, Herstellverfahren hierfür und damit durchführbares Belastungsmessverfahren |
| US11027992B2 (en) * | 2016-06-29 | 2021-06-08 | Institute Of Metal Research, Chinese Academy Of Sciences | Iron-based amorphous electrode material for wastewater treatment and use thereof |
| US11326229B2 (en) * | 2018-02-27 | 2022-05-10 | South University Of Science And Technology Of China | Monatomic amorphous palladium, a method for preparing the same and use thereof |
| US11371108B2 (en) | 2019-02-14 | 2022-06-28 | Glassimetal Technology, Inc. | Tough iron-based glasses with high glass forming ability and high thermal stability |
| US11377720B2 (en) | 2012-09-17 | 2022-07-05 | Glassimetal Technology Inc. | Bulk nickel-silicon-boron glasses bearing chromium |
| CN114855104A (zh) * | 2022-04-27 | 2022-08-05 | 南京理工大学 | 一种用于调控非晶能量状态增强催化性能的方法 |
| US11905582B2 (en) | 2017-03-09 | 2024-02-20 | Glassimetal Technology, Inc. | Bulk nickel-niobium-phosphorus-boron glasses bearing low fractions of chromium and exhibiting high toughness |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5111846A (en) * | 1974-07-20 | 1976-01-30 | Showa Denko Kk | Kikaitekitokiseino kairyosareta kaikanjugotaisoseibutsu |
| GB1476589A (en) * | 1974-08-07 | 1977-06-16 | Allied Chem | Amorphous metal alloys |
| JPS5173920A (enExample) * | 1974-12-24 | 1976-06-26 | Tohoku Daigaku Kinzoku Zairyo | |
| CA1068470A (en) * | 1975-02-24 | 1979-12-25 | Allied Chemical Corporation | Production of improved metal alloy filaments |
| SE431101B (sv) * | 1975-06-26 | 1984-01-16 | Allied Corp | Amorf metallegering |
| US4142571A (en) * | 1976-10-22 | 1979-03-06 | Allied Chemical Corporation | Continuous casting method for metallic strips |
| JPS5950743B2 (ja) * | 1976-11-05 | 1984-12-10 | 東北大学金属材料研究所長 | 耐熱性ならびに強度に優れる非晶質合金 |
| JPS53147604A (en) * | 1977-05-30 | 1978-12-22 | Tohoku Daigaku Kinzoku Zairyo | Production of noncrystalline alloy with low thermal expansion coefficiency |
| FR2398809A1 (fr) * | 1977-07-29 | 1979-02-23 | Allied Chem | Alliage amorphe de resistance amelioree a la fragilisation lors d'un traitement thermique et procede d'elaboration |
| JPS6043899B2 (ja) * | 1977-12-28 | 1985-10-01 | 株式会社東芝 | 高実効透磁率非品質合金 |
| GB2023173B (en) * | 1978-04-20 | 1982-06-23 | Gen Electric | Amorphous alloys |
| JPS5612806U (enExample) * | 1979-07-10 | 1981-02-03 | ||
| JPS5611311A (en) * | 1979-07-10 | 1981-02-04 | Tdk Corp | Distance sensor |
| DE3049906A1 (en) * | 1979-09-21 | 1982-03-18 | Hitachi Ltd | Amorphous alloys |
| JPS56136948A (en) * | 1980-03-28 | 1981-10-26 | Hitachi Ltd | Amorphous alloy for magnetic head core |
| JPS5754251A (en) * | 1980-09-15 | 1982-03-31 | Tdk Corp | Amorphous magnetic alloy material |
| FR2500851B1 (fr) * | 1981-02-27 | 1985-09-13 | Pont A Mousson | Procede d'elaboration d'alliages metalliques amorphes a base de fer, de phosphore, de carbone et de chrome, et alliage obtenu |
| AU9179282A (en) * | 1982-05-27 | 1983-12-01 | Allegheny Ludlum Steel Corp. | Amorphous, magnetic iron base - boron silicon alloy |
| JPS58213857A (ja) * | 1982-06-04 | 1983-12-12 | Takeshi Masumoto | 疲労特性に優れた非晶質鉄基合金 |
| JPS6465240A (en) * | 1983-03-23 | 1989-03-10 | Nippon Metal Ind | High corrosion-resistant amorphous alloy |
| JPS5913056A (ja) * | 1983-06-06 | 1984-01-23 | Res Inst Iron Steel Tohoku Univ | 高強度、耐疲労、耐全面腐食、耐孔食、耐隙間腐食、耐応力腐食割れ、耐水素脆性用アモルフアス鉄合金 |
| JPS6029234A (ja) * | 1983-07-11 | 1985-02-14 | Mitsubishi Electric Corp | ワイヤカツト放電加工用ワイヤ電極 |
| JPS6059032A (ja) * | 1983-09-13 | 1985-04-05 | Takeshi Masumoto | 耐食性に優れたPd基非晶質金属細線 |
| JPS6059034A (ja) * | 1983-09-13 | 1985-04-05 | Takeshi Masumoto | Cu−Ζr系非晶質金属細線 |
| JPS60143768U (ja) * | 1984-03-02 | 1985-09-24 | 久井 宗裕 | 制御用ワイヤの成形材料 |
| EP0192703B1 (en) * | 1984-08-31 | 1989-11-02 | AT&T Corp. | Nickel-based electrical contact |
| JPS6167751A (ja) * | 1984-09-10 | 1986-04-07 | Teijin Ltd | 非晶質合金及びその製造法 |
| DE3524018A1 (de) * | 1985-07-02 | 1987-01-15 | Mannesmann Ag | Verfahren und vorrichtung zum herstellen von metallglas |
| US4701226A (en) * | 1985-07-15 | 1987-10-20 | The Standard Oil Company | Corrosion resistant amorphous chromium-metalloid alloy compositions |
| JPS62221199A (ja) * | 1986-03-24 | 1987-09-29 | 株式会社 リケン | 磁気シ−ルド材 |
| JPS6362839A (ja) * | 1986-09-03 | 1988-03-19 | Nec Corp | Ta−W系非晶質合金及びその製造方法 |
| JPS6362837A (ja) * | 1986-09-03 | 1988-03-19 | Nec Corp | Ta−W系非晶質合金及びその製造方法 |
| JPS6362838A (ja) * | 1986-09-03 | 1988-03-19 | Nec Corp | Ta−W系非晶質合金及びその製造方法 |
| JPS63125670A (ja) * | 1986-11-13 | 1988-05-28 | Nec Corp | Ta−W系非晶質合金薄膜の製造方法 |
| JPS63130767A (ja) * | 1986-11-19 | 1988-06-02 | Nec Corp | Ta系非晶質合金薄膜の製造方法 |
| JPS63130768A (ja) * | 1986-11-19 | 1988-06-02 | Nec Corp | Ta系非晶質合金薄膜の製造方法 |
| JPS63130766A (ja) * | 1986-11-19 | 1988-06-02 | Nec Corp | Ta系非晶質合金薄膜の製造方法 |
| JPS6425932A (en) * | 1988-07-06 | 1989-01-27 | Takeshi Masumoto | Co-type amorphous-metal filament |
| US5015993A (en) * | 1989-06-29 | 1991-05-14 | Pitney Bowes Inc. | Ferromagnetic alloys with high nickel content and high permeability |
| JPH04176846A (ja) * | 1990-11-09 | 1992-06-24 | Seiko Instr Inc | カラー金合金 |
| JP2677721B2 (ja) * | 1991-05-15 | 1997-11-17 | 功二 橋本 | 高耐食アモルファス合金 |
| DE4303316A1 (de) * | 1993-02-05 | 1994-08-11 | Abb Management Ag | Oxidations- und korrosionsbeständige Legierung auf der Basis von dotiertem Eisenaluminid und Verwendung dieser Legierung |
| DE19514889C2 (de) * | 1995-04-22 | 1998-06-10 | Dresden Ev Inst Festkoerper | Verfahren zur Herstellung metallischer Halbzeuge |
| WO2008105135A1 (ja) | 2007-02-28 | 2008-09-04 | Nippon Steel Corporation | 軟磁気特性に優れたFe系非晶質合金 |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3403996A (en) * | 1965-09-17 | 1968-10-01 | Matsushita Electric Industrial Co Ltd | Ferromagnetic material |
| US3406057A (en) * | 1965-03-26 | 1968-10-15 | Matsushita Electric Industrial Co Ltd | Ferromagnetic material |
| US3427154A (en) * | 1964-09-11 | 1969-02-11 | Ibm | Amorphous alloys and process therefor |
| US3433630A (en) * | 1965-10-15 | 1969-03-18 | Matsushita Electric Industrial Co Ltd | Magnetic permeability material |
| US3461943A (en) * | 1966-10-17 | 1969-08-19 | United Aircraft Corp | Process for making filamentary materials |
| US3542542A (en) * | 1968-04-05 | 1970-11-24 | Matsushita Electric Industrial Co Ltd | Magnetic permeability material |
| US3543831A (en) * | 1967-01-09 | 1970-12-01 | United Aircraft Corp | Electrostatic coatings |
| US3658979A (en) * | 1965-03-30 | 1972-04-25 | Monsanto Co | Method for forming fibers and filaments directly from melts of low viscosities |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US905758A (en) * | 1908-03-14 | 1908-12-01 | Edward Halford Strange | Process of manufacturing thin sheets, foil, strips, or ribbons of zinc, lead, or other metal or alloy. |
| US3871836A (en) * | 1972-12-20 | 1975-03-18 | Allied Chem | Cutting blades made of or coated with an amorphous metal |
| GB1476589A (en) * | 1974-08-07 | 1977-06-16 | Allied Chem | Amorphous metal alloys |
| EP0002923B1 (en) * | 1978-01-03 | 1981-11-11 | Allied Corporation | Iron group transition metal-refractory metal-boron glassy alloys |
-
1972
- 1972-12-26 US US00318146A patent/US3856513A/en not_active Ceased
-
1973
- 1973-11-06 JP JP12411373A patent/JPS5519976B2/ja not_active Expired
- 1973-11-21 GB GB5408573A patent/GB1447267A/en not_active Expired
- 1973-11-21 GB GB1446975A patent/GB1447268A/en not_active Expired
- 1973-11-30 CA CA187,101A patent/CA1012382A/en not_active Expired
- 1973-11-30 IT IT70517/73A patent/IT999851B/it active
- 1973-12-21 DE DE2364131A patent/DE2364131C2/de not_active Expired
- 1973-12-21 DE DE2366326A patent/DE2366326C2/de not_active Expired
- 1973-12-21 DE DE2366327A patent/DE2366327C2/de not_active Expired
- 1973-12-26 FR FR7346350A patent/FR2211536B1/fr not_active Expired
-
1978
- 1978-12-01 JP JP53148972A patent/JPS5935417B2/ja not_active Expired
-
1979
- 1979-12-18 JP JP54163656A patent/JPS5842256B2/ja not_active Expired
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3427154A (en) * | 1964-09-11 | 1969-02-11 | Ibm | Amorphous alloys and process therefor |
| US3406057A (en) * | 1965-03-26 | 1968-10-15 | Matsushita Electric Industrial Co Ltd | Ferromagnetic material |
| US3658979A (en) * | 1965-03-30 | 1972-04-25 | Monsanto Co | Method for forming fibers and filaments directly from melts of low viscosities |
| US3403996A (en) * | 1965-09-17 | 1968-10-01 | Matsushita Electric Industrial Co Ltd | Ferromagnetic material |
| US3433630A (en) * | 1965-10-15 | 1969-03-18 | Matsushita Electric Industrial Co Ltd | Magnetic permeability material |
| US3461943A (en) * | 1966-10-17 | 1969-08-19 | United Aircraft Corp | Process for making filamentary materials |
| US3543831A (en) * | 1967-01-09 | 1970-12-01 | United Aircraft Corp | Electrostatic coatings |
| US3542542A (en) * | 1968-04-05 | 1970-11-24 | Matsushita Electric Industrial Co Ltd | Magnetic permeability material |
Cited By (332)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4033795A (en) * | 1971-12-30 | 1977-07-05 | International Business Machines Corporation | Method for inducing uniaxial magnetic anisotropy in an amorphous ferromagnetic alloy |
| US3940293A (en) * | 1972-12-20 | 1976-02-24 | Allied Chemical Corporation | Method of producing amorphous cutting blades |
| USRE29989E (en) * | 1972-12-20 | 1979-05-08 | Allied Chemical Corporation | Cutting blades made of or coated with an amorphous metal |
| USRE30106E (en) * | 1972-12-20 | 1979-10-02 | Allied Chemical Corporation | Method of producing amorphous cutting blades |
| US4007072A (en) * | 1973-11-16 | 1977-02-08 | Fuji Photo Film Co., Ltd. | Ferromagnetic metal powder comprising lead and method for making the same |
| USRE29239E (en) * | 1974-01-07 | 1977-05-31 | Whyco Chromium Company Inc. | Ternary alloys |
| US3986867A (en) * | 1974-01-12 | 1976-10-19 | The Research Institute For Iron, Steel And Other Metals Of The Tohoku University | Iron-chromium series amorphous alloys |
| US4059441A (en) * | 1974-08-07 | 1977-11-22 | Allied Chemical Corporation | Metallic glasses with high crystallization temperatures and high hardness values |
| US4053333A (en) * | 1974-09-20 | 1977-10-11 | University Of Pennsylvania | Enhancing magnetic properties of amorphous alloys by annealing under stress |
| US4053331A (en) * | 1974-09-20 | 1977-10-11 | University Of Pennsylvania | Method of making amorphous metallic alloys having enhanced magnetic properties by using tensile stress |
| US4053332A (en) * | 1974-09-20 | 1977-10-11 | University Of Pennsylvania | Enhancing magnetic properties of amorphous alloys by rolling |
| US3989517A (en) * | 1974-10-30 | 1976-11-02 | Allied Chemical Corporation | Titanium-beryllium base amorphous alloys |
| USRE30080E (en) * | 1975-04-28 | 1979-08-21 | Allied Chemical Corporation | Titanium-beryllium base amorphous alloys |
| US3986901A (en) * | 1975-04-30 | 1976-10-19 | International Business Machines Corporation | Controlled catalyst for manufacturing magnetic alloy particles having selective coercivity |
| US4067732A (en) * | 1975-06-26 | 1978-01-10 | Allied Chemical Corporation | Amorphous alloys which include iron group elements and boron |
| US4052201A (en) * | 1975-06-26 | 1977-10-04 | Allied Chemical Corporation | Amorphous alloys with improved resistance to embrittlement upon heat treatment |
| US4050931A (en) * | 1975-08-13 | 1977-09-27 | Allied Chemical Corporation | Amorphous metal alloys in the beryllium-titanium-zirconium system |
| US4202022A (en) * | 1975-10-20 | 1980-05-06 | Kokusai Denshin Denwa Kabushiki Kaisha | Magnetic transfer record film and apparatus for magneto-optically reading magnetic record patterns using the same |
| US4126494A (en) * | 1975-10-20 | 1978-11-21 | Kokusai Denshin Denwa Kabushiki Kaisha | Magnetic transfer record film |
| US4036638A (en) * | 1975-11-13 | 1977-07-19 | Allied Chemical Corporation | Binary amorphous alloys of iron or cobalt and boron |
| US4122240A (en) * | 1976-02-17 | 1978-10-24 | United Technologies Corporation | Skin melting |
| US4038073A (en) * | 1976-03-01 | 1977-07-26 | Allied Chemical Corporation | Near-zero magnetostrictive glassy metal alloys with high saturation induction |
| FR2343394A1 (fr) * | 1976-03-02 | 1977-09-30 | Allied Chem | Blindage electromagnetique flexible |
| US4030892A (en) * | 1976-03-02 | 1977-06-21 | Allied Chemical Corporation | Flexible electromagnetic shield comprising interlaced glassy alloy filaments |
| US4126287A (en) * | 1976-03-02 | 1978-11-21 | Allied Chemical Corporation | Flexible electromagnetic shield comprising interlaced glassy alloy filaments |
| US4152486A (en) * | 1976-03-11 | 1979-05-01 | Kokusai Denshin Denwa Kabushiki Kaisha | Magneto-optical memory medium |
| US4056411A (en) * | 1976-05-14 | 1977-11-01 | Ho Sou Chen | Method of making magnetic devices including amorphous alloys |
| US4116728A (en) * | 1976-09-02 | 1978-09-26 | General Electric Company | Treatment of amorphous magnetic alloys to produce a wide range of magnetic properties |
| US4081298A (en) * | 1976-09-07 | 1978-03-28 | Allied Chemical Corporation | Heat treatment of iron-nickel-phosphorus-boron glassy metal alloys |
| US4085396A (en) * | 1976-09-27 | 1978-04-18 | Bell Telephone Laboratories, Incorporated | Electric fuse |
| US4115682A (en) * | 1976-11-24 | 1978-09-19 | Allied Chemical Corporation | Welding of glassy metallic materials |
| US4116687A (en) * | 1976-12-13 | 1978-09-26 | Allied Chemical Corporation | Glassy superconducting metal alloys in the beryllium-niobium-zirconium system |
| US4745037A (en) * | 1976-12-15 | 1988-05-17 | Allied Corporation | Homogeneous, ductile brazing foils |
| US4148973A (en) * | 1976-12-15 | 1979-04-10 | Allied Chemical Corporation | Homogeneous, ductile brazing foils |
| US4116682A (en) * | 1976-12-27 | 1978-09-26 | Polk Donald E | Amorphous metal alloys and products thereof |
| US4152146A (en) * | 1976-12-29 | 1979-05-01 | Allied Chemical Corporation | Glass-forming alloys with improved filament strength |
| US4152144A (en) * | 1976-12-29 | 1979-05-01 | Allied Chemical Corporation | Metallic glasses having a combination of high permeability, low magnetostriction, low ac core loss and high thermal stability |
| US4137075A (en) * | 1977-01-17 | 1979-01-30 | Allied Chemical Corporation | Metallic glasses with a combination of high crystallization temperatures and high hardness values |
| US4188211A (en) * | 1977-02-18 | 1980-02-12 | Tdk Electronics Company, Limited | Thermally stable amorphous magnetic alloy |
| US4247398A (en) * | 1977-04-05 | 1981-01-27 | Tdk Electronics Co., Ltd. | High gradient magnetic separation apparatus |
| US4172718A (en) * | 1977-05-04 | 1979-10-30 | Siemens Aktiengesellschaft | Ta-containing amorphous alloy layers and process for producing the same |
| US4118222A (en) * | 1977-06-02 | 1978-10-03 | Allied Chemical Corporation | Glassy hafnium-beryllium alloys |
| FR2394101A1 (fr) * | 1977-06-06 | 1979-01-05 | Corning Glass Works | Guide d'onde optique a revetement protecteur |
| US4148669A (en) * | 1977-08-09 | 1979-04-10 | Allied Chemical Corporation | Zirconium-titanium alloys containing transition metal elements |
| US4171992A (en) * | 1977-08-09 | 1979-10-23 | Allied Chemical Corporation | Preparation of zirconium alloys containing transition metal elements |
| US4113478A (en) * | 1977-08-09 | 1978-09-12 | Allied Chemical Corporation | Zirconium alloys containing transition metal elements |
| US4135924A (en) * | 1977-08-09 | 1979-01-23 | Allied Chemical Corporation | Filaments of zirconium-copper glassy alloys containing transition metal elements |
| US4126449A (en) * | 1977-08-09 | 1978-11-21 | Allied Chemical Corporation | Zirconium-titanium alloys containing transition metal elements |
| US4150981A (en) * | 1977-08-15 | 1979-04-24 | Allied Chemical Corporation | Glassy alloys containing cobalt, nickel and iron having near-zero magnetostriction and high saturation induction |
| US4221592A (en) * | 1977-09-02 | 1980-09-09 | Allied Chemical Corporation | Glassy alloys which include iron group elements and boron |
| DE2839626A1 (de) * | 1977-09-12 | 1979-03-22 | Sony Corp | Amorphe magnetische legierung |
| US4190438A (en) * | 1977-09-12 | 1980-02-26 | Sony Corporation | Amorphous magnetic alloy |
| US4225339A (en) * | 1977-12-28 | 1980-09-30 | Tokyo Shibaura Denki Kabushiki Kaisha | Amorphous alloy of high magnetic permeability |
| US4231816A (en) * | 1977-12-30 | 1980-11-04 | International Business Machines Corporation | Amorphous metallic and nitrogen containing alloy films |
| EP0002909A1 (en) * | 1978-01-03 | 1979-07-11 | Allied Corporation | Amorphous alloys and filaments thereof |
| US4133681A (en) * | 1978-01-03 | 1979-01-09 | Allied Chemical Corporation | Nickel-refractory metal-boron glassy alloys |
| US4140525A (en) * | 1978-01-03 | 1979-02-20 | Allied Chemical Corporation | Ultra-high strength glassy alloys |
| US4133679A (en) * | 1978-01-03 | 1979-01-09 | Allied Chemical Corporation | Iron-refractory metal-boron glassy alloys |
| US4133682A (en) * | 1978-01-03 | 1979-01-09 | Allied Chemical Corporation | Cobalt-refractory metal-boron glassy alloys |
| WO1979000674A1 (fr) * | 1978-02-03 | 1979-09-20 | Shin Gijutsu Kaihatsu Jigyodan | Alliages de carbone amorphe et articles fabriques avec ces alliages |
| US4318738A (en) * | 1978-02-03 | 1982-03-09 | Shin-Gijutsu Kaihatsu Jigyodan | Amorphous carbon alloys and articles manufactured from said alloys |
| US4210443A (en) * | 1978-02-27 | 1980-07-01 | Allied Chemical Corporation | Iron group transition metal-refractory metal-boron glassy alloys |
| US4152147A (en) * | 1978-04-10 | 1979-05-01 | Allied Chemical Corporation | Beryllium-containing iron-boron glassy magnetic alloys |
| US4300950A (en) * | 1978-04-20 | 1981-11-17 | General Electric Company | Amorphous metal alloys and ribbons thereof |
| US4202089A (en) * | 1978-06-02 | 1980-05-13 | The Singer Company | Splat-cooled instrument flexure and method to fabricate same |
| US4283225A (en) * | 1978-06-05 | 1981-08-11 | Allied Chemical Corporation | Process for fabricating homogeneous, ductile brazing foils and products produced thereby |
| US4169744A (en) * | 1978-06-28 | 1979-10-02 | Western Gold And Platinum Company | Nickel-chromium-silicon alloy brazing foil |
| EP0007062A1 (en) * | 1978-07-17 | 1980-01-23 | Allied Corporation | Preparation of phosphorus-containing metallic glass-forming alloy melts |
| US4201601A (en) * | 1978-07-19 | 1980-05-06 | Gte Sylvania Incorporated | Copper brazing alloy foils containing germanium |
| US4189618A (en) * | 1978-07-31 | 1980-02-19 | Allied Chemical Corporation | Electromagnetic shielding envelopes from wound glassy metal filaments |
| US4536361A (en) * | 1978-08-28 | 1985-08-20 | Torobin Leonard B | Method for producing plastic microfilaments |
| US4392072A (en) * | 1978-09-13 | 1983-07-05 | General Electric Company | Dynamoelectric machine stator having articulated amorphous metal components |
| US4309214A (en) * | 1978-09-18 | 1982-01-05 | L'air Liquide, Societe Anonyme Pour L'etude Et L'exploitation Des Procedes Georges Claude | Manufacture of metal powder |
| US4525223A (en) * | 1978-09-19 | 1985-06-25 | Noboru Tsuya | Method of manufacturing a thin ribbon wafer of semiconductor material |
| US4186245A (en) * | 1978-09-28 | 1980-01-29 | Allied Chemical Corporation | Energy storage flywheel |
| EP0010866A1 (en) * | 1978-10-02 | 1980-05-14 | Allied Corporation | Homogeneous brazing foils of copper based metallic glasses |
| US4197146A (en) * | 1978-10-24 | 1980-04-08 | General Electric Company | Molded amorphous metal electrical magnetic components |
| US4174419A (en) * | 1978-11-08 | 1979-11-13 | Allied Chemical Corporation | Stabilized magnetic shields |
| EP0011703A1 (en) * | 1978-11-08 | 1980-06-11 | Allied Corporation | Magnetic composite structure and method for making said structure |
| US4316572A (en) * | 1978-11-13 | 1982-02-23 | Allied Corporation | Homogeneous, ductile brazing foils |
| US4201837A (en) * | 1978-11-16 | 1980-05-06 | General Electric Company | Bonded amorphous metal electromagnetic components |
| US4341845A (en) * | 1978-12-22 | 1982-07-27 | General Electric Company | Helical metallic ribbon for continuous edge winding applications |
| US4256039A (en) * | 1979-01-02 | 1981-03-17 | Allied Chemical Corporation | Armor-piercing projectile |
| US4268325A (en) * | 1979-01-22 | 1981-05-19 | Allied Chemical Corporation | Magnetic glassy metal alloy sheets with improved soft magnetic properties |
| JPS55104450A (en) * | 1979-01-30 | 1980-08-09 | Tohoku Metal Ind Ltd | Amorphous magnetic alloy with superior corrosion resistance and stress corrosion cracking resistance |
| US4302515A (en) * | 1979-02-01 | 1981-11-24 | Allied Corporation | Nickel brazed articles |
| EP0014335A1 (en) * | 1979-02-01 | 1980-08-20 | Allied Corporation | Homogeneous ductile brazing foils |
| US4260007A (en) * | 1979-03-14 | 1981-04-07 | Allied Chemical Corporation | Method and apparatus for casting amorphous filament using a crucible with a boric oxide seal |
| US4229389A (en) * | 1979-03-16 | 1980-10-21 | Thompson Marine Corporation | Gas diffuser, aerator, or sparger apparatus |
| US4248707A (en) * | 1979-03-16 | 1981-02-03 | Thompson Marine Corporation | Gas diffuser, aerator, or sparger method |
| EP0069406A2 (en) | 1979-03-23 | 1983-01-12 | Allied Corporation | Method of making shaped articles from metallic glass bodies |
| US4221587A (en) * | 1979-03-23 | 1980-09-09 | Allied Chemical Corporation | Method for making metallic glass powder |
| EP0019682A1 (en) * | 1979-03-23 | 1980-12-10 | Allied Corporation | Method for making metallic glass powder |
| US4576653A (en) * | 1979-03-23 | 1986-03-18 | Allied Corporation | Method of making complex boride particle containing alloys |
| US4439236A (en) * | 1979-03-23 | 1984-03-27 | Allied Corporation | Complex boride particle containing alloys |
| US4353737A (en) * | 1979-03-23 | 1982-10-12 | Allied Corporation | Method of making metallic glass powders from glassy alloys |
| DE3010506A1 (de) * | 1979-03-23 | 1980-09-25 | Allied Chem | Metallglaspulver und verfahren zu dessen herstellung |
| DE3011152A1 (de) * | 1979-03-23 | 1980-10-02 | Allied Chem | Borhaltige legierungen, verfahren zu deren herstellung und deren verwendung |
| EP0017723A1 (en) * | 1979-03-23 | 1980-10-29 | Allied Corporation | Method and apparatus for making metallic glass powder |
| US4290808A (en) * | 1979-03-23 | 1981-09-22 | Allied Chemical Corporation | Metallic glass powders from glassy alloys |
| EP0016916A1 (en) * | 1979-03-30 | 1980-10-15 | Allied Corporation | Homogeneous ductile brazing foils |
| WO1980002123A1 (en) * | 1979-04-09 | 1980-10-16 | United Technologies Corp | Wire with rapidly quenched structure |
| USRE32428E (en) * | 1979-04-23 | 1987-05-26 | Allied Corporation | Amorphous antipilferage marker |
| US4484184A (en) * | 1979-04-23 | 1984-11-20 | Allied Corporation | Amorphous antipilferage marker |
| USRE32427E (en) * | 1979-04-23 | 1987-05-26 | Amorphous antipilferage marker | |
| US4298862A (en) * | 1979-04-23 | 1981-11-03 | Allied Chemical Corporation | Amorphous antipilferage marker |
| EP0018507A1 (en) * | 1979-05-03 | 1980-11-12 | Allied Corporation | Beryllium-containing iron-boron glassy magnetic alloys and devices utilizing same |
| US4226619A (en) * | 1979-05-04 | 1980-10-07 | Electric Power Research Institute, Inc. | Amorphous alloy with high magnetic induction at room temperature |
| US4217135A (en) * | 1979-05-04 | 1980-08-12 | General Electric Company | Iron-boron-silicon ternary amorphous alloys |
| US4409296A (en) * | 1979-05-09 | 1983-10-11 | Allegheny Ludlum Steel Corporation | Rapidly cast alloy strip having dissimilar portions |
| US4339270A (en) * | 1979-05-16 | 1982-07-13 | Toyo Soda Manufacturing Co. Ltd. | Corrosion resistant amorphous noble metal-base alloys |
| US4219355A (en) * | 1979-05-25 | 1980-08-26 | Allied Chemical Corporation | Iron-metalloid amorphous alloys for electromagnetic devices |
| EP0020937A1 (en) * | 1979-05-25 | 1981-01-07 | Allied Corporation | Method of enhancing the magnetic properties of amorphous metal alloys |
| JPS55161048A (en) * | 1979-06-01 | 1980-12-15 | Nippon Steel Corp | Amorphous alloy for transformer |
| US5200002A (en) * | 1979-06-15 | 1993-04-06 | Vacuumschmelze Gmbh | Amorphous low-retentivity alloy |
| US4470553A (en) * | 1979-08-16 | 1984-09-11 | Allied Corporation | Inline winder |
| US4314661A (en) * | 1979-08-20 | 1982-02-09 | Allied Corporation | Homogeneous, ductile brazing foils |
| US4331497A (en) * | 1979-08-27 | 1982-05-25 | Allied Corporation | Composite shell |
| US4258756A (en) * | 1979-08-27 | 1981-03-31 | Allied Chemical Corporation | Composite shell |
| EP0027502A1 (en) * | 1979-08-27 | 1981-04-29 | Allied Corporation | Composite shell formed of glassy metal alloy strips |
| US4260416A (en) * | 1979-09-04 | 1981-04-07 | Allied Chemical Corporation | Amorphous metal alloy for structural reinforcement |
| EP0027515A1 (en) * | 1979-09-04 | 1981-04-29 | Allied Corporation | Amorphous metal useful as structural reinforcement |
| US4265665A (en) * | 1979-10-01 | 1981-05-05 | Allied Chemical Corporation | Foundry molds containing glassy metal alloy filaments |
| EP0026863A1 (en) * | 1979-10-09 | 1981-04-15 | Allied Corporation | Corrosion resistant glassy metal alloys |
| US4406700A (en) * | 1979-11-14 | 1983-09-27 | Allied Corporation | Powder produced by embrittling of metallic glassy alloy by hydrogen charging |
| US4359352A (en) * | 1979-11-19 | 1982-11-16 | Marko Materials, Inc. | Nickel base superalloys which contain boron and have been processed by a rapid solidification process |
| US4298409A (en) * | 1979-12-10 | 1981-11-03 | Allied Chemical Corporation | Method for making iron-metalloid amorphous alloys for electromagnetic devices |
| US4249969A (en) * | 1979-12-10 | 1981-02-10 | Allied Chemical Corporation | Method of enhancing the magnetic properties of an Fea Bb Sic d amorphous alloy |
| US4338131A (en) * | 1980-02-19 | 1982-07-06 | Allied Corporation | Nickel-boron binary amorphous alloys |
| US4321090A (en) * | 1980-03-06 | 1982-03-23 | Allied Corporation | Magnetic amorphous metal alloys |
| EP0035644A1 (en) * | 1980-03-06 | 1981-09-16 | Allied Corporation | Magnetic amorphous metal alloys |
| US4735864A (en) * | 1980-04-17 | 1988-04-05 | Tsuyoshi Masumoto and Unitika, Limited | Amorphous metal filaments and process for producing same |
| EP0039169A3 (en) * | 1980-04-17 | 1981-12-09 | Tsuyoshi Masumoto | Amorphous metal filaments and process for producing the same |
| US4523626A (en) * | 1980-04-17 | 1985-06-18 | Tsuyoshi Masumoto | Amorphous metal filaments and process for producing the same |
| EP0038584A1 (de) * | 1980-04-21 | 1981-10-28 | BBC Aktiengesellschaft Brown, Boveri & Cie. | Mehrschichtiges Lot und Verfahren zu dessen Herstellung |
| US4385944A (en) * | 1980-05-29 | 1983-05-31 | Allied Corporation | Magnetic implements from glassy alloys |
| US4385932A (en) * | 1980-06-24 | 1983-05-31 | Tokyo Shibaura Denki Kabushiki Kaisha | Amorphous magnetic alloy |
| US4889568A (en) * | 1980-09-26 | 1989-12-26 | Allied-Signal Inc. | Amorphous alloys for electromagnetic devices cross reference to related applications |
| US4409041A (en) * | 1980-09-26 | 1983-10-11 | Allied Corporation | Amorphous alloys for electromagnetic devices |
| US4527614A (en) * | 1980-10-14 | 1985-07-09 | Unitika Ltd. | Amorphous Co-based metal filaments and process for production of the same |
| EP0050479A1 (en) * | 1980-10-16 | 1982-04-28 | Unitika Ltd. | Amorphous co-based metal filaments and process for the production of the same |
| US4781771A (en) * | 1980-10-16 | 1988-11-01 | Unitika Ltd. | Amorphous Co-based metal filaments and process for production of the same |
| EP0055371A1 (en) * | 1980-12-27 | 1982-07-07 | Kabushiki Kaisha Toshiba | Neutron absorber, neutron absorber assembly utilizing the same, and other uses thereof |
| US4523950A (en) * | 1980-12-29 | 1985-06-18 | Allied Corporation | Boron containing rapid solidification alloy and method of making the same |
| US4533389A (en) * | 1980-12-29 | 1985-08-06 | Allied Corporation | Boron containing rapid solidification alloy and method of making the same |
| EP0055327A1 (en) * | 1980-12-29 | 1982-07-07 | Allied Corporation | Amorphous metal alloys having enhanced AC magnetic properties |
| US4389262A (en) * | 1980-12-31 | 1983-06-21 | Allied Corporation | Amorphous alloys of nickel, aluminum and boron |
| EP0055403A1 (en) * | 1980-12-31 | 1982-07-07 | Allied Corporation | Amorphous alloys of nickel, aluminum and boron |
| EP0056141A1 (en) * | 1981-01-14 | 1982-07-21 | Allied Corporation | Homogeneous ductile nickel-palladium based brazing foils |
| US4537517A (en) * | 1981-02-10 | 1985-08-27 | Tokyo Shibaura Denki Kabushiki Kaisha | Temperature sensitive amorphous magnetic alloy |
| US4517017A (en) * | 1981-02-10 | 1985-05-14 | Tokyo Shibaura Denki Kabushiki Kaisha | Temperature sensitive amorphous magnetic alloy |
| US6296948B1 (en) | 1981-02-17 | 2001-10-02 | Ati Properties, Inc. | Amorphous metal alloy strip and method of making such strip |
| US6471789B1 (en) | 1981-02-17 | 2002-10-29 | Ati Properties | Amorphous metal alloy strip |
| US5370749A (en) * | 1981-02-17 | 1994-12-06 | Allegheny Ludlum Corporation | Amorphous metal alloy strip |
| US6277212B1 (en) | 1981-02-17 | 2001-08-21 | Ati Properties, Inc. | Amorphous metal alloy strip and method of making such strip |
| DE3106607A1 (de) * | 1981-02-23 | 1982-09-09 | Fr. Kammerer GmbH, 7530 Pforzheim | Plattierverfahren |
| US4437907A (en) | 1981-03-06 | 1984-03-20 | Nippon Steel Corporation | Amorphous alloy for use as a core |
| US4525314A (en) * | 1981-03-18 | 1985-06-25 | Torobin Leonard B | Producing metal and metal glass microfilaments |
| US4495691A (en) * | 1981-03-31 | 1985-01-29 | Tsuyoshi Masumoto | Process for the production of fine amorphous metallic wires |
| US4381943A (en) * | 1981-07-20 | 1983-05-03 | Allied Corporation | Chemically homogeneous microcrystalline metal powder for coating substrates |
| US4503085A (en) * | 1981-07-22 | 1985-03-05 | Allied Corporation | Amorphous metal powder for coating substrates |
| US4473417A (en) * | 1981-08-18 | 1984-09-25 | Tokyo Shibaura Denki Kabushiki Kaisha | Amorphous alloy for magnetic core material |
| US4834816A (en) * | 1981-08-21 | 1989-05-30 | Allied-Signal Inc. | Metallic glasses having a combination of high permeability, low coercivity, low ac core loss, low exciting power and high thermal stability |
| US4614221A (en) * | 1981-09-29 | 1986-09-30 | Unitika Ltd. | Method of manufacturing thin metal wire |
| US4433474A (en) | 1981-10-08 | 1984-02-28 | Electric Power Research Institute, Inc. | Amorphous magnetic core and process for manufacturing to improve efficiency |
| EP0076918A1 (en) * | 1981-10-08 | 1983-04-20 | Allied Corporation | Amorphous magnetic core and process for manufacturing to improve efficiency |
| US4495487A (en) * | 1981-11-02 | 1985-01-22 | Allied Corporation | Amorphous antipilferage marker |
| EP0078401B1 (en) * | 1981-11-02 | 1985-08-07 | Allied Corporation | Amorphous antipilferage marker |
| US4650130A (en) * | 1982-01-04 | 1987-03-17 | Allied Corporation | Rapidly solidified powder production system |
| US4464208A (en) * | 1982-01-08 | 1984-08-07 | Tokyo Shibaura Denki Kabushiki Kaisha | Amorphous alloy for magnetic head |
| EP0086973A3 (en) * | 1982-02-18 | 1984-10-24 | Allied Corporation | Tuned vibration detector |
| US4439253A (en) * | 1982-03-04 | 1984-03-27 | Allied Corporation | Cobalt rich manganese containing near-zero magnetostrictive metallic glasses having high saturation induction |
| US4655857A (en) * | 1982-03-08 | 1987-04-07 | Tsuyoshi Masumoto | Ni-Cr type alloy material |
| US4379720A (en) * | 1982-03-15 | 1983-04-12 | Marko Materials, Inc. | Nickel-aluminum-boron powders prepared by a rapid solidification process |
| EP0092091A3 (en) * | 1982-04-15 | 1984-03-07 | Allied Corporation | Manufacture of powder cores for electromagnetic apparatus |
| EP0092091A2 (en) | 1982-04-15 | 1983-10-26 | Allied Corporation | Apparatus for the production of magnetic powder |
| EP0093281A3 (en) * | 1982-04-29 | 1986-03-26 | Allied Corporation | Surveillance system having magnetomechanical marker |
| US4510490A (en) * | 1982-04-29 | 1985-04-09 | Allied Corporation | Coded surveillance system having magnetomechanical marker |
| US4450206A (en) * | 1982-05-27 | 1984-05-22 | Allegheny Ludlum Steel Corporation | Amorphous metals and articles made thereof |
| EP0096182A3 (en) * | 1982-06-03 | 1986-03-26 | Allied Corporation | Coded surveillance system having magnetomechanical marker |
| EP0100919A1 (en) * | 1982-08-11 | 1984-02-22 | Allied Corporation | Low temperature, high strength nickel based brazing alloys |
| EP0103770A1 (en) * | 1982-09-20 | 1984-03-28 | Allied Corporation | Homogeneous low melting point copper based alloys |
| EP0103805A1 (en) * | 1982-09-20 | 1984-03-28 | Allied Corporation | Homogeneous low melting point copper based alloys |
| US4489136A (en) * | 1982-09-20 | 1984-12-18 | Allied Corporation | Homogeneous low melting point copper based alloys |
| US4469536A (en) * | 1982-11-10 | 1984-09-04 | The United States Of America As Represented By The Secretary Of The Navy | Alloys and method of making |
| US4543135A (en) * | 1982-11-15 | 1985-09-24 | Allied Corporation | Nickel high-chromium base brazing filler metal for high temperature applications |
| USRE35042E (en) * | 1983-02-04 | 1995-09-26 | Allied Corporation | Amorphous antipilferage marker |
| US4553136A (en) * | 1983-02-04 | 1985-11-12 | Allied Corporation | Amorphous antipilferage marker |
| EP0121649A1 (en) * | 1983-02-04 | 1984-10-17 | Allied Corporation | Amorphous antipilferage marker |
| US4606977A (en) * | 1983-02-07 | 1986-08-19 | Allied Corporation | Amorphous metal hardfacing coatings |
| US4702302A (en) * | 1983-02-23 | 1987-10-27 | Sumitomo Electric Industries Ltd. | Method of making thin alloy wire |
| US4448618A (en) * | 1983-02-28 | 1984-05-15 | Allied Corporation | Nickel based brazing filler metals |
| US4508257A (en) * | 1983-02-28 | 1985-04-02 | Allied Corporation | Method of brazing with nickel based alloy |
| US4588452A (en) * | 1983-03-16 | 1986-05-13 | Allied Corporation | Amorphous alloys for electromagnetic devices |
| US4473413A (en) * | 1983-03-16 | 1984-09-25 | Allied Corporation | Amorphous alloys for electromagnetic devices |
| US4520335A (en) * | 1983-04-06 | 1985-05-28 | Westinghouse Electric Corp. | Transformer with ferromagnetic circuits of unequal saturation inductions |
| US4573630A (en) * | 1983-04-26 | 1986-03-04 | Allied Corporation | Homogeneous low melting point copper based alloys |
| DE3422281A1 (de) * | 1983-06-20 | 1984-12-20 | Allied Corp., Morristown, N.J. | Verfahren zur herstellung von formlingen aus magnetischen metallegierungen und so hergestellte formlinge |
| US4839487A (en) * | 1983-07-06 | 1989-06-13 | Mitsubishi Denki Kabushiki Kaisha | Wire electrode for wire-cut electrical discharge machining |
| US4557769A (en) * | 1983-07-16 | 1985-12-10 | Alps Electric Co., Ltd. | Soft magnetic material |
| US4566323A (en) * | 1983-07-29 | 1986-01-28 | Aisin Seiki Kabushiki Kaisha | Liquid helium level indicating gauge |
| US4612161A (en) * | 1983-10-20 | 1986-09-16 | The United States Of America As Represented By The United States Department Of Energy | Fabrication of metallic glass structures |
| US4655079A (en) * | 1983-11-22 | 1987-04-07 | Aisin Seiki Kabushiki Kaisha | Level gauge for liquid helium |
| US4560454A (en) * | 1984-05-01 | 1985-12-24 | The Standard Oil Company (Ohio) | Electrolysis of halide-containing solutions with platinum based amorphous metal alloy anodes |
| US4643058A (en) * | 1984-05-10 | 1987-02-17 | Allied Corporation | Floating gang rotary slitting device and method |
| EP0166864A1 (en) * | 1984-05-10 | 1986-01-08 | Allied Corporation | Floating gang rotary slitting device |
| US4617983A (en) * | 1984-05-21 | 1986-10-21 | Unitika Ltd. | Method and apparatus for continuously manufacturing metal filaments |
| US5035755A (en) * | 1984-05-23 | 1991-07-30 | Allied-Signal Inc. | Amorphous metal alloys having enhanced AC magnetic properties at elevated temperatures |
| EP0170909A1 (de) * | 1984-07-10 | 1986-02-12 | Atlas Fahrzeugtechnik GmbH | Piezokeramische Ventilplatte für ein Niederdruckeinspritzventil und Verfahren zu deren Herstellung |
| EP0191107A4 (en) * | 1984-07-27 | 1988-10-06 | Japan Res Dev Corp | AMORPHOUS MAGNETIC ACTION MATERIAL. |
| US5060478A (en) * | 1984-07-27 | 1991-10-29 | Research Development Corporation Of Japan | Magnetical working amorphous substance |
| US4735789A (en) * | 1984-07-27 | 1988-04-05 | Lonza Ltd. | Process for the production of catalytically-active metallic glasses |
| US4727202A (en) * | 1984-07-27 | 1988-02-23 | Lonza Ltd. | Process for the production of catalytically-active metallic glasses |
| US4743313A (en) * | 1984-11-12 | 1988-05-10 | Alps Electric Co., Ltd. | Amorphous alloy for use in magnetic heads |
| US4760333A (en) * | 1984-12-13 | 1988-07-26 | Kanto Seiki Co., Ltd. | Crossed coil meter having concentrically wound magnetic shield |
| US4634462A (en) * | 1985-01-09 | 1987-01-06 | Allied Corporation | Methods of and apparatus for monitoring precipitates in metallic materials |
| US4745806A (en) * | 1985-01-29 | 1988-05-24 | Aisin Seiki Kabushiki Kaisha | Level gauge for liquid helium |
| US4781803A (en) * | 1985-02-26 | 1988-11-01 | The Standard Oil Company | Electrolytic processes employing platinum based amorphous metal alloy oxygen anodes |
| US4746584A (en) * | 1985-06-24 | 1988-05-24 | The Standard Oil Company | Novel amorphous metal alloys as electrodes for hydrogen formation and oxidation |
| US4609442A (en) * | 1985-06-24 | 1986-09-02 | The Standard Oil Company | Electrolysis of halide-containing solutions with amorphous metal alloys |
| US4705610A (en) * | 1985-06-24 | 1987-11-10 | The Standard Oil Company | Anodes containing iridium based amorphous metal alloys and use thereof as halogen electrodes |
| AU584436B2 (en) * | 1985-07-15 | 1989-05-25 | Standard Oil Company, The | Corrosion resistant amorphous chromium alloy compositions |
| US4968363A (en) * | 1985-08-06 | 1990-11-06 | Mitsui Engineering & Shipbuilding Co., Ltd. | Method of preventing corrosion of a material against hydrochloric acid |
| US5158229A (en) * | 1985-08-13 | 1992-10-27 | Allied-Signal Inc. | Low temperature, high strength, nickel, base brazing alloys |
| DE3645282C2 (de) * | 1985-12-04 | 1996-02-08 | Gen Electric | Verfahren zum Herstellen eines Transformatorkerns und danach erhaltener gewickelter Transformatorkern |
| DE3690625C2 (de) * | 1985-12-04 | 1994-01-20 | Gen Electric | Verfahren zum Herstellen einer Baueinheit aus einem magnetischen Kern aus amorphem Metall und einer Spulenstruktur für einen elektrischen Transformator und elektrischer Transformator |
| DE3704499A1 (de) * | 1986-02-18 | 1987-08-20 | Gen Electric | Transformatorkern |
| JPS61223103A (ja) * | 1986-02-21 | 1986-10-03 | Toshiba Corp | 非晶質構造体の製造方法 |
| US4823113A (en) * | 1986-02-27 | 1989-04-18 | Allied-Signal Inc. | Glassy alloy identification marker |
| US4750951A (en) * | 1986-05-19 | 1988-06-14 | Alps Electric Co., Ltd. | Amorphous alloy for magnetic heads |
| US4696731A (en) * | 1986-12-16 | 1987-09-29 | The Standard Oil Company | Amorphous metal-based composite oxygen anodes |
| US4702813A (en) * | 1986-12-16 | 1987-10-27 | The Standard Oil Company | Multi-layered amorphous metal-based oxygen anodes |
| US4834814A (en) * | 1987-01-12 | 1989-05-30 | Allied-Signal Inc. | Metallic glasses having a combination of high permeability, low coercivity, low AC core loss, low exciting power and high thermal stability |
| US5041175A (en) * | 1987-04-28 | 1991-08-20 | Yoshida Kogyo K.K. | Amorphous aluminum alloys |
| US4978513A (en) * | 1987-07-14 | 1990-12-18 | Lonza Ltd. | Catalyst for the oxidation of carbon compounds |
| US4916109A (en) * | 1987-07-14 | 1990-04-10 | Lonza Ltd. | Catalyst for the oxidation of carbon compounds |
| DE3841748A1 (de) * | 1988-01-14 | 1989-07-27 | Alps Electric Co Ltd | Legierung mit hochgesaettigter magnetischer flussdichte |
| US5110378A (en) * | 1988-08-17 | 1992-05-05 | Allied-Signal Inc. | Metallic glasses having a combination of high permeability, low coercivity, low ac core loss, low exciting power and high thermal stability |
| US5076865A (en) * | 1988-10-15 | 1991-12-31 | Yoshida Kogyo K. K. | Amorphous aluminum alloys |
| US5443664A (en) * | 1988-11-16 | 1995-08-22 | Hitachi Metals, Ltd. | Surge current-suppressing circuit and magnetic device therein |
| US5277977A (en) * | 1988-12-29 | 1994-01-11 | Tdk Corporation | Ferromagnetic stabilized ultrafine spherical hexagonal crystalline Fe2 |
| US4956743A (en) * | 1989-03-13 | 1990-09-11 | Allied-Signal Inc. | Ground fault interrupters for glassy metal alloys |
| US5011553A (en) * | 1989-07-14 | 1991-04-30 | Allied-Signal, Inc. | Iron-rich metallic glasses having high saturation induction and superior soft ferromagnetic properties |
| US4989989A (en) * | 1989-08-31 | 1991-02-05 | Westinghouse Electric Corp. | Hydraulic sensor for quench detection and location in superconductors |
| US5055144A (en) * | 1989-10-02 | 1991-10-08 | Allied-Signal Inc. | Methods of monitoring precipitates in metallic materials |
| US5279349A (en) * | 1989-12-29 | 1994-01-18 | Honda Giken Kogyo Kabushiki Kaisha | Process for casting amorphous alloy member |
| US5456770A (en) * | 1991-07-30 | 1995-10-10 | Nippon Steel Corporation | Amorphous magnetic alloy with high magnetic flux density |
| US5240066A (en) * | 1991-09-26 | 1993-08-31 | Technalum Research, Inc. | Method of casting amorphous and microcrystalline microwires |
| US5278377A (en) * | 1991-11-27 | 1994-01-11 | Minnesota Mining And Manufacturing Company | Electromagnetic radiation susceptor material employing ferromagnetic amorphous alloy particles |
| US5759300A (en) * | 1994-03-29 | 1998-06-02 | Nippon Steel Corporation | Liquid-phase diffusion bonding alloy foils for joining heat-resistant metals in oxidizing atmospheres |
| US5683822A (en) * | 1994-04-06 | 1997-11-04 | Nippon Steel Corporation | Liquid-phase diffusion bonding alloy foils for joining heat-resistant metals in oxidizing atmospheres |
| CN1047632C (zh) * | 1994-10-14 | 1999-12-22 | Fmc有限公司 | 非晶态金属合金的生产方法 |
| US5518518A (en) * | 1994-10-14 | 1996-05-21 | Fmc Corporation | Amorphous metal alloy and method of producing same |
| RU2149214C1 (ru) * | 1994-10-14 | 2000-05-20 | Фмк Корпорейшн | Аморфный металлический сплав и способ его получения |
| US5583734A (en) * | 1994-11-10 | 1996-12-10 | Raychem Corporation | Surge arrester with overvoltage sensitive grounding switch |
| EP0745698A1 (en) * | 1995-05-31 | 1996-12-04 | Samsung Heavy Industries Co., Ltd. | Corrosion and wear resistant iron alloy and method for preparing corrosion and wear resistant members using the same |
| US5961746A (en) * | 1996-04-22 | 1999-10-05 | Read-Rite Corporation | Corrosion resistant amorphous magnetic alloys |
| US6103396A (en) * | 1996-08-20 | 2000-08-15 | Alliedsignal Inc. | Thick amorphous metal strip having improved ductility and magnetic properties |
| WO1998027788A1 (en) * | 1996-12-19 | 1998-06-25 | Advanced Metal Technologies Ltd. | Amorphous metallic alloy electrical heater system |
| US6053989A (en) * | 1997-02-27 | 2000-04-25 | Fmc Corporation | Amorphous and amorphous/microcrystalline metal alloys and methods for their production |
| ES2138906A1 (es) * | 1997-07-04 | 2000-01-16 | Aplicaciones Magneticas S A | Metodo de fabricacion y procesado de microhilos metalicos amorfos revestidos de cubierta aislante con elevadas propiedades magneticas. |
| US6481088B1 (en) * | 1997-07-09 | 2002-11-19 | Akihisa Inoue | Golf club manufacturing method |
| EP0899353A3 (en) * | 1997-08-28 | 1999-05-19 | Alps Electric Co., Ltd. | Sinter and casting comprising Fe-based high-hardness glassy alloy |
| US6432226B2 (en) | 1999-04-12 | 2002-08-13 | Alliedsignal Inc. | Magnetic glassy alloys for high frequency applications |
| US6475303B1 (en) | 1999-04-12 | 2002-11-05 | Honeywell International Inc. | Magnetic glassy alloys for electronic article surveillance |
| US20040140017A1 (en) * | 2000-11-09 | 2004-07-22 | Branagan Daniel J. | Hard metallic materials |
| US20100015348A1 (en) * | 2000-11-09 | 2010-01-21 | Branagan Daniel J | Method of forming a hardened surface on a substrate |
| US7785428B2 (en) | 2000-11-09 | 2010-08-31 | Battelle Energy Alliance, Llc | Method of forming a hardened surface on a substrate |
| US8097095B2 (en) * | 2000-11-09 | 2012-01-17 | Battelle Energy Alliance, Llc | Hardfacing material |
| US20040141868A1 (en) * | 2000-11-09 | 2004-07-22 | Branagan Daniel J. | Method for forming a hard metallic wire |
| US6585033B2 (en) * | 2001-02-19 | 2003-07-01 | Fukuda Metal Foil & Powder Co., Ltd. | Process for producing vanadium alloy foil |
| WO2003044754A1 (en) | 2001-11-15 | 2003-05-30 | Metglas, Inc. | Electronic article surveillance markers for recorded media |
| US6749695B2 (en) | 2002-02-08 | 2004-06-15 | Ronald J. Martis | Fe-based amorphous metal alloy having a linear BH loop |
| US6930581B2 (en) | 2002-02-08 | 2005-08-16 | Metglas, Inc. | Current transformer having an amorphous fe-based core |
| WO2003067615A1 (en) * | 2002-02-08 | 2003-08-14 | Honeywell International Inc. | Current transformer having an amorphous fe-based core |
| US20030151483A1 (en) * | 2002-02-08 | 2003-08-14 | Martis Ronald J. | Current transformer having an amorphous fe-based core |
| US6869566B1 (en) | 2003-03-05 | 2005-03-22 | The United States Of America As Represented By The Secretary Of The Air Force | Method of fabricating metallic glasses in bulk forms |
| WO2004112862A1 (de) * | 2003-06-26 | 2004-12-29 | Eidgenössische Technische Hochschule Zürich | Prothese und verfahren zu deren herstellung |
| US20050034792A1 (en) * | 2003-08-12 | 2005-02-17 | Lu Zhaoping | Bulk amorphous steels based on Fe alloys |
| US7052561B2 (en) * | 2003-08-12 | 2006-05-30 | Ut-Battelle, Llc | Bulk amorphous steels based on Fe alloys |
| US20080160266A1 (en) * | 2004-01-27 | 2008-07-03 | Branagan Daniel J | Metallic coatings on silicon substrates |
| US7670406B2 (en) | 2004-09-16 | 2010-03-02 | Belashchenko Vladimir E | Deposition system, method and materials for composite coatings |
| US20070243335A1 (en) * | 2004-09-16 | 2007-10-18 | Belashchenko Vladimir E | Deposition System, Method And Materials For Composite Coatings |
| US20070253856A1 (en) * | 2004-09-27 | 2007-11-01 | Vecchio Kenneth S | Low Cost Amorphous Steel |
| US20120076946A1 (en) * | 2005-11-14 | 2012-03-29 | Lawrence Livermore National Security, Llc | Amorphous Metal Formulations and Structured Coatings for Corrosion and Wear Resistance |
| US8778460B2 (en) * | 2005-11-14 | 2014-07-15 | Lawrence Livermore National Security, Llc. | Amorphous metal formulations and structured coatings for corrosion and wear resistance |
| US20070175545A1 (en) * | 2006-02-02 | 2007-08-02 | Nec Tokin Corporation | Amorphous soft magnetic alloy and inductance component using the same |
| US10984932B2 (en) | 2006-02-02 | 2021-04-20 | Tokin Corporation | Amorphous soft magnetic alloy and inductance component using the same |
| US8057530B2 (en) | 2006-06-30 | 2011-11-15 | Tyco Healthcare Group Lp | Medical devices with amorphous metals, and methods therefor |
| US20080125848A1 (en) * | 2006-06-30 | 2008-05-29 | Kusleika Richard S | Medical devices with amorphous metals, and methods therefor |
| US7589266B2 (en) | 2006-08-21 | 2009-09-15 | Zuli Holdings, Ltd. | Musical instrument string |
| US8049088B2 (en) | 2006-08-21 | 2011-11-01 | Zuli Holdings, Ltd. | Musical instrument string |
| US20090272246A1 (en) * | 2006-08-21 | 2009-11-05 | Zuli Holdings Ltd. | Musical instrument string |
| US20080041213A1 (en) * | 2006-08-21 | 2008-02-21 | Jacob Richter | Musical instrument string |
| US20100006185A1 (en) * | 2007-04-12 | 2010-01-14 | General Electric Company | Amorphous metal alloy having high tensile strength and electrical resistivity |
| US7771545B2 (en) | 2007-04-12 | 2010-08-10 | General Electric Company | Amorphous metal alloy having high tensile strength and electrical resistivity |
| US8986469B2 (en) | 2007-11-09 | 2015-03-24 | The Regents Of The University Of California | Amorphous alloy materials |
| US9343748B2 (en) * | 2010-06-08 | 2016-05-17 | Yale University | Bulk metallic glass nanowires for use in energy conversion and storage devices |
| US20130150230A1 (en) * | 2010-06-08 | 2013-06-13 | Yale University | Bulk metallic glass nanowires for use in energy conversion and storage devices |
| US9752205B2 (en) | 2010-08-20 | 2017-09-05 | Posco | High-carbon iron-based amorphous alloy using molten pig iron and method of manufacturing the same |
| US9222157B2 (en) * | 2010-08-20 | 2015-12-29 | Posco | High-carbon iron-based amorphous alloy using molten pig iron and method of manufacturing the same |
| US20130146185A1 (en) * | 2010-08-20 | 2013-06-13 | Posco | High-Carbon Iron-Based Amorphous Alloy Using Molten Pig Iron and Method of Manufacturing the Same |
| DE102011001784A1 (de) * | 2011-04-04 | 2012-10-04 | Vacuumschmelze Gmbh & Co. Kg | Verfahren zur Herstellung einer Feder für ein mechanisches Uhrwerk und Feder für ein mechanisches Uhrwerk |
| DE102011001783B4 (de) | 2011-04-04 | 2022-11-24 | Vacuumschmelze Gmbh & Co. Kg | Feder für ein mechanisches Uhrwerk, mechanisches Uhrwerk, Uhr mit einem mechanischen Uhrwerk und Verfahren zur Herstellung einer Feder |
| DE102011001783A1 (de) * | 2011-04-04 | 2012-10-04 | Vacuumschmelze Gmbh & Co. Kg | Feder für ein mechanisches Uhrwerk, mechanisches Uhrwerk, Uhr mit einem mechanischen Uhrwerk und Verfahren zur Herstellung einer Feder |
| DE102011001784B4 (de) * | 2011-04-04 | 2018-03-22 | Vacuumschmelze Gmbh & Co. Kg | Verfahren zur Herstellung einer Feder für ein mechanisches Uhrwerk und Feder für ein mechanisches Uhrwerk |
| US20120276404A1 (en) * | 2011-04-27 | 2012-11-01 | Hon Hai Precision Industry Co., Ltd. | Coated article and method for making the same |
| CN102758183A (zh) * | 2011-04-27 | 2012-10-31 | 鸿富锦精密工业(深圳)有限公司 | 镀膜件及其制备方法 |
| US9920410B2 (en) | 2011-08-22 | 2018-03-20 | California Institute Of Technology | Bulk nickel-based chromium and phosphorous bearing metallic glasses |
| US11377720B2 (en) | 2012-09-17 | 2022-07-05 | Glassimetal Technology Inc. | Bulk nickel-silicon-boron glasses bearing chromium |
| CN102877009A (zh) * | 2012-10-23 | 2013-01-16 | 河北工业大学 | 一种制备多孔镍基非晶态合金材料的方法 |
| US9863024B2 (en) | 2012-10-30 | 2018-01-09 | Glassimetal Technology, Inc. | Bulk nickel-based chromium and phosphorus bearing metallic glasses with high toughness |
| US9365916B2 (en) * | 2012-11-12 | 2016-06-14 | Glassimetal Technology, Inc. | Bulk iron-nickel glasses bearing phosphorus-boron and germanium |
| US20140130942A1 (en) * | 2012-11-12 | 2014-05-15 | Glassimetal Technology, Inc. | Bulk iron-nickel glasses bearing phosphorus-boron and germanium |
| US9556504B2 (en) | 2012-11-15 | 2017-01-31 | Glassimetal Technology, Inc. | Bulk nickel-phosphorus-boron glasses bearing chromium and tantalum |
| US9534283B2 (en) | 2013-01-07 | 2017-01-03 | Glassimental Technology, Inc. | Bulk nickel—silicon—boron glasses bearing iron |
| US10086246B2 (en) | 2013-01-29 | 2018-10-02 | Glassimetal Technology, Inc. | Golf club fabricated from bulk metallic glasses with high toughness and high stiffness |
| US9816166B2 (en) | 2013-02-26 | 2017-11-14 | Glassimetal Technology, Inc. | Bulk nickel-phosphorus-boron glasses bearing manganese |
| US9863025B2 (en) | 2013-08-16 | 2018-01-09 | Glassimetal Technology, Inc. | Bulk nickel-phosphorus-boron glasses bearing manganese, niobium and tantalum |
| US9920400B2 (en) | 2013-12-09 | 2018-03-20 | Glassimetal Technology, Inc. | Bulk nickel-based glasses bearing chromium, niobium, phosphorus and silicon |
| US9957596B2 (en) | 2013-12-23 | 2018-05-01 | Glassimetal Technology, Inc. | Bulk nickel-iron-based, nickel-cobalt-based and nickel-copper based glasses bearing chromium, niobium, phosphorus and boron |
| US10000834B2 (en) | 2014-02-25 | 2018-06-19 | Glassimetal Technology, Inc. | Bulk nickel-chromium-phosphorus glasses bearing niobium and boron exhibiting high strength and/or high thermal stability of the supercooled liquid |
| US10287663B2 (en) | 2014-08-12 | 2019-05-14 | Glassimetal Technology, Inc. | Bulk nickel-phosphorus-silicon glasses bearing manganese |
| CN104878324A (zh) * | 2015-06-01 | 2015-09-02 | 大连理工大学 | 一种软磁性FeCoNiMB高熵块体非晶合金及其制备方法 |
| US11027992B2 (en) * | 2016-06-29 | 2021-06-08 | Institute Of Metal Research, Chinese Academy Of Sciences | Iron-based amorphous electrode material for wastewater treatment and use thereof |
| US11905582B2 (en) | 2017-03-09 | 2024-02-20 | Glassimetal Technology, Inc. | Bulk nickel-niobium-phosphorus-boron glasses bearing low fractions of chromium and exhibiting high toughness |
| US10458008B2 (en) | 2017-04-27 | 2019-10-29 | Glassimetal Technology, Inc. | Zirconium-cobalt-nickel-aluminum glasses with high glass forming ability and high reflectivity |
| US11326229B2 (en) * | 2018-02-27 | 2022-05-10 | South University Of Science And Technology Of China | Monatomic amorphous palladium, a method for preparing the same and use thereof |
| US11371108B2 (en) | 2019-02-14 | 2022-06-28 | Glassimetal Technology, Inc. | Tough iron-based glasses with high glass forming ability and high thermal stability |
| DE102019112795A1 (de) * | 2019-05-15 | 2020-11-19 | Trafag Ag | Belastungsmessanordnung, Herstellverfahren hierfür und damit durchführbares Belastungsmessverfahren |
| CN114855104A (zh) * | 2022-04-27 | 2022-08-05 | 南京理工大学 | 一种用于调控非晶能量状态增强催化性能的方法 |
| CN114855104B (zh) * | 2022-04-27 | 2024-01-30 | 南京理工大学 | 一种用于调控非晶能量状态增强催化性能的方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2364131C2 (de) | 1990-02-15 |
| FR2211536A1 (enExample) | 1974-07-19 |
| JPS5842256B2 (ja) | 1983-09-19 |
| GB1447267A (en) | 1976-08-25 |
| JPS5499035A (en) | 1979-08-04 |
| JPS5519976B2 (enExample) | 1980-05-30 |
| IT999851B (it) | 1976-03-10 |
| JPS55107746A (en) | 1980-08-19 |
| CA1012382A (en) | 1977-06-21 |
| DE2364131A1 (de) | 1974-06-27 |
| FR2211536B1 (enExample) | 1976-06-25 |
| DE2366327C2 (de) | 1986-01-02 |
| JPS4991014A (enExample) | 1974-08-30 |
| GB1447268A (en) | 1976-08-25 |
| JPS5935417B2 (ja) | 1984-08-28 |
| DE2366326C2 (de) | 1982-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3856513A (en) | Novel amorphous metals and amorphous metal articles | |
| US4144058A (en) | Amorphous metal alloys composed of iron, nickel, phosphorus, boron and, optionally carbon | |
| USRE32925E (en) | Novel amorphous metals and amorphous metal articles | |
| EP0018096B1 (en) | Boron containing transistion metal alloys comprising a dispersion of an ultrafine crystalline metallic phase and method for making said alloys, method of making an article from a metallic glass body | |
| US8361250B2 (en) | Amorphous platinum-rich alloys | |
| US4182628A (en) | Partially amorphous silver-copper-indium brazing foil | |
| US4052201A (en) | Amorphous alloys with improved resistance to embrittlement upon heat treatment | |
| US4473401A (en) | Amorphous iron-based alloy excelling in fatigue property | |
| JP4128614B2 (ja) | ベリリウムを含有する金属ガラスの形成 | |
| KR920004680B1 (ko) | 높은 강도, 내열성 알루미늄-기재합금 | |
| US3989517A (en) | Titanium-beryllium base amorphous alloys | |
| Got et al. | Mechanical properties of amorphous Fe80P16C3B1 filament produced by glass-coated melt spinning | |
| US4113478A (en) | Zirconium alloys containing transition metal elements | |
| US4400208A (en) | Process for the production of iron, phosphorus, carbon and chromium based amorphous metal alloys, and the alloys obtained | |
| US4133679A (en) | Iron-refractory metal-boron glassy alloys | |
| JPH08269647A (ja) | Ni基非晶質金属フィラメント | |
| US4255189A (en) | Low metalloid containing amorphous metal alloys | |
| Zhang et al. | Bulk glassy alloys with low liquidus temperature in Pt-Cu-P system | |
| US4210443A (en) | Iron group transition metal-refractory metal-boron glassy alloys | |
| EP0002923B1 (en) | Iron group transition metal-refractory metal-boron glassy alloys | |
| CN110106454B (zh) | 一种硼基非晶合金及其制备方法 | |
| US4171992A (en) | Preparation of zirconium alloys containing transition metal elements | |
| WO1999049095A1 (fr) | Alliage amorphe a base de titane | |
| JPH07252561A (ja) | Ti−Zr系合金 | |
| CN1417369A (zh) | 低密度块状金属玻璃 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RF | Reissue application filed |
Effective date: 19861023 |