SU582755A3 - Способ получени производных 1-фенокси-3-аминопропанола-2 или их солей - Google Patents
Способ получени производных 1-фенокси-3-аминопропанола-2 или их солейInfo
- Publication number
- SU582755A3 SU582755A3 SU7301923620A SU1923620A SU582755A3 SU 582755 A3 SU582755 A3 SU 582755A3 SU 7301923620 A SU7301923620 A SU 7301923620A SU 1923620 A SU1923620 A SU 1923620A SU 582755 A3 SU582755 A3 SU 582755A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- acid
- salts
- alkyl
- general formula
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000002270 dispersing agent Substances 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 239000002253 acid Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- -1 methoxy, ethoxy propoxy, butoxy Chemical group 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- OVPXWZQQDUKDFN-UHFFFAOYSA-N 1-pyridin-3-ylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CN=C1 OVPXWZQQDUKDFN-UHFFFAOYSA-N 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- WEGYGNROSJDEIW-UHFFFAOYSA-N 3-Acetylpyridine Chemical compound CC(=O)C1=CC=CN=C1 WEGYGNROSJDEIW-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 235000011054 acetic acid Nutrition 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 229940072033 potash Drugs 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 235000015320 potassium carbonate Nutrition 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- PVNIIMVLHYAWGP-UHFFFAOYSA-N nicotinic acid Natural products OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QFTYGVICBOHFQU-UHFFFAOYSA-N 1-amino-3-(4-butoxyphenoxy)propan-2-ol Chemical compound CCCCOC1=CC=C(OCC(O)CN)C=C1 QFTYGVICBOHFQU-UHFFFAOYSA-N 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- ZBEILIOSFDQFCJ-UHFFFAOYSA-N 4-hydroxy-4-pyridin-3-ylbut-3-en-2-one Chemical compound CC(=O)C=C(O)C1=CC=CN=C1 ZBEILIOSFDQFCJ-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- XBLVHTDFJBKJLG-UHFFFAOYSA-N Ethyl nicotinate Chemical compound CCOC(=O)C1=CC=CN=C1 XBLVHTDFJBKJLG-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- NVJUHMXYKCUMQA-UHFFFAOYSA-N 1-ethoxypropane Chemical compound CCCOCC NVJUHMXYKCUMQA-UHFFFAOYSA-N 0.000 description 1
- MAHBRCSFUWZVFC-UHFFFAOYSA-N 2-butan-2-yloxyphenol Chemical compound CCC(C)OC1=CC=CC=C1O MAHBRCSFUWZVFC-UHFFFAOYSA-N 0.000 description 1
- FNEJKCGACRPXBT-UHFFFAOYSA-N 2-prop-2-enoxyphenol Chemical compound OC1=CC=CC=C1OCC=C FNEJKCGACRPXBT-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- PMPYBNRUDYMHOX-UHFFFAOYSA-N 3-[[3-(4-butoxyphenoxy)-2-hydroxypropyl]amino]-1-pyridin-3-ylbut-2-en-1-one Chemical compound C1=CC(OCCCC)=CC=C1OCC(O)CNC(C)=CC(=O)C1=CC=CN=C1 PMPYBNRUDYMHOX-UHFFFAOYSA-N 0.000 description 1
- IJOZYTYQIPLTDY-UHFFFAOYSA-N 3-chloro-1-pyridin-3-ylbut-2-en-1-one;hydrochloride Chemical compound Cl.CC(Cl)=CC(=O)C1=CC=CN=C1 IJOZYTYQIPLTDY-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- MWKMHTLLGQHDQQ-UHFFFAOYSA-N C(C)(C)O.C(=O)(O)C(O)C(O)C(=O)O Chemical compound C(C)(C)O.C(=O)(O)C(O)C(O)C(=O)O MWKMHTLLGQHDQQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- YCGJNUWHMUIDPA-UHFFFAOYSA-N [Na].C(C1=CN=CC=C1)(=O)CC(C)=O Chemical compound [Na].C(C1=CN=CC=C1)(=O)CC(C)=O YCGJNUWHMUIDPA-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229960000250 adipic acid Drugs 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IBBLRJGOOANPTQ-JKVLGAQCSA-N quinapril hydrochloride Chemical compound Cl.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2=CC=CC=C2C1)C(O)=O)CC1=CC=CC=C1 IBBLRJGOOANPTQ-JKVLGAQCSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003511 tertiary amides Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/24—Ethers with hydroxy compounds containing no oxirane rings with polyhydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU65414 | 1972-05-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU582755A3 true SU582755A3 (ru) | 1977-11-30 |
Family
ID=19727058
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7301923620A SU582755A3 (ru) | 1972-05-24 | 1973-05-21 | Способ получени производных 1-фенокси-3-аминопропанола-2 или их солей |
| SU1923622A SU489309A3 (ru) | 1972-05-24 | 1973-05-21 | Способ получени производных 1-фенокси-3-аминопропан-2-ола |
| SU1923621A SU563120A3 (ru) | 1972-05-24 | 1973-05-21 | Способ получени производных 1-фенокси-3-аминопропан2-ола или их солей |
| SU1922038A SU493958A3 (ru) | 1972-05-24 | 1973-05-23 | Способ получени производных 1-фенокси3-аминопропан 2-ола |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1923622A SU489309A3 (ru) | 1972-05-24 | 1973-05-21 | Способ получени производных 1-фенокси-3-аминопропан-2-ола |
| SU1923621A SU563120A3 (ru) | 1972-05-24 | 1973-05-21 | Способ получени производных 1-фенокси-3-аминопропан2-ола или их солей |
| SU1922038A SU493958A3 (ru) | 1972-05-24 | 1973-05-23 | Способ получени производных 1-фенокси3-аминопропан 2-ола |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3940406A (enExample) |
| JP (4) | JPS4948675A (enExample) |
| AR (4) | AR199903A1 (enExample) |
| AT (4) | AT326659B (enExample) |
| BE (1) | BE800005A (enExample) |
| BG (3) | BG21851A3 (enExample) |
| CA (1) | CA1015357A (enExample) |
| CH (4) | CH581621A5 (enExample) |
| CS (4) | CS183701B2 (enExample) |
| DD (1) | DD106835A5 (enExample) |
| DE (1) | DE2323354A1 (enExample) |
| ES (4) | ES415047A1 (enExample) |
| FR (1) | FR2185411B1 (enExample) |
| GB (1) | GB1409959A (enExample) |
| HU (1) | HU165663B (enExample) |
| IE (1) | IE37655B1 (enExample) |
| IL (1) | IL42333A (enExample) |
| LU (1) | LU65414A1 (enExample) |
| NL (1) | NL7306691A (enExample) |
| PH (3) | PH9827A (enExample) |
| PL (1) | PL91588B1 (enExample) |
| RO (2) | RO66268A (enExample) |
| SE (1) | SE399425B (enExample) |
| SU (4) | SU582755A3 (enExample) |
| ZA (1) | ZA733513B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4066768A (en) * | 1973-12-27 | 1978-01-03 | Cassella Farbwerke Mainkur Aktiengesellschaft | Derivatives of 1-phenoxy-3-amino-propan-2-ol |
| US4088764A (en) * | 1973-12-27 | 1978-05-09 | Cassella Farbwerke Mainkur Aktiengesellschaft | Pharmaceutically active derivatives of 1-phenoxy-3-amino-propan-2-ol |
| CH594626A5 (enExample) * | 1974-05-14 | 1978-01-13 | Ciba Geigy Ag | |
| US4139623A (en) * | 1974-05-14 | 1979-02-13 | C-G Corp. | Cyclic-substituted derivatives of 1-amino-2-propanol |
| JPS528043A (en) * | 1975-07-10 | 1977-01-21 | Toagosei Chem Ind Co Ltd | Adhesive |
| US4097490A (en) * | 1975-09-25 | 1978-06-27 | Merck & Co., Inc. | Pyroglutamic acid salts of t-butylamino-2,3-dihydroxypropane |
| US4060601A (en) * | 1976-06-15 | 1977-11-29 | Merck & Co., Inc. | Certain lower-alkyl amino-2'-hydroxy-propoxy pyridines |
| JPH0774714B2 (ja) * | 1986-11-18 | 1995-08-09 | 中野冷機株式会社 | オープンショーケースの温度制御装置 |
| JP2858389B2 (ja) * | 1994-02-21 | 1999-02-17 | カシオ計算機株式会社 | 液晶表示装置およびその製造方法 |
| US5585388A (en) * | 1995-04-07 | 1996-12-17 | Sibia Neurosciences, Inc. | Substituted pyridines useful as modulators of acetylcholine receptors |
| US7244751B2 (en) * | 2003-02-14 | 2007-07-17 | Shenzhen Chipscreen Biosciences Ltd. | Histone deacetylase inhibitors of novel benzamide derivatives with potent differentiation and anti-proliferation activity |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1047927A (en) * | 1964-03-09 | 1966-11-09 | Ici Ltd | Alkanolamine derivatives |
| US3261829A (en) * | 1964-08-12 | 1966-07-19 | Searle & Co | Spiro(steroidal-6,3'-1-pyrazolines) and process |
| US3679693A (en) * | 1970-09-15 | 1972-07-25 | Smith Kline French Lab | N-pyridylalkyl-{62 -alkoxy-{62 -trifluoromethyl-phenalkylamines |
| CH578532A5 (enExample) * | 1971-08-03 | 1976-08-13 | Cassella Farbwerke Mainkur Ag | |
| BE787057A (fr) * | 1971-08-03 | 1973-02-01 | Cassella Farbwerke Mainkur Ag | Derives du phenoxy-1 amino-3 propanol-2 et medicaments qui en contiennent |
-
1972
- 1972-05-24 LU LU65414A patent/LU65414A1/xx unknown
-
1973
- 1973-05-09 DE DE2323354A patent/DE2323354A1/de active Pending
- 1973-05-14 NL NL7306691A patent/NL7306691A/xx not_active Application Discontinuation
- 1973-05-16 HU HUCA346A patent/HU165663B/hu unknown
- 1973-05-21 SU SU7301923620A patent/SU582755A3/ru active
- 1973-05-21 SU SU1923622A patent/SU489309A3/ru active
- 1973-05-21 SU SU1923621A patent/SU563120A3/ru active
- 1973-05-21 IE IE805/73A patent/IE37655B1/xx unknown
- 1973-05-21 US US05/362,567 patent/US3940406A/en not_active Expired - Lifetime
- 1973-05-22 BG BG024936A patent/BG21851A3/xx unknown
- 1973-05-22 JP JP48056387A patent/JPS4948675A/ja active Pending
- 1973-05-22 IL IL42333A patent/IL42333A/en unknown
- 1973-05-22 JP JP48056386A patent/JPS4941380A/ja active Pending
- 1973-05-22 BG BG24934A patent/BG22072A3/xx unknown
- 1973-05-22 DD DD170987A patent/DD106835A5/xx unknown
- 1973-05-22 BG BG023691A patent/BG20782A3/xx unknown
- 1973-05-23 AT AT450273A patent/AT326659B/de not_active IP Right Cessation
- 1973-05-23 AT AT450173A patent/AT326658B/de not_active IP Right Cessation
- 1973-05-23 AR AR248187A patent/AR199903A1/es active
- 1973-05-23 CH CH737673A patent/CH581621A5/xx not_active IP Right Cessation
- 1973-05-23 CS CS7300003713A patent/CS183701B2/cs unknown
- 1973-05-23 CS CS7300003714A patent/CS181241B2/cs unknown
- 1973-05-23 PH PH14648A patent/PH9827A/en unknown
- 1973-05-23 ES ES415047A patent/ES415047A1/es not_active Expired
- 1973-05-23 AR AR248190A patent/AR199905A1/es active
- 1973-05-23 ZA ZA733513A patent/ZA733513B/xx unknown
- 1973-05-23 CS CS7300003715A patent/CS183702B2/cs unknown
- 1973-05-23 CH CH737773A patent/CH581622A5/xx not_active IP Right Cessation
- 1973-05-23 RO RO7300077378A patent/RO66268A/ro unknown
- 1973-05-23 CH CH737573A patent/CH581620A5/xx not_active IP Right Cessation
- 1973-05-23 AR AR248189A patent/AR199904A1/es active
- 1973-05-23 CA CA172,038A patent/CA1015357A/en not_active Expired
- 1973-05-23 ES ES415046A patent/ES415046A1/es not_active Expired
- 1973-05-23 SE SE7307242A patent/SE399425B/xx unknown
- 1973-05-23 SU SU1922038A patent/SU493958A3/ru active
- 1973-05-23 AT AT450373A patent/AT326660B/de not_active IP Right Cessation
- 1973-05-23 CH CH737873A patent/CH596180A5/xx not_active IP Right Cessation
- 1973-05-23 RO RO7374886A patent/RO64607A/ro unknown
- 1973-05-23 JP JP48056904A patent/JPS4948678A/ja active Pending
- 1973-05-23 GB GB2458273A patent/GB1409959A/en not_active Expired
- 1973-05-23 AT AT450073A patent/AT326657B/de not_active IP Right Cessation
- 1973-05-23 JP JP48056903A patent/JPS4948677A/ja active Pending
- 1973-05-23 ES ES415045A patent/ES415045A1/es not_active Expired
- 1973-05-23 CS CS7300003712A patent/CS183692B2/cs unknown
- 1973-05-23 ES ES415044A patent/ES415044A1/es not_active Expired
- 1973-05-23 PL PL1973162780A patent/PL91588B1/pl unknown
- 1973-05-24 BE BE131502A patent/BE800005A/xx unknown
- 1973-05-24 FR FR7318866A patent/FR2185411B1/fr not_active Expired
-
1974
- 1974-03-08 PH PH15601*A patent/PH9508A/en unknown
- 1974-03-08 PH PH15602*UA patent/PH9369A/en unknown
- 1974-05-23 AR AR248188A patent/AR200869A1/es active
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4243807A (en) | 4-Phenoxymethyl-piperidines | |
| SU1005655A3 (ru) | Способ получени 3-арилокси-3-фенилпропиламинов или их солей | |
| SU582755A3 (ru) | Способ получени производных 1-фенокси-3-аминопропанола-2 или их солей | |
| BG65889B1 (bg) | Производно на пиридин-1-оксид и методи за неговото превръщане във фармацевтично полезни съединения | |
| JPS595577B2 (ja) | チカンサレテイル サンカンシキアミノアルコ−ルノ セイホウ | |
| SU559643A3 (ru) | Способ получени производных 1-фенокси-3-аминопропан-2-ола или их солей | |
| JP2013035837A (ja) | 一種のイリジウムキラル触媒によって3−アルケニレン置換インドロンを不斉水素添加する方法 | |
| US4587356A (en) | Process for the production of nuclear substituted cinnamoylanthranilic acid derivatives | |
| US2542466A (en) | Cyclohexyl-phenyl-aminoalkylketones and their production | |
| SU786895A3 (ru) | Способ получени производных тиазолидин-,тиазан-или морфолинкарбоновых кислот или их кислотно-аддитивных солей | |
| FI75148C (fi) | Foerfarande foer framstaellning av ringsubstituerade cinnamoylantranilsyraderivat. | |
| DE841917C (de) | Verfahren zur Herstellung von Bis-tert.-aminoalkoxyalkanen und ihren quaternaeren Ammoniumhalogeniden | |
| EP0096720B1 (en) | Process for the preparation of B-[(2-methylpropoxy)-methyl]-N-phenyl-N-(phenylmethyl)-1-pyrrolidineethanamine | |
| SU617007A3 (ru) | Способ получени аминов или их солей | |
| JPS6140266A (ja) | ピラゾ−ル誘導体 | |
| SU528035A3 (ru) | Способ получени производных изохинолина или их солей | |
| HU220971B1 (hu) | Eljárás 0-(3-amino-2-hidroxi-propil)-hidroximsav-halogenidek előállítására | |
| CA2127292A1 (en) | Process for producing hydroxyalkane carboxylic acid amides | |
| DE1122958B (de) | Verfahren zur Herstellung von N,N-disubstituierten Arylessigsaeureamiden | |
| CH460773A (de) | Verfahren zur Herstellung von substituierten 3-(3-Hydroxyphenyl)-1-phenacyl-piperidinen | |
| SU549078A3 (ru) | Способ получени производных 1фенокси-3-амино-пропан-2-ола или их солей | |
| SU439978A1 (ru) | Способ получени сульфамоилпиримидина или его соли | |
| JPH0660135B2 (ja) | シクロブテン誘導体 | |
| JPS5927343B2 (ja) | 3−アミノイソオキサゾ−ル類の合成法 | |
| US3992449A (en) | 2-(γ-Aminopropyl)hydroquinones and process for producing the same |